Merge branch 'develop' into rte-fixes2

Conflicts:
	package.json
	src/autocomplete/CommandProvider.js
	src/autocomplete/UserProvider.js
	src/components/structures/RoomView.js
	src/components/structures/UserSettings.js
	src/components/views/rooms/MessageComposerInput.js

src/components/structures/CreateRoom.js

@@ -16,15 +16,15 @@ limitations under the License.
 
 'use strict';
 
-var React = require("react");
-var MatrixClientPeg = require("../../MatrixClientPeg");
-var PresetValues = {
+import React from 'react';
+import { _t } from '../../languageHandler';
+import sdk from '../../index';
+import MatrixClientPeg from '../../MatrixClientPeg';
+const PresetValues = {
     PrivateChat: "private_chat",
     PublicChat: "public_chat",
     Custom: "custom",
 };
-var q = require('q');
-var sdk = require('../../index');
 
 module.exports = React.createClass({
     displayName: 'CreateRoom',
@@ -231,7 +231,7 @@ module.exports = React.createClass({
             if (curr_phase == this.phases.ERROR) {
                 error_box = (
                     <div className="mx_Error">
-                        An error occured: {this.state.error_string}
+                        {_t('An error occurred: %(error_string)s', {error_string: this.state.error_string})}
                     </div>
                 );
             }
@@ -246,29 +246,29 @@ module.exports = React.createClass({
 
             return (
             <div className="mx_CreateRoom">
-                <SimpleRoomHeader title="CreateRoom" collapsedRhs={ this.props.collapsedRhs }/>
+                <SimpleRoomHeader title={_t("Create Room")} collapsedRhs={ this.props.collapsedRhs }/>
                 <div className="mx_CreateRoom_body">
-                    <input type="text" ref="room_name" value={this.state.room_name} onChange={this.onNameChange} placeholder="Name"/> <br />
-                    <textarea className="mx_CreateRoom_description" ref="topic" value={this.state.topic} onChange={this.onTopicChange} placeholder="Topic"/> <br />
+                    <input type="text" ref="room_name" value={this.state.room_name} onChange={this.onNameChange} placeholder={_t('Name')}/> <br />
+                    <textarea className="mx_CreateRoom_description" ref="topic" value={this.state.topic} onChange={this.onTopicChange} placeholder={_t('Topic')}/> <br />
                     <RoomAlias ref="alias" alias={this.state.alias} homeserver={ domain } onChange={this.onAliasChanged}/> <br />
                     <UserSelector ref="user_selector" selected_users={this.state.invited_users} onChange={this.onInviteChanged}/> <br />
                     <Presets ref="presets" onChange={this.onPresetChanged} preset={this.state.preset}/> <br />
                     <div>
                         <label>
                             <input type="checkbox" ref="is_private" checked={this.state.is_private} onChange={this.onPrivateChanged}/>
-                            Make this room private
+                            {_t('Make this room private')}
                         </label>
                     </div>
                     <div>
                         <label>
                             <input type="checkbox" ref="share_history" checked={this.state.share_history} onChange={this.onShareHistoryChanged}/>
-                            Share message history with new users
+                            {_t('Share message history with new users')}
                         </label>
                     </div>
                     <div className="mx_CreateRoom_encrypt">
                         <label>
                             <input type="checkbox" ref="encrypt" checked={this.state.encrypt} onChange={this.onEncryptChanged}/>
-                            Encrypt room
+                            {_t('Encrypt room')}
                         </label>
                     </div>
                     <div>

src/components/structures/FilePanel.js

@@ -14,13 +14,12 @@ See the License for the specific language governing permissions and
 limitations under the License.
 */
 
-var React = require('react');
-var ReactDOM = require("react-dom");
+import React from 'react';
 
-var Matrix = require("matrix-js-sdk");
-var sdk = require('../../index');
-var MatrixClientPeg = require("../../MatrixClientPeg");
-var dis = require("../../dispatcher");
+import Matrix from 'matrix-js-sdk';
+import sdk from '../../index';
+import MatrixClientPeg from '../../MatrixClientPeg';
+import { _t, _tJsx } from '../../languageHandler';
 
 /*
  * Component which shows the filtered file using a TimelinePanel
@@ -59,6 +58,8 @@ var FilePanel = React.createClass({
         var client = MatrixClientPeg.get();
         var room = client.getRoom(roomId);
 
+        this.noRoom = !room;
+
         if (room) {
             var filter = new Matrix.Filter(client.credentials.userId);
             filter.setDefinition(
@@ -82,13 +83,24 @@ var FilePanel = React.createClass({
                     console.error("Failed to get or create file panel filter", error);
                 }
             );
-        }
-        else {
+        } else {
             console.error("Failed to add filtered timelineSet for FilePanel as no room!");
         }
     },
 
     render: function() {
+        if (MatrixClientPeg.get().isGuest()) {
+            return <div className="mx_FilePanel mx_RoomView_messageListWrapper">
+                <div className="mx_RoomView_empty">
+                {_tJsx("You must <a>register</a> to use this functionality", /<a>(.*?)<\/a>/, (sub) => <a href="#/register" key="sub">{sub}</a>)}
+                </div>
+            </div>;
+        } else if (this.noRoom) {
+            return <div className="mx_FilePanel mx_RoomView_messageListWrapper">
+                <div className="mx_RoomView_empty">{_t("You must join the room to see its files")}</div>
+            </div>;
+        }
+
         // wrap a TimelinePanel with the jump-to-event bits turned off.
         var TimelinePanel = sdk.getComponent("structures.TimelinePanel");
         var Loader = sdk.getComponent("elements.Spinner");
@@ -105,7 +117,7 @@ var FilePanel = React.createClass({
                     showUrlPreview = { false }
                     tileShape="file_grid"
                     opacity={ this.props.opacity }
-                    empty="There are no visible files in this room"
+                    empty={_t('There are no visible files in this room')}
                 />
             );
         }

src/components/structures/InteractiveAuth.js

@@ -19,8 +19,6 @@ const InteractiveAuth = Matrix.InteractiveAuth;
 
 import React from 'react';
 
-import sdk from '../../index';
-
 import {getEntryComponentForLoginType} from '../views/login/InteractiveAuthEntryComponents';
 
 export default React.createClass({

src/components/structures/LoggedInView.js

@@ -18,11 +18,15 @@ limitations under the License.
 import * as Matrix from 'matrix-js-sdk';
 import React from 'react';
 
+import UserSettingsStore from '../../UserSettingsStore';
 import KeyCode from '../../KeyCode';
 import Notifier from '../../Notifier';
 import PageTypes from '../../PageTypes';
+import CallMediaHandler from '../../CallMediaHandler';
 import sdk from '../../index';
 import dis from '../../dispatcher';
+import sessionStore from '../../stores/SessionStore';
+import MatrixClientPeg from '../../MatrixClientPeg';
 
 /**
  * This is what our MatrixChat shows when we are logged in. The precise view is
@@ -39,10 +43,13 @@ export default React.createClass({
     propTypes: {
         matrixClient: React.PropTypes.instanceOf(Matrix.MatrixClient).isRequired,
         page_type: React.PropTypes.string.isRequired,
-        onRoomIdResolved: React.PropTypes.func,
         onRoomCreated: React.PropTypes.func,
         onUserSettingsClose: React.PropTypes.func,
 
+        // Called with the credentials of a registered user (if they were a ROU that
+        // transitioned to PWLU)
+        onRegistered: React.PropTypes.func,
+
         teamToken: React.PropTypes.string,
 
         // and lots and lots of other stuff.
@@ -63,6 +70,13 @@ export default React.createClass({
         };
     },
 
+    getInitialState: function() {
+        return {
+            // use compact timeline view
+            useCompactLayout: UserSettingsStore.getSyncedSetting('useCompactLayout'),
+        };
+    },
+
     componentWillMount: function() {
         // stash the MatrixClient in case we log out before we are unmounted
         this._matrixClient = this.props.matrixClient;
@@ -71,11 +85,35 @@ export default React.createClass({
         // RoomView.getScrollState()
         this._scrollStateMap = {};
 
+        CallMediaHandler.loadDevices();
+
         document.addEventListener('keydown', this._onKeyDown);
+
+        this._sessionStore = sessionStore;
+        this._sessionStoreToken = this._sessionStore.addListener(
+            this._setStateFromSessionStore,
+        );
+        this._setStateFromSessionStore();
+
+        this._matrixClient.on("accountData", this.onAccountData);
     },
 
     componentWillUnmount: function() {
         document.removeEventListener('keydown', this._onKeyDown);
+        this._matrixClient.removeListener("accountData", this.onAccountData);
+        if (this._sessionStoreToken) {
+            this._sessionStoreToken.remove();
+        }
+    },
+
+    // Child components assume that the client peg will not be null, so give them some
+    // sort of assurance here by only allowing a re-render if the client is truthy.
+    //
+    // This is required because `LoggedInView` maintains its own state and if this state
+    // updates after the client peg has been made null (during logout), then it will
+    // attempt to re-render and the children will throw errors.
+    shouldComponentUpdate: function() {
+        return Boolean(MatrixClientPeg.get());
     },
 
     getScrollStateForRoom: function(roomId) {
@@ -89,6 +127,20 @@ export default React.createClass({
         return this.refs.roomView.canResetTimeline();
     },
 
+    _setStateFromSessionStore() {
+        this.setState({
+            userHasGeneratedPassword: Boolean(this._sessionStore.getCachedPassword()),
+        });
+    },
+
+    onAccountData: function(event) {
+        if (event.getType() === "im.vector.web.settings") {
+            this.setState({
+                useCompactLayout: event.getContent().useCompactLayout,
+            });
+        }
+    },
+
     _onKeyDown: function(ev) {
             /*
             // Remove this for now as ctrl+alt = alt-gr so this breaks keyboards which rely on alt-gr for numbers
@@ -107,18 +159,6 @@ export default React.createClass({
         var handled = false;
 
         switch (ev.keyCode) {
-            case KeyCode.ESCAPE:
-
-                // Implemented this way so possible handling for other pages is neater
-                switch (this.props.page_type) {
-                    case PageTypes.UserSettings:
-                        this.props.onUserSettingsClose();
-                        handled = true;
-                        break;
-                }
-
-                break;
-
             case KeyCode.UP:
             case KeyCode.DOWN:
                 if (ev.altKey && !ev.shiftKey && !ev.ctrlKey && !ev.metaKey) {
@@ -171,8 +211,9 @@ export default React.createClass({
         const RoomDirectory = sdk.getComponent('structures.RoomDirectory');
         const HomePage = sdk.getComponent('structures.HomePage');
         const MatrixToolbar = sdk.getComponent('globals.MatrixToolbar');
-        const GuestWarningBar = sdk.getComponent('globals.GuestWarningBar');
         const NewVersionBar = sdk.getComponent('globals.NewVersionBar');
+        const UpdateCheckBar = sdk.getComponent('globals.UpdateCheckBar');
+        const PasswordNagBar = sdk.getComponent('globals.PasswordNagBar');
 
         let page_element;
         let right_panel = '';
@@ -181,33 +222,29 @@ export default React.createClass({
             case PageTypes.RoomView:
                 page_element = <RoomView
                         ref='roomView'
-                        roomAddress={this.props.currentRoomAlias || this.props.currentRoomId}
                         autoJoin={this.props.autoJoin}
-                        onRoomIdResolved={this.props.onRoomIdResolved}
-                        eventId={this.props.initialEventId}
+                        onRegistered={this.props.onRegistered}
                         thirdPartyInvite={this.props.thirdPartyInvite}
                         oobData={this.props.roomOobData}
-                        highlightedEventId={this.props.highlightedEventId}
                         eventPixelOffset={this.props.initialEventPixelOffset}
-                        key={this.props.currentRoomAlias || this.props.currentRoomId}
+                        key={this.props.currentRoomId || 'roomview'}
                         opacity={this.props.middleOpacity}
                         collapsedRhs={this.props.collapse_rhs}
                         ConferenceHandler={this.props.ConferenceHandler}
                         scrollStateMap={this._scrollStateMap}
                     />;
-                if (!this.props.collapse_rhs) right_panel = <RightPanel roomId={this.props.currentRoomId} opacity={this.props.sideOpacity} />;
+                if (!this.props.collapse_rhs) right_panel = <RightPanel roomId={this.props.currentRoomId} opacity={this.props.rightOpacity} />;
                 break;
 
             case PageTypes.UserSettings:
                 page_element = <UserSettings
                     onClose={this.props.onUserSettingsClose}
                     brand={this.props.config.brand}
-                    collapsedRhs={this.props.collapse_rhs}
                     enableLabs={this.props.config.enableLabs}
                     referralBaseUrl={this.props.config.referralBaseUrl}
                     teamToken={this.props.teamToken}
                 />;
-                if (!this.props.collapse_rhs) right_panel = <RightPanel opacity={this.props.sideOpacity}/>;
+                if (!this.props.collapse_rhs) right_panel = <RightPanel opacity={this.props.rightOpacity}/>;
                 break;
 
             case PageTypes.CreateRoom:
@@ -215,7 +252,7 @@ export default React.createClass({
                     onRoomCreated={this.props.onRoomCreated}
                     collapsedRhs={this.props.collapse_rhs}
                 />;
-                if (!this.props.collapse_rhs) right_panel = <RightPanel opacity={this.props.sideOpacity}/>;
+                if (!this.props.collapse_rhs) right_panel = <RightPanel opacity={this.props.rightOpacity}/>;
                 break;
 
             case PageTypes.RoomDirectory:
@@ -226,30 +263,36 @@ export default React.createClass({
                 break;
 
             case PageTypes.HomePage:
+                // If team server config is present, pass the teamServerURL. props.teamToken
+                // must also be set for the team page to be displayed, otherwise the
+                // welcomePageUrl is used (which might be undefined).
+                const teamServerUrl = this.props.config.teamServerConfig ?
+                    this.props.config.teamServerConfig.teamServerURL : null;
+
                 page_element = <HomePage
-                    collapsedRhs={this.props.collapse_rhs}
-                    teamServerUrl={this.props.config.teamServerConfig.teamServerURL}
+                    teamServerUrl={teamServerUrl}
                     teamToken={this.props.teamToken}
-                />
-                if (!this.props.collapse_rhs) right_panel = <RightPanel opacity={this.props.sideOpacity}/>
+                    homePageUrl={this.props.config.welcomePageUrl}
+                />;
                 break;
 
             case PageTypes.UserView:
                 page_element = null; // deliberately null for now
-                right_panel = <RightPanel userId={this.props.viewUserId} opacity={this.props.sideOpacity} />;
+                right_panel = <RightPanel userId={this.props.viewUserId} opacity={this.props.rightOpacity} />;
                 break;
         }
 
-        var topBar;
+        let topBar;
+        const isGuest = this.props.matrixClient.isGuest();
         if (this.props.hasNewVersion) {
             topBar = <NewVersionBar version={this.props.version} newVersion={this.props.newVersion}
-                releaseNotes={this.props.newVersionReleaseNotes}
+                                    releaseNotes={this.props.newVersionReleaseNotes}
             />;
-        }
-        else if (this.props.matrixClient.isGuest()) {
-            topBar = <GuestWarningBar />;
-        }
-        else if (Notifier.supportsDesktopNotifications() && !Notifier.isEnabled() && !Notifier.isToolbarHidden()) {
+        } else if (this.props.checkingForUpdate) {
+            topBar = <UpdateCheckBar {...this.props.checkingForUpdate} />;
+        } else if (this.state.userHasGeneratedPassword) {
+            topBar = <PasswordNagBar />;
+        } else if (!isGuest && Notifier.supportsDesktopNotifications() && !Notifier.isEnabled() && !Notifier.isToolbarHidden()) {
             topBar = <MatrixToolbar />;
         }
 
@@ -257,6 +300,9 @@ export default React.createClass({
         if (topBar) {
             bodyClasses += ' mx_MatrixChat_toolbarShowing';
         }
+        if (this.state.useCompactLayout) {
+            bodyClasses += ' mx_MatrixChat_useCompactLayout';
+        }
 
         return (
             <div className='mx_MatrixChat_wrapper'>
@@ -265,8 +311,7 @@ export default React.createClass({
                     <LeftPanel
                         selectedRoom={this.props.currentRoomId}
                         collapsed={this.props.collapse_lhs || false}
-                        opacity={this.props.sideOpacity}
-                        teamToken={this.props.teamToken}
+                        opacity={this.props.leftOpacity}
                     />
                     <main className='mx_MatrixChat_middlePanel'>
                         {page_element}

src/components/structures/MessagePanel.js

@@ -84,6 +84,15 @@ module.exports = React.createClass({
 
         // shape parameter to be passed to EventTiles
         tileShape: React.PropTypes.string,
+
+        // show twelve hour timestamps
+        isTwelveHour: React.PropTypes.bool,
+
+        // show timestamps always
+        alwaysShowTimestamps: React.PropTypes.bool,
+
+        // hide redacted events as per old behaviour
+        hideRedactions: React.PropTypes.bool,
     },
 
     componentWillMount: function() {
@@ -230,8 +239,8 @@ module.exports = React.createClass({
     },
 
     _getEventTiles: function() {
-        var EventTile = sdk.getComponent('rooms.EventTile');
-        var DateSeparator = sdk.getComponent('messages.DateSeparator');
+        const EventTile = sdk.getComponent('rooms.EventTile');
+        const DateSeparator = sdk.getComponent('messages.DateSeparator');
         const MemberEventListSummary = sdk.getComponent('views.elements.MemberEventListSummary');
 
         this.eventNodes = {};
@@ -310,7 +319,7 @@ module.exports = React.createClass({
                 const key = "membereventlistsummary-" + (prevEvent ? mxEv.getId() : "initial");
 
                 if (this._wantsDateSeparator(prevEvent, mxEv.getDate())) {
-                    let dateSeparator = <li key={ts1+'~'}><DateSeparator key={ts1+'~'} ts={ts1}/></li>;
+                    let dateSeparator = <li key={ts1+'~'}><DateSeparator key={ts1+'~'} ts={ts1} showTwelveHour={this.props.isTwelveHour}/></li>;
                     ret.push(dateSeparator);
                 }
 
@@ -413,8 +422,8 @@ module.exports = React.createClass({
     },
 
     _getTilesForEvent: function(prevEvent, mxEv, last) {
-        var EventTile = sdk.getComponent('rooms.EventTile');
-        var DateSeparator = sdk.getComponent('messages.DateSeparator');
+        const EventTile = sdk.getComponent('rooms.EventTile');
+        const DateSeparator = sdk.getComponent('messages.DateSeparator');
         var ret = [];
 
         // is this a continuation of the previous message?
@@ -452,11 +461,13 @@ module.exports = React.createClass({
 
         // do we need a date separator since the last event?
         if (this._wantsDateSeparator(prevEvent, eventDate)) {
-            var dateSeparator = <li key={ts1}><DateSeparator key={ts1} ts={ts1}/></li>;
+            var dateSeparator = <li key={ts1}><DateSeparator key={ts1} ts={ts1} showTwelveHour={this.props.isTwelveHour}/></li>;
             ret.push(dateSeparator);
             continuation = false;
         }
 
+        if (mxEv.isRedacted() && this.props.hideRedactions) return ret;
+
         var eventId = mxEv.getId();
         var highlight = (eventId == this.props.highlightedEventId);
 
@@ -468,7 +479,6 @@ module.exports = React.createClass({
         if (this.props.manageReadReceipts) {
             readReceipts = this._getReadReceiptsForEvent(mxEv);
         }
-
         ret.push(
                 <li key={eventId}
                         ref={this._collectEventNode.bind(this, eventId)}
@@ -482,6 +492,7 @@ module.exports = React.createClass({
                         checkUnmounting={this._isUnmounting}
                         eventSendStatus={mxEv.status}
                         tileShape={this.props.tileShape}
+                        isTwelveHour={this.props.isTwelveHour}
                         last={last} isSelectedEvent={highlight}/>
                 </li>
         );
@@ -615,8 +626,13 @@ module.exports = React.createClass({
         var style = this.props.hidden ? { display: 'none' } : {};
         style.opacity = this.props.opacity;
 
+        var className = this.props.className + " mx_fadable";
+        if (this.props.alwaysShowTimestamps) {
+            className += " mx_MessagePanel_alwaysShowTimestamps";
+        }
+
         return (
-            <ScrollPanel ref="scrollPanel" className={ this.props.className + " mx_fadable" }
+            <ScrollPanel ref="scrollPanel" className={ className }
                     onScroll={ this.props.onScroll }
                     onResize={ this.onResize }
                     onFillRequest={ this.props.onFillRequest }

src/components/structures/NotificationPanel.js

@@ -16,7 +16,7 @@ limitations under the License.
 
 var React = require('react');
 var ReactDOM = require("react-dom");
-
+import { _t } from '../../languageHandler';
 var Matrix = require("matrix-js-sdk");
 var sdk = require('../../index');
 var MatrixClientPeg = require("../../MatrixClientPeg");
@@ -37,7 +37,6 @@ var NotificationPanel = React.createClass({
         var Loader = sdk.getComponent("elements.Spinner");
 
         var timelineSet = MatrixClientPeg.get().getNotifTimelineSet();
-
         if (timelineSet) {
             return (
                 <TimelinePanel key={"NotificationPanel_" + this.props.roomId}
@@ -48,7 +47,7 @@ var NotificationPanel = React.createClass({
                     showUrlPreview = { false }
                     opacity={ this.props.opacity }
                     tileShape="notif"
-                    empty="You have no visible notifications"
+                    empty={ _t('You have no visible notifications') }
                 />
             );
         }

src/components/structures/RoomStatusBar.js

@@ -14,12 +14,12 @@ See the License for the specific language governing permissions and
 limitations under the License.
 */
 
-var React = require('react');
-var sdk = require('../../index');
-var dis = require("../../dispatcher");
-var WhoIsTyping = require("../../WhoIsTyping");
-var MatrixClientPeg = require("../../MatrixClientPeg");
-const MemberAvatar = require("../views/avatars/MemberAvatar");
+import React from 'react';
+import { _t, _tJsx } from '../../languageHandler';
+import sdk from '../../index';
+import WhoIsTyping from '../../WhoIsTyping';
+import MatrixClientPeg from '../../MatrixClientPeg';
+import MemberAvatar from '../views/avatars/MemberAvatar';
 
 const HIDE_DEBOUNCE_MS = 10000;
 const STATUS_BAR_HIDDEN = 0;
@@ -175,8 +175,8 @@ module.exports = React.createClass({
                 <div className="mx_RoomStatusBar_scrollDownIndicator"
                         onClick={ this.props.onScrollToBottomClick }>
                     <img src="img/scrolldown.svg" width="24" height="24"
-                        alt="Scroll to bottom of page"
-                        title="Scroll to bottom of page"/>
+                        alt={ _t("Scroll to bottom of page") }
+                        title={ _t("Scroll to bottom of page") }/>
                 </div>
             );
         }
@@ -250,10 +250,10 @@ module.exports = React.createClass({
                 <div className="mx_RoomStatusBar_connectionLostBar">
                     <img src="img/warning.svg" width="24" height="23" title="/!\ " alt="/!\ "/>
                     <div className="mx_RoomStatusBar_connectionLostBar_title">
-                        Connectivity to the server has been lost.
+                        {_t('Connectivity to the server has been lost.')}
                     </div>
                     <div className="mx_RoomStatusBar_connectionLostBar_desc">
-                        Sent messages will be stored until your connection has returned.
+                        {_t('Sent messages will be stored until your connection has returned.')}
                     </div>
                 </div>
             );
@@ -266,7 +266,7 @@ module.exports = React.createClass({
                         <TabCompleteBar tabComplete={this.props.tabComplete} />
                         <div className="mx_RoomStatusBar_tabCompleteEol" title="->|">
                             <TintableSvg src="img/eol.svg" width="22" height="16"/>
-                            Auto-complete
+                            {_t('Auto-complete')}
                         </div>
                     </div>
                 </div>
@@ -281,15 +281,13 @@ module.exports = React.createClass({
                         { this.props.unsentMessageError }
                     </div>
                     <div className="mx_RoomStatusBar_connectionLostBar_desc">
-                        <a className="mx_RoomStatusBar_resend_link"
-                          onClick={ this.props.onResendAllClick }>
-                            Resend all
-                        </a> or <a
-                          className="mx_RoomStatusBar_resend_link"
-                          onClick={ this.props.onCancelAllClick }>
-                            cancel all
-                        </a> now. You can also select individual messages to
-                        resend or cancel.
+                    {_tJsx("<a>Resend all</a> or <a>cancel all</a> now. You can also select individual messages to resend or cancel.",
+                        [/<a>(.*?)<\/a>/, /<a>(.*?)<\/a>/],
+                        [
+                            (sub) => <a className="mx_RoomStatusBar_resend_link" key="resend" onClick={ this.props.onResendAllClick }>{sub}</a>,
+                            (sub) => <a className="mx_RoomStatusBar_resend_link" key="cancel" onClick={ this.props.onCancelAllClick }>{sub}</a>,
+                        ]
+                    )}
                     </div>
                 </div>
             );
@@ -298,8 +296,8 @@ module.exports = React.createClass({
         // unread count trumps who is typing since the unread count is only
         // set when you've scrolled up
         if (this.props.numUnreadMessages) {
-            var unreadMsgs = this.props.numUnreadMessages + " new message" +
-                (this.props.numUnreadMessages > 1 ? "s" : "");
+            // MUST use var name "count" for pluralization to kick in
+            var unreadMsgs = _t("%(count)s new messages", {count: this.props.numUnreadMessages});
 
             return (
                 <div className="mx_RoomStatusBar_unreadMessagesBar"
@@ -324,7 +322,7 @@ module.exports = React.createClass({
         if (this.props.hasActiveCall) {
             return (
                 <div className="mx_RoomStatusBar_callBar">
-                    <b>Active call</b>
+                    <b>{_t('Active call')}</b>
                 </div>
             );
         }

src/components/structures/RoomView.js

@@ -25,6 +25,7 @@ var ReactDOM = require("react-dom");
 var q = require("q");
 var classNames = require("classnames");
 var Matrix = require("matrix-js-sdk");
+import { _t } from '../../languageHandler';
 
 var UserSettingsStore = require('../../UserSettingsStore');
 var MatrixClientPeg = require("../../MatrixClientPeg");
@@ -44,6 +45,8 @@ import KeyCode from '../../KeyCode';
 
 import UserProvider from '../../autocomplete/UserProvider';
 
+import RoomViewStore from '../../stores/RoomViewStore';
+
 var DEBUG = false;
 
 if (DEBUG) {
@@ -58,16 +61,9 @@ module.exports = React.createClass({
     propTypes: {
         ConferenceHandler: React.PropTypes.any,
 
-        // Either a room ID or room alias for the room to display.
-        // If the room is being displayed as a result of the user clicking
-        // on a room alias, the alias should be supplied. Otherwise, a room
-        // ID should be supplied.
-        roomAddress: React.PropTypes.string.isRequired,
-
-        // If a room alias is passed to roomAddress, a function can be
-        // provided here that will be called with the ID of the room
-        // once it has been resolved.
-        onRoomIdResolved: React.PropTypes.func,
+        // Called with the credentials of a registered user (if they were a ROU that
+        // transitioned to PWLU)
+        onRegistered: React.PropTypes.func,
 
         // An object representing a third party invite to join this room
         // Fields:
@@ -87,36 +83,8 @@ module.exports = React.createClass({
         //  *                      invited us tovthe room
         oobData: React.PropTypes.object,
 
-        // id of an event to jump to. If not given, will go to the end of the
-        // live timeline.
-        eventId: React.PropTypes.string,
-
-        // where to position the event given by eventId, in pixels from the
-        // bottom of the viewport. If not given, will try to put the event
-        // 1/3 of the way down the viewport.
-        eventPixelOffset: React.PropTypes.number,
-
-        // ID of an event to highlight. If undefined, no event will be highlighted.
-        // Typically this will either be the same as 'eventId', or undefined.
-        highlightedEventId: React.PropTypes.string,
-
         // is the RightPanel collapsed?
         collapsedRhs: React.PropTypes.bool,
-
-        // a map from room id to scroll state, which will be updated on unmount.
-        //
-        // If there is no special scroll state (ie, we are following the live
-        // timeline), the scroll state is null. Otherwise, it is an object with
-        // the following properties:
-        //
-        //    focussedEvent: the ID of the 'focussed' event. Typically this is
-        //        the last event fully visible in the viewport, though if we
-        //        have done an explicit scroll to an explicit event, it will be
-        //        that event.
-        //
-        //    pixelOffset: the number of pixels the window is scrolled down
-        //        from the focussedEvent.
-        scrollStateMap: React.PropTypes.object,
     },
 
     getInitialState: function() {
@@ -124,6 +92,17 @@ module.exports = React.createClass({
             room: null,
             roomId: null,
             roomLoading: true,
+            peekLoading: false,
+            shouldPeek: true,
+
+            // The event to be scrolled to initially
+            initialEventId: null,
+            // The offset in pixels from the event with which to scroll vertically
+            initialEventPixelOffset: null,
+            // Whether to highlight the event scrolled to
+            isInitialEventHighlighted: null,
+
+            forwardingEvent: null,
             editingRoomSettings: false,
             uploadingRoomSettings: false,
             numUnreadMessages: 0,
@@ -169,40 +148,72 @@ module.exports = React.createClass({
             onClickCompletes: true,
             onStateChange: (isCompleting) => {
                 this.forceUpdate();
-            }
+            },
         });
 
-        if (this.props.roomAddress[0] == '#') {
-            // we always look up the alias from the directory server:
-            // we want the room that the given alias is pointing to
-            // right now. We may have joined that alias before but there's
-            // no guarantee the alias hasn't subsequently been remapped.
-            MatrixClientPeg.get().getRoomIdForAlias(this.props.roomAddress).done((result) => {
-                if (this.props.onRoomIdResolved) {
-                    this.props.onRoomIdResolved(result.room_id);
-                }
-                var room = MatrixClientPeg.get().getRoom(result.room_id);
-                this.setState({
-                    room: room,
-                    roomId: result.room_id,
-                    roomLoading: !room,
-                    unsentMessageError: this._getUnsentMessageError(room),
-                }, this._onHaveRoom);
-            }, (err) => {
-                this.setState({
-                    roomLoading: false,
-                    roomLoadError: err,
-                });
-            });
-        } else {
-            var room = MatrixClientPeg.get().getRoom(this.props.roomAddress);
-            this.setState({
-                roomId: this.props.roomAddress,
-                room: room,
-                roomLoading: !room,
-                unsentMessageError: this._getUnsentMessageError(room),
-            }, this._onHaveRoom);
+        // Start listening for RoomViewStore updates
+        this._roomStoreToken = RoomViewStore.addListener(this._onRoomViewStoreUpdate);
+        this._onRoomViewStoreUpdate(true);
+    },
+
+    _onRoomViewStoreUpdate: function(initial) {
+        if (this.unmounted) {
+            return;
         }
+        const newState = {
+            roomId: RoomViewStore.getRoomId(),
+            roomAlias: RoomViewStore.getRoomAlias(),
+            roomLoading: RoomViewStore.isRoomLoading(),
+            roomLoadError: RoomViewStore.getRoomLoadError(),
+            joining: RoomViewStore.isJoining(),
+            initialEventId: RoomViewStore.getInitialEventId(),
+            initialEventPixelOffset: RoomViewStore.getInitialEventPixelOffset(),
+            isInitialEventHighlighted: RoomViewStore.isInitialEventHighlighted(),
+            forwardingEvent: RoomViewStore.getForwardingEvent(),
+            shouldPeek: RoomViewStore.shouldPeek(),
+        };
+
+        // finished joining, start waiting for a room and show a spinner. See onRoom.
+        newState.waitingForRoom = this.state.joining && !newState.joining &&
+                        !RoomViewStore.getJoinError();
+
+        // Temporary logging to diagnose https://github.com/vector-im/riot-web/issues/4307
+        console.log(
+            'RVS update:',
+            newState.roomId,
+            newState.roomAlias,
+            'loading?', newState.roomLoading,
+            'joining?', newState.joining,
+            'initial?', initial,
+            'waiting?', newState.waitingForRoom,
+            'shouldPeek?', newState.shouldPeek,
+        );
+
+        // NB: This does assume that the roomID will not change for the lifetime of
+        // the RoomView instance
+        if (initial) {
+            newState.room = MatrixClientPeg.get().getRoom(newState.roomId);
+        }
+
+        // Clear the search results when clicking a search result (which changes the
+        // currently scrolled to event, this.state.initialEventId).
+        if (this.state.initialEventId !== newState.initialEventId) {
+            newState.searchResults = null;
+        }
+
+        // Store the scroll state for the previous room so that we can return to this
+        // position when viewing this room in future.
+        if (this.state.roomId !== newState.roomId) {
+            this._updateScrollMap(this.state.roomId);
+        }
+
+        this.setState(newState, () => {
+            // At this point, this.state.roomId could be null (e.g. the alias might not
+            // have been resolved yet) so anything called here must handle this case.
+            if (initial) {
+                this._onHaveRoom();
+            }
+        });
     },
 
     _onHaveRoom: function() {
@@ -217,29 +228,31 @@ module.exports = React.createClass({
         // which must be by alias or invite wherever possible (peeking currently does
         // not work over federation).
 
-        // NB. We peek if we are not in the room, although if we try to peek into
-        // a room in which we have a member event (ie. we've left) synapse will just
-        // send us the same data as we get in the sync (ie. the last events we saw).
-        var user_is_in_room = null;
-        if (this.state.room) {
-            user_is_in_room = this.state.room.hasMembershipState(
-                MatrixClientPeg.get().credentials.userId, 'join'
-            );
-
-            UserProvider.getInstance().setUserListFromRoom(this.state.room);
-            this.tabComplete.loadEntries(this.state.room);
+        // NB. We peek if we have never seen the room before (i.e. js-sdk does not know
+        // about it). We don't peek in the historical case where we were joined but are
+        // now not joined because the js-sdk peeking API will clobber our historical room,
+        // making it impossible to indicate a newly joined room.
+        const room = this.state.room;
+        if (room) {
+            UserProvider.getInstance().setUserListFromRoom(room);
+            this.tabComplete.loadEntries(room);
+            this.setState({
+                unsentMessageError: this._getUnsentMessageError(room),
+            });
+            this._onRoomLoaded(room);
         }
-
-        if (!user_is_in_room && this.state.roomId) {
+        if (!this.state.joining && this.state.roomId) {
             if (this.props.autoJoin) {
                 this.onJoinButtonClicked();
-            } else if (this.state.roomId) {
+            } else if (!room && this.state.shouldPeek) {
                 console.log("Attempting to peek into room %s", this.state.roomId);
-
+                this.setState({
+                    peekLoading: true,
+                });
                 MatrixClientPeg.get().peekInRoom(this.state.roomId).then((room) => {
                     this.setState({
                         room: room,
-                        roomLoading: false,
+                        peekLoading: false,
                     });
                     this._onRoomLoaded(room);
                 }, (err) => {
@@ -249,16 +262,16 @@ module.exports = React.createClass({
                     if (err.errcode == "M_GUEST_ACCESS_FORBIDDEN") {
                         // This is fine: the room just isn't peekable (we assume).
                         this.setState({
-                            roomLoading: false,
+                            peekLoading: false,
                         });
                     } else {
                         throw err;
                     }
                 }).done();
             }
-        } else if (user_is_in_room) {
+        } else if (room) {
+            // Stop peeking because we have joined this room previously
             MatrixClientPeg.get().stopPeeking();
-            this._onRoomLoaded(this.state.room);
         }
     },
 
@@ -294,17 +307,6 @@ module.exports = React.createClass({
         }
     },
 
-    componentWillReceiveProps: function(newProps) {
-        if (newProps.roomAddress != this.props.roomAddress) {
-            throw new Error("changing room on a RoomView is not supported");
-        }
-
-        if (newProps.eventId != this.props.eventId) {
-            // when we change focussed event id, hide the search results.
-            this.setState({searchResults: null});
-        }
-    },
-
     shouldComponentUpdate: function(nextProps, nextState) {
         return (!ObjectUtils.shallowEqual(this.props, nextProps) ||
                 !ObjectUtils.shallowEqual(this.state, nextState));
@@ -330,7 +332,7 @@ module.exports = React.createClass({
         this.unmounted = true;
 
         // update the scroll map before we get unmounted
-        this._updateScrollMap();
+        this._updateScrollMap(this.state.roomId);
 
         if (this.refs.roomView) {
             // disconnect the D&D event listeners from the room view. This
@@ -359,6 +361,11 @@ module.exports = React.createClass({
 
         document.removeEventListener("keydown", this.onKeyDown);
 
+        // Remove RoomStore listener
+        if (this._roomStoreToken) {
+            this._roomStoreToken.remove();
+        }
+
         // cancel any pending calls to the rate_limited_funcs
         this._updateRoomMembers.cancelPendingCall();
 
@@ -370,10 +377,10 @@ module.exports = React.createClass({
     onPageUnload(event) {
         if (ContentMessages.getCurrentUploads().length > 0) {
             return event.returnValue =
-                'You seem to be uploading files, are you sure you want to quit?';
+                _t("You seem to be uploading files, are you sure you want to quit?");
         } else if (this._getCallForRoom() && this.state.callState !== 'ended') {
             return event.returnValue =
-                'You seem to be in a call, are you sure you want to quit?';
+                _t("You seem to be in a call, are you sure you want to quit?");
         }
     },
 
@@ -518,7 +525,7 @@ module.exports = React.createClass({
         this._updatePreviewUrlVisibility(room);
     },
 
-    _warnAboutEncryption: function (room) {
+    _warnAboutEncryption: function(room) {
         if (!MatrixClientPeg.get().isRoomEncrypted(room.roomId)) {
             return;
         }
@@ -529,14 +536,14 @@ module.exports = React.createClass({
         if (!userHasUsedEncryption) {
             const QuestionDialog = sdk.getComponent("dialogs.QuestionDialog");
             Modal.createDialog(QuestionDialog, {
-                title: "Warning!",
+                title: _t("Warning!"),
                 hasCancelButton: false,
                 description: (
                     <div>
-                        <p>End-to-end encryption is in beta and may not be reliable.</p>
-                        <p>You should <b>not</b> yet trust it to secure data.</p>
-                        <p>Devices will <b>not</b> yet be able to decrypt history from before they joined the room.</p>
-                        <p>Encrypted messages will not be visible on clients that do not yet implement encryption.</p>
+                        <p>{ _t("End-to-end encryption is in beta and may not be reliable") }.</p>
+                        <p>{ _t("You should not yet trust it to secure data") }.</p>
+                        <p>{ _t("Devices will not yet be able to decrypt history from before they joined the room") }.</p>
+                        <p>{ _t("Encrypted messages will not be visible on clients that do not yet implement encryption") }.</p>
                     </div>
                 ),
             });
@@ -598,21 +605,28 @@ module.exports = React.createClass({
         });
     },
 
-    onRoom: function(room) {
-        // This event is fired when the room is 'stored' by the JS SDK, which
-        // means it's now a fully-fledged room object ready to be used, so
-        // set it in our state and start using it (ie. init the timeline)
-        // This will happen if we start off viewing a room we're not joined,
-        // then join it whilst RoomView is looking at that room.
-        if (!this.state.room && room.roomId == this._joiningRoomId) {
-            this._joiningRoomId = undefined;
-            this.setState({
-                room: room,
-                joining: false,
-            });
-
-            this._onRoomLoaded(room);
+    _updateScrollMap(roomId) {
+        // No point updating scroll state if the room ID hasn't been resolved yet
+        if (!roomId) {
+            return;
         }
+        dis.dispatch({
+            action: 'update_scroll_state',
+            room_id: roomId,
+            scroll_state: this._getScrollState(),
+        });
+    },
+
+    onRoom: function(room) {
+        if (!room || room.roomId !== this.state.roomId) {
+            return;
+        }
+        this.setState({
+            room: room,
+            waitingForRoom: false,
+        }, () => {
+            this._onRoomLoaded(room);
+        });
     },
 
     updateTint: function() {
@@ -665,7 +679,14 @@ module.exports = React.createClass({
 
     onRoomMemberMembership: function(ev, member, oldMembership) {
         if (member.userId == MatrixClientPeg.get().credentials.userId) {
-            this.forceUpdate();
+
+            if (member.membership === 'join') {
+                this.setState({
+                    waitingForRoom: false,
+                });
+            } else {
+                this.forceUpdate();
+            }
         }
     },
 
@@ -695,10 +716,6 @@ module.exports = React.createClass({
                 // compatability workaround, let's not bother.
                 Rooms.setDMRoom(this.state.room.roomId, me.events.member.getSender()).done();
             }
-
-            this.setState({
-                joining: false
-            });
         }
     }, 500),
 
@@ -707,10 +724,10 @@ module.exports = React.createClass({
         if (!unsentMessages.length) return "";
         for (const event of unsentMessages) {
             if (!event.error || event.error.name !== "UnknownDeviceError") {
-                return "Some of your messages have not been sent.";
+                return _t("Some of your messages have not been sent.");
             }
         }
-        return "Message not sent due to unknown devices being present";
+        return _t("Message not sent due to unknown devices being present");
     },
 
     _getUnsentMessages: function(room) {
@@ -773,41 +790,62 @@ module.exports = React.createClass({
     },
 
     onJoinButtonClicked: function(ev) {
-        var self = this;
+        const cli = MatrixClientPeg.get();
 
-        var cli = MatrixClientPeg.get();
-        var display_name_promise = q();
-        // if this is the first room we're joining, check the user has a display name
-        // and if they don't, prompt them to set one.
-        // NB. This unfortunately does not re-use the ChangeDisplayName component because
-        // it doesn't behave quite as desired here (we want an input field here rather than
-        // content-editable, and we want a default).
-        if (cli.getRooms().filter((r) => {
-            return r.hasMembershipState(cli.credentials.userId, "join");
-        })) {
-            display_name_promise = cli.getProfileInfo(cli.credentials.userId).then((result) => {
-                if (!result.displayname) {
-                    var SetDisplayNameDialog = sdk.getComponent('views.dialogs.SetDisplayNameDialog');
-                    var dialog_defer = q.defer();
-                    Modal.createDialog(SetDisplayNameDialog, {
-                        currentDisplayName: result.displayname,
-                        onFinished: (submitted, newDisplayName) => {
-                            if (submitted) {
-                                cli.setDisplayName(newDisplayName).done(() => {
-                                    dialog_defer.resolve();
-                                });
-                            }
-                            else {
-                                dialog_defer.reject();
-                            }
-                        }
-                    });
-                    return dialog_defer.promise;
-                }
+        // If the user is a ROU, allow them to transition to a PWLU
+        if (cli && cli.isGuest()) {
+            // Join this room once the user has registered and logged in
+            const signUrl = this.props.thirdPartyInvite ?
+                this.props.thirdPartyInvite.inviteSignUrl : undefined;
+            dis.dispatch({
+                action: 'do_after_sync_prepared',
+                deferred_action: {
+                    action: 'join_room',
+                    opts: { inviteSignUrl: signUrl },
+                },
             });
+
+            // Don't peek whilst registering otherwise getPendingEventList complains
+            // Do this by indicating our intention to join
+            dis.dispatch({
+                action: 'will_join',
+            });
+
+            const SetMxIdDialog = sdk.getComponent('views.dialogs.SetMxIdDialog');
+            const close = Modal.createDialog(SetMxIdDialog, {
+                homeserverUrl: cli.getHomeserverUrl(),
+                onFinished: (submitted, credentials) => {
+                    if (submitted) {
+                        this.props.onRegistered(credentials);
+                    } else {
+                        dis.dispatch({
+                            action: 'cancel_after_sync_prepared',
+                        });
+                        dis.dispatch({
+                            action: 'cancel_join',
+                        });
+                    }
+                },
+                onDifferentServerClicked: (ev) => {
+                    dis.dispatch({action: 'start_registration'});
+                    close();
+                },
+                onLoginClick: (ev) => {
+                    dis.dispatch({action: 'start_login'});
+                    close();
+                },
+            }).close;
+            return;
         }
 
-        display_name_promise.then(() => {
+        q().then(() => {
+            const signUrl = this.props.thirdPartyInvite ?
+                this.props.thirdPartyInvite.inviteSignUrl : undefined;
+            dis.dispatch({
+                action: 'join_room',
+                opts: { inviteSignUrl: signUrl },
+            });
+
             // if this is an invite and has the 'direct' hint set, mark it as a DM room now.
             if (this.state.room) {
                 const me = this.state.room.getMember(MatrixClientPeg.get().credentials.userId);
@@ -819,72 +857,7 @@ module.exports = React.createClass({
                     }
                 }
             }
-
             return q();
-        }).then(() => {
-            var sign_url = this.props.thirdPartyInvite ? this.props.thirdPartyInvite.inviteSignUrl : undefined;
-            return MatrixClientPeg.get().joinRoom(this.props.roomAddress,
-                                                  { inviteSignUrl: sign_url } );
-        }).then(function(resp) {
-            var roomId = resp.roomId;
-
-            // It is possible that there is no Room yet if state hasn't come down
-            // from /sync - joinRoom will resolve when the HTTP request to join succeeds,
-            // NOT when it comes down /sync. If there is no room, we'll keep the
-            // joining flag set until we see it.
-
-            // We'll need to initialise the timeline when joining, but due to
-            // the above, we can't do it here: we do it in onRoom instead,
-            // once we have a useable room object.
-            var room = MatrixClientPeg.get().getRoom(roomId);
-            if (!room) {
-                // wait for the room to turn up in onRoom.
-                self._joiningRoomId = roomId;
-            } else {
-                // we've got a valid room, but that might also just mean that
-                // it was peekable (so we had one before anyway).  If we are
-                // not yet a member of the room, we will need to wait for that
-                // to happen, in onRoomStateMember.
-                var me = MatrixClientPeg.get().credentials.userId;
-                self.setState({
-                    joining: !room.hasMembershipState(me, "join"),
-                    room: room
-                });
-            }
-        }).catch(function(error) {
-            self.setState({
-                joining: false,
-                joinError: error
-            });
-
-            if (!error) return;
-
-            // https://matrix.org/jira/browse/SYN-659
-            // Need specific error message if joining a room is refused because the user is a guest and guest access is not allowed
-            if (
-                error.errcode == 'M_GUEST_ACCESS_FORBIDDEN' ||
-                (
-                    error.errcode == 'M_FORBIDDEN' &&
-                    MatrixClientPeg.get().isGuest()
-                )
-            ) {
-                var NeedToRegisterDialog = sdk.getComponent("dialogs.NeedToRegisterDialog");
-                Modal.createDialog(NeedToRegisterDialog, {
-                    title: "Failed to join the room",
-                    description: "This room is private or inaccessible to guests. You may be able to join if you register."
-                });
-            } else {
-                var msg = error.message ? error.message : JSON.stringify(error);
-                var ErrorDialog = sdk.getComponent("dialogs.ErrorDialog");
-                Modal.createDialog(ErrorDialog, {
-                    title: "Failed to join room",
-                    description: msg
-                });
-            }
-        }).done();
-
-        this.setState({
-            joining: true
         });
     },
 
@@ -936,11 +909,7 @@ module.exports = React.createClass({
 
     uploadFile: function(file) {
         if (MatrixClientPeg.get().isGuest()) {
-            var NeedToRegisterDialog = sdk.getComponent("dialogs.NeedToRegisterDialog");
-            Modal.createDialog(NeedToRegisterDialog, {
-                title: "Please Register",
-                description: "Guest users can't upload files. Please register to upload."
-            });
+            dis.dispatch({action: 'view_set_mxid'});
             return;
         }
 
@@ -958,8 +927,8 @@ module.exports = React.createClass({
             const ErrorDialog = sdk.getComponent("dialogs.ErrorDialog");
             console.error("Failed to upload file " + file + " " + error);
             Modal.createDialog(ErrorDialog, {
-                title: "Failed to upload file",
-                description: ((error && error.message) ? error.message : "Server may be unavailable, overloaded, or the file too big"),
+                title: _t('Failed to upload file'),
+                description: ((error && error.message) ? error.message : _t("Server may be unavailable, overloaded, or the file too big")),
             });
         });
     },
@@ -1045,8 +1014,8 @@ module.exports = React.createClass({
             var ErrorDialog = sdk.getComponent("dialogs.ErrorDialog");
             console.error("Search failed: " + error);
             Modal.createDialog(ErrorDialog, {
-                title: "Search failed",
-                description: ((error && error.message) ? error.message : "Server may be unavailable, overloaded, or search timed out :("),
+                title: _t("Search failed"),
+                description: ((error && error.message) ? error.message : _t("Server may be unavailable, overloaded, or search timed out :(")),
             });
         }).finally(function() {
             self.setState({
@@ -1081,12 +1050,12 @@ module.exports = React.createClass({
         if (!this.state.searchResults.next_batch) {
             if (this.state.searchResults.results.length == 0) {
                 ret.push(<li key="search-top-marker">
-                         <h2 className="mx_RoomView_topMarker">No results</h2>
+                         <h2 className="mx_RoomView_topMarker">{ _t("No results") }</h2>
                          </li>
                         );
             } else {
                 ret.push(<li key="search-top-marker">
-                         <h2 className="mx_RoomView_topMarker">No more results</h2>
+                         <h2 className="mx_RoomView_topMarker">{ _t("No more results") }</h2>
                          </li>
                         );
             }
@@ -1123,10 +1092,10 @@ module.exports = React.createClass({
                     // it. We should tell the js sdk to go and find out about
                     // it. But that's not an issue currently, as synapse only
                     // returns results for rooms we're joined to.
-                    var roomName = room ? room.name : "Unknown room "+roomId;
+                    var roomName = room ? room.name : _t("Unknown room %(roomId)s", { roomId: roomId });
 
                     ret.push(<li key={mxEv.getId() + "-room"}>
-                                 <h1>Room: { roomName }</h1>
+                                 <h1>{ _t("Room") }: { roomName }</h1>
                              </li>);
                     lastRoomId = roomId;
                 }
@@ -1172,7 +1141,7 @@ module.exports = React.createClass({
                 });
                 var ErrorDialog = sdk.getComponent("dialogs.ErrorDialog");
                 Modal.createDialog(ErrorDialog, {
-                    title: "Failed to save settings",
+                    title: _t("Failed to save settings"),
                     description: fails.map(function(result) { return result.reason; }).join("\n"),
                 });
                 // still editing room settings
@@ -1193,7 +1162,15 @@ module.exports = React.createClass({
     onCancelClick: function() {
         console.log("updateTint from onCancelClick");
         this.updateTint();
-        this.setState({editingRoomSettings: false});
+        this.setState({
+            editingRoomSettings: false,
+        });
+        if (this.state.forwardingEvent) {
+            dis.dispatch({
+                action: 'forward_event',
+                event: null,
+            });
+        }
         dis.dispatch({action: 'focus_composer'});
     },
 
@@ -1208,11 +1185,11 @@ module.exports = React.createClass({
         MatrixClientPeg.get().forget(this.state.room.roomId).done(function() {
             dis.dispatch({ action: 'view_next_room' });
         }, function(err) {
-            var errCode = err.errcode || "unknown error code";
+            var errCode = err.errcode || _t("unknown error code");
             var ErrorDialog = sdk.getComponent("dialogs.ErrorDialog");
             Modal.createDialog(ErrorDialog, {
-                title: "Error",
-                description: `Failed to forget room (${errCode})`
+                title: _t("Error"),
+                description: _t("Failed to forget room %(errCode)s", { errCode: errCode }),
             });
         });
     },
@@ -1233,8 +1210,8 @@ module.exports = React.createClass({
             var msg = error.message ? error.message : JSON.stringify(error);
             var ErrorDialog = sdk.getComponent("dialogs.ErrorDialog");
             Modal.createDialog(ErrorDialog, {
-                title: "Failed to reject invite",
-                description: msg
+                title: _t("Failed to reject invite"),
+                description: msg,
             });
 
             self.setState({
@@ -1295,21 +1272,6 @@ module.exports = React.createClass({
         }
     },
 
-    // update scrollStateMap on unmount
-    _updateScrollMap: function() {
-        if (!this.state.room) {
-            // we were instantiated on a room alias and haven't yet joined the room.
-            return;
-        }
-        if (!this.props.scrollStateMap) return;
-
-        var roomId = this.state.room.roomId;
-
-        var state = this._getScrollState();
-        this.props.scrollStateMap[roomId] = state;
-    },
-
-
     // get the current scroll position of the room, so that it can be
     // restored when we switch back to it.
     //
@@ -1463,61 +1425,65 @@ module.exports = React.createClass({
     },
 
     render: function() {
-        var RoomHeader = sdk.getComponent('rooms.RoomHeader');
-        var MessageComposer = sdk.getComponent('rooms.MessageComposer');
-        var RoomSettings = sdk.getComponent("rooms.RoomSettings");
-        var AuxPanel = sdk.getComponent("rooms.AuxPanel");
-        var SearchBar = sdk.getComponent("rooms.SearchBar");
-        var ScrollPanel = sdk.getComponent("structures.ScrollPanel");
-        var TintableSvg = sdk.getComponent("elements.TintableSvg");
-        var RoomPreviewBar = sdk.getComponent("rooms.RoomPreviewBar");
-        var Loader = sdk.getComponent("elements.Spinner");
-        var TimelinePanel = sdk.getComponent("structures.TimelinePanel");
+        const RoomHeader = sdk.getComponent('rooms.RoomHeader');
+        const MessageComposer = sdk.getComponent('rooms.MessageComposer');
+        const ForwardMessage = sdk.getComponent("rooms.ForwardMessage");
+        const RoomSettings = sdk.getComponent("rooms.RoomSettings");
+        const AuxPanel = sdk.getComponent("rooms.AuxPanel");
+        const SearchBar = sdk.getComponent("rooms.SearchBar");
+        const ScrollPanel = sdk.getComponent("structures.ScrollPanel");
+        const TintableSvg = sdk.getComponent("elements.TintableSvg");
+        const RoomPreviewBar = sdk.getComponent("rooms.RoomPreviewBar");
+        const Loader = sdk.getComponent("elements.Spinner");
+        const TimelinePanel = sdk.getComponent("structures.TimelinePanel");
+
+        // Whether the preview bar spinner should be shown. We do this when joining or
+        // when waiting for a room to be returned by js-sdk when joining
+        const previewBarSpinner = this.state.joining || this.state.waitingForRoom;
 
         if (!this.state.room) {
-                if (this.state.roomLoading) {
-                    return (
-                        <div className="mx_RoomView">
-                            <Loader />
-                        </div>
-                    );
+            if (this.state.roomLoading || this.state.peekLoading) {
+                return (
+                    <div className="mx_RoomView">
+                        <Loader />
+                    </div>
+                );
+            } else {
+                var inviterName = undefined;
+                if (this.props.oobData) {
+                    inviterName = this.props.oobData.inviterName;
+                }
+                var invitedEmail = undefined;
+                if (this.props.thirdPartyInvite) {
+                    invitedEmail = this.props.thirdPartyInvite.invitedEmail;
                 }
-                else {
-                    var inviterName = undefined;
-                    if (this.props.oobData) {
-                        inviterName = this.props.oobData.inviterName;
-                    }
-                    var invitedEmail = undefined;
-                    if (this.props.thirdPartyInvite) {
-                        invitedEmail = this.props.thirdPartyInvite.invitedEmail;
-                    }
 
-                    // We have no room object for this room, only the ID.
-                    // We've got to this room by following a link, possibly a third party invite.
-                    var room_alias = this.props.roomAddress[0] == '#' ? this.props.roomAddress : null;
-                    return (
-                        <div className="mx_RoomView">
-                            <RoomHeader ref="header"
-                                room={this.state.room}
-                                oobData={this.props.oobData}
-                                collapsedRhs={ this.props.collapsedRhs }
+                // We have no room object for this room, only the ID.
+                // We've got to this room by following a link, possibly a third party invite.
+                const roomAlias = this.state.roomAlias;
+                return (
+                    <div className="mx_RoomView">
+                        <RoomHeader ref="header"
+                            room={this.state.room}
+                            oobData={this.props.oobData}
+                            collapsedRhs={ this.props.collapsedRhs }
+                        />
+                        <div className="mx_RoomView_auxPanel">
+                            <RoomPreviewBar onJoinClick={ this.onJoinButtonClicked }
+                                            onForgetClick={ this.onForgetClick }
+                                            onRejectClick={ this.onRejectThreepidInviteButtonClicked }
+                                            canPreview={ false } error={ this.state.roomLoadError }
+                                            roomAlias={roomAlias}
+                                            spinner={previewBarSpinner}
+                                            inviterName={inviterName}
+                                            invitedEmail={invitedEmail}
+                                            room={this.state.room}
                             />
-                            <div className="mx_RoomView_auxPanel">
-                                <RoomPreviewBar onJoinClick={ this.onJoinButtonClicked }
-                                                onForgetClick={ this.onForgetClick }
-                                                onRejectClick={ this.onRejectThreepidInviteButtonClicked }
-                                                canPreview={ false } error={ this.state.roomLoadError }
-                                                roomAlias={room_alias}
-                                                spinner={this.state.joining}
-                                                inviterName={inviterName}
-                                                invitedEmail={invitedEmail}
-                                                room={this.state.room}
-                                />
-                            </div>
-                            <div className="mx_RoomView_messagePanel"></div>
                         </div>
-                    );
-                }
+                        <div className="mx_RoomView_messagePanel"></div>
+                    </div>
+                );
+            }
         }
 
         var myUserId = MatrixClientPeg.get().credentials.userId;
@@ -1551,7 +1517,7 @@ module.exports = React.createClass({
                                             onRejectClick={ this.onRejectButtonClicked }
                                             inviterName={ inviterName }
                                             canPreview={ false }
-                                            spinner={this.state.joining}
+                                            spinner={previewBarSpinner}
                                             room={this.state.room}
                             />
                         </div>
@@ -1600,17 +1566,18 @@ module.exports = React.createClass({
             />;
         }
 
-        var aux = null;
+        let aux = null;
+        let hideCancel = false;
         if (this.state.editingRoomSettings) {
             aux = <RoomSettings ref="room_settings" onSaveClick={this.onSettingsSaveClick} onCancelClick={this.onCancelClick} room={this.state.room} />;
-        }
-        else if (this.state.uploadingRoomSettings) {
+        } else if (this.state.uploadingRoomSettings) {
             aux = <Loader/>;
-        }
-        else if (this.state.searching) {
+        } else if (this.state.forwardingEvent !== null) {
+            aux = <ForwardMessage onCancelClick={this.onCancelClick} />;
+        } else if (this.state.searching) {
+            hideCancel = true; // has own cancel
             aux = <SearchBar ref="search_bar" searchInProgress={this.state.searchInProgress } onCancelClick={this.onCancelSearchClick} onSearch={this.onSearch}/>;
-        }
-        else if (!myMember || myMember.membership !== "join") {
+        } else if (!myMember || myMember.membership !== "join") {
             // We do have a room object for this room, but we're not currently in it.
             // We may have a 3rd party invite to it.
             var inviterName = undefined;
@@ -1621,11 +1588,12 @@ module.exports = React.createClass({
             if (this.props.thirdPartyInvite) {
                 invitedEmail = this.props.thirdPartyInvite.invitedEmail;
             }
+            hideCancel = true;
             aux = (
                 <RoomPreviewBar onJoinClick={this.onJoinButtonClicked}
                                 onForgetClick={ this.onForgetClick }
                                 onRejectClick={this.onRejectThreepidInviteButtonClicked}
-                                spinner={this.state.joining}
+                                spinner={previewBarSpinner}
                                 inviterName={inviterName}
                                 invitedEmail={invitedEmail}
                                 canPreview={this.state.canPeek}
@@ -1672,7 +1640,7 @@ module.exports = React.createClass({
 
             if (call.type === "video") {
                 zoomButton = (
-                    <div className="mx_RoomView_voipButton" onClick={this.onFullscreenClick} title="Fill screen">
+                    <div className="mx_RoomView_voipButton" onClick={this.onFullscreenClick} title={ _t("Fill screen") }>
                         <TintableSvg src="img/fullscreen.svg" width="29" height="22" style={{ marginTop: 1, marginRight: 4 }}/>
                     </div>
                 );
@@ -1680,14 +1648,14 @@ module.exports = React.createClass({
                 videoMuteButton =
                     <div className="mx_RoomView_voipButton" onClick={this.onMuteVideoClick}>
                         <TintableSvg src={call.isLocalVideoMuted() ? "img/video-unmute.svg" : "img/video-mute.svg"}
-                             alt={call.isLocalVideoMuted() ? "Click to unmute video" : "Click to mute video"}
+                             alt={call.isLocalVideoMuted() ? _t("Click to unmute video") : _t("Click to mute video")}
                              width="31" height="27"/>
                     </div>;
             }
             voiceMuteButton =
                 <div className="mx_RoomView_voipButton" onClick={this.onMuteAudioClick}>
                     <TintableSvg src={call.isMicrophoneMuted() ? "img/voice-unmute.svg" : "img/voice-mute.svg"}
-                         alt={call.isMicrophoneMuted() ? "Click to unmute audio" : "Click to mute audio"}
+                         alt={call.isMicrophoneMuted() ? _t("Click to unmute audio") : _t("Click to mute audio")}
                          width="21" height="26"/>
                 </div>;
 
@@ -1722,17 +1690,24 @@ module.exports = React.createClass({
             hideMessagePanel = true;
         }
 
-        // console.log("ShowUrlPreview for %s is %s", this.state.room.roomId, this.state.showUrlPreview);
+        const shouldHighlight = this.state.isInitialEventHighlighted;
+        let highlightedEventId = null;
+        if (this.state.forwardingEvent) {
+            highlightedEventId = this.state.forwardingEvent.getId();
+        } else if (shouldHighlight) {
+            highlightedEventId = this.state.initialEventId;
+        }
 
+        // console.log("ShowUrlPreview for %s is %s", this.state.room.roomId, this.state.showUrlPreview);
         var messagePanel = (
             <TimelinePanel ref={this._gatherTimelinePanelRef}
                 timelineSet={this.state.room.getUnfilteredTimelineSet()}
                 manageReadReceipts={!UserSettingsStore.getSyncedSetting('hideReadReceipts', false)}
                 manageReadMarkers={true}
                 hidden={hideMessagePanel}
-                highlightedEventId={this.props.highlightedEventId}
-                eventId={this.props.eventId}
-                eventPixelOffset={this.props.eventPixelOffset}
+                highlightedEventId={highlightedEventId}
+                eventId={this.state.initialEventId}
+                eventPixelOffset={this.state.initialEventPixelOffset}
                 onScroll={ this.onMessageListScroll }
                 onReadMarkerUpdated={ this._updateTopUnreadMessagesBar }
                 showUrlPreview = { this.state.showUrlPreview }
@@ -1763,17 +1738,15 @@ module.exports = React.createClass({
                     oobData={this.props.oobData}
                     editing={this.state.editingRoomSettings}
                     saving={this.state.uploadingRoomSettings}
+                    inRoom={myMember && myMember.membership === 'join'}
                     collapsedRhs={ this.props.collapsedRhs }
                     onSearchClick={this.onSearchClick}
                     onSettingsClick={this.onSettingsClick}
                     onSaveClick={this.onSettingsSaveClick}
-                    onCancelClick={this.onCancelClick}
-                    onForgetClick={
-                        (myMember && myMember.membership === "leave") ? this.onForgetClick : null
-                    }
-                    onLeaveClick={
-                        (myMember && myMember.membership === "join") ? this.onLeaveClick : null
-                    } />
+                    onCancelClick={(aux && !hideCancel) ? this.onCancelClick : null}
+                    onForgetClick={(myMember && myMember.membership === "leave") ? this.onForgetClick : null}
+                    onLeaveClick={(myMember && myMember.membership === "join") ? this.onLeaveClick : null}
+                />
                 { auxPanel }
                 { topUnreadMessagesBar }
                 { messagePanel }

src/components/structures/ScrollPanel.js

@@ -352,13 +352,14 @@ module.exports = React.createClass({
             const tile = tiles[backwards ? i : tiles.length - 1 - i];
             // Subtract height of tile as if it were unpaginated
             excessHeight -= tile.clientHeight;
+            //If removing the tile would lead to future pagination, break before setting scroll token
+            if (tile.clientHeight > excessHeight) {
+                break;
+            }
             // The tile may not have a scroll token, so guard it
             if (tile.dataset.scrollTokens) {
                 markerScrollToken = tile.dataset.scrollTokens.split(',')[0];
             }
-            if (tile.clientHeight > excessHeight) {
-                break;
-            }
         }
 
         if (markerScrollToken) {

src/components/structures/TimelinePanel.js

@@ -23,12 +23,14 @@ var Matrix = require("matrix-js-sdk");
 var EventTimeline = Matrix.EventTimeline;
 
 var sdk = require('../../index');
+import { _t } from '../../languageHandler';
 var MatrixClientPeg = require("../../MatrixClientPeg");
 var dis = require("../../dispatcher");
 var ObjectUtils = require('../../ObjectUtils');
 var Modal = require("../../Modal");
 var UserActivity = require("../../UserActivity");
 var KeyCode = require('../../KeyCode');
+import UserSettingsStore from '../../UserSettingsStore';
 
 var PAGINATE_SIZE = 20;
 var INITIAL_SIZE = 20;
@@ -122,13 +124,15 @@ var TimelinePanel = React.createClass({
         let initialReadMarker = null;
         if (this.props.manageReadMarkers) {
             const readmarker = this.props.timelineSet.room.getAccountData('m.fully_read');
-            if (readmarker){
+            if (readmarker) {
                 initialReadMarker = readmarker.getContent().event_id;
             } else {
                 initialReadMarker = this._getCurrentReadReceipt();
             }
         }
 
+        const syncedSettings = UserSettingsStore.getSyncedSettings();
+
         return {
             events: [],
             timelineLoading: true, // track whether our room timeline is loading
@@ -171,14 +175,23 @@ var TimelinePanel = React.createClass({
 
             // cache of matrixClient.getSyncState() (but from the 'sync' event)
             clientSyncState: MatrixClientPeg.get().getSyncState(),
+
+            // should the event tiles have twelve hour times
+            isTwelveHour: syncedSettings.showTwelveHourTimestamps,
+
+            // always show timestamps on event tiles?
+            alwaysShowTimestamps: syncedSettings.alwaysShowTimestamps,
+
+            // hide redacted events as per old behaviour
+            hideRedactions: syncedSettings.hideRedactions,
         };
     },
 
     componentWillMount: function() {
         debuglog("TimelinePanel: mounting");
 
-        this.last_rr_sent_event_id = undefined;
-        this.last_rm_sent_event_id = undefined;
+        this.lastRRSentEventId = undefined;
+        this.lastRMSentEventId = undefined;
 
         this.dispatcherRef = dis.register(this.onAction);
         MatrixClientPeg.get().on("Room.timeline", this.onRoomTimeline);
@@ -504,12 +517,13 @@ var TimelinePanel = React.createClass({
         // very possible have logged out within that timeframe, so check
         // we still have a client.
         const cli = MatrixClientPeg.get();
-        // if no client or client is guest don't send RR
+        // if no client or client is guest don't send RR or RM
         if (!cli || cli.isGuest()) return;
 
-        var currentReadUpToEventId = this._getCurrentReadReceipt(true);
-        var currentReadUpToEventIndex = this._indexForEventId(currentReadUpToEventId);
+        let shouldSendRR = true;
 
+        const currentRREventId = this._getCurrentReadReceipt(true);
+        const currentRREventIndex = this._indexForEventId(currentRREventId);
         // We want to avoid sending out read receipts when we are looking at
         // events in the past which are before the latest RR.
         //
@@ -523,43 +537,60 @@ var TimelinePanel = React.createClass({
         // RRs) - but that is a bit of a niche case. It will sort itself out when
         // the user eventually hits the live timeline.
         //
-        if (currentReadUpToEventId && currentReadUpToEventIndex === null &&
+        if (currentRREventId && currentRREventIndex === null &&
                 this._timelineWindow.canPaginate(EventTimeline.FORWARDS)) {
-            return;
+            shouldSendRR = false;
         }
 
-        var lastReadEventIndex = this._getLastDisplayedEventIndex({
-            ignoreOwn: true
+        const lastReadEventIndex = this._getLastDisplayedEventIndex({
+            ignoreOwn: true,
         });
-        if (lastReadEventIndex === null) return;
+        if (lastReadEventIndex === null) {
+            shouldSendRR = false;
+        }
+        let lastReadEvent = this.state.events[lastReadEventIndex];
+        shouldSendRR = shouldSendRR &&
+            // Only send a RR if the last read event is ahead in the timeline relative to
+            // the current RR event.
+            lastReadEventIndex > currentRREventIndex &&
+            // Only send a RR if the last RR set != the one we would send
+            this.lastRRSentEventId != lastReadEvent.getId();
 
-        var lastReadEvent = this.state.events[lastReadEventIndex];
+        // Only send a RM if the last RM sent != the one we would send
+        const shouldSendRM =
+            this.lastRMSentEventId != this.state.readMarkerEventId;
 
         // we also remember the last read receipt we sent to avoid spamming the
         // same one at the server repeatedly
-        if ((lastReadEventIndex > currentReadUpToEventIndex &&
-            this.last_rr_sent_event_id != lastReadEvent.getId()) ||
-                this.last_rm_sent_event_id != this.state.readMarkerEventId) {
-
-            this.last_rr_sent_event_id = lastReadEvent.getId();
-            this.last_rm_sent_event_id = this.state.readMarkerEventId;
+        if (shouldSendRR || shouldSendRM) {
+            if (shouldSendRR) {
+                this.lastRRSentEventId = lastReadEvent.getId();
+            } else {
+                lastReadEvent = null;
+            }
+            this.lastRMSentEventId = this.state.readMarkerEventId;
 
+            debuglog('TimelinePanel: Sending Read Markers for ',
+                this.props.timelineSet.room.roomId,
+                'rm', this.state.readMarkerEventId,
+                lastReadEvent ? 'rr ' + lastReadEvent.getId() : '',
+            );
             MatrixClientPeg.get().setRoomReadMarkers(
                 this.props.timelineSet.room.roomId,
                 this.state.readMarkerEventId,
-                lastReadEvent
+                lastReadEvent, // Could be null, in which case no RR is sent
             ).catch((e) => {
                 // /read_markers API is not implemented on this HS, fallback to just RR
-                if (e.errcode === 'M_UNRECOGNIZED') {
+                if (e.errcode === 'M_UNRECOGNIZED' && lastReadEvent) {
                     return MatrixClientPeg.get().sendReadReceipt(
-                        lastReadEvent
+                        lastReadEvent,
                     ).catch(() => {
-                        this.last_rr_sent_event_id = undefined;
+                        this.lastRRSentEventId = undefined;
                     });
                 }
                 // it failed, so allow retries next time the user is active
-                this.last_rr_sent_event_id = undefined;
-                this.last_rm_sent_event_id = undefined;
+                this.lastRRSentEventId = undefined;
+                this.lastRMSentEventId = undefined;
             });
 
             // do a quick-reset of our unreadNotificationCount to avoid having
@@ -572,7 +603,6 @@ var TimelinePanel = React.createClass({
                 this.props.timelineSet.room.setUnreadNotificationCount('highlight', 0);
                 dis.dispatch({
                     action: 'on_room_read',
-                    room: this.props.timelineSet.room,
                 });
             }
         }
@@ -872,6 +902,9 @@ var TimelinePanel = React.createClass({
 
         var onError = (error) => {
             this.setState({timelineLoading: false});
+            console.error(
+                `Error loading timeline panel at ${eventId}: ${error}`,
+            );
             var msg = error.message ? error.message : JSON.stringify(error);
             var ErrorDialog = sdk.getComponent("dialogs.ErrorDialog");
 
@@ -890,14 +923,11 @@ var TimelinePanel = React.createClass({
                     });
                 };
             }
-            var message = "Tried to load a specific point in this room's timeline, but ";
-            if (error.errcode == 'M_FORBIDDEN') {
-                message += "you do not have permission to view the message in question.";
-            } else {
-                message += "was unable to find it.";
-            }
+            var message = (error.errcode == 'M_FORBIDDEN')
+            	? _t("Tried to load a specific point in this room's timeline, but you do not have permission to view the message in question.")
+                : _t("Tried to load a specific point in this room's timeline, but was unable to find it.");
             Modal.createDialog(ErrorDialog, {
-                title: "Failed to load timeline position",
+                title: _t("Failed to load timeline position"),
                 description: message,
                 onFinished: onFinished,
             });
@@ -1089,27 +1119,29 @@ var TimelinePanel = React.createClass({
         const forwardPaginating = (
             this.state.forwardPaginating || this.state.clientSyncState == 'PREPARED'
         );
-
         return (
             <MessagePanel ref="messagePanel"
-                    hidden={ this.props.hidden }
-                    backPaginating={ this.state.backPaginating }
-                    forwardPaginating={ forwardPaginating }
-                    events={ this.state.events }
-                    highlightedEventId={ this.props.highlightedEventId }
-                    readMarkerEventId={ this.state.readMarkerEventId }
-                    readMarkerVisible={ this.state.readMarkerVisible }
-                    suppressFirstDateSeparator={ this.state.canBackPaginate }
-                    showUrlPreview = { this.props.showUrlPreview }
-                    manageReadReceipts = { this.props.manageReadReceipts }
-                    ourUserId={ MatrixClientPeg.get().credentials.userId }
-                    stickyBottom={ stickyBottom }
-                    onScroll={ this.onMessageListScroll }
-                    onFillRequest={ this.onMessageListFillRequest }
-                    onUnfillRequest={ this.onMessageListUnfillRequest }
-                    opacity={ this.props.opacity }
-                    className={ this.props.className }
-                    tileShape={ this.props.tileShape }
+                          hidden={ this.props.hidden }
+                          hideRedactions={ this.state.hideRedactions }
+                          backPaginating={ this.state.backPaginating }
+                          forwardPaginating={ forwardPaginating }
+                          events={ this.state.events }
+                          highlightedEventId={ this.props.highlightedEventId }
+                          readMarkerEventId={ this.state.readMarkerEventId }
+                          readMarkerVisible={ this.state.readMarkerVisible }
+                          suppressFirstDateSeparator={ this.state.canBackPaginate }
+                          showUrlPreview = { this.props.showUrlPreview }
+                          manageReadReceipts = { this.props.manageReadReceipts }
+                          ourUserId={ MatrixClientPeg.get().credentials.userId }
+                          stickyBottom={ stickyBottom }
+                          onScroll={ this.onMessageListScroll }
+                          onFillRequest={ this.onMessageListFillRequest }
+                          onUnfillRequest={ this.onMessageListUnfillRequest }
+                          opacity={ this.props.opacity }
+                          isTwelveHour={ this.state.isTwelveHour }
+                          alwaysShowTimestamps={ this.state.alwaysShowTimestamps }
+                          className={ this.props.className }
+                          tileShape={ this.props.tileShape }
             />
         );
     },

src/components/structures/UploadBar.js

@@ -18,6 +18,7 @@ var React = require('react');
 var ContentMessages = require('../../ContentMessages');
 var dis = require('../../dispatcher');
 var filesize = require('filesize');
+import { _t } from '../../languageHandler';
 
 module.exports = React.createClass({displayName: 'UploadBar',
     propTypes: {
@@ -81,10 +82,8 @@ module.exports = React.createClass({displayName: 'UploadBar',
             uploadedSize = uploadedSize.replace(/ .*/, '');
         }
 
-        var others;
-        if (uploads.length > 1) {
-            others = ' and ' + (uploads.length - 1) + ' other' + (uploads.length > 2 ? 's' : '');
-        }
+        // MUST use var name 'count' for pluralization to kick in
+        var uploadText = _t("Uploading %(filename)s and %(count)s others", {filename: upload.fileName, count: (uploads.length - 1)});
 
         return (
             <div className="mx_UploadBar">
@@ -98,7 +97,7 @@ module.exports = React.createClass({displayName: 'UploadBar',
                 <div className="mx_UploadBar_uploadBytes">
                     { uploadedSize } / { totalSize }
                 </div>
-                <div className="mx_UploadBar_uploadFilename">Uploading {upload.fileName}{others}</div>
+                <div className="mx_UploadBar_uploadFilename">{uploadText}</div>
             </div>
         );
     }

src/components/structures/login/ForgotPassword.js

@@ -17,6 +17,7 @@ limitations under the License.
 'use strict';
 
 var React = require('react');
+import { _t } from '../../../languageHandler';
 var sdk = require('../../../index');
 var Modal = require("../../../Modal");
 var MatrixClientPeg = require('../../../MatrixClientPeg');
@@ -54,7 +55,7 @@ module.exports = React.createClass({
                 progress: "sent_email"
             });
         }, (err) => {
-            this.showErrorDialog("Failed to send email: " + err.message);
+            this.showErrorDialog(_t('Failed to send email') + ": " + err.message);
             this.setState({
                 progress: null
             });
@@ -78,30 +79,33 @@ module.exports = React.createClass({
         ev.preventDefault();
 
         if (!this.state.email) {
-            this.showErrorDialog("The email address linked to your account must be entered.");
+            this.showErrorDialog(_t('The email address linked to your account must be entered.'));
         }
         else if (!this.state.password || !this.state.password2) {
-            this.showErrorDialog("A new password must be entered.");
+            this.showErrorDialog(_t('A new password must be entered.'));
         }
         else if (this.state.password !== this.state.password2) {
-            this.showErrorDialog("New passwords must match each other.");
+            this.showErrorDialog(_t('New passwords must match each other.'));
         }
         else {
             var QuestionDialog = sdk.getComponent("dialogs.QuestionDialog");
             Modal.createDialog(QuestionDialog, {
-                title: "Warning",
+                title: _t('Warning!'),
                 description:
                     <div>
-                        Resetting password will currently reset any end-to-end encryption keys on all devices,
-                        making encrypted chat history unreadable, unless you first export your room keys
-                        and re-import them afterwards.
-                        In future this <a href="https://github.com/vector-im/riot-web/issues/2671">will be improved</a>.
+                        { _t(
+                            'Resetting password will currently reset any ' +
+                            'end-to-end encryption keys on all devices, ' +
+                            'making encrypted chat history unreadable, ' + 
+                            'unless you first export your room keys and re-import ' +
+                            'them afterwards. In future this will be improved.'
+                        ) }
                     </div>,
-                button: "Continue",
+                button: _t('Continue'),
                 extraButtons: [
                     <button className="mx_Dialog_primary"
                             onClick={this._onExportE2eKeysClicked}>
-                        Export E2E room keys
+                        { _t('Export E2E room keys') }
                     </button>
                 ],
                 onFinished: (confirmed) => {
@@ -150,7 +154,7 @@ module.exports = React.createClass({
         var ErrorDialog = sdk.getComponent("dialogs.ErrorDialog");
         Modal.createDialog(ErrorDialog, {
             title: title,
-            description: body
+            description: body,
         });
     },
 
@@ -168,22 +172,20 @@ module.exports = React.createClass({
         else if (this.state.progress === "sent_email") {
             resetPasswordJsx = (
                 <div>
-                    An email has been sent to {this.state.email}. Once you&#39;ve followed
-                    the link it contains, click below.
+                    { _t('An email has been sent to') } {this.state.email}. { _t('Once you&#39;ve followed the link it contains, click below') }.
                     <br />
                     <input className="mx_Login_submit" type="button" onClick={this.onVerify}
-                        value="I have verified my email address" />
+                        value={ _t('I have verified my email address') } />
                 </div>
             );
         }
         else if (this.state.progress === "complete") {
             resetPasswordJsx = (
                 <div>
-                    <p>Your password has been reset.</p>
-                    <p>You have been logged out of all devices and will no longer receive push notifications.
-                    To re-enable notifications, sign in again on each device.</p>
+                    <p>{ _t('Your password has been reset') }.</p>
+                    <p>{ _t('You have been logged out of all devices and will no longer receive push notifications. To re-enable notifications, sign in again on each device') }.</p>
                     <input className="mx_Login_submit" type="button" onClick={this.props.onComplete}
-                        value="Return to login screen" />
+                        value={ _t('Return to login screen') } />
                 </div>
             );
         }
@@ -191,7 +193,7 @@ module.exports = React.createClass({
             resetPasswordJsx = (
             <div>
                 <div className="mx_Login_prompt">
-                    To reset your password, enter the email address linked to your account:
+                    { _t('To reset your password, enter the email address linked to your account') }:
                 </div>
                 <div>
                     <form onSubmit={this.onSubmitForm}>
@@ -199,21 +201,21 @@ module.exports = React.createClass({
                             name="reset_email" // define a name so browser's password autofill gets less confused
                             value={this.state.email}
                             onChange={this.onInputChanged.bind(this, "email")}
-                            placeholder="Email address" autoFocus />
+                            placeholder={ _t('Email address') } autoFocus />
                         <br />
                         <input className="mx_Login_field" ref="pass" type="password"
                             name="reset_password"
                             value={this.state.password}
                             onChange={this.onInputChanged.bind(this, "password")}
-                            placeholder="New password" />
+                            placeholder={ _t('New password') } />
                         <br />
                         <input className="mx_Login_field" ref="pass" type="password"
                             name="reset_password_confirm"
                             value={this.state.password2}
                             onChange={this.onInputChanged.bind(this, "password2")}
-                            placeholder="Confirm your new password" />
+                            placeholder={ _t('Confirm your new password') } />
                         <br />
-                        <input className="mx_Login_submit" type="submit" value="Send Reset Email" />
+                        <input className="mx_Login_submit" type="submit" value={ _t('Send Reset Email') } />
                     </form>
                     <ServerConfig ref="serverConfig"
                         withToggleButton={true}
@@ -227,10 +229,10 @@ module.exports = React.createClass({
                     <div className="mx_Login_error">
                     </div>
                     <a className="mx_Login_create" onClick={this.props.onLoginClick} href="#">
-                        Return to login
+                        {_t('Return to login screen')}
                     </a>
                     <a className="mx_Login_create" onClick={this.props.onRegisterClick} href="#">
-                        Create a new account
+                        { _t('Create an account') }
                     </a>
                     <LoginFooter />
                 </div>

src/components/structures/login/Login.js

@@ -18,8 +18,7 @@ limitations under the License.
 'use strict';
 
 import React from 'react';
-import ReactDOM from 'react-dom';
-import url from 'url';
+import { _t, _tJsx } from '../../../languageHandler';
 import sdk from '../../../index';
 import Login from '../../../Login';
 
@@ -88,7 +87,27 @@ module.exports = React.createClass({
         ).then((data) => {
             this.props.onLoggedIn(data);
         }, (error) => {
-            this._setStateFromError(error, true);
+            let errorText;
+
+            // Some error strings only apply for logging in
+            const usingEmail = username.indexOf("@") > 0;
+            if (error.httpStatus == 400 && usingEmail) {
+                errorText = _t('This Home Server does not support login using email address.');
+            } else if (error.httpStatus === 401 || error.httpStatus === 403) {
+                errorText = _t('Incorrect username and/or password.');
+            } else {
+                // other errors, not specific to doing a password login
+                errorText = this._errorTextFromError(error);
+            }
+
+            this.setState({
+                errorText: errorText,
+                // 401 would be the sensible status code for 'incorrect password'
+                // but the login API gives a 403 https://matrix.org/jira/browse/SYN-744
+                // mentions this (although the bug is for UI auth which is not this)
+                // We treat both as an incorrect password
+                loginIncorrect: error.httpStatus === 401 || error.httpStatus == 403,
+            });
         }).finally(() => {
             this.setState({
                 busy: false
@@ -111,7 +130,16 @@ module.exports = React.createClass({
         this._loginLogic.loginAsGuest().then(function(data) {
             self.props.onLoggedIn(data);
         }, function(error) {
-            self._setStateFromError(error, true);
+            let errorText;
+            if (error.httpStatus === 403) {
+                errorText = _t("Guest access is disabled on this Home Server.");
+            } else {
+                errorText = self._errorTextFromError(error);
+            }
+            self.setState({
+                errorText: errorText,
+                loginIncorrect: false,
+            });
         }).finally(function() {
             self.setState({
                 busy: false
@@ -130,7 +158,7 @@ module.exports = React.createClass({
     onPhoneNumberChanged: function(phoneNumber) {
         // Validate the phone number entered
         if (!PHONE_NUMBER_REGEX.test(phoneNumber)) {
-            this.setState({ errorText: 'The phone number entered looks invalid' });
+            this.setState({ errorText: _t('The phone number entered looks invalid') });
             return;
         }
 
@@ -184,53 +212,48 @@ module.exports = React.createClass({
                 currentFlow: self._getCurrentFlowStep(),
             });
         }, function(err) {
-            self._setStateFromError(err, false);
+            self.setState({
+                errorText: self._errorTextFromError(err),
+                loginIncorrect: false,
+            });
         }).finally(function() {
             self.setState({
                 busy: false,
             });
-        });
+        }).done();
     },
 
     _getCurrentFlowStep: function() {
         return this._loginLogic ? this._loginLogic.getCurrentFlowStep() : null;
     },
 
-    _setStateFromError: function(err, isLoginAttempt) {
-        this.setState({
-            errorText: this._errorTextFromError(err),
-            // https://matrix.org/jira/browse/SYN-744
-            loginIncorrect: isLoginAttempt && (err.httpStatus == 401 || err.httpStatus == 403)
-        });
-    },
-
     _errorTextFromError(err) {
-        if (err.friendlyText) {
-            return err.friendlyText;
-        }
-
         let errCode = err.errcode;
         if (!errCode && err.httpStatus) {
             errCode = "HTTP " + err.httpStatus;
         }
 
-        let errorText = "Error: Problem communicating with the given homeserver " +
-                (errCode ? "(" + errCode + ")" : "");
+        let errorText = _t("Error: Problem communicating with the given homeserver.") +
+                (errCode ? " (" + errCode + ")" : "");
 
         if (err.cors === 'rejected') {
             if (window.location.protocol === 'https:' &&
                 (this.state.enteredHomeserverUrl.startsWith("http:") ||
-                 !this.state.enteredHomeserverUrl.startsWith("http")))
-            {
+                 !this.state.enteredHomeserverUrl.startsWith("http"))
+            ) {
                 errorText = <span>
-                    Can't connect to homeserver via HTTP when an HTTPS URL is in your browser bar.
-                    Either use HTTPS or <a href='https://www.google.com/search?&q=enable%20unsafe%20scripts'>enable unsafe scripts</a>
+                    { _tJsx("Can't connect to homeserver via HTTP when an HTTPS URL is in your browser bar. " +
+                            "Either use HTTPS or <a>enable unsafe scripts</a>.",
+                      /<a>(.*?)<\/a>/,
+                      (sub) => { return <a href="https://www.google.com/search?&q=enable%20unsafe%20scripts">{ sub }</a>; }
+                    )}
                 </span>;
-            }
-            else {
+            } else {
                 errorText = <span>
-                    Can't connect to homeserver - please check your connectivity and ensure
-                    your <a href={ this.state.enteredHomeserverUrl }>homeserver's SSL certificate</a> is trusted.
+                    { _tJsx("Can't connect to homeserver - please check your connectivity, ensure your <a>homeserver's SSL certificate</a> is trusted, and that a browser extension is not blocking requests.",
+                      /<a>(.*?)<\/a>/,
+                      (sub) => { return <a href={this.state.enteredHomeserverUrl}>{ sub }</a>; }
+                    )}
                 </span>;
             }
         }
@@ -242,12 +265,6 @@ module.exports = React.createClass({
         switch (step) {
             case 'm.login.password':
                 const PasswordLogin = sdk.getComponent('login.PasswordLogin');
-                // HSs that are not matrix.org may not be configured to have their
-                // domain name === domain part.
-                let hsDomain = url.parse(this.state.enteredHomeserverUrl).hostname;
-                if (hsDomain !== 'matrix.org') {
-                    hsDomain = null;
-                }
                 return (
                     <PasswordLogin
                         onSubmit={this.onPasswordLogin}
@@ -259,7 +276,6 @@ module.exports = React.createClass({
                         onPhoneNumberChanged={this.onPhoneNumberChanged}
                         onForgotPasswordClick={this.props.onForgotPasswordClick}
                         loginIncorrect={this.state.loginIncorrect}
-                        hsDomain={hsDomain}
                     />
                 );
             case 'm.login.cas':
@@ -273,8 +289,7 @@ module.exports = React.createClass({
                 }
                 return (
                     <div>
-                    Sorry, this homeserver is using a login which is not
-                    recognised ({step})
+                    { _t('Sorry, this homeserver is using a login which is not recognised ')}({step})
                     </div>
                 );
         }
@@ -291,7 +306,7 @@ module.exports = React.createClass({
         if (this.props.enableGuest) {
             loginAsGuestJsx =
                 <a className="mx_Login_create" onClick={this._onLoginAsGuestClick} href="#">
-                    Login as guest
+                    { _t('Login as guest')}
                 </a>;
         }
 
@@ -299,7 +314,7 @@ module.exports = React.createClass({
         if (this.props.onCancelClick) {
             returnToAppJsx =
                 <a className="mx_Login_create" onClick={this.props.onCancelClick} href="#">
-                    Return to app
+                    { _t('Return to app')}
                 </a>;
         }
 
@@ -308,7 +323,7 @@ module.exports = React.createClass({
                 <div className="mx_Login_box">
                     <LoginHeader />
                     <div>
-                        <h2>Sign in
+                        <h2>{ _t('Sign in')}
                             { loader }
                         </h2>
                         { this.componentForStep(this.state.currentFlow) }
@@ -324,7 +339,7 @@ module.exports = React.createClass({
                                 { this.state.errorText }
                         </div>
                         <a className="mx_Login_create" onClick={this.props.onRegisterClick} href="#">
-                            Create a new account
+                            { _t('Create an account')}
                         </a>
                         { loginAsGuestJsx }
                         { returnToAppJsx }

src/components/structures/login/PostRegistration.js

@@ -16,9 +16,10 @@ limitations under the License.
 
 'use strict';
 
-var React = require('react');
-var sdk = require('../../../index');
-var MatrixClientPeg = require('../../../MatrixClientPeg');
+import React from 'react';
+import sdk from '../../../index';
+import MatrixClientPeg from '../../../MatrixClientPeg';
+import { _t } from '../../../languageHandler';
 
 module.exports = React.createClass({
     displayName: 'PostRegistration',
@@ -49,7 +50,7 @@ module.exports = React.createClass({
             });
         }, function(error) {
             self.setState({
-                errorString: "Failed to fetch avatar URL",
+                errorString: _t("Failed to fetch avatar URL"),
                 busy: false
             });
         });
@@ -64,12 +65,12 @@ module.exports = React.createClass({
                 <div className="mx_Login_box">
                     <LoginHeader />
                     <div className="mx_Login_profile">
-                        Set a display name:
+                        { _t('Set a display name:') }
                         <ChangeDisplayName />
-                        Upload an avatar:
+                        { _t('Upload an avatar:') }
                         <ChangeAvatar
                             initialAvatarUrl={this.state.avatarUrl} />
-                        <button onClick={this.props.onComplete}>Continue</button>
+                        <button onClick={this.props.onComplete}>{ _t('Continue') }</button>
                         {this.state.errorString}
                     </div>
                 </div>

src/components/structures/login/Registration.js

@@ -21,12 +21,11 @@ import q from 'q';
 import React from 'react';
 
 import sdk from '../../../index';
-import dis from '../../../dispatcher';
 import ServerConfig from '../../views/login/ServerConfig';
 import MatrixClientPeg from '../../../MatrixClientPeg';
 import RegistrationForm from '../../views/login/RegistrationForm';
-import CaptchaForm from '../../views/login/CaptchaForm';
 import RtsClient from '../../../RtsClient';
+import { _t } from '../../../languageHandler';
 
 const MIN_PASSWORD_LENGTH = 6;
 
@@ -46,8 +45,6 @@ module.exports = React.createClass({
         brand: React.PropTypes.string,
         email: React.PropTypes.string,
         referrer: React.PropTypes.string,
-        username: React.PropTypes.string,
-        guestAccessToken: React.PropTypes.string,
         teamServerConfig: React.PropTypes.shape({
             // Email address to request new teams
             supportEmail: React.PropTypes.string.isRequired,
@@ -98,7 +95,7 @@ module.exports = React.createClass({
             this.props.teamServerConfig.teamServerURL &&
             !this._rtsClient
         ) {
-            this._rtsClient = new RtsClient(this.props.teamServerConfig.teamServerURL);
+            this._rtsClient = this.props.rtsClient || new RtsClient(this.props.teamServerConfig.teamServerURL);
 
             this.setState({
                 teamServerBusy: true,
@@ -162,7 +159,7 @@ module.exports = React.createClass({
                     msisdn_available |= flow.stages.indexOf('m.login.msisdn') > -1;
                 }
                 if (!msisdn_available) {
-                    msg = "This server does not support authentication with a phone number";
+                    msg = _t('This server does not support authentication with a phone number.');
                 }
             }
             this.setState({
@@ -221,30 +218,29 @@ module.exports = React.createClass({
         }
 
         trackPromise.then((teamToken) => {
-            console.info('Team token promise',teamToken);
-            this.props.onLoggedIn({
+            return this.props.onLoggedIn({
                 userId: response.user_id,
                 deviceId: response.device_id,
                 homeserverUrl: this._matrixClient.getHomeserverUrl(),
                 identityServerUrl: this._matrixClient.getIdentityServerUrl(),
                 accessToken: response.access_token
             }, teamToken);
-        }).then(() => {
-            return this._setupPushers();
+        }).then((cli) => {
+            return this._setupPushers(cli);
         });
     },
 
-    _setupPushers: function() {
+    _setupPushers: function(matrixClient) {
         if (!this.props.brand) {
             return q();
         }
-        return MatrixClientPeg.get().getPushers().then((resp)=>{
+        return matrixClient.getPushers().then((resp)=>{
             const pushers = resp.pushers;
             for (let i = 0; i < pushers.length; ++i) {
                 if (pushers[i].kind == 'email') {
                     const emailPusher = pushers[i];
                     emailPusher.data = { brand: this.props.brand };
-                    MatrixClientPeg.get().setPusher(emailPusher).done(() => {
+                    matrixClient.setPusher(emailPusher).done(() => {
                         console.log("Set email branding to " + this.props.brand);
                     }, (error) => {
                         console.error("Couldn't set email branding: " + error);
@@ -260,29 +256,29 @@ module.exports = React.createClass({
         var errMsg;
         switch (errCode) {
             case "RegistrationForm.ERR_PASSWORD_MISSING":
-                errMsg = "Missing password.";
+                errMsg = _t('Missing password.');
                 break;
             case "RegistrationForm.ERR_PASSWORD_MISMATCH":
-                errMsg = "Passwords don't match.";
+                errMsg = _t('Passwords don\'t match.');
                 break;
             case "RegistrationForm.ERR_PASSWORD_LENGTH":
-                errMsg = `Password too short (min ${MIN_PASSWORD_LENGTH}).`;
+                errMsg = _t('Password too short (min %(MIN_PASSWORD_LENGTH)s).', {MIN_PASSWORD_LENGTH: MIN_PASSWORD_LENGTH});
                 break;
             case "RegistrationForm.ERR_EMAIL_INVALID":
-                errMsg = "This doesn't look like a valid email address";
+                errMsg = _t('This doesn\'t look like a valid email address.');
                 break;
             case "RegistrationForm.ERR_PHONE_NUMBER_INVALID":
-                errMsg = "This doesn't look like a valid phone number";
+                errMsg = _t('This doesn\'t look like a valid phone number.');
                 break;
             case "RegistrationForm.ERR_USERNAME_INVALID":
-                errMsg = "User names may only contain letters, numbers, dots, hyphens and underscores.";
+                errMsg = _t('User names may only contain letters, numbers, dots, hyphens and underscores.');
                 break;
             case "RegistrationForm.ERR_USERNAME_BLANK":
-                errMsg = "You need to enter a user name";
+                errMsg = _t('You need to enter a user name.');
                 break;
             default:
                 console.error("Unknown error code: %s", errCode);
-                errMsg = "An unknown error occurred.";
+                errMsg = _t('An unknown error occurred.');
                 break;
         }
         this.setState({
@@ -297,17 +293,6 @@ module.exports = React.createClass({
     },
 
     _makeRegisterRequest: function(auth) {
-        let guestAccessToken = this.props.guestAccessToken;
-
-        if (
-            this.state.formVals.username !== this.props.username ||
-            this.state.hsUrl != this.props.defaultHsUrl
-        ) {
-            // don't try to upgrade if we changed our username
-            // or are registering on a different HS
-            guestAccessToken = null;
-        }
-
         // Only send the bind params if we're sending username / pw params
         // (Since we need to send no params at all to use the ones saved in the
         // session).
@@ -322,7 +307,7 @@ module.exports = React.createClass({
             undefined, // session id: included in the auth dict already
             auth,
             bindThreepids,
-            guestAccessToken,
+            null,
         );
     },
 
@@ -359,10 +344,6 @@ module.exports = React.createClass({
         } else if (this.state.busy || this.state.teamServerBusy) {
             registerBody = <Spinner />;
         } else {
-            let guestUsername = this.props.username;
-            if (this.state.hsUrl != this.props.defaultHsUrl) {
-                guestUsername = null;
-            }
             let errorSection;
             if (this.state.errorText) {
                 errorSection = <div className="mx_Login_error">{this.state.errorText}</div>;
@@ -376,7 +357,6 @@ module.exports = React.createClass({
                         defaultPhoneNumber={this.state.formVals.phoneNumber}
                         defaultPassword={this.state.formVals.password}
                         teamsConfig={this.state.teamsConfig}
-                        guestUsername={guestUsername}
                         minPasswordLength={MIN_PASSWORD_LENGTH}
                         onError={this.onFormValidationFailed}
                         onRegisterClick={this.onFormSubmit}
@@ -400,7 +380,7 @@ module.exports = React.createClass({
         if (this.props.onCancelClick) {
             returnToAppJsx = (
                 <a className="mx_Login_create" onClick={this.props.onCancelClick} href="#">
-                    Return to app
+                    {_t('Return to app')}
                 </a>
             );
         }
@@ -413,10 +393,10 @@ module.exports = React.createClass({
                             this.state.teamSelected.domain + "/icon.png" :
                             null}
                     />
-                    <h2>Create an account</h2>
+                    <h2>{_t('Create an account')}</h2>
                     {registerBody}
                     <a className="mx_Login_create" onClick={this.props.onLoginClick} href="#">
-                        I already have an account
+                        {_t('I already have an account')}
                     </a>
                     {returnToAppJsx}
                     <LoginFooter />

src/components/views/avatars/BaseAvatar.js

@@ -32,6 +32,7 @@ module.exports = React.createClass({
         urls: React.PropTypes.array, // [highest_priority, ... , lowest_priority]
         width: React.PropTypes.number,
         height: React.PropTypes.number,
+        // XXX resizeMethod not actually used.
         resizeMethod: React.PropTypes.string,
         defaultToInitialLetter: React.PropTypes.bool // true to add default url
     },

src/components/views/create_room/CreateRoomButton.js

@@ -16,8 +16,8 @@ limitations under the License.
 
 'use strict';
 
-var React = require('react');
-
+import React from 'react';
+import { _t } from '../../../languageHandler';
 module.exports = React.createClass({
     displayName: 'CreateRoomButton',
     propTypes: {
@@ -36,7 +36,7 @@ module.exports = React.createClass({
 
     render: function() {
         return (
-            <button className="mx_CreateRoomButton" onClick={this.onClick}>Create Room</button>
+            <button className="mx_CreateRoomButton" onClick={this.onClick}>{_t("Create Room")}</button>
         );
     }
 });

src/components/views/create_room/Presets.js

@@ -17,6 +17,7 @@ limitations under the License.
 'use strict';
 
 var React = require('react');
+import { _t } from '../../../languageHandler';
 
 var Presets = {
     PrivateChat: "private_chat",
@@ -46,9 +47,9 @@ module.exports = React.createClass({
     render: function() {
         return (
             <select className="mx_Presets" onChange={this.onValueChanged} value={this.props.preset}>
-                <option value={this.Presets.PrivateChat}>Private Chat</option>
-                <option value={this.Presets.PublicChat}>Public Chat</option>
-                <option value={this.Presets.Custom}>Custom</option>
+                <option value={this.Presets.PrivateChat}>{_t("Private Chat")}</option>
+                <option value={this.Presets.PublicChat}>{_t("Public Chat")}</option>
+                <option value={this.Presets.Custom}>{_t("Custom")}</option>
             </select>
         );
     }

src/components/views/create_room/RoomAlias.js

@@ -15,6 +15,7 @@ limitations under the License.
 */
 
 var React = require('react');
+import { _t } from '../../../languageHandler';
 
 module.exports = React.createClass({
     displayName: 'RoomAlias',
@@ -94,7 +95,7 @@ module.exports = React.createClass({
 
     render: function() {
         return (
-            <input type="text" className="mx_RoomAlias" placeholder="Alias (optional)"
+            <input type="text" className="mx_RoomAlias" placeholder={_t("Alias (optional)")}
                 onChange={this.onValueChanged} onFocus={this.onFocus} onBlur={this.onBlur}
                 value={this.props.alias}/>
         );

src/components/views/dialogs/BaseDialog.js

@@ -47,19 +47,7 @@ export default React.createClass({
         children: React.PropTypes.node,
     },
 
-    componentWillMount: function() {
-        this.priorActiveElement = document.activeElement;
-    },
-
-    componentWillUnmount: function() {
-        if (this.priorActiveElement !== null) {
-            this.priorActiveElement.focus();
-        }
-    },
-
-    // Must be when the key is released (and not pressed) otherwise componentWillUnmount
-    // will focus another element which will receive future key events
-    _onKeyUp: function(e) {
+    _onKeyDown: function(e) {
         if (e.keyCode === KeyCode.ESCAPE) {
             e.stopPropagation();
             e.preventDefault();
@@ -81,7 +69,7 @@ export default React.createClass({
         const TintableSvg = sdk.getComponent("elements.TintableSvg");
 
         return (
-            <div onKeyUp={this._onKeyUp} className={this.props.className}>
+            <div onKeyDown={this._onKeyDown} className={this.props.className}>
                 <AccessibleButton onClick={this._onCancelClick}
                     className="mx_Dialog_cancelButton"
                 >

src/components/views/dialogs/ChatCreateOrReuseDialog.js

@@ -16,36 +16,30 @@ limitations under the License.
 
 import React from 'react';
 import sdk from '../../../index';
-import dis from '../../../dispatcher';
+import { _t } from '../../../languageHandler';
 import MatrixClientPeg from '../../../MatrixClientPeg';
 import DMRoomMap from '../../../utils/DMRoomMap';
 import AccessibleButton from '../elements/AccessibleButton';
 import Unread from '../../../Unread';
 import classNames from 'classnames';
-import createRoom from '../../../createRoom';
 
 export default class ChatCreateOrReuseDialog extends React.Component {
 
     constructor(props) {
         super(props);
-        this.onNewDMClick = this.onNewDMClick.bind(this);
         this.onRoomTileClick = this.onRoomTileClick.bind(this);
+
+        this.state = {
+            tiles: [],
+            profile: {
+                displayName: null,
+                avatarUrl: null,
+            },
+            profileError: null,
+        };
     }
 
-    onNewDMClick() {
-        createRoom({dmUserId: this.props.userId});
-        this.props.onFinished(true);
-    }
-
-    onRoomTileClick(roomId) {
-        dis.dispatch({
-            action: 'view_room',
-            room_id: roomId,
-        });
-        this.props.onFinished(true);
-    }
-
-    render() {
+    componentWillMount() {
         const client = MatrixClientPeg.get();
 
         const dmRoomMap = new DMRoomMap(client);
@@ -70,40 +64,123 @@ export default class ChatCreateOrReuseDialog extends React.Component {
                         highlight={highlight}
                         isInvite={me.membership == "invite"}
                         onClick={this.onRoomTileClick}
-                    />
+                    />,
                 );
             }
         }
 
-        const labelClasses = classNames({
-            mx_MemberInfo_createRoom_label: true,
-            mx_RoomTile_name: true,
+        this.setState({
+            tiles: tiles,
         });
-        const startNewChat = <AccessibleButton
-            className="mx_MemberInfo_createRoom"
-            onClick={this.onNewDMClick}
-        >
-            <div className="mx_RoomTile_avatar">
-                <img src="img/create-big.svg" width="26" height="26" />
-            </div>
-            <div className={labelClasses}><i>Start new chat</i></div>
-        </AccessibleButton>;
+
+        if (tiles.length === 0) {
+            this.setState({
+                busyProfile: true,
+            });
+            MatrixClientPeg.get().getProfileInfo(this.props.userId).done((resp) => {
+                const profile = {
+                    displayName: resp.displayname,
+                    avatarUrl: null,
+                };
+                if (resp.avatar_url) {
+                    profile.avatarUrl = MatrixClientPeg.get().mxcUrlToHttp(
+                        resp.avatar_url, 48, 48, "crop",
+                    );
+                }
+                this.setState({
+                    busyProfile: false,
+                    profile: profile,
+                });
+            }, (err) => {
+                console.error(
+                    'Unable to get profile for user ' + this.props.userId + ':',
+                    err,
+                );
+                this.setState({
+                    busyProfile: false,
+                    profileError: err,
+                });
+            });
+        }
+    }
+
+    onRoomTileClick(roomId) {
+        this.props.onExistingRoomSelected(roomId);
+    }
+
+    render() {
+        let title = '';
+        let content = null;
+        if (this.state.tiles.length > 0) {
+            // Show the existing rooms with a "+" to add a new dm
+            title = _t('Create a new chat or reuse an existing one');
+            const labelClasses = classNames({
+                mx_MemberInfo_createRoom_label: true,
+                mx_RoomTile_name: true,
+            });
+            const startNewChat = <AccessibleButton
+                className="mx_MemberInfo_createRoom"
+                onClick={this.props.onNewDMClick}
+            >
+                <div className="mx_RoomTile_avatar">
+                    <img src="img/create-big.svg" width="26" height="26" />
+                </div>
+                <div className={labelClasses}><i>{ _t("Start new chat") }</i></div>
+            </AccessibleButton>;
+            content = <div className="mx_Dialog_content">
+                { _t('You already have existing direct chats with this user:') }
+                <div className="mx_ChatCreateOrReuseDialog_tiles">
+                    { this.state.tiles }
+                    { startNewChat }
+                </div>
+            </div>;
+        } else {
+            // Show the avatar, name and a button to confirm that a new chat is requested
+            const BaseAvatar = sdk.getComponent('avatars.BaseAvatar');
+            const Spinner = sdk.getComponent('elements.Spinner');
+            title = _t('Start chatting');
+
+            let profile = null;
+            if (this.state.busyProfile) {
+                profile = <Spinner />;
+            } else if (this.state.profileError) {
+                profile = <div className="error">
+                    Unable to load profile information for { this.props.userId }
+                </div>;
+            } else {
+                profile = <div className="mx_ChatCreateOrReuseDialog_profile">
+                    <BaseAvatar
+                        name={this.state.profile.displayName || this.props.userId}
+                        url={this.state.profile.avatarUrl}
+                        width={48} height={48}
+                    />
+                    <div className="mx_ChatCreateOrReuseDialog_profile_name">
+                        {this.state.profile.displayName || this.props.userId}
+                    </div>
+                </div>;
+            }
+            content = <div>
+                <div className="mx_Dialog_content">
+                    <p>
+                        { _t('Click on the button below to start chatting!') }
+                    </p>
+                    { profile }
+                </div>
+                <div className="mx_Dialog_buttons">
+                    <button className="mx_Dialog_primary" onClick={this.props.onNewDMClick}>
+                        { _t('Start Chatting') }
+                    </button>
+                </div>
+            </div>;
+        }
 
         const BaseDialog = sdk.getComponent('views.dialogs.BaseDialog');
         return (
             <BaseDialog className='mx_ChatCreateOrReuseDialog'
-                onFinished={() => {
-                    this.props.onFinished(false)
-                }}
-                title='Create a new chat or reuse an existing one'
+                onFinished={ this.props.onFinished.bind(false) }
+                title={title}
             >
-                <div className="mx_Dialog_content">
-                    You already have existing direct chats with this user:
-                    <div className="mx_ChatCreateOrReuseDialog_tiles">
-                        {tiles}
-                        {startNewChat}
-                    </div>
-                </div>
+                { content }
             </BaseDialog>
         );
     }
@@ -111,5 +188,8 @@ export default class ChatCreateOrReuseDialog extends React.Component {
 
 ChatCreateOrReuseDialog.propTyps = {
     userId: React.PropTypes.string.isRequired,
+    // Called when clicking outside of the dialog
     onFinished: React.PropTypes.func.isRequired,
+    onNewDMClick: React.PropTypes.func.isRequired,
+    onExistingRoomSelected: React.PropTypes.func.isRequired,
 };

src/components/views/dialogs/ChatInviteDialog.js

@@ -15,25 +15,24 @@ limitations under the License.
 */
 
 import React from 'react';
-import classNames from 'classnames';
+import { _t } from '../../../languageHandler';
 import sdk from '../../../index';
 import { getAddressType, inviteMultipleToRoom } from '../../../Invite';
 import createRoom from '../../../createRoom';
 import MatrixClientPeg from '../../../MatrixClientPeg';
 import DMRoomMap from '../../../utils/DMRoomMap';
-import rate_limited_func from '../../../ratelimitedfunc';
-import dis from '../../../dispatcher';
 import Modal from '../../../Modal';
 import AccessibleButton from '../elements/AccessibleButton';
 import q from 'q';
-import Fuse from 'fuse.js';
+import dis from '../../../dispatcher';
 
 const TRUNCATE_QUERY_LIST = 40;
+const QUERY_USER_DIRECTORY_DEBOUNCE_MS = 200;
 
 module.exports = React.createClass({
     displayName: "ChatInviteDialog",
     propTypes: {
-        title: React.PropTypes.string,
+        title: React.PropTypes.string.isRequired,
         description: React.PropTypes.oneOfType([
             React.PropTypes.element,
             React.PropTypes.string,
@@ -43,17 +42,13 @@ module.exports = React.createClass({
         roomId: React.PropTypes.string,
         button: React.PropTypes.string,
         focus: React.PropTypes.bool,
-        onFinished: React.PropTypes.func.isRequired
+        onFinished: React.PropTypes.func.isRequired,
     },
 
     getDefaultProps: function() {
         return {
-            title: "Start a chat",
-            description: "Who would you like to communicate with?",
             value: "",
-            placeholder: "Email, name or matrix ID",
-            button: "Start Chat",
-            focus: true
+            focus: true,
         };
     },
 
@@ -61,12 +56,20 @@ module.exports = React.createClass({
         return {
             error: false,
 
-            // List of AddressTile.InviteAddressType objects represeting
+            // List of AddressTile.InviteAddressType objects representing
             // the list of addresses we're going to invite
             inviteList: [],
 
-            // List of AddressTile.InviteAddressType objects represeting
-            // the set of autocompletion results for the current search
+            // Whether a search is ongoing
+            busy: false,
+            // An error message generated during the user directory search
+            searchError: null,
+            // Whether the server supports the user_directory API
+            serverSupportsUserDirectory: true,
+            // The query being searched for
+            query: "",
+            // List of AddressTile.InviteAddressType objects representing
+            // the set of auto-completion results for the current search
             // query.
             queryList: [],
         };
@@ -77,20 +80,6 @@ module.exports = React.createClass({
             // Set the cursor at the end of the text input
             this.refs.textinput.value = this.props.value;
         }
-        // Create a Fuse instance for fuzzy searching this._userList
-        this._fuse = new Fuse(
-            // Use an empty list at first that will later be populated
-            // (see this._updateUserList)
-            [],
-            {
-                shouldSort: true,
-                location: 0, // The index of the query in the test string
-                distance: 5, // The distance away from location the query can be
-                // 0.0 = exact match, 1.0 = match anything
-                threshold: 0.3,
-            }
-        );
-        this._updateUserList();
     },
 
     onButtonClick: function() {
@@ -112,17 +101,28 @@ module.exports = React.createClass({
                     // A Direct Message room already exists for this user, so select a
                     // room from a list that is similar to the one in MemberInfo panel
                     const ChatCreateOrReuseDialog = sdk.getComponent(
-                        "views.dialogs.ChatCreateOrReuseDialog"
+                        "views.dialogs.ChatCreateOrReuseDialog",
                     );
-                    Modal.createDialog(ChatCreateOrReuseDialog, {
+                    const close = Modal.createDialog(ChatCreateOrReuseDialog, {
                         userId: userId,
                         onFinished: (success) => {
-                            if (success) {
-                                this.props.onFinished(true, inviteList[0]);
-                            }
-                            // else show this ChatInviteDialog again
-                        }
-                    });
+                            this.props.onFinished(success);
+                        },
+                        onNewDMClick: () => {
+                            dis.dispatch({
+                                action: 'start_chat',
+                                user_id: userId,
+                            });
+                            close(true);
+                        },
+                        onExistingRoomSelected: (roomId) => {
+                            dis.dispatch({
+                                action: 'view_room',
+                                room_id: roomId,
+                            });
+                            close(true);
+                        },
+                    }).close;
                 } else {
                     this._startChat(inviteList);
                 }
@@ -148,15 +148,15 @@ module.exports = React.createClass({
         } else if (e.keyCode === 38) { // up arrow
             e.stopPropagation();
             e.preventDefault();
-            this.addressSelector.moveSelectionUp();
+            if (this.addressSelector) this.addressSelector.moveSelectionUp();
         } else if (e.keyCode === 40) { // down arrow
             e.stopPropagation();
             e.preventDefault();
-            this.addressSelector.moveSelectionDown();
+            if (this.addressSelector) this.addressSelector.moveSelectionDown();
         } else if (this.state.queryList.length > 0 && (e.keyCode === 188 || e.keyCode === 13 || e.keyCode === 9)) { // comma or enter or tab
             e.stopPropagation();
             e.preventDefault();
-            this.addressSelector.chooseSelection();
+            if (this.addressSelector) this.addressSelector.chooseSelection();
         } else if (this.refs.textinput.value.length === 0 && this.state.inviteList.length && e.keyCode === 8) { // backspace
             e.stopPropagation();
             e.preventDefault();
@@ -179,71 +179,36 @@ module.exports = React.createClass({
 
     onQueryChanged: function(ev) {
         const query = ev.target.value;
-        let queryList = [];
-
-        if (query.length < 2) {
-            return;
-        }
-
         if (this.queryChangedDebouncer) {
             clearTimeout(this.queryChangedDebouncer);
         }
-        this.queryChangedDebouncer = setTimeout(() => {
-            // Only do search if there is something to search
-            if (query.length > 0 && query != '@') {
-                // Weighted keys prefer to match userIds when first char is @
-                this._fuse.options.keys = [{
-                    name: 'displayName',
-                    weight: query[0] === '@' ? 0.1 : 0.9,
-                },{
-                    name: 'userId',
-                    weight: query[0] === '@' ? 0.9 : 0.1,
-                }];
-                queryList = this._fuse.search(query).map((user) => {
-                    // Return objects, structure of which is defined
-                    // by InviteAddressType
-                    return {
-                        addressType: 'mx',
-                        address: user.userId,
-                        displayName: user.displayName,
-                        avatarMxc: user.avatarUrl,
-                        isKnown: true,
-                    }
-                });
-
-                // If the query is a valid address, add an entry for that
-                // This is important, otherwise there's no way to invite
-                // a perfectly valid address if there are close matches.
-                const addrType = getAddressType(query);
-                if (addrType !== null) {
-                    queryList.unshift({
-                        addressType: addrType,
-                        address: query,
-                        isKnown: false,
-                    });
-                    if (this._cancelThreepidLookup) this._cancelThreepidLookup();
-                    if (addrType == 'email') {
-                        this._lookupThreepid(addrType, query).done();
-                    }
+        // Only do search if there is something to search
+        if (query.length > 0 && query != '@' && query.length >= 2) {
+            this.queryChangedDebouncer = setTimeout(() => {
+                if (this.state.serverSupportsUserDirectory) {
+                    this._doUserDirectorySearch(query);
+                } else {
+                    this._doLocalSearch(query);
                 }
-            }
+            }, QUERY_USER_DIRECTORY_DEBOUNCE_MS);
+        } else {
             this.setState({
-                queryList: queryList,
-                error: false,
-            }, () => {
-                this.addressSelector.moveSelectionTop();
+                queryList: [],
+                query: "",
+                searchError: null,
             });
-        }, 200);
+        }
     },
 
     onDismissed: function(index) {
         var self = this;
-        return function() {
+        return () => {
             var inviteList = self.state.inviteList.slice();
             inviteList.splice(index, 1);
             self.setState({
                 inviteList: inviteList,
                 queryList: [],
+                query: "",
             });
             if (this._cancelThreepidLookup) this._cancelThreepidLookup();
         };
@@ -262,10 +227,109 @@ module.exports = React.createClass({
         this.setState({
             inviteList: inviteList,
             queryList: [],
+            query: "",
         });
         if (this._cancelThreepidLookup) this._cancelThreepidLookup();
     },
 
+    _doUserDirectorySearch: function(query) {
+        this.setState({
+            busy: true,
+            query,
+            searchError: null,
+        });
+        MatrixClientPeg.get().searchUserDirectory({
+            term: query,
+        }).then((resp) => {
+            // The query might have changed since we sent the request, so ignore
+            // responses for anything other than the latest query.
+            if (this.state.query !== query) {
+                return;
+            }
+            this._processResults(resp.results, query);
+        }).catch((err) => {
+            console.error('Error whilst searching user directory: ', err);
+            this.setState({
+                searchError: err.errcode ? err.message : _t('Something went wrong!'),
+            });
+            if (err.errcode === 'M_UNRECOGNIZED') {
+                this.setState({
+                    serverSupportsUserDirectory: false,
+                });
+                // Do a local search immediately
+                this._doLocalSearch(query);
+            }
+        }).done(() => {
+            this.setState({
+                busy: false,
+            });
+        });
+    },
+
+    _doLocalSearch: function(query) {
+        this.setState({
+            query,
+            searchError: null,
+        });
+        const queryLowercase = query.toLowerCase();
+        const results = [];
+        MatrixClientPeg.get().getUsers().forEach((user) => {
+            if (user.userId.toLowerCase().indexOf(queryLowercase) === -1 &&
+                user.displayName.toLowerCase().indexOf(queryLowercase) === -1
+            ) {
+                return;
+            }
+
+            // Put results in the format of the new API
+            results.push({
+                user_id: user.userId,
+                display_name: user.displayName,
+                avatar_url: user.avatarUrl,
+            });
+        });
+        this._processResults(results, query);
+    },
+
+    _processResults: function(results, query) {
+        const queryList = [];
+        results.forEach((user) => {
+            if (user.user_id === MatrixClientPeg.get().credentials.userId) {
+                return;
+            }
+            // Return objects, structure of which is defined
+            // by InviteAddressType
+            queryList.push({
+                addressType: 'mx',
+                address: user.user_id,
+                displayName: user.display_name,
+                avatarMxc: user.avatar_url,
+                isKnown: true,
+            });
+        });
+
+        // If the query is a valid address, add an entry for that
+        // This is important, otherwise there's no way to invite
+        // a perfectly valid address if there are close matches.
+        const addrType = getAddressType(query);
+        if (addrType !== null) {
+            queryList.unshift({
+                addressType: addrType,
+                address: query,
+                isKnown: false,
+            });
+            if (this._cancelThreepidLookup) this._cancelThreepidLookup();
+            if (addrType == 'email') {
+                this._lookupThreepid(addrType, query).done();
+            }
+        }
+        this.setState({
+            queryList,
+            error: false,
+        }, () => {
+            if (this.addressSelector) this.addressSelector.moveSelectionTop();
+        });
+    },
+
     _getDirectMessageRooms: function(addr) {
         const dmRoomMap = new DMRoomMap(MatrixClientPeg.get());
         const dmRooms = dmRoomMap.getDMRoomsForUserId(addr);
@@ -284,11 +348,7 @@ module.exports = React.createClass({
 
     _startChat: function(addrs) {
         if (MatrixClientPeg.get().isGuest()) {
-            var NeedToRegisterDialog = sdk.getComponent("dialogs.NeedToRegisterDialog");
-            Modal.createDialog(NeedToRegisterDialog, {
-                title: "Please Register",
-                description: "Guest users can't invite users. Please register."
-            });
+            dis.dispatch({action: 'view_set_mxid'});
             return;
         }
 
@@ -308,8 +368,8 @@ module.exports = React.createClass({
                 console.error(err.stack);
                 var ErrorDialog = sdk.getComponent("dialogs.ErrorDialog");
                 Modal.createDialog(ErrorDialog, {
-                    title: "Failed to invite",
-                    description: ((err && err.message) ? err.message : "Operation failed"),
+                    title: _t("Failed to invite"),
+                    description: ((err && err.message) ? err.message : _t("Operation failed")),
                 });
                 return null;
             })
@@ -321,8 +381,8 @@ module.exports = React.createClass({
                 console.error(err.stack);
                 var ErrorDialog = sdk.getComponent("dialogs.ErrorDialog");
                 Modal.createDialog(ErrorDialog, {
-                    title: "Failed to invite user",
-                    description: ((err && err.message) ? err.message : "Operation failed"),
+                    title: _t("Failed to invite user"),
+                    description: ((err && err.message) ? err.message : _t("Operation failed")),
                 });
                 return null;
             })
@@ -342,8 +402,8 @@ module.exports = React.createClass({
                 console.error(err.stack);
                 var ErrorDialog = sdk.getComponent("dialogs.ErrorDialog");
                 Modal.createDialog(ErrorDialog, {
-                    title: "Failed to invite",
-                    description: ((err && err.message) ? err.message : "Operation failed"),
+                    title: _t("Failed to invite"),
+                    description: ((err && err.message) ? err.message : _t("Operation failed")),
                 });
                 return null;
             })
@@ -354,18 +414,6 @@ module.exports = React.createClass({
         this.props.onFinished(true, addrTexts);
     },
 
-    _updateUserList: new rate_limited_func(function() {
-        // Get all the users
-        this._userList = MatrixClientPeg.get().getUsers();
-        // Remove current user
-        const meIx = this._userList.findIndex((u) => {
-            return u.userId === MatrixClientPeg.get().credentials.userId;
-        });
-        this._userList.splice(meIx, 1);
-
-        this._fuse.set(this._userList);
-    }, 500),
-
     _isOnInviteList: function(uid) {
         for (let i = 0; i < this.state.inviteList.length; i++) {
             if (
@@ -401,7 +449,7 @@ module.exports = React.createClass({
         if (errorList.length > 0) {
             var ErrorDialog = sdk.getComponent("dialogs.ErrorDialog");
             Modal.createDialog(ErrorDialog, {
-                title: "Failed to invite the following users to the " + room.name + " room:",
+                title: _t("Failed to invite the following users to the %(roomName)s room:", {roomName: room.name}),
                 description: errorList.join(", "),
             });
         }
@@ -433,6 +481,7 @@ module.exports = React.createClass({
         this.setState({
             inviteList: inviteList,
             queryList: [],
+            query: "",
         });
         if (this._cancelThreepidLookup) this._cancelThreepidLookup();
         return inviteList;
@@ -468,7 +517,7 @@ module.exports = React.createClass({
                     displayName: res.displayname,
                     avatarMxc: res.avatar_url,
                     isKnown: true,
-                }]
+                }],
             });
         });
     },
@@ -500,23 +549,27 @@ module.exports = React.createClass({
                 placeholder={this.props.placeholder}
                 defaultValue={this.props.value}
                 autoFocus={this.props.focus}>
-            </textarea>
+            </textarea>,
         );
 
-        var error;
-        var addressSelector;
+        let error;
+        let addressSelector;
         if (this.state.error) {
-            error = <div className="mx_ChatInviteDialog_error">You have entered an invalid contact. Try using their Matrix ID or email address.</div>;
+            error = <div className="mx_ChatInviteDialog_error">{_t("You have entered an invalid contact. Try using their Matrix ID or email address.")}</div>;
+        } else if (this.state.searchError) {
+            error = <div className="mx_ChatInviteDialog_error">{this.state.searchError}</div>;
+        } else if (
+            this.state.query.length > 0 &&
+            this.state.queryList.length === 0 &&
+            !this.state.busy
+        ) {
+            error = <div className="mx_ChatInviteDialog_error">{_t("No results")}</div>;
         } else {
-            const addressSelectorHeader = <div className="mx_ChatInviteDialog_addressSelectHeader">
-                Searching known users
-            </div>;
             addressSelector = (
                 <AddressSelector ref={(ref) => {this.addressSelector = ref;}}
                     addressList={ this.state.queryList }
                     onSelected={ this.onSelected }
                     truncateAt={ TRUNCATE_QUERY_LIST }
-                    header={ addressSelectorHeader }
                 />
             );
         }

src/components/views/dialogs/ConfirmRedactDialog.js

@@ -17,6 +17,7 @@ limitations under the License.
 import React from 'react';
 import sdk from '../../../index';
 import classnames from 'classnames';
+import { _t } from '../../../languageHandler';
 
 /*
  * A dialog for confirming a redaction.
@@ -42,7 +43,7 @@ export default React.createClass({
     render: function() {
         const BaseDialog = sdk.getComponent('views.dialogs.BaseDialog');
 
-        const title = "Confirm Redaction";
+        const title = _t("Confirm Removal");
 
         const confirmButtonClass = classnames({
             'mx_Dialog_primary': true,
@@ -55,16 +56,16 @@ export default React.createClass({
                 title={title}
             >
                 <div className="mx_Dialog_content">
-                    Are you sure you wish to redact (delete) this event?
-                    Note that if you redact a room name or topic change, it could undo the change.
+                    {_t("Are you sure you wish to remove (delete) this event? " +
+                        "Note that if you delete a room name or topic change, it could undo the change.")}
                 </div>
                 <div className="mx_Dialog_buttons">
                     <button className={confirmButtonClass} onClick={this.onOk}>
-                        Redact
+                        {_t("Remove")}
                     </button>
 
                     <button onClick={this.onCancel}>
-                        Cancel
+                        {_t("Cancel")}
                     </button>
                 </div>
             </BaseDialog>

src/components/views/dialogs/ConfirmUserActionDialog.js

@@ -16,6 +16,7 @@ limitations under the License.
 
 import React from 'react';
 import sdk from '../../../index';
+import { _t } from '../../../languageHandler';
 import classnames from 'classnames';
 
 /*
@@ -69,7 +70,7 @@ export default React.createClass({
         const BaseDialog = sdk.getComponent('views.dialogs.BaseDialog');
         const MemberAvatar = sdk.getComponent("views.avatars.MemberAvatar");
 
-        const title = this.props.action + " this person?";
+        const title = _t("%(actionVerb)s this person?", { actionVerb: this.props.action});
         const confirmButtonClass = classnames({
             'mx_Dialog_primary': true,
             'danger': this.props.danger,
@@ -82,7 +83,7 @@ export default React.createClass({
                     <form onSubmit={this.onOk}>
                         <input className="mx_ConfirmUserActionDialog_reasonField"
                             ref={this._collectReasonField}
-                            placeholder="Reason"
+                            placeholder={ _t("Reason") }
                             autoFocus={true}
                         />
                     </form>
@@ -111,7 +112,7 @@ export default React.createClass({
                     </button>
 
                     <button onClick={this.onCancel}>
-                        Cancel
+                        { _t("Cancel") }
                     </button>
                 </div>
             </BaseDialog>

src/components/views/dialogs/DeactivateAccountDialog.js

@@ -20,6 +20,7 @@ import sdk from '../../../index';
 import MatrixClientPeg from '../../../MatrixClientPeg';
 import * as Lifecycle from '../../../Lifecycle';
 import Velocity from 'velocity-vector';
+import { _t } from '../../../languageHandler';
 
 export default class DeactivateAccountDialog extends React.Component {
     constructor(props, context) {
@@ -56,10 +57,10 @@ export default class DeactivateAccountDialog extends React.Component {
             Lifecycle.onLoggedOut();
             this.props.onFinished(false);
         }, (err) => {
-            let errStr = 'Unknown error';
+            let errStr = _t('Unknown error');
             // https://matrix.org/jira/browse/SYN-744
             if (err.httpStatus == 401 || err.httpStatus == 403) {
-                errStr = 'Incorrect password';
+                errStr = _t('Incorrect password');
                 Velocity(this._passwordField, "callout.shake", 300);
             }
             this.setState({
@@ -85,29 +86,29 @@ export default class DeactivateAccountDialog extends React.Component {
             passwordBoxClass = 'error';
         }
 
-        const okLabel = this.state.busy ? <Loader /> : 'Deactivate Account';
+        const okLabel = this.state.busy ? <Loader /> : _t('Deactivate Account');
         const okEnabled = this.state.confirmButtonEnabled && !this.state.busy;
 
         let cancelButton = null;
         if (!this.state.busy) {
             cancelButton = <button onClick={this._onCancel} autoFocus={true}>
-                Cancel
+                {_t("Cancel")}
             </button>;
         }
 
         return (
             <div className="mx_DeactivateAccountDialog">
                 <div className="mx_Dialog_title danger">
-                    Deactivate Account
+                    {_t("Deactivate Account")}
                 </div>
                 <div className="mx_Dialog_content">
-                    <p>This will make your account permanently unusable. You will not be able to re-register the same user ID.</p>
+                    <p>{_t("This will make your account permanently unusable. You will not be able to re-register the same user ID.")}</p>
 
-                    <p>This action is irreversible.</p>
+                    <p>{_t("This action is irreversible.")}</p>
 
-                    <p>To continue, please enter your password.</p>
+                    <p>{_t("To continue, please enter your password.")}</p>
 
-                    <p>Password:</p>
+                    <p>{_t("Password")}:</p>
                     <input
                         type="password"
                         onChange={this._onPasswordFieldChange}

src/components/views/dialogs/DeviceVerifyDialog.js

@@ -0,0 +1,77 @@
+/*
+Copyright 2016 OpenMarket Ltd
+Copyright 2017 Vector Creations Ltd
+
+Licensed under the Apache License, Version 2.0 (the "License");
+you may not use this file except in compliance with the License.
+You may obtain a copy of the License at
+
+    http://www.apache.org/licenses/LICENSE-2.0
+
+Unless required by applicable law or agreed to in writing, software
+distributed under the License is distributed on an "AS IS" BASIS,
+WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+See the License for the specific language governing permissions and
+limitations under the License.
+*/
+
+import React from 'react';
+import MatrixClientPeg from '../../../MatrixClientPeg';
+import sdk from '../../../index';
+import * as FormattingUtils from '../../../utils/FormattingUtils';
+import { _t } from '../../../languageHandler';
+
+export default function DeviceVerifyDialog(props) {
+    const QuestionDialog = sdk.getComponent("dialogs.QuestionDialog");
+
+    const key = FormattingUtils.formatCryptoKey(props.device.getFingerprint());
+    const body = (
+        <div>
+            <p>
+                {_t("To verify that this device can be trusted, please contact its " +
+                    "owner using some other means (e.g. in person or a phone call) " +
+                    "and ask them whether the key they see in their User Settings " +
+                    "for this device matches the key below:")}
+            </p>
+            <div className="mx_UserSettings_cryptoSection">
+                <ul>
+                    <li><label>{_t("Device name")}:</label> <span>{ props.device.getDisplayName() }</span></li>
+                    <li><label>{_t("Device ID")}:</label> <span><code>{ props.device.deviceId}</code></span></li>
+                    <li><label>{_t("Device key")}:</label> <span><code><b>{ key }</b></code></span></li>
+                </ul>
+            </div>
+            <p>
+                {_t("If it matches, press the verify button below. " +
+                    "If it doesn't, then someone else is intercepting this device " +
+                    "and you probably want to press the blacklist button instead.")}
+            </p>
+            <p>
+                {_t("In future this verification process will be more sophisticated.")}
+            </p>
+        </div>
+    );
+
+    function onFinished(confirm) {
+        if (confirm) {
+            MatrixClientPeg.get().setDeviceVerified(
+                props.userId, props.device.deviceId, true,
+            );
+        }
+        props.onFinished(confirm);
+    }
+
+    return (
+        <QuestionDialog
+            title={_t("Verify device")}
+            description={body}
+            button={_t("I verify that the keys match")}
+            onFinished={onFinished}
+        />
+    );
+}
+
+DeviceVerifyDialog.propTypes = {
+    userId: React.PropTypes.string.isRequired,
+    device: React.PropTypes.object.isRequired,
+    onFinished: React.PropTypes.func.isRequired,
+};

src/components/views/dialogs/ErrorDialog.js

@@ -27,6 +27,7 @@ limitations under the License.
 
 import React from 'react';
 import sdk from '../../../index';
+import { _t } from '../../../languageHandler';
 
 export default React.createClass({
     displayName: 'ErrorDialog',
@@ -43,10 +44,10 @@ export default React.createClass({
 
     getDefaultProps: function() {
         return {
-            title: "Error",
-            description: "An error has occurred.",
-            button: "OK",
             focus: true,
+            title: null,
+            description: null,
+            button: null,
         };
     },
 
@@ -60,13 +61,13 @@ export default React.createClass({
         const BaseDialog = sdk.getComponent('views.dialogs.BaseDialog');
         return (
             <BaseDialog className="mx_ErrorDialog" onFinished={this.props.onFinished}
-                    title={this.props.title}>
+                    title={this.props.title || _t('Error')}>
                 <div className="mx_Dialog_content">
-                    {this.props.description}
+                    {this.props.description || _t('An error has occurred.')}
                 </div>
                 <div className="mx_Dialog_buttons">
                     <button ref="button" className="mx_Dialog_primary" onClick={this.props.onFinished}>
-                        {this.props.button}
+                        {this.props.button || _t('OK')}
                     </button>
                 </div>
             </BaseDialog>

src/components/views/dialogs/InteractiveAuthDialog.js

@@ -15,11 +15,10 @@ See the License for the specific language governing permissions and
 limitations under the License.
 */
 
-import Matrix from 'matrix-js-sdk';
-
 import React from 'react';
 
 import sdk from '../../../index';
+import { _t } from '../../../languageHandler';
 
 import AccessibleButton from '../elements/AccessibleButton';
 
@@ -46,12 +45,6 @@ export default React.createClass({
         title: React.PropTypes.string,
     },
 
-    getDefaultProps: function() {
-        return {
-            title: "Authentication",
-        };
-    },
-
     getInitialState: function() {
         return {
             authError: null,
@@ -85,7 +78,7 @@ export default React.createClass({
                     <AccessibleButton onClick={this._onDismissClick}
                         className="mx_UserSettings_button"
                     >
-                        Dismiss
+                        {_t("Dismiss")}
                     </AccessibleButton>
                 </div>
             );
@@ -105,7 +98,7 @@ export default React.createClass({
         return (
             <BaseDialog className="mx_InteractiveAuthDialog"
                 onFinished={this.props.onFinished}
-                title={this.state.authError ? 'Error' : this.props.title}
+                title={this.state.authError ? 'Error' : (this.props.title || _t('Authentication'))}
             >
                 {content}
             </BaseDialog>

src/components/views/dialogs/KeyShareDialog.js

@@ -0,0 +1,172 @@
+/*
+Copyright 2017 Vector Creations Ltd
+
+Licensed under the Apache License, Version 2.0 (the "License");
+you may not use this file except in compliance with the License.
+You may obtain a copy of the License at
+
+    http://www.apache.org/licenses/LICENSE-2.0
+
+Unless required by applicable law or agreed to in writing, software
+distributed under the License is distributed on an "AS IS" BASIS,
+WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+See the License for the specific language governing permissions and
+limitations under the License.
+*/
+
+import Modal from '../../../Modal';
+import React from 'react';
+import sdk from '../../../index';
+
+import { _t } from '../../../languageHandler';
+
+/**
+ * Dialog which asks the user whether they want to share their keys with
+ * an unverified device.
+ *
+ * onFinished is called with `true` if the key should be shared, `false` if it
+ * should not, and `undefined` if the dialog is cancelled. (In other words:
+ * truthy: do the key share. falsy: don't share the keys).
+ */
+export default React.createClass({
+    propTypes: {
+        matrixClient: React.PropTypes.object.isRequired,
+        userId: React.PropTypes.string.isRequired,
+        deviceId: React.PropTypes.string.isRequired,
+        onFinished: React.PropTypes.func.isRequired,
+    },
+
+    getInitialState: function() {
+        return {
+            deviceInfo: null,
+            wasNewDevice: false,
+        };
+    },
+
+    componentDidMount: function() {
+        this._unmounted = false;
+        const userId = this.props.userId;
+        const deviceId = this.props.deviceId;
+
+        // give the client a chance to refresh the device list
+        this.props.matrixClient.downloadKeys([userId], false).then((r) => {
+            if (this._unmounted) { return; }
+
+            const deviceInfo = r[userId][deviceId];
+
+            if(!deviceInfo) {
+                console.warn(`No details found for device ${userId}:${deviceId}`);
+
+                this.props.onFinished(false);
+                return;
+            }
+
+            const wasNewDevice = !deviceInfo.isKnown();
+
+            this.setState({
+                deviceInfo: deviceInfo,
+                wasNewDevice: wasNewDevice,
+            });
+
+            // if the device was new before, it's not any more.
+            if (wasNewDevice) {
+                this.props.matrixClient.setDeviceKnown(
+                    userId,
+                    deviceId,
+                    true,
+                );
+            }
+        }).done();
+    },
+
+    componentWillUnmount: function() {
+        this._unmounted = true;
+    },
+
+
+    _onVerifyClicked: function() {
+        const DeviceVerifyDialog = sdk.getComponent('views.dialogs.DeviceVerifyDialog');
+
+        console.log("KeyShareDialog: Starting verify dialog");
+        Modal.createDialog(DeviceVerifyDialog, {
+            userId: this.props.userId,
+            device: this.state.deviceInfo,
+            onFinished: (verified) => {
+                if (verified) {
+                    // can automatically share the keys now.
+                    this.props.onFinished(true);
+                }
+            },
+        });
+    },
+
+    _onShareClicked: function() {
+        console.log("KeyShareDialog: User clicked 'share'");
+        this.props.onFinished(true);
+    },
+
+    _onIgnoreClicked: function() {
+        console.log("KeyShareDialog: User clicked 'ignore'");
+        this.props.onFinished(false);
+    },
+
+    _renderContent: function() {
+        const displayName = this.state.deviceInfo.getDisplayName() ||
+            this.state.deviceInfo.deviceId;
+
+        let text;
+        if (this.state.wasNewDevice) {
+            text = "You added a new device '%(displayName)s', which is"
+                + " requesting encryption keys.";
+        } else {
+            text = "Your unverified device '%(displayName)s' is requesting"
+                + " encryption keys.";
+        }
+        text = _t(text, {displayName: displayName});
+
+        return (
+            <div>
+                <p>{text}</p>
+
+                <div className="mx_Dialog_buttons">
+                    <button onClick={this._onVerifyClicked}>
+                        {_t('Start verification')}
+                    </button>
+                    <button onClick={this._onShareClicked}>
+                        {_t('Share without verifying')}
+                    </button>
+                    <button onClick={this._onIgnoreClicked}>
+                        {_t('Ignore request')}
+                    </button>
+                </div>
+            </div>
+        );
+    },
+
+    render: function() {
+        const BaseDialog = sdk.getComponent('views.dialogs.BaseDialog');
+        const Spinner = sdk.getComponent('views.elements.Spinner');
+
+        let content;
+
+        if (this.state.deviceInfo) {
+            content = this._renderContent();
+        } else {
+            content = (
+                <div>
+                    <p>{_t('Loading device info...')}</p>
+                    <Spinner />
+                </div>
+            );
+        }
+
+        return (
+            <BaseDialog className='mx_KeyShareRequestDialog'
+                onFinished={this.props.onFinished}
+                title={_t('Encryption key request')}
+            >
+                {content}
+            </BaseDialog>
+        );
+    },
+});

src/components/views/dialogs/NeedToRegisterDialog.js

@@ -1,78 +0,0 @@
-/*
-Copyright 2016 OpenMarket Ltd
-
-Licensed under the Apache License, Version 2.0 (the "License");
-you may not use this file except in compliance with the License.
-You may obtain a copy of the License at
-
-    http://www.apache.org/licenses/LICENSE-2.0
-
-Unless required by applicable law or agreed to in writing, software
-distributed under the License is distributed on an "AS IS" BASIS,
-WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
-See the License for the specific language governing permissions and
-limitations under the License.
-*/
-
-/*
- * Usage:
- * Modal.createDialog(NeedToRegisterDialog, {
- *   title: "some text", (default: "Registration required")
- *   description: "some more text",
- *   onFinished: someFunction,
- * });
- */
-
-import React from 'react';
-import dis from '../../../dispatcher';
-import sdk from '../../../index';
-
-module.exports = React.createClass({
-    displayName: 'NeedToRegisterDialog',
-    propTypes: {
-        title: React.PropTypes.string,
-        description: React.PropTypes.oneOfType([
-            React.PropTypes.element,
-            React.PropTypes.string,
-        ]),
-        onFinished: React.PropTypes.func.isRequired,
-    },
-
-    getDefaultProps: function() {
-        return {
-            title: "Registration required",
-            description: "A registered account is required for this action",
-        };
-    },
-
-    onRegisterClicked: function() {
-        dis.dispatch({
-            action: "start_upgrade_registration",
-        });
-        if (this.props.onFinished) {
-            this.props.onFinished();
-        }
-    },
-
-    render: function() {
-        const BaseDialog = sdk.getComponent('views.dialogs.BaseDialog');
-        return (
-            <BaseDialog className="mx_NeedToRegisterDialog"
-                onFinished={this.props.onFinished}
-                title={this.props.title}
-            >
-                <div className="mx_Dialog_content">
-                    {this.props.description}
-                </div>
-                <div className="mx_Dialog_buttons">
-                    <button className="mx_Dialog_primary" onClick={this.props.onFinished} autoFocus={true}>
-                        Cancel
-                    </button>
-                    <button onClick={this.onRegisterClicked}>
-                        Register
-                    </button>
-                </div>
-            </BaseDialog>
-        );
-    },
-});

src/components/views/dialogs/QuestionDialog.js

@@ -16,6 +16,7 @@ limitations under the License.
 
 import React from 'react';
 import sdk from '../../../index';
+import { _t } from '../../../languageHandler';
 
 export default React.createClass({
     displayName: 'QuestionDialog',
@@ -33,7 +34,6 @@ export default React.createClass({
             title: "",
             description: "",
             extraButtons: null,
-            button: "OK",
             focus: true,
             hasCancelButton: true,
         };
@@ -47,17 +47,11 @@ export default React.createClass({
         this.props.onFinished(false);
     },
 
-    componentDidMount: function() {
-        if (this.props.focus) {
-            this.refs.button.focus();
-        }
-    },
-
     render: function() {
         const BaseDialog = sdk.getComponent('views.dialogs.BaseDialog');
         const cancelButton = this.props.hasCancelButton ? (
             <button onClick={this.onCancel}>
-                Cancel
+                {_t("Cancel")}
             </button>
         ) : null;
         return (
@@ -69,8 +63,8 @@ export default React.createClass({
                     {this.props.description}
                 </div>
                 <div className="mx_Dialog_buttons">
-                    <button ref="button" className="mx_Dialog_primary" onClick={this.onOk}>
-                        {this.props.button}
+                    <button className="mx_Dialog_primary" onClick={this.onOk} autoFocus={this.props.focus}>
+                        {this.props.button || _t('OK')}
                     </button>
                     {this.props.extraButtons}
                     {cancelButton}

src/components/views/dialogs/SessionRestoreErrorDialog.js

@@ -18,6 +18,7 @@ import React from 'react';
 import sdk from '../../../index';
 import SdkConfig from '../../../SdkConfig';
 import Modal from '../../../Modal';
+import { _t, _tJsx } from '../../../languageHandler';
 
 
 export default React.createClass({
@@ -43,29 +44,32 @@ export default React.createClass({
 
         if (SdkConfig.get().bug_report_endpoint_url) {
             bugreport = (
-                <p>Otherwise, <a onClick={this._sendBugReport} href='#'>
-                   click here</a> to send a bug report.
+                <p>
+                {_tJsx(
+                    "Otherwise, <a>click here</a> to send a bug report.",
+                    /<a>(.*?)<\/a>/, (sub) => <a onClick={this._sendBugReport} key="bugreport" href='#'>{sub}</a>,
+                )}
                 </p>
             );
         }
 
         return (
             <BaseDialog className="mx_ErrorDialog" onFinished={this.props.onFinished}
-                    title='Unable to restore session'>
+                    title={_t('Unable to restore session')}>
                 <div className="mx_Dialog_content">
-                    <p>We encountered an error trying to restore your previous session. If
-                    you continue, you will need to log in again, and encrypted chat
-                    history will be unreadable.</p>
+                    <p>{_t("We encountered an error trying to restore your previous session. If " +
+                    "you continue, you will need to log in again, and encrypted chat " +
+                    "history will be unreadable.")}</p>
 
-                    <p>If you have previously used a more recent version of Riot, your session
-                    may be incompatible with this version. Close this window and return
-                    to the more recent version.</p>
+                    <p>{_t("If you have previously used a more recent version of Riot, your session " +
+                    "may be incompatible with this version. Close this window and return " +
+                    "to the more recent version.")}</p>
 
                     {bugreport}
                 </div>
                 <div className="mx_Dialog_buttons">
                     <button className="mx_Dialog_primary" onClick={this._continueClicked}>
-                        Continue anyway
+                        {_t("Continue anyway")}
                     </button>
                 </div>
             </BaseDialog>

src/components/views/dialogs/SetDisplayNameDialog.js

@@ -1,87 +0,0 @@
-/*
-Copyright 2016 OpenMarket Ltd
-
-Licensed under the Apache License, Version 2.0 (the "License");
-you may not use this file except in compliance with the License.
-You may obtain a copy of the License at
-
-    http://www.apache.org/licenses/LICENSE-2.0
-
-Unless required by applicable law or agreed to in writing, software
-distributed under the License is distributed on an "AS IS" BASIS,
-WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
-See the License for the specific language governing permissions and
-limitations under the License.
-*/
-
-import React from 'react';
-import sdk from '../../../index';
-import MatrixClientPeg from '../../../MatrixClientPeg';
-
-/**
- * Prompt the user to set a display name.
- *
- * On success, `onFinished(true, newDisplayName)` is called.
- */
-export default React.createClass({
-    displayName: 'SetDisplayNameDialog',
-    propTypes: {
-        onFinished: React.PropTypes.func.isRequired,
-        currentDisplayName: React.PropTypes.string,
-    },
-
-    getInitialState: function() {
-        if (this.props.currentDisplayName) {
-            return { value: this.props.currentDisplayName };
-        }
-
-        if (MatrixClientPeg.get().isGuest()) {
-            return { value : "Guest " + MatrixClientPeg.get().getUserIdLocalpart() };
-        }
-        else {
-            return { value : MatrixClientPeg.get().getUserIdLocalpart() };
-        }
-    },
-
-    componentDidMount: function() {
-        this.refs.input_value.select();
-    },
-
-    onValueChange: function(ev) {
-        this.setState({
-            value: ev.target.value
-        });
-    },
-
-    onFormSubmit: function(ev) {
-        ev.preventDefault();
-        this.props.onFinished(true, this.state.value);
-        return false;
-    },
-
-    render: function() {
-        const BaseDialog = sdk.getComponent('views.dialogs.BaseDialog');
-        return (
-            <BaseDialog className="mx_SetDisplayNameDialog"
-                onFinished={this.props.onFinished}
-                title="Set a Display Name"
-            >
-                <div className="mx_Dialog_content">
-                    Your display name is how you'll appear to others when you speak in rooms.<br/>
-                    What would you like it to be?
-                </div>
-                <form onSubmit={this.onFormSubmit}>
-                    <div className="mx_Dialog_content">
-                        <input type="text" ref="input_value" value={this.state.value}
-                            autoFocus={true} onChange={this.onValueChange} size="30"
-                            className="mx_SetDisplayNameDialog_input"
-                        />
-                    </div>
-                    <div className="mx_Dialog_buttons">
-                        <input className="mx_Dialog_primary" type="submit" value="Set" />
-                    </div>
-                </form>
-            </BaseDialog>
-        );
-    },
-});

src/components/views/dialogs/SetEmailDialog.js

@@ -0,0 +1,164 @@
+/*
+Copyright 2017 Vector Creations Ltd
+
+Licensed under the Apache License, Version 2.0 (the "License");
+you may not use this file except in compliance with the License.
+You may obtain a copy of the License at
+
+    http://www.apache.org/licenses/LICENSE-2.0
+
+Unless required by applicable law or agreed to in writing, software
+distributed under the License is distributed on an "AS IS" BASIS,
+WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+See the License for the specific language governing permissions and
+limitations under the License.
+*/
+
+import React from 'react';
+import sdk from '../../../index';
+import Email from '../../../email';
+import AddThreepid from '../../../AddThreepid';
+import { _t } from '../../../languageHandler';
+import Modal from '../../../Modal';
+
+
+/**
+ * Prompt the user to set an email address.
+ *
+ * On success, `onFinished(true)` is called.
+ */
+export default React.createClass({
+    displayName: 'SetEmailDialog',
+    propTypes: {
+        onFinished: React.PropTypes.func.isRequired,
+    },
+
+    getInitialState: function() {
+        return {
+            emailAddress: null,
+            emailBusy: false,
+        };
+    },
+
+    componentDidMount: function() {
+    },
+
+    onEmailAddressChanged: function(value) {
+        this.setState({
+            emailAddress: value,
+        });
+    },
+
+    onSubmit: function() {
+        const ErrorDialog = sdk.getComponent("dialogs.ErrorDialog");
+        const QuestionDialog = sdk.getComponent("dialogs.QuestionDialog");
+
+        const emailAddress = this.state.emailAddress;
+        if (!Email.looksValid(emailAddress)) {
+            Modal.createDialog(ErrorDialog, {
+                title: _t("Invalid Email Address"),
+                description: _t("This doesn't appear to be a valid email address"),
+            });
+            return;
+        }
+        this._addThreepid = new AddThreepid();
+        // we always bind emails when registering, so let's do the
+        // same here.
+        this._addThreepid.addEmailAddress(emailAddress, true).done(() => {
+            Modal.createDialog(QuestionDialog, {
+                title: _t("Verification Pending"),
+                description: _t(
+                    "Please check your email and click on the link it contains. Once this " +
+                    "is done, click continue.",
+                ),
+                button: _t('Continue'),
+                onFinished: this.onEmailDialogFinished,
+            });
+        }, (err) => {
+            this.setState({emailBusy: false});
+            console.error("Unable to add email address " + emailAddress + " " + err);
+            Modal.createDialog(ErrorDialog, {
+                title: _t("Unable to add email address"),
+                description: ((err && err.message) ? err.message : _t("Operation failed")),
+            });
+        });
+        this.setState({emailBusy: true});
+    },
+
+    onCancelled: function() {
+        this.props.onFinished(false);
+    },
+
+    onEmailDialogFinished: function(ok) {
+        if (ok) {
+            this.verifyEmailAddress();
+        } else {
+            this.setState({emailBusy: false});
+        }
+    },
+
+    verifyEmailAddress: function() {
+        this._addThreepid.checkEmailLinkClicked().done(() => {
+            this.props.onFinished(true);
+        }, (err) => {
+            this.setState({emailBusy: false});
+            if (err.errcode == 'M_THREEPID_AUTH_FAILED') {
+                const QuestionDialog = sdk.getComponent("dialogs.QuestionDialog");
+                const message = _t("Unable to verify email address.") + " " +
+                    _t("Please check your email and click on the link it contains. Once this is done, click continue.");
+                Modal.createDialog(QuestionDialog, {
+                    title: _t("Verification Pending"),
+                    description: message,
+                    button: _t('Continue'),
+                    onFinished: this.onEmailDialogFinished,
+                });
+            } else {
+                const ErrorDialog = sdk.getComponent("dialogs.ErrorDialog");
+                console.error("Unable to verify email address: " + err);
+                Modal.createDialog(ErrorDialog, {
+                    title: _t("Unable to verify email address."),
+                    description: ((err && err.message) ? err.message : _t("Operation failed")),
+                });
+            }
+        });
+    },
+
+    render: function() {
+        const BaseDialog = sdk.getComponent('views.dialogs.BaseDialog');
+        const Spinner = sdk.getComponent('elements.Spinner');
+        const EditableText = sdk.getComponent('elements.EditableText');
+
+        const emailInput = this.state.emailBusy ? <Spinner /> : <EditableText
+            className="mx_SetEmailDialog_email_input"
+            placeholder={ _t("Email address") }
+            placeholderClassName="mx_SetEmailDialog_email_input_placeholder"
+            blurToCancel={ false }
+            onValueChanged={ this.onEmailAddressChanged } />;
+
+        return (
+            <BaseDialog className="mx_SetEmailDialog"
+                onFinished={this.onCancelled}
+                title={this.props.title}
+            >
+                <div className="mx_Dialog_content">
+                    <p>
+                        { _t('This will allow you to reset your password and receive notifications.') }
+                    </p>
+                    { emailInput }
+                </div>
+                <div className="mx_Dialog_buttons">
+                    <input className="mx_Dialog_primary"
+                        type="submit"
+                        value={_t("Continue")}
+                        onClick={this.onSubmit}
+                    />
+                    <input
+                        type="submit"
+                        value={_t("Skip")}
+                        onClick={this.onCancelled}
+                    />
+                </div>
+            </BaseDialog>
+        );
+    },
+});

src/components/views/dialogs/SetMxIdDialog.js

@@ -0,0 +1,294 @@
+/*
+Copyright 2016 OpenMarket Ltd
+Copyright 2017 Vector Creations Ltd
+
+Licensed under the Apache License, Version 2.0 (the "License");
+you may not use this file except in compliance with the License.
+You may obtain a copy of the License at
+
+    http://www.apache.org/licenses/LICENSE-2.0
+
+Unless required by applicable law or agreed to in writing, software
+distributed under the License is distributed on an "AS IS" BASIS,
+WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+See the License for the specific language governing permissions and
+limitations under the License.
+*/
+
+import q from 'q';
+import React from 'react';
+import sdk from '../../../index';
+import MatrixClientPeg from '../../../MatrixClientPeg';
+import classnames from 'classnames';
+import KeyCode from '../../../KeyCode';
+import { _t, _tJsx } from '../../../languageHandler';
+
+// The amount of time to wait for further changes to the input username before
+// sending a request to the server
+const USERNAME_CHECK_DEBOUNCE_MS = 250;
+
+/**
+ * Prompt the user to set a display name.
+ *
+ * On success, `onFinished(true, newDisplayName)` is called.
+ */
+export default React.createClass({
+    displayName: 'SetMxIdDialog',
+    propTypes: {
+        onFinished: React.PropTypes.func.isRequired,
+        // Called when the user requests to register with a different homeserver
+        onDifferentServerClicked: React.PropTypes.func.isRequired,
+        // Called if the user wants to switch to login instead
+        onLoginClick: React.PropTypes.func.isRequired,
+    },
+
+    getInitialState: function() {
+        return {
+            // The entered username
+            username: '',
+            // Indicate ongoing work on the username
+            usernameBusy: false,
+            // Indicate error with username
+            usernameError: '',
+            // Assume the homeserver supports username checking until "M_UNRECOGNIZED"
+            usernameCheckSupport: true,
+
+            // Whether the auth UI is currently being used
+            doingUIAuth: false,
+            // Indicate error with auth
+            authError: '',
+        };
+    },
+
+    componentDidMount: function() {
+        this.refs.input_value.select();
+
+        this._matrixClient = MatrixClientPeg.get();
+    },
+
+    onValueChange: function(ev) {
+        this.setState({
+            username: ev.target.value,
+            usernameBusy: true,
+            usernameError: '',
+        }, () => {
+            if (!this.state.username || !this.state.usernameCheckSupport) {
+                this.setState({
+                    usernameBusy: false,
+                });
+                return;
+            }
+
+            // Debounce the username check to limit number of requests sent
+            if (this._usernameCheckTimeout) {
+                clearTimeout(this._usernameCheckTimeout);
+            }
+            this._usernameCheckTimeout = setTimeout(() => {
+                this._doUsernameCheck().finally(() => {
+                    this.setState({
+                        usernameBusy: false,
+                    });
+                });
+            }, USERNAME_CHECK_DEBOUNCE_MS);
+        });
+    },
+
+    onKeyUp: function(ev) {
+        if (ev.keyCode === KeyCode.ENTER) {
+            this.onSubmit();
+        }
+    },
+
+    onSubmit: function(ev) {
+        this.setState({
+            doingUIAuth: true,
+        });
+    },
+
+    _doUsernameCheck: function() {
+        // Check if username is available
+        return this._matrixClient.isUsernameAvailable(this.state.username).then(
+            (isAvailable) => {
+                if (isAvailable) {
+                    this.setState({usernameError: ''});
+                }
+            },
+            (err) => {
+                // Indicate whether the homeserver supports username checking
+                const newState = {
+                    usernameCheckSupport: err.errcode !== "M_UNRECOGNIZED",
+                };
+                console.error('Error whilst checking username availability: ', err);
+                switch (err.errcode) {
+                    case "M_USER_IN_USE":
+                        newState.usernameError = _t('Username not available');
+                        break;
+                    case "M_INVALID_USERNAME":
+                        newState.usernameError = _t(
+                            'Username invalid: %(errMessage)s',
+                            { errMessage: err.message},
+                        );
+                        break;
+                    case "M_UNRECOGNIZED":
+                        // This homeserver doesn't support username checking, assume it's
+                        // fine and rely on the error appearing in registration step.
+                        newState.usernameError = '';
+                        break;
+                    case undefined:
+                        newState.usernameError = _t('Something went wrong!');
+                        break;
+                    default:
+                        newState.usernameError = _t(
+                            'An error occurred: %(error_string)s',
+                            { error_string: err.message },
+                        );
+                        break;
+                }
+                this.setState(newState);
+            },
+        );
+    },
+
+    _generatePassword: function() {
+        return Math.random().toString(36).slice(2);
+    },
+
+    _makeRegisterRequest: function(auth) {
+        // Not upgrading - changing mxids
+        const guestAccessToken = null;
+        if (!this._generatedPassword) {
+            this._generatedPassword = this._generatePassword();
+        }
+        return this._matrixClient.register(
+            this.state.username,
+            this._generatedPassword,
+            undefined, // session id: included in the auth dict already
+            auth,
+            {},
+            guestAccessToken,
+        );
+    },
+
+    _onUIAuthFinished: function(success, response) {
+        this.setState({
+            doingUIAuth: false,
+        });
+
+        if (!success) {
+            this.setState({ authError: response.message });
+            return;
+        }
+
+        // XXX Implement RTS /register here
+        const teamToken = null;
+
+        this.props.onFinished(true, {
+            userId: response.user_id,
+            deviceId: response.device_id,
+            homeserverUrl: this._matrixClient.getHomeserverUrl(),
+            identityServerUrl: this._matrixClient.getIdentityServerUrl(),
+            accessToken: response.access_token,
+            password: this._generatedPassword,
+            teamToken: teamToken,
+        });
+    },
+
+    render: function() {
+        const BaseDialog = sdk.getComponent('views.dialogs.BaseDialog');
+        const InteractiveAuth = sdk.getComponent('structures.InteractiveAuth');
+        const Spinner = sdk.getComponent('elements.Spinner');
+
+        let auth;
+        if (this.state.doingUIAuth) {
+            auth = <InteractiveAuth
+                matrixClient={this._matrixClient}
+                makeRequest={this._makeRegisterRequest}
+                onAuthFinished={this._onUIAuthFinished}
+                inputs={{}}
+                poll={true}
+            />;
+        }
+        const inputClasses = classnames({
+            "mx_SetMxIdDialog_input": true,
+            "error": Boolean(this.state.usernameError),
+        });
+
+        let usernameIndicator = null;
+        let usernameBusyIndicator = null;
+        if (this.state.usernameBusy) {
+            usernameBusyIndicator = <Spinner w="24" h="24"/>;
+        } else {
+            const usernameAvailable = this.state.username &&
+                this.state.usernameCheckSupport && !this.state.usernameError;
+            const usernameIndicatorClasses = classnames({
+                "error": Boolean(this.state.usernameError),
+                "success": usernameAvailable,
+            });
+            usernameIndicator = <div className={usernameIndicatorClasses}>
+                { usernameAvailable ? _t('Username available') : this.state.usernameError }
+            </div>;
+        }
+
+        let authErrorIndicator = null;
+        if (this.state.authError) {
+            authErrorIndicator = <div className="error">
+                { this.state.authError }
+            </div>;
+        }
+        const canContinue = this.state.username &&
+            !this.state.usernameError &&
+            !this.state.usernameBusy;
+
+        return (
+            <BaseDialog className="mx_SetMxIdDialog"
+                onFinished={this.props.onFinished}
+                title="To get started, please pick a username!"
+            >
+                <div className="mx_Dialog_content">
+                    <div className="mx_SetMxIdDialog_input_group">
+                        <input type="text" ref="input_value" value={this.state.username}
+                            autoFocus={true}
+                            onChange={this.onValueChange}
+                            onKeyUp={this.onKeyUp}
+                            size="30"
+                            className={inputClasses}
+                        />
+                        { usernameBusyIndicator }
+                    </div>
+                    { usernameIndicator }
+                    <p>
+                        { _tJsx(
+                            'This will be your account name on the <span></span> ' +
+                            'homeserver, or you can pick a <a>different server</a>.',
+                            [
+                                /<span><\/span>/,
+                                /<a>(.*?)<\/a>/,
+                            ],
+                            [
+                                (sub) => <span>{this.props.homeserverUrl}</span>,
+                                (sub) => <a href="#" onClick={this.props.onDifferentServerClicked}>{sub}</a>,
+                            ],
+                        )}
+                    </p>
+                    <p>
+                        { _tJsx(
+                            'If you already have a Matrix account you can <a>log in</a> instead.',
+                            /<a>(.*?)<\/a>/,
+                            [(sub) => <a href="#" onClick={this.props.onLoginClick}>{sub}</a>],
+                        )}
+                    </p>
+                    { auth }
+                    { authErrorIndicator }
+                </div>
+                <div className="mx_Dialog_buttons">
+                    <input className="mx_Dialog_primary"
+                        type="submit"
+                        value={_t("Continue")}
+                        onClick={this.onSubmit}
+                        disabled={!canContinue}
+                    />
+                </div>
+            </BaseDialog>
+        );
+    },
+});

src/components/views/dialogs/TextInputDialog.js

@@ -16,6 +16,7 @@ limitations under the License.
 
 import React from 'react';
 import sdk from '../../../index';
+import { _t } from '../../../languageHandler';
 
 export default React.createClass({
     displayName: 'TextInputDialog',
@@ -36,7 +37,6 @@ export default React.createClass({
             title: "",
             value: "",
             description: "",
-            button: "OK",
             focus: true,
         };
     },
@@ -73,7 +73,7 @@ export default React.createClass({
                 </div>
                 <div className="mx_Dialog_buttons">
                     <button onClick={this.onCancel}>
-                        Cancel
+                        { _t("Cancel") }
                     </button>
                     <button className="mx_Dialog_primary" onClick={this.onOk}>
                         {this.props.button}

src/components/views/dialogs/UnknownDeviceDialog.js

@@ -16,10 +16,10 @@ limitations under the License.
 
 import React from 'react';
 import sdk from '../../../index';
-import dis from '../../../dispatcher';
 import MatrixClientPeg from '../../../MatrixClientPeg';
 import GeminiScrollbar from 'react-gemini-scrollbar';
 import Resend from '../../../Resend';
+import { _t } from '../../../languageHandler';
 
 function DeviceListEntry(props) {
     const {userId, device} = props;
@@ -120,17 +120,17 @@ export default React.createClass({
         if (blacklistUnverified) {
             warning = (
                 <h4>
-                    You are currently blacklisting unverified devices; to send
-                    messages to these devices you must verify them.
+                    {_t("You are currently blacklisting unverified devices; to send " +
+                    "messages to these devices you must verify them.")}
                 </h4>
             );
         } else {
             warning = (
                 <div>
                     <p>
-                        We recommend you go through the verification process
-                        for each device to confirm they belong to their legitimate owner,
-                        but you can resend the message without verifying if you prefer.
+                        {_t("We recommend you go through the verification process " +
+                            "for each device to confirm they belong to their legitimate owner, " +
+                            "but you can resend the message without verifying if you prefer.")}
                     </p>
                 </div>
             );
@@ -145,14 +145,14 @@ export default React.createClass({
                             console.log("UnknownDeviceDialog closed by escape");
                             this.props.onFinished();
                 }}
-                title='Room contains unknown devices'
+                title={_t('Room contains unknown devices')}
             >
                 <GeminiScrollbar autoshow={false} className="mx_Dialog_content">
                     <h4>
-                        "{this.props.room.name}" contains devices that you haven't seen before.
+                        {_t('"%(RoomName)s" contains devices that you haven\'t seen before.', {RoomName: this.props.room.name})}
                     </h4>
                     { warning }
-                    Unknown devices:
+                    {_t("Unknown devices")}:
 
                     <UnknownDeviceList devices={this.props.devices} />
                 </GeminiScrollbar>
@@ -162,7 +162,7 @@ export default React.createClass({
                                 this.props.onFinished();
                                 Resend.resendUnsentEvents(this.props.room);
                             }}>
-                        Send anyway
+                        {_t("Send anyway")}
                     </button>
                     <button className="mx_Dialog_primary" autoFocus={ true }
                             onClick={() => {

src/components/views/elements/ActionButton.js

@@ -27,6 +27,7 @@ export default React.createClass({
         size: PropTypes.string,
         tooltip: PropTypes.bool,
         action: PropTypes.string.isRequired,
+        mouseOverAction: PropTypes.string,
         label: PropTypes.string.isRequired,
         iconPath: PropTypes.string.isRequired,
     },
@@ -51,6 +52,9 @@ export default React.createClass({
 
     _onMouseEnter: function() {
         if (this.props.tooltip) this.setState({showTooltip: true});
+        if (this.props.mouseOverAction) {
+            dis.dispatch({action: this.props.mouseOverAction});
+        }
     },
 
     _onMouseLeave: function() {

src/components/views/elements/AddressTile.js

@@ -16,12 +16,11 @@ limitations under the License.
 
 'use strict';
 
-var React = require('react');
-var classNames = require('classnames');
-var sdk = require("../../../index");
-var Invite = require("../../../Invite");
-var MatrixClientPeg = require("../../../MatrixClientPeg");
-var Avatar = require('../../../Avatar');
+import React from 'react';
+import classNames from 'classnames';
+import sdk from "../../../index";
+import MatrixClientPeg from "../../../MatrixClientPeg";
+import { _t } from '../../../languageHandler';
 
 // React PropType definition for an object describing
 // an address that can be invited to a room (which
@@ -142,7 +141,7 @@ export default React.createClass({
             });
 
             info = (
-                <div className={unknownClasses}>Unknown Address</div>
+                <div className={unknownClasses}>{_t("Unknown Address")}</div>
             );
         }
 

src/components/views/elements/CreateRoomButton.js

@@ -17,12 +17,14 @@ limitations under the License.
 import React from 'react';
 import sdk from '../../../index';
 import PropTypes from 'prop-types';
+import { _t } from '../../../languageHandler';
 
 const CreateRoomButton = function(props) {
     const ActionButton = sdk.getComponent('elements.ActionButton');
     return (
-        <ActionButton action="view_create_chat"
-            label="Create new room"
+        <ActionButton action="view_create_room"
+            mouseOverAction={props.callout ? "callout_create_room" : null}
+            label={ _t("Create new room") }
             iconPath="img/icons-create-room.svg"
             size={props.size}
             tooltip={props.tooltip}

src/components/views/elements/DeviceVerifyButtons.js

@@ -18,6 +18,7 @@ import React from 'react';
 import MatrixClientPeg from '../../../MatrixClientPeg';
 import sdk from '../../../index';
 import Modal from '../../../Modal';
+import { _t } from '../../../languageHandler';
 
 export default React.createClass({
     displayName: 'DeviceVerifyButtons',
@@ -50,42 +51,10 @@ export default React.createClass({
     },
 
     onVerifyClick: function() {
-        var QuestionDialog = sdk.getComponent("dialogs.QuestionDialog");
-        Modal.createDialog(QuestionDialog, {
-            title: "Verify device",
-            description: (
-                <div>
-                    <p>
-                        To verify that this device can be trusted, please contact its
-                        owner using some other means (e.g. in person or a phone call)
-                        and ask them whether the key they see in their User Settings
-                        for this device matches the key below:
-                    </p>
-                    <div className="mx_UserSettings_cryptoSection">
-                        <ul>
-                            <li><label>Device name:</label> <span>{ this.state.device.getDisplayName() }</span></li>
-                            <li><label>Device ID:</label>   <span><code>{ this.state.device.deviceId}</code></span></li>
-                            <li><label>Device key:</label>  <span><code><b>{ this.state.device.getFingerprint() }</b></code></span></li>
-                        </ul>
-                    </div>
-                    <p>
-                        If it matches, press the verify button below.
-                        If it doesnt, then someone else is intercepting this device
-                        and you probably want to press the blacklist button instead.
-                    </p>
-                    <p>
-                        In future this verification process will be more sophisticated.
-                    </p>
-                </div>
-            ),
-            button: "I verify that the keys match",
-            onFinished: confirm=>{
-                if (confirm) {
-                    MatrixClientPeg.get().setDeviceVerified(
-                        this.props.userId, this.state.device.deviceId, true
-                    );
-                }
-            },
+        const DeviceVerifyDialog = sdk.getComponent('views.dialogs.DeviceVerifyDialog');
+        Modal.createDialog(DeviceVerifyDialog, {
+            userId: this.props.userId,
+            device: this.state.device,
         });
     },
 
@@ -114,14 +83,14 @@ export default React.createClass({
             blacklistButton = (
                 <button className="mx_MemberDeviceInfo_textButton mx_MemberDeviceInfo_unblacklist"
                   onClick={this.onUnblacklistClick}>
-                    Unblacklist
+                    {_t("Unblacklist")}
                 </button>
             );
         } else {
             blacklistButton = (
                 <button className="mx_MemberDeviceInfo_textButton mx_MemberDeviceInfo_blacklist"
                   onClick={this.onBlacklistClick}>
-                    Blacklist
+                    {_t("Blacklist")}
                 </button>
             );
         }
@@ -130,14 +99,14 @@ export default React.createClass({
             verifyButton = (
                 <button className="mx_MemberDeviceInfo_textButton mx_MemberDeviceInfo_unverify"
                   onClick={this.onUnverifyClick}>
-                    Unverify
+                    {_t("Unverify")}
                 </button>
             );
         } else {
             verifyButton = (
                 <button className="mx_MemberDeviceInfo_textButton mx_MemberDeviceInfo_verify"
                   onClick={this.onVerifyClick}>
-                    Verify...
+                    {_t("Verify...")}
                 </button>
             );
         }

src/components/views/elements/DirectorySearchBox.js

@@ -93,7 +93,7 @@ export default class DirectorySearchBox extends React.Component {
                     className="mx_DirectorySearchBox_input"
                     ref={this._collectInput}
                     onChange={this._onChange} onKeyUp={this._onKeyUp}
-                    placeholder={this.props.placeholder}
+                    placeholder={this.props.placeholder} autoFocus
                 />
                 {join_button}
                 <span className="mx_DirectorySearchBox_clear_wrapper">

src/components/views/elements/Dropdown.js

@@ -17,6 +17,7 @@ limitations under the License.
 import React from 'react';
 import classnames from 'classnames';
 import AccessibleButton from './AccessibleButton';
+import { _t } from '../../../languageHandler';
 
 class MenuOption extends React.Component {
     constructor(props) {
@@ -152,10 +153,12 @@ export default class Dropdown extends React.Component {
     }
 
     _onInputClick(ev) {
-        this.setState({
-            expanded: !this.state.expanded,
-        });
-        ev.preventDefault();
+        if (!this.state.expanded) {
+            this.setState({
+                expanded: true,
+            });
+            ev.preventDefault();
+        }
     }
 
     _onMenuOptionClick(dropdownKey) {
@@ -252,8 +255,8 @@ export default class Dropdown extends React.Component {
             );
         });
         if (options.length === 0) {
-            return [<div className="mx_Dropdown_option">
-                No results
+            return [<div key="0" className="mx_Dropdown_option">
+                {_t("No results")}
             </div>];
         }
         return options;

src/components/views/elements/HomeButton.js

@@ -17,12 +17,13 @@ limitations under the License.
 import React from 'react';
 import sdk from '../../../index';
 import PropTypes from 'prop-types';
+import { _t } from '../../../languageHandler';
 
 const HomeButton = function(props) {
     const ActionButton = sdk.getComponent('elements.ActionButton');
     return (
         <ActionButton action="view_home_page"
-            label="Welcome page"
+            label={ _t("Home") }
             iconPath="img/icons-home.svg"
             size={props.size}
             tooltip={props.tooltip}

src/components/views/elements/LanguageDropdown.js

@@ -0,0 +1,120 @@
+/*
+Copyright 2017 Marcel Radzio (MTRNord)
+Copyright 2017 Vector Creations Ltd.
+
+Licensed under the Apache License, Version 2.0 (the "License");
+you may not use this file except in compliance with the License.
+You may obtain a copy of the License at
+
+    http://www.apache.org/licenses/LICENSE-2.0
+
+Unless required by applicable law or agreed to in writing, software
+distributed under the License is distributed on an "AS IS" BASIS,
+WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+See the License for the specific language governing permissions and
+limitations under the License.
+*/
+
+import React from 'react';
+
+import sdk from '../../../index';
+import UserSettingsStore from '../../../UserSettingsStore';
+import * as languageHandler from '../../../languageHandler';
+
+function languageMatchesSearchQuery(query, language) {
+    if (language.label.toUpperCase().indexOf(query.toUpperCase()) == 0) return true;
+    if (language.value.toUpperCase() == query.toUpperCase()) return true;
+    return false;
+}
+
+export default class LanguageDropdown extends React.Component {
+    constructor(props) {
+        super(props);
+        this._onSearchChange = this._onSearchChange.bind(this);
+
+        this.state = {
+            searchQuery: '',
+            langs: null,
+        }
+    }
+
+    componentWillMount() {
+        languageHandler.getAllLanguagesFromJson().then((langs) => {
+            langs.sort(function(a, b){
+                if(a.label < b.label) return -1;
+                if(a.label > b.label) return 1;
+                return 0;
+            });
+            this.setState({langs});
+        }).catch(() => {
+            this.setState({langs: ['en']});
+        }).done();
+
+        if (!this.props.value) {
+            // If no value is given, we start with the first
+            // country selected, but our parent component
+            // doesn't know this, therefore we do this.
+            const _localSettings = UserSettingsStore.getLocalSettings();
+            if (_localSettings.hasOwnProperty('language')) {
+              this.props.onOptionChange(_localSettings.language);
+            }else {
+              const language = languageHandler.normalizeLanguageKey(languageHandler.getLanguageFromBrowser());
+              this.props.onOptionChange(language);
+            }
+        }
+    }
+
+    _onSearchChange(search) {
+        this.setState({
+            searchQuery: search,
+        });
+    }
+
+    render() {
+        if (this.state.langs === null) {
+            const Spinner = sdk.getComponent('elements.Spinner');
+            return <Spinner />;
+        }
+
+        const Dropdown = sdk.getComponent('elements.Dropdown');
+
+        let displayedLanguages;
+        if (this.state.searchQuery) {
+            displayedLanguages = this.state.langs.filter((lang) => {
+                return languageMatchesSearchQuery(this.state.searchQuery, lang);
+            });
+        } else {
+            displayedLanguages = this.state.langs;
+        }
+
+        const options = displayedLanguages.map((language) => {
+            return <div key={language.value}>
+                {language.label}
+            </div>;
+        });
+
+        // default value here too, otherwise we need to handle null / undefined
+        // values between mounting and the initial value propgating
+        let value = null;
+        const _localSettings = UserSettingsStore.getLocalSettings();
+        if (_localSettings.hasOwnProperty('language')) {
+          value = this.props.value || _localSettings.language;
+        } else {
+          const language = navigator.language || navigator.userLanguage;
+          value = this.props.value || language;
+        }
+
+        return <Dropdown className={this.props.className}
+            onOptionChange={this.props.onOptionChange} onSearchChange={this._onSearchChange}
+            searchEnabled={true} value={value}
+        >
+            {options}
+        </Dropdown>
+    }
+}
+
+LanguageDropdown.propTypes = {
+    className: React.PropTypes.string,
+    onOptionChange: React.PropTypes.func.isRequired,
+    value: React.PropTypes.string,
+};

src/components/views/elements/MemberEventListSummary.js

@@ -14,7 +14,9 @@ See the License for the specific language governing permissions and
 limitations under the License.
 */
 import React from 'react';
+import sdk from '../../../index';
 const MemberAvatar = require('../avatars/MemberAvatar.js');
+import { _t } from '../../../languageHandler';
 
 module.exports = React.createClass({
     displayName: 'MemberEventListSummary',
@@ -110,9 +112,13 @@ module.exports = React.createClass({
             return null;
         }
 
+        const EmojiText = sdk.getComponent('elements.EmojiText');
+
         return (
             <span className="mx_TextualEvent mx_MemberEventListSummary_summary">
-                {summaries.join(", ")}
+                <EmojiText>
+                    {summaries.join(", ")}
+                </EmojiText>
             </span>
         );
     },
@@ -203,30 +209,146 @@ module.exports = React.createClass({
      * @param {boolean} plural whether there were multiple users undergoing the same
      * transition.
      * @param {number} repeats the number of times the transition was repeated in a row.
-     * @returns {string} the written English equivalent of the transition.
+     * @returns {string} the written Human Readable equivalent of the transition.
      */
     _getDescriptionForTransition(t, plural, repeats) {
-        const beConjugated = plural ? "were" : "was";
-        const invitation = "their invitation" + (plural || (repeats > 1) ? "s" : "");
-
+        // The empty interpolations 'severalUsers' and 'oneUser'
+        // are there only to show translators to non-English languages
+        // that the verb is conjugated to plural or singular Subject.
         let res = null;
-        const map = {
-            "joined": "joined",
-            "left": "left",
-            "joined_and_left": "joined and left",
-            "left_and_joined": "left and rejoined",
-            "invite_reject": "rejected " + invitation,
-            "invite_withdrawal": "had " + invitation + " withdrawn",
-            "invited": beConjugated + " invited",
-            "banned": beConjugated + " banned",
-            "unbanned": beConjugated + " unbanned",
-            "kicked": beConjugated + " kicked",
-            "changed_name": "changed name",
-            "changed_avatar": "changed avatar",
-        };
-
-        if (Object.keys(map).includes(t)) {
-            res = map[t] + (repeats > 1 ? " " + repeats + " times" : "" );
+        switch(t) {
+            case "joined":
+                if (repeats > 1) {
+                    res = (plural)
+                        ? _t("%(severalUsers)sjoined %(repeats)s times", { severalUsers: "", repeats: repeats })
+                        : _t("%(oneUser)sjoined %(repeats)s times", { oneUser: "", repeats: repeats });
+                } else {
+                    res = (plural)
+                        ? _t("%(severalUsers)sjoined", { severalUsers: "" })
+                        : _t("%(oneUser)sjoined", { oneUser: "" });
+                }
+                break;
+            case "left":
+                if (repeats > 1) {
+                    res = (plural)
+                        ? _t("%(severalUsers)sleft %(repeats)s times", { severalUsers: "", repeats: repeats })
+                        : _t("%(oneUser)sleft %(repeats)s times", { oneUser: "", repeats: repeats });
+                } else {
+                    res = (plural)
+                        ? _t("%(severalUsers)sleft", { severalUsers: "" })
+                        : _t("%(oneUser)sleft", { oneUser: "" });
+                }
+               break;
+            case "joined_and_left":
+                if (repeats > 1) {
+                    res = (plural)
+                        ? _t("%(severalUsers)sjoined and left %(repeats)s times", { severalUsers: "", repeats: repeats })
+                        : _t("%(oneUser)sjoined and left %(repeats)s times", { oneUser: "", repeats: repeats });
+                } else {
+                    res = (plural)
+                        ? _t("%(severalUsers)sjoined and left", { severalUsers: "" })
+                        : _t("%(oneUser)sjoined and left", { oneUser: "" });
+                }
+                break;
+            case "left_and_joined":
+                if (repeats > 1) {
+                    res = (plural)
+                        ? _t("%(severalUsers)sleft and rejoined %(repeats)s times", { severalUsers: "", repeats: repeats })
+                        : _t("%(oneUser)sleft and rejoined %(repeats)s times", { oneUser: "", repeats: repeats });
+                } else {
+                    res = (plural)
+                        ? _t("%(severalUsers)sleft and rejoined", { severalUsers: "" })
+                        : _t("%(oneUser)sleft and rejoined", { oneUser: "" });
+                }
+                break;
+            case "invite_reject":
+                if (repeats > 1) {
+                    res = (plural)
+                        ? _t("%(severalUsers)srejected their invitations %(repeats)s times", { severalUsers: "", repeats: repeats })
+                        : _t("%(oneUser)srejected their invitation %(repeats)s times", { oneUser: "", repeats: repeats });
+                } else {
+                    res = (plural)
+                        ? _t("%(severalUsers)srejected their invitations", { severalUsers: "" })
+                        : _t("%(oneUser)srejected their invitation", { oneUser: "" });
+                }
+                break;
+            case "invite_withdrawal":
+                if (repeats > 1) {
+                    res = (plural)
+                        ? _t("%(severalUsers)shad their invitations withdrawn %(repeats)s times", { severalUsers: "", repeats: repeats })
+                        : _t("%(oneUser)shad their invitation withdrawn %(repeats)s times", { oneUser: "", repeats: repeats });
+                } else {
+                    res = (plural)
+                        ? _t("%(severalUsers)shad their invitations withdrawn", { severalUsers: "" })
+                        : _t("%(oneUser)shad their invitation withdrawn", { oneUser: "" });
+                }
+                break;
+            case "invited":
+                if (repeats > 1) {
+                    res = (plural)
+                        ? _t("were invited %(repeats)s times", { repeats: repeats })
+                        : _t("was invited %(repeats)s times", { repeats: repeats });
+                } else {
+                    res = (plural)
+                        ? _t("were invited")
+                        : _t("was invited");
+                }
+                break;
+            case "banned":
+                if (repeats > 1) {
+                    res = (plural)
+                        ? _t("were banned %(repeats)s times", { repeats: repeats })
+                        : _t("was banned %(repeats)s times", { repeats: repeats });
+                } else {
+                    res = (plural)
+                        ? _t("were banned")
+                        : _t("was banned");
+                }
+                break;
+            case "unbanned":
+                if (repeats > 1) {
+                    res = (plural)
+                        ? _t("were unbanned %(repeats)s times", { repeats: repeats })
+                        : _t("was unbanned %(repeats)s times", { repeats: repeats });
+                } else {
+                    res = (plural)
+                        ? _t("were unbanned")
+                        : _t("was unbanned");
+                }
+                break;
+            case "kicked":
+                if (repeats > 1) {
+                    res = (plural)
+                        ? _t("were kicked %(repeats)s times", { repeats: repeats })
+                        : _t("was kicked %(repeats)s times", { repeats: repeats });
+                } else {
+                    res = (plural)
+                        ? _t("were kicked")
+                        : _t("was kicked");
+                }
+                break;
+            case "changed_name":
+                if (repeats > 1) {
+                    res = (plural)
+                        ? _t("%(severalUsers)schanged their name %(repeats)s times", { severalUsers: "", repeats: repeats })
+                        : _t("%(oneUser)schanged their name %(repeats)s times", { oneUser: "", repeats: repeats });
+                } else {
+                    res = (plural)
+                        ? _t("%(severalUsers)schanged their name", { severalUsers: "" })
+                        : _t("%(oneUser)schanged their name", { oneUser: "" });
+                }
+                break;
+            case "changed_avatar":
+                if (repeats > 1) {
+                    res = (plural)
+                        ? _t("%(severalUsers)schanged their avatar %(repeats)s times", { severalUsers: "", repeats: repeats })
+                        : _t("%(oneUser)schanged their avatar %(repeats)s times", { oneUser: "", repeats: repeats });
+                } else {
+                    res = (plural)
+                        ? _t("%(severalUsers)schanged their avatar", { severalUsers: "" })
+                        : _t("%(oneUser)schanged their avatar", { oneUser: "" });
+                }
+                break;
         }
 
         return res;
@@ -254,11 +376,12 @@ module.exports = React.createClass({
             return items[0];
         } else if (remaining) {
             items = items.slice(0, itemLimit);
-            const other = " other" + (remaining > 1 ? "s" : "");
-            return items.join(', ') + ' and ' + remaining + other;
+            return (remaining > 1) 
+                ? _t("%(items)s and %(remaining)s others", { items: items.join(', '), remaining: remaining } )
+                : _t("%(items)s and one other", { items: items.join(', ') });
         } else {
             const lastItem = items.pop();
-            return items.join(', ') + ' and ' + lastItem;
+            return _t("%(items)s and %(lastItem)s", { items: items.join(', '), lastItem: lastItem });
         }
     },
 
@@ -269,7 +392,7 @@ module.exports = React.createClass({
             );
         });
         return (
-            <span className="mx_MemberEventListSummary_avatars">
+            <span className="mx_MemberEventListSummary_avatars" onClick={ this._toggleSummary }>
                 {avatars}
             </span>
         );

src/components/views/elements/PowerSelector.js

@@ -18,11 +18,10 @@ limitations under the License.
 
 import React from 'react';
 import * as Roles from '../../../Roles';
+import { _t } from '../../../languageHandler';
 
+var LEVEL_ROLE_MAP = {};
 var reverseRoles = {};
-Object.keys(Roles.LEVEL_ROLE_MAP).forEach(function(key) {
-    reverseRoles[Roles.LEVEL_ROLE_MAP[key]] = key;
-});
 
 module.exports = React.createClass({
     displayName: 'PowerSelector',
@@ -44,9 +43,16 @@ module.exports = React.createClass({
 
     getInitialState: function() {
         return {
-            custom: (Roles.LEVEL_ROLE_MAP[this.props.value] === undefined),
+            custom: (LEVEL_ROLE_MAP[this.props.value] === undefined),
         };
     },
+    
+    componentWillMount: function() {
+    	LEVEL_ROLE_MAP = Roles.levelRoleMap();
+    	Object.keys(LEVEL_ROLE_MAP).forEach(function(key) {
+			reverseRoles[LEVEL_ROLE_MAP[key]] = key;
+		});
+    },
 
     onSelectChange: function(event) {
         this.setState({ custom: event.target.value === "Custom" });
@@ -94,7 +100,7 @@ module.exports = React.createClass({
             selectValue = "Custom";
         }
         else {
-            selectValue = Roles.LEVEL_ROLE_MAP[this.props.value] || "Custom";
+            selectValue = LEVEL_ROLE_MAP[this.props.value] || "Custom";
         }
         var select;
         if (this.props.disabled) {
@@ -105,15 +111,15 @@ module.exports = React.createClass({
             const levels = [0, 50, 100];
             let options = levels.map((level) => {
                 return {
-                    value: Roles.LEVEL_ROLE_MAP[level],
+                    value: LEVEL_ROLE_MAP[level],
                     // Give a userDefault (users_default in the power event) of 0 but
                     // because level !== undefined, this should never be used.
                     text: Roles.textualPowerLevel(level, 0),
                 }
             });
-            options.push({ value: "Custom", text: "Custom level" });
+            options.push({ value: "Custom", text: _t("Custom level") });
             options = options.map((op) => {
-                return <option value={op.value}>{op.text}</option>;
+                return <option value={op.value} key={op.value}>{op.text}</option>;
             });
 
             select =

src/components/views/elements/RoomDirectoryButton.js

@@ -17,12 +17,14 @@ limitations under the License.
 import React from 'react';
 import sdk from '../../../index';
 import PropTypes from 'prop-types';
+import { _t } from '../../../languageHandler';
 
 const RoomDirectoryButton = function(props) {
     const ActionButton = sdk.getComponent('elements.ActionButton');
     return (
         <ActionButton action="view_room_directory"
-            label="Room directory"
+            mouseOverAction={props.callout ? "callout_room_directory" : null}
+            label={ _t("Room directory") }
             iconPath="img/icons-directory.svg"
             size={props.size}
             tooltip={props.tooltip}

src/components/views/elements/SettingsButton.js

@@ -17,12 +17,13 @@ limitations under the License.
 import React from 'react';
 import sdk from '../../../index';
 import PropTypes from 'prop-types';
+import { _t } from '../../../languageHandler';
 
 const SettingsButton = function(props) {
     const ActionButton = sdk.getComponent('elements.ActionButton');
     return (
         <ActionButton action="view_user_settings"
-            label="Settings"
+            label={ _t("Settings") }
             iconPath="img/icons-settings.svg"
             size={props.size}
             tooltip={props.tooltip}

src/components/views/elements/StartChatButton.js

@@ -17,12 +17,14 @@ limitations under the License.
 import React from 'react';
 import sdk from '../../../index';
 import PropTypes from 'prop-types';
+import { _t } from '../../../languageHandler';
 
 const StartChatButton = function(props) {
     const ActionButton = sdk.getComponent('elements.ActionButton');
     return (
         <ActionButton action="view_create_chat"
-            label="Start chat"
+            mouseOverAction={props.callout ? "callout_start_chat" : null}
+            label={ _t("Start chat") }
             iconPath="img/icons-people.svg"
             size={props.size}
             tooltip={props.tooltip}

src/components/views/elements/TruncatedList.js

@@ -14,6 +14,7 @@ See the License for the specific language governing permissions and
 limitations under the License.
 */
 var React = require('react');
+import { _t } from '../../../languageHandler';
 
 module.exports = React.createClass({
     displayName: 'TruncatedList',
@@ -33,7 +34,7 @@ module.exports = React.createClass({
             truncateAt: 2,
             createOverflowElement: function(overflowCount, totalCount) {
                 return (
-                    <div>And {overflowCount} more...</div>
+                    <div>{_t("And %(count)s more...", {count: overflowCount})}</div>
                 );
             }
         };

src/components/views/elements/UserSelector.js

@@ -16,7 +16,8 @@ limitations under the License.
 
 'use strict';
 
-var React = require('react');
+import React from 'react';
+import { _t } from '../../../languageHandler';
 
 module.exports = React.createClass({
     displayName: 'UserSelector',
@@ -59,9 +60,9 @@ module.exports = React.createClass({
                         return <li key={user_id}>{user_id} - <span onClick={function() {self.removeUser(user_id);}}>X</span></li>;
                     })}
                 </ul>
-                <input type="text" ref="user_id_input" defaultValue="" className="mx_UserSelector_userIdInput" placeholder="ex. @bob:example.com"/>
+                <input type="text" ref="user_id_input" defaultValue="" className="mx_UserSelector_userIdInput" placeholder={_t("ex. @bob:example.com")}/>
                 <button onClick={this.onAddUserId} className="mx_UserSelector_AddUserId">
-                    Add User
+                    {_t("Add User")}
                 </button>
             </div>
         );

src/components/views/login/CaptchaForm.js

@@ -16,7 +16,9 @@ limitations under the License.
 
 'use strict';
 
-var React = require('react');
+import React from 'react';
+import { _t } from '../../../languageHandler';
+
 var DIV_ID = 'mx_recaptcha';
 
 /**
@@ -44,6 +46,10 @@ module.exports = React.createClass({
         };
     },
 
+    componentWillMount: function() {
+        this._captchaWidgetId = null;
+    },
+
     componentDidMount: function() {
         // Just putting a script tag into the returned jsx doesn't work, annoyingly,
         // so we do this instead.
@@ -73,6 +79,10 @@ module.exports = React.createClass({
         }
     },
 
+    componentWillUnmount: function() {
+        this._resetRecaptcha();
+    },
+
     _renderRecaptcha: function(divId) {
         if (!global.grecaptcha) {
             console.error("grecaptcha not loaded!");
@@ -88,12 +98,18 @@ module.exports = React.createClass({
         }
 
         console.log("Rendering to %s", divId);
-        global.grecaptcha.render(divId, {
+        this._captchaWidgetId = global.grecaptcha.render(divId, {
             sitekey: publicKey,
             callback: this.props.onCaptchaResponse,
         });
     },
 
+    _resetRecaptcha: function() {
+        if (this._captchaWidgetId !== null) {
+            global.grecaptcha.reset(this._captchaWidgetId);
+        }
+    },
+
     _onCaptchaLoaded: function() {
         console.log("Loaded recaptcha script.");
         try {
@@ -117,7 +133,7 @@ module.exports = React.createClass({
 
         return (
             <div ref="recaptchaContainer">
-                This Home Server would like to make sure you are not a robot
+                {_t("This Home Server would like to make sure you are not a robot")}
                 <br/>
                 <div id={DIV_ID}></div>
                 {error}

src/components/views/login/CasLogin.js

@@ -16,7 +16,8 @@ limitations under the License.
 
 'use strict';
 
-var React = require('react');
+import React from 'react';
+import { _t } from '../../../languageHandler';
 
 module.exports = React.createClass({
     displayName: 'CasLogin',
@@ -28,7 +29,7 @@ module.exports = React.createClass({
     render: function() {
         return (
             <div>
-                <button onClick={this.props.onSubmit}>Sign in with CAS</button>
+                <button onClick={this.props.onSubmit}>{_t("Sign in with CAS")}</button>
             </div>
         );
     }

src/components/views/login/CountryDropdown.js

@@ -19,7 +19,6 @@ import React from 'react';
 import sdk from '../../../index';
 
 import { COUNTRIES } from '../../../phonenumber';
-import { charactersToImageNode } from '../../../HtmlUtils';
 
 const COUNTRIES_BY_ISO2 = new Object(null);
 for (const c of COUNTRIES) {
@@ -27,9 +26,14 @@ for (const c of COUNTRIES) {
 }
 
 function countryMatchesSearchQuery(query, country) {
+    // Remove '+' if present (when searching for a prefix)
+    if (query[0] === '+') {
+        query = query.slice(1);
+    }
+
     if (country.name.toUpperCase().indexOf(query.toUpperCase()) == 0) return true;
     if (country.iso2 == query.toUpperCase()) return true;
-    if (country.prefix == query) return true;
+    if (country.prefix.indexOf(query) !== -1) return true;
     return false;
 }
 
@@ -38,10 +42,11 @@ export default class CountryDropdown extends React.Component {
         super(props);
         this._onSearchChange = this._onSearchChange.bind(this);
         this._onOptionChange = this._onOptionChange.bind(this);
+        this._getShortOption = this._getShortOption.bind(this);
 
         this.state = {
             searchQuery: '',
-        }
+        };
     }
 
     componentWillMount() {
@@ -64,13 +69,21 @@ export default class CountryDropdown extends React.Component {
     }
 
     _flagImgForIso2(iso2) {
-        // Unicode Regional Indicator Symbol letter 'A'
-        const RIS_A = 0x1F1E6;
-        const ASCII_A = 65;
-        return charactersToImageNode(iso2, true,
-            RIS_A + (iso2.charCodeAt(0) - ASCII_A),
-            RIS_A + (iso2.charCodeAt(1) - ASCII_A),
-        );
+        return <img src={`flags/${iso2}.png`}/>;
+    }
+
+    _getShortOption(iso2) {
+        if (!this.props.isSmall) {
+            return undefined;
+        }
+        let countryPrefix;
+        if (this.props.showPrefix) {
+            countryPrefix = '+' + COUNTRIES_BY_ISO2[iso2].prefix;
+        }
+        return <span>
+            { this._flagImgForIso2(iso2) }
+            { countryPrefix }
+        </span>;
     }
 
     render() {
@@ -99,7 +112,7 @@ export default class CountryDropdown extends React.Component {
         const options = displayedCountries.map((country) => {
             return <div key={country.iso2}>
                 {this._flagImgForIso2(country.iso2)}
-                {country.name}
+                {country.name} <span>(+{country.prefix})</span>
             </div>;
         });
 
@@ -107,21 +120,21 @@ export default class CountryDropdown extends React.Component {
         // values between mounting and the initial value propgating
         const value = this.props.value || COUNTRIES[0].iso2;
 
-        const getShortOption = this.props.isSmall ? this._flagImgForIso2 : undefined;
-
-        return <Dropdown className={this.props.className}
+        return <Dropdown className={this.props.className + " left_aligned"}
             onOptionChange={this._onOptionChange} onSearchChange={this._onSearchChange}
-            menuWidth={298} getShortOption={getShortOption}
+            menuWidth={298} getShortOption={this._getShortOption}
             value={value} searchEnabled={true}
         >
             {options}
-        </Dropdown>
+        </Dropdown>;
     }
 }
 
 CountryDropdown.propTypes = {
     className: React.PropTypes.string,
     isSmall: React.PropTypes.bool,
+    // if isSmall, show +44 in the selected value
+    showPrefix: React.PropTypes.bool,
     onOptionChange: React.PropTypes.func.isRequired,
     value: React.PropTypes.string,
 };

src/components/views/login/CustomServerDialog.js

@@ -14,7 +14,8 @@ See the License for the specific language governing permissions and
 limitations under the License.
 */
 
-var React = require("react");
+import React from 'react';
+import { _t } from '../../../languageHandler';
 
 module.exports = React.createClass({
     displayName: 'CustomServerDialog',
@@ -23,24 +24,24 @@ module.exports = React.createClass({
         return (
             <div className="mx_ErrorDialog">
                 <div className="mx_Dialog_title">
-                    Custom Server Options
+                    {_t("Custom Server Options")}
                 </div>
                 <div className="mx_Dialog_content">
                     <span>
-                        You can use the custom server options to sign into other Matrix
-                        servers by specifying a different Home server URL.
+                        {_t("You can use the custom server options to sign into other Matrix " +
+                        "servers by specifying a different Home server URL.")}
                         <br/>
-                        This allows you to use this app with an existing Matrix account on
-                        a different home server.
+                        {_t("This allows you to use this app with an existing Matrix account on " +
+                            "a different home server.")}
                         <br/>
                         <br/>
-                        You can also set a custom identity server but this will typically prevent
-                        interaction with users based on email address.
+                        {_t("You can also set a custom identity server but this will typically prevent " +
+                            "interaction with users based on email address.")}
                     </span>
                 </div>
                 <div className="mx_Dialog_buttons">
                     <button onClick={this.props.onFinished} autoFocus={true}>
-                        Dismiss
+                        {_t("Dismiss")}
                     </button>
                 </div>
             </div>

src/components/views/login/InteractiveAuthEntryComponents.js

@@ -20,6 +20,7 @@ import url from 'url';
 import classnames from 'classnames';
 
 import sdk from '../../../index';
+import { _t } from '../../../languageHandler';
 
 /* This file contains a collection of components which are used by the
  * InteractiveAuth to prompt the user to enter the information needed
@@ -128,8 +129,8 @@ export const PasswordAuthEntry = React.createClass({
 
         return (
             <div>
-                <p>To continue, please enter your password.</p>
-                <p>Password:</p>
+                <p>{_t("To continue, please enter your password.")}</p>
+                <p>{_t("Password:")}</p>
                 <form onSubmit={this._onSubmit}>
                     <input
                         ref="passwordField"
@@ -255,8 +256,8 @@ export const EmailIdentityAuthEntry = React.createClass({
         } else {
             return (
                 <div>
-                    <p>An email has been sent to <i>{this.props.inputs.emailAddress}</i></p>
-                    <p>Please check your email to continue registration.</p>
+                    <p>{_t("An email has been sent to")} <i>{this.props.inputs.emailAddress}</i></p>
+                    <p>{_t("Please check your email to continue registration.")}</p>
                 </div>
             );
         }
@@ -348,7 +349,7 @@ export const MsisdnAuthEntry = React.createClass({
                 });
             } else {
                 this.setState({
-                    errorText: "Token incorrect",
+                    errorText: _t("Token incorrect"),
                 });
             }
         }).catch((e) => {
@@ -369,8 +370,8 @@ export const MsisdnAuthEntry = React.createClass({
             });
             return (
                 <div>
-                    <p>A text message has been sent to +<i>{this._msisdn}</i></p>
-                    <p>Please enter the code it contains:</p>
+                    <p>{_t("A text message has been sent to")} +<i>{this._msisdn}</i></p>
+                    <p>{_t("Please enter the code it contains:")}</p>
                     <div className="mx_InteractiveAuthEntryComponents_msisdnWrapper">
                         <form onSubmit={this._onFormSubmit}>
                             <input type="text"
@@ -379,7 +380,7 @@ export const MsisdnAuthEntry = React.createClass({
                                 onChange={this._onTokenChange}
                             />
                             <br />
-                            <input type="submit" value="Submit"
+                            <input type="submit" value={_t("Submit")}
                                 className={submitClasses}
                                 disabled={!enableSubmit}
                             />
@@ -439,7 +440,7 @@ export const FallbackAuthEntry = React.createClass({
     render: function() {
         return (
             <div>
-                <a onClick={this._onShowFallbackClick}>Start authentication</a>
+                <a onClick={this._onShowFallbackClick}>{_t("Start authentication")}</a>
                 <div className="error">
                     {this.props.errorText}
                 </div>

src/components/views/login/LoginFooter.js

@@ -16,7 +16,8 @@ limitations under the License.
 
 'use strict';
 
-var React = require('react');
+import { _t } from '../../../languageHandler';
+import React from 'react';
 
 module.exports = React.createClass({
     displayName: 'LoginFooter',
@@ -24,8 +25,8 @@ module.exports = React.createClass({
     render: function() {
         return (
             <div className="mx_Login_links">
-                <a href="https://matrix.org">powered by Matrix</a>
+                <a href="https://matrix.org">{_t("powered by Matrix")}</a>
             </div>
         );
-    }
+    },
 });

src/components/views/login/PasswordLogin.js

@@ -16,9 +16,9 @@ limitations under the License.
 */
 
 import React from 'react';
-import ReactDOM from 'react-dom';
 import classNames from 'classnames';
 import sdk from '../../../index';
+import { _t } from '../../../languageHandler';
 import {field_input_incorrect} from '../../../UiEffects';
 
 
@@ -121,56 +121,38 @@ class PasswordLogin extends React.Component {
                     autoFocus
                 />;
             case PasswordLogin.LOGIN_FIELD_MXID:
-                const mxidInputClasses = classNames({
-                    "mx_Login_field": true,
-                    "mx_Login_username": true,
-                    "mx_Login_field_has_prefix": true,
-                    "mx_Login_field_has_suffix": Boolean(this.props.hsDomain),
-                });
-                let suffix = null;
-                if (this.props.hsDomain) {
-                    suffix = <div className="mx_Login_field_suffix">
-                        :{this.props.hsDomain}
-                    </div>;
-                }
-                return <div className="mx_Login_field_group">
-                    <div className="mx_Login_field_prefix">@</div>
-                    <input
-                        className={mxidInputClasses}
-                        key="username_input"
-                        type="text"
-                        name="username" // make it a little easier for browser's remember-password
-                        onChange={this.onUsernameChanged}
-                        placeholder="username"
-                        value={this.state.username}
-                        autoFocus
-                    />
-                    {suffix}
-                </div>;
+                return <input
+                    className="mx_Login_field mx_Login_username"
+                    key="username_input"
+                    type="text"
+                    name="username" // make it a little easier for browser's remember-password
+                    onChange={this.onUsernameChanged}
+                    placeholder={_t('User name')}
+                    value={this.state.username}
+                    autoFocus
+                />;
             case PasswordLogin.LOGIN_FIELD_PHONE:
                 const CountryDropdown = sdk.getComponent('views.login.CountryDropdown');
-                const prefix = this.state.phonePrefix;
                 return <div className="mx_Login_phoneSection">
                     <CountryDropdown
-                        className="mx_Login_phoneCountry"
+                        className="mx_Login_phoneCountry mx_Login_field_prefix"
                         ref="phone_country"
                         onOptionChange={this.onPhoneCountryChanged}
                         value={this.state.phoneCountry}
+                        isSmall={true}
+                        showPrefix={true}
+                    />
+                    <input
+                        className="mx_Login_phoneNumberField mx_Login_field mx_Login_field_has_prefix"
+                        ref="phoneNumber"
+                        key="phone_input"
+                        type="text"
+                        name="phoneNumber"
+                        onChange={this.onPhoneNumberChanged}
+                        placeholder={_t("Mobile phone number")}
+                        value={this.state.phoneNumber}
+                        autoFocus
                     />
-                    <div className="mx_Login_field_group">
-                        <div className="mx_Login_field_prefix">+{prefix}</div>
-                        <input
-                            className="mx_Login_phoneNumberField mx_Login_field mx_Login_field_has_prefix"
-                            ref="phoneNumber"
-                            key="phone_input"
-                            type="text"
-                            name="phoneNumber"
-                            onChange={this.onPhoneNumberChanged}
-                            placeholder="Mobile phone number"
-                            value={this.state.phoneNumber}
-                            autoFocus
-                        />
-                    </div>
                 </div>;
         }
     }
@@ -181,7 +163,7 @@ class PasswordLogin extends React.Component {
         if (this.props.onForgotPasswordClick) {
             forgotPasswordJsx = (
                 <a className="mx_Login_forgot" onClick={this.props.onForgotPasswordClick} href="#">
-                    Forgot your password?
+                    { _t('Forgot your password?') }
                 </a>
             );
         }
@@ -199,24 +181,24 @@ class PasswordLogin extends React.Component {
             <div>
                 <form onSubmit={this.onSubmitForm}>
                 <div className="mx_Login_type_container">
-                    <label className="mx_Login_type_label">I want to sign in with my</label>
+                    <label className="mx_Login_type_label">{ _t('Sign in with') }</label>
                     <Dropdown
                         className="mx_Login_type_dropdown"
                         value={this.state.loginType}
                         onOptionChange={this.onLoginTypeChange}>
-                            <span key={PasswordLogin.LOGIN_FIELD_MXID}>Matrix ID</span>
-                            <span key={PasswordLogin.LOGIN_FIELD_EMAIL}>Email Address</span>
-                            <span key={PasswordLogin.LOGIN_FIELD_PHONE}>Phone</span>
+                            <span key={PasswordLogin.LOGIN_FIELD_MXID}>{ _t('my Matrix ID') }</span>
+                            <span key={PasswordLogin.LOGIN_FIELD_EMAIL}>{ _t('Email address') }</span>
+                            <span key={PasswordLogin.LOGIN_FIELD_PHONE}>{ _t('Phone') }</span>
                     </Dropdown>
                 </div>
                 {loginField}
                 <input className={pwFieldClass} ref={(e) => {this._passwordField = e;}} type="password"
                     name="password"
                     value={this.state.password} onChange={this.onPasswordChanged}
-                    placeholder="Password" />
+                    placeholder={ _t('Password') } />
                 <br />
                 {forgotPasswordJsx}
-                <input className="mx_Login_submit" type="submit" value="Sign in" />
+                <input className="mx_Login_submit" type="submit" value={ _t('Sign in') } />
                 </form>
             </div>
         );
@@ -239,7 +221,6 @@ PasswordLogin.propTypes = {
     onPhoneNumberChanged: React.PropTypes.func,
     onPasswordChanged: React.PropTypes.func,
     loginIncorrect: React.PropTypes.bool,
-    hsDomain: React.PropTypes.string,
 };
 
 module.exports = PasswordLogin;

src/components/views/login/RegistrationForm.js

@@ -21,6 +21,7 @@ import sdk from '../../../index';
 import Email from '../../../email';
 import { looksValid as phoneNumberLooksValid } from '../../../phonenumber';
 import Modal from '../../../Modal';
+import { _t } from '../../../languageHandler';
 
 const FIELD_EMAIL = 'field_email';
 const FIELD_PHONE_COUNTRY = 'field_phone_country';
@@ -53,11 +54,6 @@ module.exports = React.createClass({
             })).required,
         }),
 
-        // A username that will be used if no username is entered.
-        // Specifying this param will also warn the user that entering
-        // a different username will cause a fresh account to be generated.
-        guestUsername: React.PropTypes.string,
-
         minPasswordLength: React.PropTypes.number,
         onError: React.PropTypes.func,
         onRegisterClick: React.PropTypes.func.isRequired, // onRegisterClick(Object) => ?Promise
@@ -100,30 +96,29 @@ module.exports = React.createClass({
             if (this.refs.email.value == '') {
                 var QuestionDialog = sdk.getComponent("dialogs.QuestionDialog");
                 Modal.createDialog(QuestionDialog, {
-                    title: "Warning",
+                    title: _t("Warning!"),
                     description:
                         <div>
-                            If you don't specify an email address, you won't be able to reset your password.<br/>
-                            Are you sure?
+                            {_t("If you don't specify an email address, you won't be able to reset your password. " +
+                                "Are you sure?")}
                         </div>,
-                    button: "Continue",
+                    button: _t("Continue"),
                     onFinished: function(confirmed) {
                         if (confirmed) {
-                            self._doSubmit();
+                            self._doSubmit(ev);
                         }
                     },
                 });
-            }
-            else {
-                self._doSubmit();
+            } else {
+                self._doSubmit(ev);
             }
         }
     },
 
-    _doSubmit: function() {
+    _doSubmit: function(ev) {
         let email = this.refs.email.value.trim();
         var promise = this.props.onRegisterClick({
-            username: this.refs.username.value.trim() || this.props.guestUsername,
+            username: this.refs.username.value.trim(),
             password: this.refs.password.value.trim(),
             email: email,
             phoneCountry: this.state.phoneCountry,
@@ -191,7 +186,7 @@ module.exports = React.createClass({
                 break;
             case FIELD_USERNAME:
                 // XXX: SPEC-1
-                var username = this.refs.username.value.trim() || this.props.guestUsername;
+                var username = this.refs.username.value.trim();
                 if (encodeURIComponent(username) != username) {
                     this.markFieldValid(
                         field_id,
@@ -281,7 +276,7 @@ module.exports = React.createClass({
         const emailSection = (
             <div>
                 <input type="text" ref="email"
-                    autoFocus={true} placeholder="Email address (optional)"
+                    autoFocus={true} placeholder={_t("Email address (optional)")}
                     defaultValue={this.props.defaultEmail}
                     className={this._classForField(FIELD_EMAIL, 'mx_Login_field')}
                     onBlur={function() {self.validateField(FIELD_EMAIL);}}
@@ -304,7 +299,7 @@ module.exports = React.createClass({
             } else if (this.state.selectedTeam) {
                 belowEmailSection = (
                     <p className="mx_Login_support">
-                        You are registering with {this.state.selectedTeam.name}
+                        {_t("You are registering with %(SelectedTeamName)s", {SelectedTeamName: this.state.selectedTeam.name})}
                     </p>
                 );
             }
@@ -314,35 +309,31 @@ module.exports = React.createClass({
         const phoneSection = (
             <div className="mx_Login_phoneSection">
                 <CountryDropdown ref="phone_country" onOptionChange={this._onPhoneCountryChange}
-                    className="mx_Login_phoneCountry"
+                    className="mx_Login_phoneCountry mx_Login_field_prefix"
                     value={this.state.phoneCountry}
+                    isSmall={true}
+                    showPrefix={true}
+                />
+                <input type="text" ref="phoneNumber"
+                    placeholder={_t("Mobile phone number (optional)")}
+                    defaultValue={this.props.defaultPhoneNumber}
+                    className={this._classForField(
+                        FIELD_PHONE_NUMBER,
+                        'mx_Login_phoneNumberField',
+                        'mx_Login_field',
+                        'mx_Login_field_has_prefix'
+                    )}
+                    onBlur={function() {self.validateField(FIELD_PHONE_NUMBER);}}
+                    value={self.state.phoneNumber}
                 />
-                <div className="mx_Login_field_group">
-                    <div className="mx_Login_field_prefix">+{this.state.phonePrefix}</div>
-                    <input type="text" ref="phoneNumber"
-                        placeholder="Mobile phone number (optional)"
-                        defaultValue={this.props.defaultPhoneNumber}
-                        className={this._classForField(
-                            FIELD_PHONE_NUMBER,
-                            'mx_Login_phoneNumberField',
-                            'mx_Login_field',
-                            'mx_Login_field_has_prefix'
-                        )}
-                        onBlur={function() {self.validateField(FIELD_PHONE_NUMBER);}}
-                        value={self.state.phoneNumber}
-                    />
-                </div>
             </div>
         );
 
         const registerButton = (
-            <input className="mx_Login_submit" type="submit" value="Register" />
+            <input className="mx_Login_submit" type="submit" value={_t("Register")} />
         );
 
-        let placeholderUserName = "User name";
-        if (this.props.guestUsername) {
-            placeholderUserName += " (default: " + this.props.guestUsername + ")";
-        }
+        let placeholderUserName = _t("User name");
 
         return (
             <div>
@@ -355,16 +346,13 @@ module.exports = React.createClass({
                         className={this._classForField(FIELD_USERNAME, 'mx_Login_field')}
                         onBlur={function() {self.validateField(FIELD_USERNAME);}} />
                     <br />
-                    { this.props.guestUsername ?
-                        <div className="mx_Login_fieldLabel">Setting a user name will create a fresh account</div> : null
-                    }
                     <input type="password" ref="password"
                         className={this._classForField(FIELD_PASSWORD, 'mx_Login_field')}
                         onBlur={function() {self.validateField(FIELD_PASSWORD);}}
-                        placeholder="Password" defaultValue={this.props.defaultPassword} />
+                        placeholder={_t("Password")} defaultValue={this.props.defaultPassword} />
                     <br />
                     <input type="password" ref="passwordConfirm"
-                        placeholder="Confirm password"
+                        placeholder={_t("Confirm password")}
                         className={this._classForField(FIELD_PASSWORD_CONFIRM, 'mx_Login_field')}
                         onBlur={function() {self.validateField(FIELD_PASSWORD_CONFIRM);}}
                         defaultValue={this.props.defaultPassword} />

src/components/views/login/ServerConfig.js

@@ -19,6 +19,7 @@ limitations under the License.
 var React = require('react');
 var Modal = require('../../../Modal');
 var sdk = require('../../../index');
+import { _t } from '../../../languageHandler';
 
 /**
  * A pure UI component which displays the HS and IS to use.
@@ -131,19 +132,19 @@ module.exports = React.createClass({
         var toggleButton;
         if (this.props.withToggleButton) {
             toggleButton = (
-                <div style={{ textAlign: 'center' }}>
+                <div className="mx_ServerConfig_selector">
                     <input className="mx_Login_radio" id="basic" name="configVisible" type="radio"
                         checked={!this.state.configVisible}
                         onChange={this.onServerConfigVisibleChange.bind(this, false)} />
                     <label className="mx_Login_label" htmlFor="basic">
-                        Default server
+                        {_t("Default server")}
                     </label>
                     &nbsp;&nbsp;
                     <input className="mx_Login_radio" id="advanced" name="configVisible" type="radio"
                         checked={this.state.configVisible}
                         onChange={this.onServerConfigVisibleChange.bind(this, true)} />
                     <label className="mx_Login_label" htmlFor="advanced">
-                        Custom server
+                        {_t("Custom server")}
                     </label>
                 </div>
             );
@@ -155,7 +156,7 @@ module.exports = React.createClass({
             <div style={serverConfigStyle}>
                 <div className="mx_ServerConfig">
                     <label className="mx_Login_label mx_ServerConfig_hslabel" htmlFor="hsurl">
-                        Home server URL
+                        {_t("Home server URL")}
                     </label>
                     <input className="mx_Login_field" id="hsurl" type="text"
                         placeholder={this.props.defaultHsUrl}
@@ -163,7 +164,7 @@ module.exports = React.createClass({
                         value={this.state.hs_url}
                         onChange={this.onHomeserverChanged} />
                     <label className="mx_Login_label mx_ServerConfig_islabel" htmlFor="isurl">
-                        Identity server URL
+                        {_t("Identity server URL")}
                     </label>
                     <input className="mx_Login_field" id="isurl" type="text"
                         placeholder={this.props.defaultIsUrl}
@@ -171,7 +172,7 @@ module.exports = React.createClass({
                         value={this.state.is_url}
                         onChange={this.onIdentityServerChanged} />
                     <a className="mx_ServerConfig_help" href="#" onClick={this.showHelpPopup}>
-                        What does this mean?
+                        {_t("What does this mean?")}
                     </a>
                 </div>
             </div>

src/components/views/messages/MAudioBody.js

@@ -20,8 +20,8 @@ import React from 'react';
 import MFileBody from './MFileBody';
 
 import MatrixClientPeg from '../../../MatrixClientPeg';
-import sdk from '../../../index';
 import { decryptFile, readBlobAsDataUri } from '../../../utils/DecryptFile';
+import { _t } from '../../../languageHandler';
 
 export default class MAudioBody extends React.Component {
     constructor(props) {
@@ -77,7 +77,7 @@ export default class MAudioBody extends React.Component {
             return (
                 <span className="mx_MAudioBody" ref="body">
                     <img src="img/warning.svg" width="16" height="16"/>
-                    Error decrypting audio
+                    {_t("Error decrypting audio")}
                 </span>
             );
         }

src/components/views/messages/MFileBody.js

@@ -20,10 +20,10 @@ import React from 'react';
 import filesize from 'filesize';
 import MatrixClientPeg from '../../../MatrixClientPeg';
 import sdk from '../../../index';
+import { _t } from '../../../languageHandler';
 import {decryptFile} from '../../../utils/DecryptFile';
 import Tinter from '../../../Tinter';
 import request from 'browser-request';
-import q from 'q';
 import Modal from '../../../Modal';
 
 
@@ -202,7 +202,7 @@ module.exports = React.createClass({
      * @return {string} the human readable link text for the attachment.
      */
     presentableTextForFile: function(content) {
-        var linkText = 'Attachment';
+        var linkText = _t("Attachment");
         if (content.body && content.body.length > 0) {
             // The content body should be the name of the file including a
             // file extension.
@@ -261,7 +261,7 @@ module.exports = React.createClass({
         const content = this.props.mxEvent.getContent();
         const text = this.presentableTextForFile(content);
         const isEncrypted = content.file !== undefined;
-        const fileName = content.body && content.body.length > 0 ? content.body : "Attachment";
+        const fileName = content.body && content.body.length > 0 ? content.body : _t("Attachment");
         const contentUrl = this._getContentUrl();
         const ErrorDialog = sdk.getComponent("dialogs.ErrorDialog");
 
@@ -283,7 +283,8 @@ module.exports = React.createClass({
                     }).catch((err) => {
                         console.warn("Unable to decrypt attachment: ", err);
                         Modal.createDialog(ErrorDialog, {
-                            description: "Error decrypting attachment"
+                        	title: _t("Error"),
+                            description: _t("Error decrypting attachment"),
                         });
                     }).finally(() => {
                         decrypting = false;
@@ -295,7 +296,7 @@ module.exports = React.createClass({
                     <span className="mx_MFileBody" ref="body">
                         <div className="mx_MImageBody_download">
                             <a href="javascript:void(0)" onClick={decrypt}>
-                                Decrypt {text}
+                                { _t("Decrypt %(text)s", { text: text }) }
                             </a>
                         </div>
                     </span>
@@ -314,7 +315,7 @@ module.exports = React.createClass({
                     // We can't provide a Content-Disposition header like we would for HTTP.
                     download: fileName,
                     target: "_blank",
-                    textContent: "Download " + text,
+                    textContent: _t("Download %(text)s", { text: text }),
                 }, "*");
             };
 
@@ -362,7 +363,7 @@ module.exports = React.createClass({
                         <div className="mx_MImageBody_download">
                             <a href={contentUrl} download={fileName} target="_blank" rel="noopener">
                                 <img src={tintedDownloadImageURL} width="12" height="14" ref="downloadImage"/>
-                                Download {text}
+                                { _t("Download %(text)s", { text: text }) }
                             </a>
                         </div>
                     </span>
@@ -371,7 +372,7 @@ module.exports = React.createClass({
         } else {
             var extra = text ? (': ' + text) : '';
             return <span className="mx_MFileBody">
-                Invalid file{extra}
+                { _t("Invalid file%(extra)s", { extra: extra }) }
             </span>;
         }
     },

src/components/views/messages/MImageBody.js

@@ -26,6 +26,7 @@ import dis from '../../../dispatcher';
 import { decryptFile, readBlobAsDataUri } from '../../../utils/DecryptFile';
 import q from 'q';
 import UserSettingsStore from '../../../UserSettingsStore';
+import { _t } from '../../../languageHandler';
 
 module.exports = React.createClass({
     displayName: 'MImageBody',
@@ -56,7 +57,7 @@ module.exports = React.createClass({
             const ImageView = sdk.getComponent("elements.ImageView");
             const params = {
                 src: httpUrl,
-                name: content.body && content.body.length > 0 ? content.body : 'Attachment',
+                name: content.body && content.body.length > 0 ? content.body : _t('Attachment'),
                 mxEvent: this.props.mxEvent,
             };
 
@@ -191,7 +192,7 @@ module.exports = React.createClass({
             return (
                 <span className="mx_MImageBody" ref="body">
                     <img src="img/warning.svg" width="16" height="16"/>
-                    Error decrypting image
+                    {_t("Error decrypting image")}
                 </span>
             );
         }
@@ -238,13 +239,13 @@ module.exports = React.createClass({
         } else if (content.body) {
             return (
                 <span className="mx_MImageBody">
-                    Image '{content.body}' cannot be displayed.
+                    {_t("Image '%(Body)s' cannot be displayed.", {Body: content.body})}
                 </span>
             );
         } else {
             return (
                 <span className="mx_MImageBody">
-                    This image cannot be displayed.
+                    {_t("This image cannot be displayed.")}
                 </span>
             );
         }

src/components/views/messages/MVideoBody.js

@@ -19,11 +19,10 @@ limitations under the License.
 import React from 'react';
 import MFileBody from './MFileBody';
 import MatrixClientPeg from '../../../MatrixClientPeg';
-import Model from '../../../Modal';
-import sdk from '../../../index';
 import { decryptFile, readBlobAsDataUri } from '../../../utils/DecryptFile';
 import q from 'q';
 import UserSettingsStore from '../../../UserSettingsStore';
+import { _t } from '../../../languageHandler';
 
 module.exports = React.createClass({
     displayName: 'MVideoBody',
@@ -128,7 +127,7 @@ module.exports = React.createClass({
             return (
                 <span className="mx_MVideoBody" ref="body">
                     <img src="img/warning.svg" width="16" height="16"/>
-                    Error decrypting video
+                    {_t("Error decrypting video")}
                 </span>
             );
         }

src/components/views/messages/RoomAvatarEvent.js

@@ -0,0 +1,92 @@
+/*
+Copyright 2017 Vector Creations Ltd
+
+Licensed under the Apache License, Version 2.0 (the "License");
+you may not use this file except in compliance with the License.
+You may obtain a copy of the License at
+
+    http://www.apache.org/licenses/LICENSE-2.0
+
+Unless required by applicable law or agreed to in writing, software
+distributed under the License is distributed on an "AS IS" BASIS,
+WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+See the License for the specific language governing permissions and
+limitations under the License.
+*/
+
+import React from 'react';
+import MatrixClientPeg from '../../../MatrixClientPeg';
+import { ContentRepo } from 'matrix-js-sdk';
+import { _t, _tJsx } from '../../../languageHandler';
+import sdk from '../../../index';
+import Modal from '../../../Modal';
+import AccessibleButton from '../elements/AccessibleButton';
+
+module.exports = React.createClass({
+    displayName: 'RoomAvatarEvent',
+
+    propTypes: {
+        /* the MatrixEvent to show */
+        mxEvent: React.PropTypes.object.isRequired,
+    },
+
+    onAvatarClick: function(name) {
+        var httpUrl = MatrixClientPeg.get().mxcUrlToHttp(this.props.mxEvent.getContent().url);
+        var ImageView = sdk.getComponent("elements.ImageView");
+        var params = {
+            src: httpUrl,
+            name: name,
+        };
+        Modal.createDialog(ImageView, params, "mx_Dialog_lightbox");
+    },
+
+    render: function() {
+        var ev = this.props.mxEvent;
+        var senderDisplayName = ev.sender && ev.sender.name ? ev.sender.name : ev.getSender();
+        var BaseAvatar = sdk.getComponent("avatars.BaseAvatar");
+
+        var room = MatrixClientPeg.get().getRoom(this.props.mxEvent.getRoomId());
+        var name = _t('%(senderDisplayName)s changed the avatar for %(roomName)s', {
+                senderDisplayName: senderDisplayName,
+                roomName: room ? room.name : '',
+        });
+
+        if (!ev.getContent().url || ev.getContent().url.trim().length === 0) {
+            return (
+                <div className="mx_TextualEvent">
+                    { _t('%(senderDisplayName)s removed the room avatar.', {senderDisplayName: senderDisplayName}) }
+                </div>
+            );
+        }
+
+        var url = ContentRepo.getHttpUriForMxc(
+                    MatrixClientPeg.get().getHomeserverUrl(),
+                    ev.getContent().url,
+                    Math.ceil(14 * window.devicePixelRatio),
+                    Math.ceil(14 * window.devicePixelRatio),
+                    'crop'
+                );
+
+        // it sucks that _tJsx doesn't support normal _t substitutions :((
+        return (
+            <div className="mx_RoomAvatarEvent">
+                { _tJsx('$senderDisplayName changed the room avatar to <img/>',
+                         [
+                            /\$senderDisplayName/,
+                            /<img\/>/,
+                         ],
+                         [
+                            (sub) => senderDisplayName,
+                            (sub) =>
+                                <AccessibleButton key="avatar" className="mx_RoomAvatarEvent_avatar"
+                                                  onClick={ this.onAvatarClick.bind(this, name) }>
+                                    <BaseAvatar width={14} height={14} url={ url }
+                                                name={ name } />
+                                </AccessibleButton>,
+                         ]
+                    )
+                }
+            </div>
+        );
+    },
+});

src/components/views/messages/SenderProfile.js

@@ -30,7 +30,7 @@ export default function SenderProfile(props) {
     }
 
     return (
-        <EmojiText className="mx_SenderProfile"
+        <EmojiText className="mx_SenderProfile" dir="auto"
               onClick={props.onClick}>{`${name || ''} ${props.aux || ''}`}</EmojiText>
     );
 }

src/components/views/messages/TextualBody.js

@@ -28,6 +28,7 @@ import ScalarAuthClient from '../../../ScalarAuthClient';
 import Modal from '../../../Modal';
 import SdkConfig from '../../../SdkConfig';
 import dis from '../../../dispatcher';
+import { _t } from '../../../languageHandler';
 
 linkifyMatrix(linkify);
 
@@ -62,6 +63,19 @@ module.exports = React.createClass({
         };
     },
 
+    copyToClipboard: function(text) {
+        const textArea = document.createElement("textarea");
+        textArea.value = text;
+        document.body.appendChild(textArea);
+        textArea.select();
+        try {
+            const successful = document.execCommand('copy');
+        } catch (err) {
+            console.log('Unable to copy');
+        }
+        document.body.removeChild(textArea);
+    },
+
     componentDidMount: function() {
         this._unmounted = false;
 
@@ -80,6 +94,14 @@ module.exports = React.createClass({
                     }
                 }, 10);
             }
+            // add event handlers to the 'copy code' buttons
+            const buttons = ReactDOM.findDOMNode(this).getElementsByClassName("mx_EventTile_copyButton");
+            for (let i = 0; i < buttons.length; i++) {
+                buttons[i].onclick = (e) => {
+                    const copyCode = buttons[i].parentNode.getElementsByTagName("code")[0];
+                    this.copyToClipboard(copyCode.textContent);
+                };
+            }
         }
     },
 
@@ -230,14 +252,14 @@ module.exports = React.createClass({
             let QuestionDialog = sdk.getComponent("dialogs.QuestionDialog");
             let integrationsUrl = SdkConfig.get().integrations_ui_url;
             Modal.createDialog(QuestionDialog, {
-                title: "Add an Integration",
+                title: _t("Add an Integration"),
                 description:
                     <div>
-                        You are about to be taken to a third-party site so you can
-                        authenticate your account for use with {integrationsUrl}.<br/>
-                        Do you wish to continue?
+                        {_t("You are about to be taken to a third-party site so you can " +
+                            "authenticate your account for use with %(integrationsUrl)s. " +
+                            "Do you wish to continue?", { integrationsUrl: integrationsUrl })}
                     </div>,
-                button: "Continue",
+                button: _t("Continue"),
                 onFinished: function(confirmed) {
                     if (!confirmed) {
                         return;

src/components/views/messages/TextualEvent.js

@@ -24,6 +24,11 @@ import sdk from '../../../index';
 module.exports = React.createClass({
     displayName: 'TextualEvent',
 
+    propTypes: {
+        /* the MatrixEvent to show */
+        mxEvent: React.PropTypes.object.isRequired,
+    },
+    
     render: function() {
         const EmojiText = sdk.getComponent('elements.EmojiText');
         var text = TextForEvent.textForEvent(this.props.mxEvent);

src/components/views/messages/UnknownBody.js

@@ -16,7 +16,8 @@ limitations under the License.
 
 'use strict';
 
-var React = require('react');
+import React from 'react';
+import { _t } from '../../../languageHandler';
 
 module.exports = React.createClass({
     displayName: 'UnknownBody',
@@ -24,7 +25,7 @@ module.exports = React.createClass({
     render: function() {
         const text = this.props.mxEvent.getContent().body;
         return (
-            <span className="mx_UnknownBody" title="Redacted or unknown message type">
+            <span className="mx_UnknownBody" title={_t("Removed or unknown message type")}>
                 {text}
             </span>
         );

src/components/views/room_settings/AliasSettings.js

@@ -19,6 +19,7 @@ var React = require('react');
 var ObjectUtils = require("../../../ObjectUtils");
 var MatrixClientPeg = require('../../../MatrixClientPeg');
 var sdk = require("../../../index");
+import { _t } from '../../../languageHandler';
 var Modal = require("../../../Modal");
 
 module.exports = React.createClass({
@@ -154,8 +155,8 @@ module.exports = React.createClass({
         else {
             var ErrorDialog = sdk.getComponent("dialogs.ErrorDialog");
             Modal.createDialog(ErrorDialog, {
-                title: "Invalid alias format",
-                description: "'" + alias + "' is not a valid format for an alias",
+                title: _t('Invalid alias format'),
+                description: _t('\'%(alias)s\' is not a valid format for an alias', { alias: alias }),
             });
         }
     },
@@ -170,8 +171,8 @@ module.exports = React.createClass({
         else {
             var ErrorDialog = sdk.getComponent("dialogs.ErrorDialog");
             Modal.createDialog(ErrorDialog, {
-                title: "Invalid address format",
-                description: "'" + alias + "' is not a valid format for an address",
+                title: _t('Invalid address format'),
+                description: _t('\'%(alias)s\' is not a valid format for an address', { alias: alias }),
             });
         }
     },
@@ -203,7 +204,7 @@ module.exports = React.createClass({
         if (this.props.canSetCanonicalAlias) {
             canonical_alias_section = (
                 <select onChange={this.onCanonicalAliasChange} defaultValue={ this.state.canonicalAlias }>
-                    <option value="" key="unset">not specified</option>
+                    <option value="" key="unset">{ _t('not specified') }</option>
                     {
                         Object.keys(self.state.domainToAliases).map(function(domain, i) {
                             return self.state.domainToAliases[domain].map(function(alias, j) {
@@ -220,7 +221,7 @@ module.exports = React.createClass({
         }
         else {
             canonical_alias_section = (
-                <b>{ this.state.canonicalAlias || "not set" }</b>
+                <b>{ this.state.canonicalAlias || _t('not set') }</b>
             );
         }
 
@@ -229,7 +230,7 @@ module.exports = React.createClass({
             remote_aliases_section = (
                 <div>
                     <div className="mx_RoomSettings_aliasLabel">
-                        Remote addresses for this room:
+                        {_t("Remote addresses for this room:")}
                     </div>
                     <div className="mx_RoomSettings_aliasesTable">
                         { this.state.remoteDomains.map((domain, i) => {
@@ -254,13 +255,13 @@ module.exports = React.createClass({
             <div>
                 <h3>Addresses</h3>
                 <div className="mx_RoomSettings_aliasLabel">
-                    The main address for this room is: { canonical_alias_section }
+                    { _t('The main address for this room is') }: { canonical_alias_section }
                 </div>
                 <div className="mx_RoomSettings_aliasLabel">
                     { (this.state.domainToAliases[localDomain] &&
                         this.state.domainToAliases[localDomain].length > 0)
-                      ? "Local addresses for this room:"
-                      : "This room has no local addresses" }
+                      ? _t('Local addresses for this room:')
+                      : _t('This room has no local addresses') }
                 </div>
                 <div className="mx_RoomSettings_aliasesTable">
                     { (this.state.domainToAliases[localDomain] || []).map((alias, i) => {
@@ -268,7 +269,7 @@ module.exports = React.createClass({
                         if (this.props.canSetAliases) {
                             deleteButton = (
                                 <img src="img/cancel-small.svg" width="14" height="14"
-                                    alt="Delete" onClick={ self.onAliasDeleted.bind(self, localDomain, i) } />
+                                    alt={ _t('Delete') } onClick={ self.onAliasDeleted.bind(self, localDomain, i) } />
                             );
                         }
                         return (
@@ -276,7 +277,7 @@ module.exports = React.createClass({
                                 <EditableText
                                     className="mx_RoomSettings_alias mx_RoomSettings_editable"
                                     placeholderClassName="mx_RoomSettings_aliasPlaceholder"
-                                    placeholder={ "New address (e.g. #foo:" + localDomain + ")" }
+                                    placeholder={ _t('New address (e.g. #foo:%(localDomain)s)', { localDomain: localDomain}) }
                                     blurToCancel={ false }
                                     onValueChanged={ self.onAliasChanged.bind(self, localDomain, i) }
                                     editable={ self.props.canSetAliases }
@@ -294,7 +295,7 @@ module.exports = React.createClass({
                                 ref="add_alias"
                                 className="mx_RoomSettings_alias mx_RoomSettings_editable"
                                 placeholderClassName="mx_RoomSettings_aliasPlaceholder"
-                                placeholder={ "New address (e.g. #foo:" + localDomain + ")" }
+                                placeholder={ _t('New address (e.g. #foo:%(localDomain)s)', { localDomain: localDomain}) }
                                 blurToCancel={ false }
                                 onValueChanged={ self.onAliasAdded } />
                             <div className="mx_RoomSettings_addAlias mx_filterFlipColor">

src/components/views/room_settings/ColorSettings.js

@@ -21,6 +21,8 @@ var Tinter = require('../../../Tinter');
 var MatrixClientPeg = require("../../../MatrixClientPeg");
 var Modal = require("../../../Modal");
 
+import dis from '../../../dispatcher';
+
 var ROOM_COLORS = [
     // magic room default values courtesy of Ribot
     ["#76cfa6", "#eaf5f0"],
@@ -86,11 +88,7 @@ module.exports = React.createClass({
                 }
             ).catch(function(err) {
                 if (err.errcode == 'M_GUEST_ACCESS_FORBIDDEN') {
-                    var NeedToRegisterDialog = sdk.getComponent("dialogs.NeedToRegisterDialog");
-                    Modal.createDialog(NeedToRegisterDialog, {
-                        title: "Please Register",
-                        description: "Saving room color settings is only available to registered users"
-                    });
+                    dis.dispatch({action: 'view_set_mxid'});
                 }
             });
         }

src/components/views/room_settings/UrlPreviewSettings.js

@@ -20,6 +20,7 @@ var MatrixClientPeg = require('../../../MatrixClientPeg');
 var sdk = require("../../../index");
 var Modal = require("../../../Modal");
 var UserSettingsStore = require('../../../UserSettingsStore');
+import { _t, _tJsx } from '../../../languageHandler';
 
 
 module.exports = React.createClass({
@@ -120,35 +121,47 @@ module.exports = React.createClass({
                     <input type="checkbox" ref="globalDisableUrlPreview"
                            onChange={ this.onGlobalDisableUrlPreviewChange }
                            checked={ this.state.globalDisableUrlPreview } />
-                    Disable URL previews by default for participants in this room
+                    {_t("Disable URL previews by default for participants in this room")}
                 </label>;
         }
         else {
             disableRoomPreviewUrls =
                 <label>
-                    URL previews are { this.state.globalDisableUrlPreview ? "disabled" : "enabled" } by default for participants in this room.
+                    {_t("URL previews are %(globalDisableUrlPreview)s by default for participants in this room.", {globalDisableUrlPreview: this.state.globalDisableUrlPreview ? _t("disabled") : _t("enabled")})}
                 </label>;
         }
 
+        let urlPreviewText = null;
+        if (UserSettingsStore.getUrlPreviewsDisabled()) {
+            urlPreviewText = (
+                _tJsx("You have <a>disabled</a> URL previews by default.", /<a>(.*?)<\/a>/, (sub)=><a href="#/settings">{sub}</a>)
+            );
+        }
+        else {
+            urlPreviewText = (
+                _tJsx("You have <a>enabled</a> URL previews by default.", /<a>(.*?)<\/a>/, (sub)=><a href="#/settings">{sub}</a>)
+            );
+        }
+
         return (
             <div className="mx_RoomSettings_toggles">
-                <h3>URL Previews</h3>
+                <h3>{_t("URL Previews")}</h3>
 
                 <label>
-                    You have <a href="#/settings">{ UserSettingsStore.getUrlPreviewsDisabled() ? 'disabled' : 'enabled' }</a> URL previews by default.
+                {urlPreviewText}
                 </label>
                 { disableRoomPreviewUrls }
                 <label>
                     <input type="checkbox" ref="userEnableUrlPreview"
                            onChange={ this.onUserEnableUrlPreviewChange }
                            checked={ this.state.userEnableUrlPreview } />
-                    Enable URL previews for this room (affects only you)
+                    {_t("Enable URL previews for this room (affects only you)")}
                 </label>
                 <label>
                     <input type="checkbox" ref="userDisableUrlPreview"
                            onChange={ this.onUserDisableUrlPreviewChange }
                            checked={ this.state.userDisableUrlPreview } />
-                    Disable URL previews for this room (affects only you)
+                    {_t("Disable URL previews for this room (affects only you)")}
                 </label>
             </div>
         );

src/components/views/rooms/Autocomplete.js

@@ -4,7 +4,7 @@ import classNames from 'classnames';
 import flatMap from 'lodash/flatMap';
 import isEqual from 'lodash/isEqual';
 import sdk from '../../../index';
-import type {Completion, SelectionRange} from '../../../autocomplete/Autocompleter';
+import type {Completion} from '../../../autocomplete/Autocompleter';
 import Q from 'q';
 import UserSettingsStore from '../../../UserSettingsStore';
 

src/components/views/rooms/AuxPanel.js

@@ -14,11 +14,13 @@ See the License for the specific language governing permissions and
 limitations under the License.
 */
 
-var React = require('react');
-var MatrixClientPeg = require("../../../MatrixClientPeg");
-var sdk = require('../../../index');
-var dis = require("../../../dispatcher");
-var ObjectUtils = require('../../../ObjectUtils');
+import React from 'react';
+import MatrixClientPeg from "../../../MatrixClientPeg";
+import sdk from '../../../index';
+import dis from "../../../dispatcher";
+import ObjectUtils from '../../../ObjectUtils';
+import  { _t, _tJsx} from '../../../languageHandler';
+
 
 module.exports = React.createClass({
     displayName: 'AuxPanel',
@@ -76,10 +78,10 @@ module.exports = React.createClass({
             fileDropTarget = (
                 <div className="mx_RoomView_fileDropTarget">
                     <div className="mx_RoomView_fileDropTargetLabel"
-                      title="Drop File Here">
+                      title={_t("Drop File Here")}>
                         <TintableSvg src="img/upload-big.svg" width="45" height="59"/>
                         <br/>
-                        Drop file here to upload
+                        {_t("Drop file here to upload")}
                     </div>
                 </div>
             );
@@ -87,21 +89,31 @@ module.exports = React.createClass({
 
         var conferenceCallNotification = null;
         if (this.props.displayConfCallNotification) {
-            var supportedText, joinText;
+            let supportedText = '';
+            let joinNode;
             if (!MatrixClientPeg.get().supportsVoip()) {
-                supportedText = " (unsupported)";
+                supportedText = _t(" (unsupported)");
             }
             else {
-                joinText = (<span>
-                    Join as <a onClick={(event)=>{ this.onConferenceNotificationClick(event, 'voice');}}
-                               href="#">voice</a> or <a onClick={(event)=>{ this.onConferenceNotificationClick(event, 'video'); }}
-                               href="#">video</a>.
+                joinNode = (<span>
+                    {_tJsx(
+                        "Join as <voiceText>voice</voiceText> or <videoText>video</videoText>.",
+                        [/<voiceText>(.*?)<\/voiceText>/, /<videoText>(.*?)<\/videoText>/],
+                        [
+                            (sub) => <a onClick={(event)=>{ this.onConferenceNotificationClick(event, 'voice');}} href="#">{sub}</a>,
+                            (sub) => <a onClick={(event)=>{ this.onConferenceNotificationClick(event, 'video');}} href="#">{sub}</a>,
+                        ]
+                    )}
                 </span>);
 
             }
+            // XXX: the translation here isn't great: appending ' (unsupported)' is likely to not make sense in many languages,
+            // but there are translations for this in the languages we do have so I'm leaving it for now.
             conferenceCallNotification = (
                 <div className="mx_RoomView_ongoingConfCallNotification">
-                    Ongoing conference call{ supportedText }. { joinText }
+                    {_t("Ongoing conference call%(supportedText)s.", {supportedText: supportedText})}
+                    &nbsp;
+                    {joinNode}
                 </div>
             );
         }

src/components/views/rooms/EntityTile.js

@@ -21,6 +21,7 @@ var React = require('react');
 var MatrixClientPeg = require('../../../MatrixClientPeg');
 var sdk = require('../../../index');
 import AccessibleButton from '../elements/AccessibleButton';
+import { _t } from '../../../languageHandler';
 
 
 var PRESENCE_CLASS = {
@@ -115,7 +116,7 @@ module.exports = React.createClass({
             nameEl = (
                 <div className="mx_EntityTile_details">
                     <img className="mx_EntityTile_chevron" src="img/member_chevron.png" width="8" height="12"/>
-                    <EmojiText element="div" className="mx_EntityTile_name_hover">{name}</EmojiText>
+                    <EmojiText element="div" className="mx_EntityTile_name_hover" dir="auto">{name}</EmojiText>
                     <PresenceLabel activeAgo={ activeAgo }
                         currentlyActive={this.props.presenceCurrentlyActive}
                         presenceState={this.props.presenceState} />
@@ -124,7 +125,7 @@ module.exports = React.createClass({
         }
         else {
             nameEl = (
-                <EmojiText element="div" className="mx_EntityTile_name">{name}</EmojiText>
+                <EmojiText element="div" className="mx_EntityTile_name" dir="auto">{name}</EmojiText>
             );
         }
 
@@ -140,10 +141,10 @@ module.exports = React.createClass({
         var power;
         var powerLevel = this.props.powerLevel;
         if (powerLevel >= 50 && powerLevel < 99) {
-            power = <img src="img/mod.svg" className="mx_EntityTile_power" width="16" height="17" alt="Mod"/>;
+            power = <img src="img/mod.svg" className="mx_EntityTile_power" width="16" height="17" alt={_t("Moderator")}/>;
         }
         if (powerLevel >= 99) {
-            power = <img src="img/admin.svg" className="mx_EntityTile_power" width="16" height="17" alt="Admin"/>;
+            power = <img src="img/admin.svg" className="mx_EntityTile_power" width="16" height="17" alt={_t("Admin")}/>;
         }
 
 

src/components/views/rooms/EventTile.js

@@ -16,8 +16,10 @@ limitations under the License.
 
 'use strict';
 
+
 var React = require('react');
 var classNames = require("classnames");
+import { _t } from '../../../languageHandler';
 var Modal = require('../../../Modal');
 
 var sdk = require('../../../index');
@@ -36,6 +38,7 @@ var eventTileTypes = {
     'm.call.answer' : 'messages.TextualEvent',
     'm.call.hangup' : 'messages.TextualEvent',
     'm.room.name'   : 'messages.TextualEvent',
+    'm.room.avatar' : 'messages.RoomAvatarEvent',
     'm.room.topic'  : 'messages.TextualEvent',
     'm.room.third_party_invite' : 'messages.TextualEvent',
     'm.room.history_visibility' : 'messages.TextualEvent',
@@ -129,6 +132,9 @@ module.exports = WithMatrixClient(React.createClass({
          * for now.
          */
         tileShape: React.PropTypes.string,
+
+        // show twelve hour timestamps
+        isTwelveHour: React.PropTypes.bool,
     },
 
     getInitialState: function() {
@@ -295,16 +301,6 @@ module.exports = WithMatrixClient(React.createClass({
         const receiptOffset = 15;
         let left = 0;
 
-        // It's possible that the receipt was sent several days AFTER the event.
-        // If it is, we want to display the complete date along with the HH:MM:SS,
-        // rather than just HH:MM:SS.
-        let dayAfterEvent = new Date(this.props.mxEvent.getTs());
-        dayAfterEvent.setDate(dayAfterEvent.getDate() + 1);
-        dayAfterEvent.setHours(0);
-        dayAfterEvent.setMinutes(0);
-        dayAfterEvent.setSeconds(0);
-        let dayAfterEventTime = dayAfterEvent.getTime();
-
         var receipts = this.props.readReceipts || [];
         for (var i = 0; i < receipts.length; ++i) {
             var receipt = receipts[i];
@@ -340,7 +336,7 @@ module.exports = WithMatrixClient(React.createClass({
                     suppressAnimation={this._suppressReadReceiptAnimation}
                     onClick={this.toggleAllReadAvatars}
                     timestamp={receipt.ts}
-                    showFullTimestamp={receipt.ts >= dayAfterEventTime}
+                    showTwelveHour={this.props.isTwelveHour}
                 />
             );
         }
@@ -386,6 +382,7 @@ module.exports = WithMatrixClient(React.createClass({
         dis.dispatch({
             action: 'view_room',
             event_id: this.props.mxEvent.getId(),
+            highlighted: true,
             room_id: this.props.mxEvent.getRoomId(),
         });
     },
@@ -415,9 +412,10 @@ module.exports = WithMatrixClient(React.createClass({
         var isSending = (['sending', 'queued', 'encrypting'].indexOf(this.props.eventSendStatus) !== -1);
         const isRedacted = (eventType === 'm.room.message') && this.props.isRedacted;
 
-        var classes = classNames({
+        const classes = classNames({
             mx_EventTile: true,
             mx_EventTile_info: isInfoMessage,
+            mx_EventTile_12hr: this.props.isTwelveHour,
             mx_EventTile_encrypting: this.props.eventSendStatus == 'encrypting',
             mx_EventTile_sending: isSending,
             mx_EventTile_notSent: this.props.eventSendStatus == 'not_sent',
@@ -475,9 +473,9 @@ module.exports = WithMatrixClient(React.createClass({
         if (needsSenderProfile) {
             let aux = null;
             if (!this.props.tileShape) {
-                if (msgtype === 'm.image') aux = "sent an image";
-                else if (msgtype === 'm.video') aux = "sent a video";
-                else if (msgtype === 'm.file') aux = "uploaded a file";
+                if (msgtype === 'm.image') aux = _t('sent an image');
+                else if (msgtype === 'm.video') aux = _t('sent a video');
+                else if (msgtype === 'm.file') aux = _t('uploaded a file');
                 sender = <SenderProfile onClick={ this.onSenderProfileClick } mxEvent={this.props.mxEvent} aux={aux} />;
             }
             else {
@@ -485,36 +483,34 @@ module.exports = WithMatrixClient(React.createClass({
             }
         }
 
-        var editButton = (
-            <span className="mx_EventTile_editButton" title="Options" onClick={this.onEditClicked} />
+        const editButton = (
+            <span className="mx_EventTile_editButton" title={ _t("Options") } onClick={this.onEditClicked} />
         );
-
-        var e2e;
+        let e2e;
         // cosmetic padlocks:
         if ((e2eEnabled && this.props.eventSendStatus) || this.props.mxEvent.getType() === 'm.room.encryption') {
-            e2e = <img style={{ cursor: 'initial', marginLeft: '-1px' }} className="mx_EventTile_e2eIcon" src="img/e2e-verified.svg" width="10" height="12" />;
+            e2e = <img style={{ cursor: 'initial', marginLeft: '-1px' }} className="mx_EventTile_e2eIcon" alt={_t("Encrypted by a verified device")} src="img/e2e-verified.svg" width="10" height="12" />;
         }
         // real padlocks
         else if (this.props.mxEvent.isEncrypted() || (e2eEnabled && this.props.eventSendStatus)) {
             if (this.props.mxEvent.getContent().msgtype === 'm.bad.encrypted') {
-                e2e = <img onClick={ this.onCryptoClicked } className="mx_EventTile_e2eIcon" src="img/e2e-blocked.svg" width="12" height="12" style={{ marginLeft: "-1px" }} />;
+                e2e = <img onClick={ this.onCryptoClicked } className="mx_EventTile_e2eIcon" alt={_t("Undecryptable")} src="img/e2e-blocked.svg" width="12" height="12" style={{ marginLeft: "-1px" }} />;
             }
             else if (this.state.verified == true || (e2eEnabled && this.props.eventSendStatus)) {
-                e2e = <img onClick={ this.onCryptoClicked } className="mx_EventTile_e2eIcon" src="img/e2e-verified.svg" width="10" height="12"/>;
+                e2e = <img onClick={ this.onCryptoClicked } className="mx_EventTile_e2eIcon" alt={_t("Encrypted by a verified device")} src="img/e2e-verified.svg" width="10" height="12"/>;
             }
             else {
-                e2e = <img onClick={ this.onCryptoClicked } className="mx_EventTile_e2eIcon" src="img/e2e-warning.svg" width="15" height="12" style={{ marginLeft: "-2px" }}/>;
+                e2e = <img onClick={ this.onCryptoClicked } className="mx_EventTile_e2eIcon" alt={_t("Encrypted by an unverified device")} src="img/e2e-warning.svg" width="15" height="12" style={{ marginLeft: "-2px" }}/>;
             }
         }
         else if (e2eEnabled) {
-            e2e = <img onClick={ this.onCryptoClicked } className="mx_EventTile_e2eIcon" src="img/e2e-unencrypted.svg" width="12" height="12"/>;
+            e2e = <img onClick={ this.onCryptoClicked } className="mx_EventTile_e2eIcon" alt={_t("Unencrypted message")} src="img/e2e-unencrypted.svg" width="12" height="12"/>;
         }
         const timestamp = this.props.mxEvent.getTs() ?
-            <MessageTimestamp ts={this.props.mxEvent.getTs()} /> : null;
+            <MessageTimestamp showTwelveHour={this.props.isTwelveHour} ts={this.props.mxEvent.getTs()} /> : null;
 
         if (this.props.tileShape === "notif") {
-            var room = this.props.matrixClient.getRoom(this.props.mxEvent.getRoomId());
-
+            const room = this.props.matrixClient.getRoom(this.props.mxEvent.getRoomId());
             return (
                 <div className={classes}>
                     <div className="mx_EventTile_roomName">

src/components/views/rooms/ForwardMessage.js

@@ -0,0 +1,68 @@
+/*
+ Copyright 2017 Vector Creations Ltd
+ Copyright 2017 Michael Telatynski
+
+ Licensed under the Apache License, Version 2.0 (the "License");
+ you may not use this file except in compliance with the License.
+ You may obtain a copy of the License at
+
+ http://www.apache.org/licenses/LICENSE-2.0
+
+ Unless required by applicable law or agreed to in writing, software
+ distributed under the License is distributed on an "AS IS" BASIS,
+ WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ See the License for the specific language governing permissions and
+ limitations under the License.
+ */
+
+import React from 'react';
+import { _t } from '../../../languageHandler';
+import dis from '../../../dispatcher';
+import KeyCode from '../../../KeyCode';
+
+
+module.exports = React.createClass({
+    displayName: 'ForwardMessage',
+
+    propTypes: {
+        onCancelClick: React.PropTypes.func.isRequired,
+    },
+
+    componentWillMount: function() {
+        dis.dispatch({
+            action: 'ui_opacity',
+            leftOpacity: 1.0,
+            rightOpacity: 0.3,
+            middleOpacity: 0.5,
+        });
+    },
+
+    componentDidMount: function() {
+        document.addEventListener('keydown', this._onKeyDown);
+    },
+
+    componentWillUnmount: function() {
+        dis.dispatch({
+            action: 'ui_opacity',
+            sideOpacity: 1.0,
+            middleOpacity: 1.0,
+        });
+        document.removeEventListener('keydown', this._onKeyDown);
+    },
+
+    _onKeyDown: function(ev) {
+        switch (ev.keyCode) {
+            case KeyCode.ESCAPE:
+                this.props.onCancelClick();
+                break;
+        }
+    },
+
+    render: function() {
+        return (
+            <div className="mx_ForwardMessage">
+                <h1>{_t('Please select the destination room for this message')}</h1>
+            </div>
+        );
+    },
+});

src/components/views/rooms/LinkPreviewWidget.js

@@ -100,7 +100,9 @@ module.exports = React.createClass({
 
     render: function() {
         var p = this.state.preview;
-        if (!p) return <div/>;
+        if (!p || Object.keys(p).length === 0) {
+            return <div/>;
+        }
 
         // FIXME: do we want to factor out all image displaying between this and MImageBody - especially for lightboxing?
         var image = p["og:image"];

src/components/views/rooms/MemberDeviceInfo.js

@@ -16,6 +16,7 @@ limitations under the License.
 
 import React from 'react';
 import sdk from '../../../index';
+import { _t } from '../../../languageHandler';
 
 export default class MemberDeviceInfo extends React.Component {
     render() {
@@ -25,19 +26,19 @@ export default class MemberDeviceInfo extends React.Component {
         if (this.props.device.isBlocked()) {
             indicator = (
                     <div className="mx_MemberDeviceInfo_blacklisted">
-                    <img src="img/e2e-blocked.svg" width="12" height="12" style={{ marginLeft: "-1px" }} alt="Blacklisted"/>
+                    <img src="img/e2e-blocked.svg" width="12" height="12" style={{ marginLeft: "-1px" }} alt={_t("Blacklisted")}/>
                     </div>
             );
         } else if (this.props.device.isVerified()) {
             indicator = (
                     <div className="mx_MemberDeviceInfo_verified">
-                    <img src="img/e2e-verified.svg" width="10" height="12" alt="Verified"/>
+                    <img src="img/e2e-verified.svg" width="10" height="12" alt={_t("Verified")}/>
                     </div>
             );
         } else {
             indicator = (
                     <div className="mx_MemberDeviceInfo_unverified">
-                    <img src="img/e2e-warning.svg" width="15" height="12" style={{ marginLeft: "-2px" }} alt="Unverified"/>
+                    <img src="img/e2e-warning.svg" width="15" height="12" style={{ marginLeft: "-2px" }} alt={_t("Unverified")}/>
                     </div>
             );
         }
@@ -49,7 +50,7 @@ export default class MemberDeviceInfo extends React.Component {
         // add the deviceId as a titletext to help with debugging
         return (
             <div className="mx_MemberDeviceInfo"
-                    title={"device id: " + this.props.device.deviceId} >
+                    title={_t("device id: ") + this.props.device.deviceId} >
                 <div className="mx_MemberDeviceInfo_deviceInfo">
                     <div className="mx_MemberDeviceInfo_deviceId">
                         {deviceName}

src/components/views/rooms/MemberInfo.js

@@ -31,12 +31,15 @@ import classNames from 'classnames';
 import dis from '../../../dispatcher';
 import Modal from '../../../Modal';
 import sdk from '../../../index';
+import { _t } from '../../../languageHandler';
 import createRoom from '../../../createRoom';
 import DMRoomMap from '../../../utils/DMRoomMap';
 import Unread from '../../../Unread';
 import { findReadReceiptFromUserId } from '../../../utils/Receipt';
 import WithMatrixClient from '../../../wrappers/WithMatrixClient';
 import AccessibleButton from '../elements/AccessibleButton';
+import GeminiScrollbar from 'react-gemini-scrollbar';
+
 
 module.exports = WithMatrixClient(React.createClass({
     displayName: 'MemberInfo',
@@ -219,7 +222,7 @@ module.exports = WithMatrixClient(React.createClass({
 
     onKick: function() {
         const membership = this.props.member.membership;
-        const kickLabel = membership === "invite" ? "Disinvite" : "Kick";
+        const kickLabel = membership === "invite" ? _t("Disinvite") : _t("Kick");
         const ConfirmUserActionDialog = sdk.getComponent("dialogs.ConfirmUserActionDialog");
         Modal.createDialog(ConfirmUserActionDialog, {
             member: this.props.member,
@@ -241,7 +244,7 @@ module.exports = WithMatrixClient(React.createClass({
                         const ErrorDialog = sdk.getComponent("dialogs.ErrorDialog");
                         console.error("Kick error: " + err);
                         Modal.createDialog(ErrorDialog, {
-                            title: "Failed to kick",
+                            title: _t("Failed to kick"),
                             description: ((err && err.message) ? err.message : "Operation failed"),
                         });
                     }
@@ -256,7 +259,7 @@ module.exports = WithMatrixClient(React.createClass({
         const ConfirmUserActionDialog = sdk.getComponent("dialogs.ConfirmUserActionDialog");
         Modal.createDialog(ConfirmUserActionDialog, {
             member: this.props.member,
-            action: this.props.member.membership == 'ban' ? 'Unban' : 'Ban',
+            action: this.props.member.membership == 'ban' ? _t("Unban") : _t("Ban"),
             askReason: this.props.member.membership != 'ban',
             danger: this.props.member.membership != 'ban',
             onFinished: (proceed, reason) => {
@@ -283,8 +286,8 @@ module.exports = WithMatrixClient(React.createClass({
                         const ErrorDialog = sdk.getComponent("dialogs.ErrorDialog");
                         console.error("Ban error: " + err);
                         Modal.createDialog(ErrorDialog, {
-                            title: "Error",
-                            description: "Failed to ban user",
+                            title: _t("Error"),
+                            description: _t("Failed to ban user"),
                         });
                     }
                 ).finally(()=>{
@@ -333,8 +336,8 @@ module.exports = WithMatrixClient(React.createClass({
                 }, function(err) {
                     console.error("Mute error: " + err);
                     Modal.createDialog(ErrorDialog, {
-                        title: "Error",
-                        description: "Failed to mute user",
+                        title: _t("Error"),
+                        description: _t("Failed to mute user"),
                     });
                 }
             ).finally(()=>{
@@ -374,16 +377,12 @@ module.exports = WithMatrixClient(React.createClass({
                 console.log("Mod toggle success");
             }, function(err) {
                 if (err.errcode == 'M_GUEST_ACCESS_FORBIDDEN') {
-                    var NeedToRegisterDialog = sdk.getComponent("dialogs.NeedToRegisterDialog");
-                    Modal.createDialog(NeedToRegisterDialog, {
-                        title: "Please Register",
-                        description: "This action cannot be performed by a guest user. Please register to be able to do this."
-                    });
+                    dis.dispatch({action: 'view_set_mxid'});
                 } else {
                     console.error("Toggle moderator error:" + err);
                     Modal.createDialog(ErrorDialog, {
-                        title: "Error",
-                        description: "Failed to toggle moderator status",
+                        title: _t("Error"),
+                        description: _t("Failed to toggle moderator status"),
                     });
                 }
             }
@@ -403,8 +402,8 @@ module.exports = WithMatrixClient(React.createClass({
                 const ErrorDialog = sdk.getComponent("dialogs.ErrorDialog");
                 console.error("Failed to change power level " + err);
                 Modal.createDialog(ErrorDialog, {
-                    title: "Error",
-                    description: "Failed to change power level",
+                    title: _t("Error"),
+                    description: _t("Failed to change power level"),
                 });
             }
         ).finally(()=>{
@@ -432,13 +431,13 @@ module.exports = WithMatrixClient(React.createClass({
             if (parseInt(myPower) === parseInt(powerLevel)) {
                 var QuestionDialog = sdk.getComponent("dialogs.QuestionDialog");
                 Modal.createDialog(QuestionDialog, {
-                    title: "Warning",
+                    title: _t("Warning!"),
                     description:
                         <div>
-                            You will not be able to undo this change as you are promoting the user to have the same power level as yourself.<br/>
-                            Are you sure?
+                            { _t("You will not be able to undo this change as you are promoting the user to have the same power level as yourself.") }<br/>
+                            { _t("Are you sure?") }
                         </div>,
-                    button: "Continue",
+                    button: _t("Continue"),
                     onFinished: function(confirmed) {
                         if (confirmed) {
                             self._applyPowerChange(roomId, target, powerLevel, powerLevelEvent);
@@ -581,9 +580,9 @@ module.exports = WithMatrixClient(React.createClass({
             // still loading
             devComponents = <Spinner />;
         } else if (devices === null) {
-            devComponents = "Unable to load device list";
+            devComponents = _t("Unable to load device list");
         } else if (devices.length === 0) {
-            devComponents = "No devices with registered encryption keys";
+            devComponents = _t("No devices with registered encryption keys");
         } else {
             devComponents = [];
             for (var i = 0; i < devices.length; i++) {
@@ -595,7 +594,7 @@ module.exports = WithMatrixClient(React.createClass({
 
         return (
             <div>
-                <h3>Devices</h3>
+                <h3>{ _t("Devices") }</h3>
                 <div className="mx_MemberInfo_devices">
                     {devComponents}
                 </div>
@@ -644,11 +643,11 @@ module.exports = WithMatrixClient(React.createClass({
                 <div className="mx_RoomTile_avatar">
                     <img src="img/create-big.svg" width="26" height="26" />
                 </div>
-                <div className={labelClasses}><i>Start new chat</i></div>
+                <div className={labelClasses}><i>{ _t("Start a chat") }</i></div>
             </AccessibleButton>;
 
             startChat = <div>
-                <h3>Direct chats</h3>
+                <h3>{ _t("Direct chats") }</h3>
                 {tiles}
                 {startNewChat}
             </div>;
@@ -661,7 +660,7 @@ module.exports = WithMatrixClient(React.createClass({
 
         if (this.state.can.kick) {
             const membership = this.props.member.membership;
-            const kickLabel = membership === "invite" ? "Disinvite" : "Kick";
+            const kickLabel = membership === "invite" ? _t("Disinvite") : _t("Kick");
             kickButton = (
                 <AccessibleButton className="mx_MemberInfo_field"
                         onClick={this.onKick}>
@@ -670,9 +669,9 @@ module.exports = WithMatrixClient(React.createClass({
             );
         }
         if (this.state.can.ban) {
-            let label = 'Ban';
+            let label = _t("Ban");
             if (this.props.member.membership == 'ban') {
-                label = 'Unban';
+                label = _t("Unban");
             }
             banButton = (
                 <AccessibleButton className="mx_MemberInfo_field"
@@ -682,7 +681,7 @@ module.exports = WithMatrixClient(React.createClass({
             );
         }
         if (this.state.can.mute) {
-            const muteLabel = this.state.muted ? "Unmute" : "Mute";
+            const muteLabel = this.state.muted ? _t("Unmute") : _t("Mute");
             muteButton = (
                 <AccessibleButton className="mx_MemberInfo_field"
                         onClick={this.onMuteToggle}>
@@ -691,7 +690,7 @@ module.exports = WithMatrixClient(React.createClass({
             );
         }
         if (this.state.can.toggleMod) {
-            var giveOpLabel = this.state.isTargetMod ? "Revoke Moderator" : "Make Moderator";
+            var giveOpLabel = this.state.isTargetMod ? _t("Revoke Moderator") : _t("Make Moderator");
             giveModButton = <AccessibleButton className="mx_MemberInfo_field" onClick={this.onModToggle}>
                 {giveOpLabel}
             </AccessibleButton>;
@@ -704,7 +703,7 @@ module.exports = WithMatrixClient(React.createClass({
         if (kickButton || banButton || muteButton || giveModButton) {
             adminTools =
                 <div>
-                    <h3>Admin tools</h3>
+                    <h3>{_t("Admin tools")}</h3>
 
                     <div className="mx_MemberInfo_buttons">
                         {muteButton}
@@ -717,34 +716,49 @@ module.exports = WithMatrixClient(React.createClass({
 
         const memberName = this.props.member.name;
 
+        if (this.props.member.user) {
+            var presenceState = this.props.member.user.presence;
+            var presenceLastActiveAgo = this.props.member.user.lastActiveAgo;
+            var presenceLastTs = this.props.member.user.lastPresenceTs;
+            var presenceCurrentlyActive = this.props.member.user.currentlyActive;
+        }
+
         var MemberAvatar = sdk.getComponent('avatars.MemberAvatar');
         var PowerSelector = sdk.getComponent('elements.PowerSelector');
+        var PresenceLabel = sdk.getComponent('rooms.PresenceLabel');
         const EmojiText = sdk.getComponent('elements.EmojiText');
         return (
             <div className="mx_MemberInfo">
-                <AccessibleButton className="mx_MemberInfo_cancel" onClick={this.onCancel}> <img src="img/cancel.svg" width="18" height="18"/></AccessibleButton>
-                <div className="mx_MemberInfo_avatar">
-                    <MemberAvatar onClick={this.onMemberAvatarClick} member={this.props.member} width={48} height={48} />
-                </div>
-
-                <EmojiText element="h2">{memberName}</EmojiText>
-
-                <div className="mx_MemberInfo_profile">
-                    <div className="mx_MemberInfo_profileField">
-                        { this.props.member.userId }
+                <GeminiScrollbar autoshow={true}>
+                    <AccessibleButton className="mx_MemberInfo_cancel" onClick={this.onCancel}> <img src="img/cancel.svg" width="18" height="18"/></AccessibleButton>
+                    <div className="mx_MemberInfo_avatar">
+                        <MemberAvatar onClick={this.onMemberAvatarClick} member={this.props.member} width={48} height={48} />
                     </div>
-                    <div className="mx_MemberInfo_profileField">
-                        Level: <b><PowerSelector controlled={true} value={ parseInt(this.props.member.powerLevel) } disabled={ !this.state.can.modifyLevel } onChange={ this.onPowerChange }/></b>
+
+                    <EmojiText element="h2">{memberName}</EmojiText>
+
+                    <div className="mx_MemberInfo_profile">
+                        <div className="mx_MemberInfo_profileField">
+                            { this.props.member.userId }
+                        </div>
+                        <div className="mx_MemberInfo_profileField">
+                            { _t("Level:") } <b><PowerSelector controlled={true} value={ parseInt(this.props.member.powerLevel) } disabled={ !this.state.can.modifyLevel } onChange={ this.onPowerChange }/></b>
+                        </div>
+                        <div className="mx_MemberInfo_profileField">
+                            <PresenceLabel activeAgo={ presenceLastActiveAgo }
+                                currentlyActive={ presenceCurrentlyActive }
+                                presenceState={ presenceState } />
+                        </div>
                     </div>
-                </div>
 
-                { adminTools }
+                    { adminTools }
 
-                { startChat }
+                    { startChat }
 
-                { this._renderDevices() }
+                    { this._renderDevices() }
 
-                { spinner }
+                    { spinner }
+                </GeminiScrollbar>
             </div>
         );
     }

src/components/views/rooms/MemberList.js

@@ -14,6 +14,7 @@ See the License for the specific language governing permissions and
 limitations under the License.
 */
 var React = require('react');
+import { _t } from '../../../languageHandler';
 var classNames = require('classnames');
 var Matrix = require("matrix-js-sdk");
 var q = require('q');
@@ -27,12 +28,6 @@ var CallHandler = require("../../../CallHandler");
 var Invite = require("../../../Invite");
 
 var INITIAL_LOAD_NUM_MEMBERS = 30;
-var SHARE_HISTORY_WARNING =
-    <span>
-        Newly invited users will see the history of this room. <br/>
-        If you'd prefer invited users not to see messages that were sent before they joined, <br/>
-        turn off, 'Share message history with new users' in the settings for this room.
-    </span>;
 
 module.exports = React.createClass({
     displayName: 'MemberList',
@@ -207,7 +202,9 @@ module.exports = React.createClass({
         // For now we'll pretend this is any entity. It should probably be a separate tile.
         var EntityTile = sdk.getComponent("rooms.EntityTile");
         var BaseAvatar = sdk.getComponent("avatars.BaseAvatar");
-        var text = "and " + overflowCount + " other" + (overflowCount > 1 ? "s" : "") + "...";
+        var text = (overflowCount > 1)
+        	? _t("and %(overflowCount)s others...", { overflowCount: overflowCount })
+        	: _t("and one other...");
         return (
             <EntityTile className="mx_EntityTile_ellipsis" avatarJsx={
                 <BaseAvatar url="img/ellipsis.svg" name="..." width={36} height={36} />
@@ -352,7 +349,7 @@ module.exports = React.createClass({
         if (invitedMemberTiles.length > 0) {
             invitedSection = (
                 <div className="mx_MemberList_invited">
-                    <h2>Invited</h2>
+                    <h2>{ _t("Invited") }</h2>
                     <div className="mx_MemberList_wrapper">
                         {invitedMemberTiles}
                     </div>
@@ -363,8 +360,8 @@ module.exports = React.createClass({
         var inputBox = (
             <form autoComplete="off">
                 <input className="mx_MemberList_query" id="mx_MemberList_query" type="text"
-                    onChange={this.onSearchQueryChanged} value={this.state.searchQuery}
-                    placeholder="Filter room members" />
+                        onChange={this.onSearchQueryChanged} value={this.state.searchQuery}
+                        placeholder={ _t('Filter room members') } />
             </form>
         );
 

src/components/views/rooms/MemberTile.js

@@ -22,6 +22,7 @@ var MatrixClientPeg = require('../../../MatrixClientPeg');
 var sdk = require('../../../index');
 var dis = require('../../../dispatcher');
 var Modal = require("../../../Modal");
+import { _t } from '../../../languageHandler';
 
 module.exports = React.createClass({
     displayName: 'MemberTile',
@@ -63,7 +64,7 @@ module.exports = React.createClass({
     },
 
     getPowerLabel: function() {
-        return this.props.member.userId + " (power " + this.props.member.powerLevel + ")";
+        return _t("%(userName)s (power %(powerLevelNumber)s)", {userName: this.props.member.userId, powerLevelNumber: this.props.member.powerLevel});
     },
 
     render: function() {

src/components/views/rooms/MessageComposer.js

@@ -14,7 +14,7 @@ See the License for the specific language governing permissions and
 limitations under the License.
 */
 var React = require('react');
-
+import { _t } from '../../../languageHandler';
 var CallHandler = require('../../../CallHandler');
 var MatrixClientPeg = require('../../../MatrixClientPeg');
 var Modal = require('../../../Modal');
@@ -33,6 +33,7 @@ export default class MessageComposer extends React.Component {
         this.onHangupClick = this.onHangupClick.bind(this);
         this.onUploadClick = this.onUploadClick.bind(this);
         this.onUploadFileSelected = this.onUploadFileSelected.bind(this);
+        this.uploadFiles = this.uploadFiles.bind(this);
         this.onVoiceCallClick = this.onVoiceCallClick.bind(this);
         this.onInputContentChanged = this.onInputContentChanged.bind(this);
         this.onUpArrow = this.onUpArrow.bind(this);
@@ -90,36 +91,33 @@ export default class MessageComposer extends React.Component {
 
     onUploadClick(ev) {
         if (MatrixClientPeg.get().isGuest()) {
-            let NeedToRegisterDialog = sdk.getComponent("dialogs.NeedToRegisterDialog");
-            Modal.createDialog(NeedToRegisterDialog, {
-                title: "Please Register",
-                description: "Guest users can't upload files. Please register to upload.",
-            });
+            dis.dispatch({action: 'view_set_mxid'});
             return;
         }
 
         this.refs.uploadInput.click();
     }
 
-    onUploadFileSelected(files, isPasted) {
-        if (!isPasted)
-            files = files.target.files;
+    onUploadFileSelected(files) {
+        this.uploadFiles(files.target.files);
+    }
 
+    uploadFiles(files) {
         let QuestionDialog = sdk.getComponent("dialogs.QuestionDialog");
         let TintableSvg = sdk.getComponent("elements.TintableSvg");
 
         let fileList = [];
         for (let i=0; i<files.length; i++) {
             fileList.push(<li key={i}>
-                <TintableSvg key={i} src="img/files.svg" width="16" height="16" /> {files[i].name || 'Attachment'}
+                <TintableSvg key={i} src="img/files.svg" width="16" height="16" /> {files[i].name || _t('Attachment')}
             </li>);
         }
 
         Modal.createDialog(QuestionDialog, {
-            title: "Upload Files",
+            title: _t('Upload Files'),
             description: (
                 <div>
-                    <p>Are you sure you want upload the following files?</p>
+                    <p>{ _t('Are you sure you want to upload the following files?') }</p>
                     <ul style={{listStyle: 'none', textAlign: 'left'}}>
                         {fileList}
                     </ul>
@@ -238,11 +236,11 @@ export default class MessageComposer extends React.Component {
         if (roomIsEncrypted) {
             // FIXME: show a /!\ if there are untrusted devices in the room...
             e2eImg = 'img/e2e-verified.svg';
-            e2eTitle = 'Encrypted room';
+            e2eTitle = _t('Encrypted room');
             e2eClass = 'mx_MessageComposer_e2eIcon';
         } else {
             e2eImg = 'img/e2e-unencrypted.svg';
-            e2eTitle = 'Unencrypted room';
+            e2eTitle = _t('Unencrypted room');
             e2eClass = 'mx_MessageComposer_e2eIcon mx_filterFlipColor';
         }
 
@@ -255,16 +253,16 @@ export default class MessageComposer extends React.Component {
         if (this.props.callState && this.props.callState !== 'ended') {
             hangupButton =
                 <div key="controls_hangup" className="mx_MessageComposer_hangup" onClick={this.onHangupClick}>
-                    <img src="img/hangup.svg" alt="Hangup" title="Hangup" width="25" height="26"/>
+                    <img src="img/hangup.svg" alt={ _t('Hangup') } title={ _t('Hangup') } width="25" height="26"/>
                 </div>;
         }
         else {
             callButton =
-                <div key="controls_call" className="mx_MessageComposer_voicecall" onClick={this.onVoiceCallClick} title="Voice call">
+                <div key="controls_call" className="mx_MessageComposer_voicecall" onClick={this.onVoiceCallClick} title={ _t('Voice call') }>
                     <TintableSvg src="img/icon-call.svg" width="35" height="35"/>
                 </div>;
             videoCallButton =
-                <div key="controls_videocall" className="mx_MessageComposer_videocall" onClick={this.onCallClick} title="Video call">
+                <div key="controls_videocall" className="mx_MessageComposer_videocall" onClick={this.onCallClick} title={ _t('Video call') }>
                     <TintableSvg src="img/icons-video.svg" width="35" height="35"/>
                 </div>;
         }
@@ -278,7 +276,7 @@ export default class MessageComposer extends React.Component {
             // complex because of conference calls.
             var uploadButton = (
                 <div key="controls_upload" className="mx_MessageComposer_upload"
-                        onClick={this.onUploadClick} title="Upload file">
+                        onClick={this.onUploadClick} title={ _t('Upload file') }>
                     <TintableSvg src="img/icons-upload.svg" width="35" height="35"/>
                     <input ref="uploadInput" type="file"
                         style={uploadInputStyle}
@@ -289,7 +287,7 @@ export default class MessageComposer extends React.Component {
 
             const formattingButton = (
                 <img className="mx_MessageComposer_formatting"
-                     title="Show Text Formatting Toolbar"
+                     title={_t("Show Text Formatting Toolbar")}
                      src="img/button-text-formatting.svg"
                      onClick={this.onToggleFormattingClicked}
                      style={{visibility: this.state.showFormatting ||
@@ -298,7 +296,7 @@ export default class MessageComposer extends React.Component {
             );
 
             const placeholderText = roomIsEncrypted ?
-                "Send an encrypted message…" : "Send a message (unencrypted)…";
+                _t('Send an encrypted message') + '…' : _t('Send a message (unencrypted)') + '…';
 
             controls.push(
                 <MessageComposerInput
@@ -310,7 +308,7 @@ export default class MessageComposer extends React.Component {
                     tryComplete={this._tryComplete}
                     onUpArrow={this.onUpArrow}
                     onDownArrow={this.onDownArrow}
-                    onUploadFileSelected={this.onUploadFileSelected}
+                    onFilesPasted={this.uploadFiles}
                     tabComplete={this.props.tabComplete} // used for old messagecomposerinput/tabcomplete
                     onContentChanged={this.onInputContentChanged}
                     onInputStateChanged={this.onInputStateChanged} />,
@@ -323,7 +321,7 @@ export default class MessageComposer extends React.Component {
         } else {
             controls.push(
                 <div key="controls_error" className="mx_MessageComposer_noperm_error">
-                    You do not have permission to post to this room
+                    { _t('You do not have permission to post to this room') }
                 </div>
             );
         }
@@ -352,7 +350,7 @@ export default class MessageComposer extends React.Component {
                     mx_filterFlipColor: true,
                 });
                 return <img className={className}
-                            title={name}
+                            title={ _t(name) }
                             onMouseDown={disabled ? null : onFormatButtonClicked}
                             key={name}
                             src={`img/button-text-${name}${suffix}.svg`}
@@ -372,11 +370,11 @@ export default class MessageComposer extends React.Component {
                         <div className="mx_MessageComposer_formatbar" style={this.state.showFormatting ? {} : {display: 'none'}}>
                             {formatButtons}
                             <div style={{flex: 1}}></div>
-                            <img title={`Turn Markdown ${this.state.inputState.isRichtextEnabled ? 'on' : 'off'}`}
+                            <img title={ this.state.inputState.isRichtextEnabled ? _t("Turn Markdown on") : _t("Turn Markdown off") }
                                  onMouseDown={this.onToggleMarkdownClicked}
                                 className="mx_MessageComposer_formatbar_markdown mx_filterFlipColor"
                                 src={`img/button-md-${!this.state.inputState.isRichtextEnabled}.png`} />
-                            <img title="Hide Text Formatting Toolbar"
+                            <img title={ _t("Hide Text Formatting Toolbar") }
                                  onClick={this.onToggleFormattingClicked}
                                  className="mx_MessageComposer_formatbar_cancel mx_filterFlipColor"
                                  src="img/icon-text-cancel.svg" />

src/components/views/rooms/MessageComposerInput.js

@@ -27,11 +27,12 @@ import Q from 'q';
 import MatrixClientPeg from '../../../MatrixClientPeg';
 import type {MatrixClient} from 'matrix-js-sdk/lib/matrix';
 import SlashCommands from '../../../SlashCommands';
+import KeyCode from '../../../KeyCode';
 import Modal from '../../../Modal';
 import sdk from '../../../index';
+import { _t } from '../../../languageHandler';
 
 import dis from '../../../dispatcher';
-import KeyCode from '../../../KeyCode';
 import UserSettingsStore from '../../../UserSettingsStore';
 
 import * as RichText from '../../../RichText';
@@ -44,7 +45,14 @@ import {onSendMessageFailed} from './MessageComposerInputOld';
 
 const TYPING_USER_TIMEOUT = 10000, TYPING_SERVER_TIMEOUT = 30000;
 
-const KEY_M = 77;
+const ZWS_CODE = 8203;
+const ZWS = String.fromCharCode(ZWS_CODE); // zero width space
+function stateToMarkdown(state) {
+    return __stateToMarkdown(state)
+        .replace(
+            ZWS, // draft-js-export-markdown adds these
+            ''); // this is *not* a zero width space, trust me :)
+}
 
 /*
  * The textInput part of the MessageComposer
@@ -75,7 +83,7 @@ export default class MessageComposerInput extends React.Component {
 
     static getKeyBinding(e: SyntheticKeyboardEvent): string {
         // C-m => Toggles between rich text and markdown modes
-        if (e.keyCode === KEY_M && KeyBindingUtil.isCtrlKeyCommand(e)) {
+        if (e.keyCode === KeyCode.KEY_M && KeyBindingUtil.isCtrlKeyCommand(e)) {
             return 'toggle-mode';
         }
 
@@ -99,7 +107,6 @@ export default class MessageComposerInput extends React.Component {
         this.onAction = this.onAction.bind(this);
         this.handleReturn = this.handleReturn.bind(this);
         this.handleKeyCommand = this.handleKeyCommand.bind(this);
-        this.handlePastedFiles = this.handlePastedFiles.bind(this);
         this.onEditorContentChanged = this.onEditorContentChanged.bind(this);
         this.onUpArrow = this.onUpArrow.bind(this);
         this.onDownArrow = this.onDownArrow.bind(this);
@@ -418,10 +425,6 @@ export default class MessageComposerInput extends React.Component {
         return false;
     }
 
-    handlePastedFiles(files) {
-        this.props.onUploadFileSelected(files, true);
-    }
-
     handleReturn(ev) {
         if (ev.shiftKey) {
             this.onEditorContentChanged(RichUtils.insertSoftNewline(this.state.editorState));
@@ -457,15 +460,15 @@ export default class MessageComposerInput extends React.Component {
                     console.error("Command failure: %s", err);
                     const ErrorDialog = sdk.getComponent("dialogs.ErrorDialog");
                     Modal.createDialog(ErrorDialog, {
-                        title: "Server error",
-                        description: ((err && err.message) ? err.message : "Server unavailable, overloaded, or something else went wrong."),
+                        title: _t("Server error"),
+                        description: ((err && err.message) ? err.message : _t("Server unavailable, overloaded, or something else went wrong.")),
                     });
                 });
             } else if (cmd.error) {
                 console.error(cmd.error);
                 const ErrorDialog = sdk.getComponent("dialogs.ErrorDialog");
                 Modal.createDialog(ErrorDialog, {
-                    title: "Command error",
+                    title: _t("Command error"),
                     description: cmd.error,
                 });
             }
@@ -489,9 +492,9 @@ export default class MessageComposerInput extends React.Component {
         let sendTextFn = this.client.sendTextMessage;
 
         if (contentText.startsWith('/me')) {
-            contentText = contentText.replace('/me ', '');
+            contentText = contentText.substring(4);
             // bit of a hack, but the alternative would be quite complicated
-            if (contentHTML) contentHTML = contentHTML.replace('/me ', '');
+            if (contentHTML) contentHTML = contentHTML.replace(/\/me ?/, '');
             sendHtmlFn = this.client.sendHtmlEmote;
             sendTextFn = this.client.sendEmoteMessage;
         }
@@ -692,9 +695,10 @@ export default class MessageComposerInput extends React.Component {
                 <div className={className}>
                     <img className="mx_MessageComposer_input_markdownIndicator mx_filterFlipColor"
                          onMouseDown={this.onMarkdownToggleClicked}
-                         title={`Markdown is ${this.state.isRichtextEnabled ? 'disabled' : 'enabled'}`}
-                         src={`img/button-md-${!this.state.isRichtextEnabled}.png`}/>
+                         title={ this.state.isRichtextEnabled ? _t("Markdown is disabled") : _t("Markdown is enabled")}
+                         src={`img/button-md-${!this.state.isRichtextEnabled}.png`} />
                     <Editor ref="editor"
+                            dir="auto"
                             placeholder={this.props.placeholder}
                             editorState={this.state.editorState}
                             onChange={this.onEditorContentChanged}
@@ -702,7 +706,7 @@ export default class MessageComposerInput extends React.Component {
                             keyBindingFn={MessageComposerInput.getKeyBinding}
                             handleKeyCommand={this.handleKeyCommand}
                             handleReturn={this.handleReturn}
-                            handlePastedFiles={this.handlePastedFiles}
+                            handlePastedFiles={this.props.onFilesPasted}
                             stripPastedStyles={!this.state.isRichtextEnabled}
                             onTab={this.onTab}
                             onUpArrow={this.onUpArrow}
@@ -732,7 +736,7 @@ MessageComposerInput.propTypes = {
 
     onDownArrow: React.PropTypes.func,
 
-    onUploadFileSelected: React.PropTypes.func,
+    onFilesPasted: React.PropTypes.func,
 
     // attempts to confirm currently selected completion, returns whether actually confirmed
     tryComplete: React.PropTypes.func,

src/components/views/rooms/MessageComposerInputOld.js

@@ -20,6 +20,7 @@ var SlashCommands = require("../../../SlashCommands");
 var Modal = require("../../../Modal");
 var MemberEntry = require("../../../TabCompleteEntries").MemberEntry;
 var sdk = require('../../../index');
+import { _t } from '../../../languageHandler';
 import UserSettingsStore from "../../../UserSettingsStore";
 
 var dis = require("../../../dispatcher");
@@ -28,7 +29,6 @@ var Markdown = require("../../../Markdown");
 
 var TYPING_USER_TIMEOUT = 10000;
 var TYPING_SERVER_TIMEOUT = 30000;
-var MARKDOWN_ENABLED = true;
 
 export function onSendMessageFailed(err, room) {
     // XXX: temporary logging to try to diagnose
@@ -69,11 +69,15 @@ export default React.createClass({
 
         // The text to use a placeholder in the input box
         placeholder: React.PropTypes.string.isRequired,
+
+        // callback to handle files pasted into the composer
+        onFilesPasted: React.PropTypes.func,
     },
 
     componentWillMount: function() {
         this.oldScrollHeight = 0;
-        this.markdownEnabled = MARKDOWN_ENABLED;
+        this.markdownEnabled = !UserSettingsStore.getSyncedSetting('disableMarkdown', false);
+
         var self = this;
         this.sentHistory = {
             // The list of typed messages. Index 0 is more recent
@@ -291,8 +295,8 @@ export default React.createClass({
             else {
                 var ErrorDialog = sdk.getComponent("dialogs.ErrorDialog");
                 Modal.createDialog(ErrorDialog, {
-                    title: "Unknown command",
-                    description: "Usage: /markdown on|off"
+                    title: _t("Unknown command"),
+                    description: _t("Usage") + ": /markdown on|off",
                 });
             }
             return;
@@ -311,8 +315,8 @@ export default React.createClass({
                     console.error("Command failure: %s", err);
                     var ErrorDialog = sdk.getComponent("dialogs.ErrorDialog");
                     Modal.createDialog(ErrorDialog, {
-                        title: "Server error",
-                        description: ((err && err.message) ? err.message : "Server unavailable, overloaded, or something else went wrong."),
+                        title: _t("Server error"),
+                        description: ((err && err.message) ? err.message : _t("Server unavailable, overloaded, or something else went wrong.")),
                     });
                 });
             }
@@ -320,8 +324,8 @@ export default React.createClass({
                 console.error(cmd.error);
                 var ErrorDialog = sdk.getComponent("dialogs.ErrorDialog");
                 Modal.createDialog(ErrorDialog, {
-                    title: "Command error",
-                    description: cmd.error
+                    title: _t("Command error"),
+                    description: cmd.error,
                 });
             }
             return;
@@ -439,10 +443,27 @@ export default React.createClass({
         this.refs.textarea.focus();
     },
 
+    _onPaste: function(ev) {
+        const items = ev.clipboardData.items;
+        const files = [];
+        for (const item of items) {
+            if (item.kind === 'file') {
+                files.push(item.getAsFile());
+            }
+        }
+        if (files.length && this.props.onFilesPasted) {
+            this.props.onFilesPasted(files);
+            return true;
+        }
+        return false;
+    },
+
     render: function() {
         return (
             <div className="mx_MessageComposer_input" onClick={ this.onInputClick }>
-                <textarea autoFocus ref="textarea" rows="1" onKeyDown={this.onKeyDown} onKeyUp={this.onKeyUp} placeholder={this.props.placeholder} />
+                <textarea dir="auto" autoFocus ref="textarea" rows="1" onKeyDown={this.onKeyDown} onKeyUp={this.onKeyUp} placeholder={this.props.placeholder}
+                    onPaste={this._onPaste}
+                />
             </div>
         );
     }

src/components/views/rooms/PresenceLabel.js

@@ -16,10 +16,10 @@ limitations under the License.
 
 'use strict';
 
-var React = require('react');
+import React from 'react';
+
+import { _t } from '../../../languageHandler';
 
-var MatrixClientPeg = require('../../../MatrixClientPeg');
-var sdk = require('../../../index');
 
 module.exports = React.createClass({
     displayName: 'PresenceLabel',
@@ -53,31 +53,30 @@ module.exports = React.createClass({
         var d = parseInt(t / (60 * 60 * 24));
         if (t < 60) {
             if (t < 0) {
-                return "0s";
+                return _t("for %(amount)ss", {amount: 0});
             }
-            return s + "s";
+            return _t("for %(amount)ss", {amount: s});
         }
         if (t < 60 * 60) {
-            return m + "m";
+            return  _t("for %(amount)sm", {amount: m});
         }
         if (t < 24 * 60 * 60) {
-            return h + "h";
+            return  _t("for %(amount)sh", {amount: h});
         }
-        return d + "d ";
+        return  _t("for %(amount)sd", {amount: d});
     },
 
     getPrettyPresence: function(presence) {
-        if (presence === "online") return "Online";
-        if (presence === "unavailable") return "Idle"; // XXX: is this actually right?
-        if (presence === "offline") return "Offline";
+        if (presence === "online") return _t("Online");
+        if (presence === "unavailable") return _t("Idle"); // XXX: is this actually right?
+        if (presence === "offline") return _t("Offline");
         return "Unknown";
     },
 
     render: function() {
         if (this.props.activeAgo >= 0) {
-            var ago = this.props.currentlyActive ? "" : "for " + (this.getDuration(this.props.activeAgo));
-            // var ago = this.getDuration(this.props.activeAgo) + " ago";
-            // if (this.props.currentlyActive) ago += " (now?)";
+            let duration = this.getDuration(this.props.activeAgo);
+            let ago = this.props.currentlyActive || !duration ? "" : duration;
             return (
                 <div className="mx_PresenceLabel">
                     { this.getPrettyPresence(this.props.presenceState) } { ago }

src/components/views/rooms/ReadReceiptMarker.js

@@ -23,6 +23,9 @@ var sdk = require('../../../index');
 
 var Velociraptor = require('../../../Velociraptor');
 require('../../../VelocityBounce');
+import { _t } from '../../../languageHandler';
+
+import DateUtils from '../../../DateUtils';
 
 var bounce = false;
 try {
@@ -64,8 +67,8 @@ module.exports = React.createClass({
         // Timestamp when the receipt was read
         timestamp: React.PropTypes.number,
 
-        // True to show the full date/time rather than just the time
-        showFullTimestamp: React.PropTypes.bool,
+        // True to show twelve hour format, false otherwise
+        showTwelveHour: React.PropTypes.bool,
     },
 
     getDefaultProps: function() {
@@ -170,16 +173,10 @@ module.exports = React.createClass({
 
         let title;
         if (this.props.timestamp) {
-            const prefix = "Seen by " + this.props.member.userId + " at ";
-            let ts = new Date(this.props.timestamp);
-            if (this.props.showFullTimestamp) {
-                // "15/12/2016, 7:05:45 PM (@alice:matrix.org)"
-                title = prefix + ts.toLocaleString();
-            }
-            else {
-                // "7:05:45 PM (@alice:matrix.org)"
-                title = prefix + ts.toLocaleTimeString();
-            }
+            title = _t(
+                "Seen by %(userName)s at %(dateTime)s",
+                {userName: this.props.member.userId, dateTime: DateUtils.formatDate(new Date(this.props.timestamp), this.props.showTwelveHour)}
+            );
         }
 
         return (

src/components/views/rooms/RoomHeader.js

@@ -17,7 +17,9 @@ limitations under the License.
 'use strict';
 
 var React = require('react');
+var classNames = require('classnames');
 var sdk = require('../../../index');
+import { _t } from '../../../languageHandler';
 var MatrixClientPeg = require('../../../MatrixClientPeg');
 var Modal = require("../../../Modal");
 var dis = require("../../../dispatcher");
@@ -39,6 +41,7 @@ module.exports = React.createClass({
         oobData: React.PropTypes.object,
         editing: React.PropTypes.bool,
         saving: React.PropTypes.bool,
+        inRoom: React.PropTypes.bool,
         collapsedRhs: React.PropTypes.bool,
         onSettingsClick: React.PropTypes.func,
         onSaveClick: React.PropTypes.func,
@@ -49,7 +52,7 @@ module.exports = React.createClass({
     getDefaultProps: function() {
         return {
             editing: false,
-            onSettingsClick: function() {},
+            inRoom: false,
             onSaveClick: function() {},
         };
     },
@@ -117,8 +120,8 @@ module.exports = React.createClass({
             var ErrorDialog = sdk.getComponent("dialogs.ErrorDialog");
             console.error("Failed to set avatar: " + errMsg);
             Modal.createDialog(ErrorDialog, {
-                title: "Error",
-                description: "Failed to set avatar.",
+                title: _t("Error"),
+                description: _t("Failed to set avatar."),
             });
         }).done();
     },
@@ -185,7 +188,14 @@ module.exports = React.createClass({
                 'm.room.name', user_id
             );
 
-            save_button = <AccessibleButton className="mx_RoomHeader_textButton" onClick={this.props.onSaveClick}>Save</AccessibleButton>;
+            save_button = (
+                <AccessibleButton className="mx_RoomHeader_textButton" onClick={this.props.onSaveClick}>
+                    {_t("Save")}
+                </AccessibleButton>
+            );
+        }
+
+        if (this.props.onCancelClick) {
             cancel_button = <CancelButton onClick={this.props.onCancelClick}/>;
         }
 
@@ -203,7 +213,7 @@ module.exports = React.createClass({
             // don't display the search count until the search completes and
             // gives us a valid (possibly zero) searchCount.
             if (this.props.searchInfo && this.props.searchInfo.searchCount !== undefined && this.props.searchInfo.searchCount !== null) {
-                searchStatus = <div className="mx_RoomHeader_searchStatus">&nbsp;(~{ this.props.searchInfo.searchCount } results)</div>;
+                searchStatus = <div className="mx_RoomHeader_searchStatus">&nbsp;{ _t("(~%(count)s results)", { count: this.props.searchInfo.searchCount }) }</div>;
             }
 
             // XXX: this is a bit inefficient - we could just compare room.name for 'Empty room'...
@@ -218,17 +228,17 @@ module.exports = React.createClass({
                 }
             }
 
-            var roomName = 'Join Room';
+            var roomName = _t("Join Room");
             if (this.props.oobData && this.props.oobData.name) {
                 roomName = this.props.oobData.name;
             } else if (this.props.room) {
                 roomName = this.props.room.name;
             }
 
-
+            const emojiTextClasses = classNames('mx_RoomHeader_nametext', { mx_RoomHeader_settingsHint: settingsHint });
             name =
                 <div className="mx_RoomHeader_name" onClick={this.props.onSettingsClick}>
-                    <EmojiText element="div" className={ "mx_RoomHeader_nametext " + (settingsHint ? "mx_RoomHeader_settingsHint" : "") } title={ roomName }>{roomName}</EmojiText>
+                    <EmojiText dir="auto" element="div" className={emojiTextClasses} title={roomName}>{ roomName }</EmojiText>
                     { searchStatus }
                 </div>;
         }
@@ -245,7 +255,7 @@ module.exports = React.createClass({
                 }
             }
             if (topic) {
-                topic_el = <div className="mx_RoomHeader_topic" ref="topic" title={ topic }>{ topic }</div>;
+                topic_el = <div className="mx_RoomHeader_topic" ref="topic" title={ topic } dir="auto">{ topic }</div>;
             }
         }
 
@@ -259,7 +269,7 @@ module.exports = React.createClass({
                     <div className="mx_RoomHeader_avatarPicker_edit">
                         <label htmlFor="avatarInput" ref="file_label">
                             <img src="img/camera.svg"
-                                alt="Upload avatar" title="Upload avatar"
+                                alt={ _t("Upload avatar") } title={ _t("Upload avatar") }
                                 width="17" height="15" />
                         </label>
                         <input id="avatarInput" type="file" onChange={ this.onAvatarSelected }/>
@@ -278,7 +288,7 @@ module.exports = React.createClass({
         var settings_button;
         if (this.props.onSettingsClick) {
             settings_button =
-                <AccessibleButton className="mx_RoomHeader_button" onClick={this.props.onSettingsClick} title="Settings">
+                <AccessibleButton className="mx_RoomHeader_button" onClick={this.props.onSettingsClick} title={_t("Settings")}>
                     <TintableSvg src="img/icons-settings-room.svg" width="16" height="16"/>
                 </AccessibleButton>;
         }
@@ -294,15 +304,23 @@ module.exports = React.createClass({
         var forget_button;
         if (this.props.onForgetClick) {
             forget_button =
-                <AccessibleButton className="mx_RoomHeader_button" onClick={this.props.onForgetClick} title="Forget room">
+                <AccessibleButton className="mx_RoomHeader_button" onClick={this.props.onForgetClick} title={ _t("Forget room") }>
                     <TintableSvg src="img/leave.svg" width="26" height="20"/>
                 </AccessibleButton>;
         }
 
+        let search_button;
+        if (this.props.onSearchClick && this.props.inRoom) {
+            search_button =
+                <AccessibleButton className="mx_RoomHeader_button" onClick={this.props.onSearchClick} title={ _t("Search") }>
+                    <TintableSvg src="img/icons-search.svg" width="35" height="35"/>
+                </AccessibleButton>;
+        }
+
         var rightPanel_buttons;
         if (this.props.collapsedRhs) {
             rightPanel_buttons =
-                <AccessibleButton className="mx_RoomHeader_button" onClick={this.onShowRhsClick} title="Show panel">
+                <AccessibleButton className="mx_RoomHeader_button" onClick={this.onShowRhsClick} title={ _t('Show panel') }>
                     <TintableSvg src="img/maximise.svg" width="10" height="16"/>
                 </AccessibleButton>;
         }
@@ -313,9 +331,7 @@ module.exports = React.createClass({
                 <div className="mx_RoomHeader_rightRow">
                     { settings_button }
                     { forget_button }
-                    <AccessibleButton className="mx_RoomHeader_button" onClick={this.props.onSearchClick} title="Search">
-                        <TintableSvg src="img/icons-search.svg" width="35" height="35"/>
-                    </AccessibleButton>
+                    { search_button }
                     { rightPanel_buttons }
                 </div>;
         }

src/components/views/rooms/RoomList.js

@@ -18,26 +18,43 @@ limitations under the License.
 'use strict';
 var React = require("react");
 var ReactDOM = require("react-dom");
+import { _t, _tJsx } from '../../../languageHandler';
 var GeminiScrollbar = require('react-gemini-scrollbar');
 var MatrixClientPeg = require("../../../MatrixClientPeg");
 var CallHandler = require('../../../CallHandler');
 var RoomListSorter = require("../../../RoomListSorter");
+var Unread = require('../../../Unread');
 var dis = require("../../../dispatcher");
 var sdk = require('../../../index');
 var rate_limited_func = require('../../../ratelimitedfunc');
 var Rooms = require('../../../Rooms');
 import DMRoomMap from '../../../utils/DMRoomMap';
 var Receipt = require('../../../utils/Receipt');
-var constantTimeDispatcher = require('../../../ConstantTimeDispatcher');
-import AccessibleButton from '../elements/AccessibleButton';
 
 const HIDE_CONFERENCE_CHANS = true;
 
-const VERBS = {
-    'm.favourite': 'favourite',
-    'im.vector.fake.direct': 'tag direct chat',
-    'im.vector.fake.recent': 'restore',
-    'm.lowpriority': 'demote',
+function phraseForSection(section) {
+    // These would probably be better as individual strings,
+    // but for some reason we have translations for these strings
+    // as-is, so keeping it like this for now.
+    let verb;
+    switch (section) {
+        case 'm.favourite':
+            verb = _t('to favourite');
+            break;
+        case 'im.vector.fake.direct':
+            verb = _t('to tag direct chat');
+            break;
+        case 'im.vector.fake.recent':
+            verb = _t('to restore');
+            break;
+        case 'm.lowpriority':
+            verb = _t('to demote');
+            break;
+        default:
+            return _t('Drop here to tag %(section)s', {section: section});
+    }
+    return _t('Drop here %(toAction)s', {toAction: verb});
 };
 
 module.exports = React.createClass({
@@ -46,19 +63,10 @@ module.exports = React.createClass({
     propTypes: {
         ConferenceHandler: React.PropTypes.any,
         collapsed: React.PropTypes.bool.isRequired,
-        selectedRoom: React.PropTypes.string,
+        currentRoom: React.PropTypes.string,
         searchFilter: React.PropTypes.string,
     },
 
-    shouldComponentUpdate: function(nextProps, nextState) {
-        if (nextProps.collapsed !== this.props.collapsed) return true;
-        if (nextProps.searchFilter !== this.props.searchFilter) return true;
-        if (nextState.lists !== this.state.lists ||
-            nextState.isLoadingLeftRooms !== this.state.isLoadingLeftRooms ||
-            nextState.incomingCall !== this.state.incomingCall) return true;
-        return false;
-    },
-
     getInitialState: function() {
         return {
             isLoadingLeftRooms: false,
@@ -69,6 +77,8 @@ module.exports = React.createClass({
     },
 
     componentWillMount: function() {
+        this.mounted = false;
+
         var cli = MatrixClientPeg.get();
         cli.on("Room", this.onRoom);
         cli.on("deleteRoom", this.onDeleteRoom);
@@ -76,13 +86,10 @@ module.exports = React.createClass({
         cli.on("Room.name", this.onRoomName);
         cli.on("Room.tags", this.onRoomTags);
         cli.on("Room.receipt", this.onRoomReceipt);
-        cli.on("RoomState.members", this.onRoomStateMember);
+        cli.on("RoomState.events", this.onRoomStateEvents);
         cli.on("RoomMember.name", this.onRoomMemberName);
         cli.on("accountData", this.onAccountData);
 
-        // lookup for which lists a given roomId is currently in.
-        this.listsForRoomId = {};
-
         this.refreshRoomList();
 
         // order of the sublists
@@ -97,24 +104,11 @@ module.exports = React.createClass({
         this.dispatcherRef = dis.register(this.onAction);
         // Initialise the stickyHeaders when the component is created
         this._updateStickyHeaders(true);
+
+        this.mounted = true;
     },
 
-    componentWillReceiveProps: function(nextProps) {
-        // short-circuit react when the room changes
-        // to avoid rerendering all the sublists everywhere
-        if (nextProps.selectedRoom !== this.props.selectedRoom) {
-            if (this.props.selectedRoom) {
-                constantTimeDispatcher.dispatch(
-                    "RoomTile.select", this.props.selectedRoom, {}
-                );
-            }
-            constantTimeDispatcher.dispatch(
-                "RoomTile.select", nextProps.selectedRoom, { selected: true }
-            );
-        }
-    },
-
-    componentDidUpdate: function(prevProps, prevState) {
+    componentDidUpdate: function() {
         // Reinitialise the stickyHeaders when the component is updated
         this._updateStickyHeaders(true);
         this._repositionIncomingCallBox(undefined, false);
@@ -140,29 +134,17 @@ module.exports = React.createClass({
                 }
                 break;
             case 'on_room_read':
-                // poke the right RoomTile to refresh, using the constantTimeDispatcher
-                // to avoid each and every RoomTile registering to the 'on_room_read' event
-                // XXX: if we like the constantTimeDispatcher we might want to dispatch
-                // directly from TimelinePanel rather than needlessly bouncing via here.
-                constantTimeDispatcher.dispatch(
-                    "RoomTile.refresh", payload.room.roomId, {}
-                );
-
-                // also have to poke the right list(s)
-                var lists = this.listsForRoomId[payload.room.roomId];
-                if (lists) {
-                    lists.forEach(list=>{
-                        constantTimeDispatcher.dispatch(
-                            "RoomSubList.refreshHeader", list, { room: payload.room }
-                        );
-                    });
-                }
-
+                // Force an update because the notif count state is too deep to cause
+                // an update. This forces the local echo of reading notifs to be
+                // reflected by the RoomTiles.
+                this.forceUpdate();
                 break;
         }
     },
 
     componentWillUnmount: function() {
+        this.mounted = false;
+
         dis.unregister(this.dispatcherRef);
         if (MatrixClientPeg.get()) {
             MatrixClientPeg.get().removeListener("Room", this.onRoom);
@@ -171,7 +153,7 @@ module.exports = React.createClass({
             MatrixClientPeg.get().removeListener("Room.name", this.onRoomName);
             MatrixClientPeg.get().removeListener("Room.tags", this.onRoomTags);
             MatrixClientPeg.get().removeListener("Room.receipt", this.onRoomReceipt);
-            MatrixClientPeg.get().removeListener("RoomState.members", this.onRoomStateMember);
+            MatrixClientPeg.get().removeListener("RoomState.events", this.onRoomStateEvents);
             MatrixClientPeg.get().removeListener("RoomMember.name", this.onRoomMemberName);
             MatrixClientPeg.get().removeListener("accountData", this.onAccountData);
         }
@@ -180,14 +162,10 @@ module.exports = React.createClass({
     },
 
     onRoom: function(room) {
-        // XXX: this happens rarely; ideally we should only update the correct
-        // sublists when it does (e.g. via a constantTimeDispatch to the right sublist)
         this._delayedRefreshRoomList();
     },
 
     onDeleteRoom: function(roomId) {
-        // XXX: this happens rarely; ideally we should only update the correct
-        // sublists when it does (e.g. via a constantTimeDispatch to the right sublist)
         this._delayedRefreshRoomList();
     },
 
@@ -210,10 +188,6 @@ module.exports = React.createClass({
         }
     },
 
-    _onMouseOver: function(ev) {
-        this._lastMouseOverTs = Date.now();
-    },
-
     onSubListHeaderClick: function(isHidden, scrollToPosition) {
         // The scroll area has expanded or contracted, so re-calculate sticky headers positions
         this._updateStickyHeaders(true, scrollToPosition);
@@ -223,105 +197,44 @@ module.exports = React.createClass({
         if (toStartOfTimeline) return;
         if (!room) return;
         if (data.timeline.getTimelineSet() !== room.getUnfilteredTimelineSet()) return;
-
-        // rather than regenerate our full roomlists, which is very heavy, we poke the
-        // correct sublists to just re-sort themselves.  This isn't enormously reacty,
-        // but is much faster than the default react reconciler, or having to do voodoo
-        // with shouldComponentUpdate and a pleaseRefresh property or similar.
-        var lists = this.listsForRoomId[room.roomId];
-        if (lists) {
-            lists.forEach(list=>{
-                constantTimeDispatcher.dispatch("RoomSubList.sort", list, { room: room });
-            });
-        }
-
-        // we have to explicitly hit the roomtile which just changed
-        constantTimeDispatcher.dispatch(
-            "RoomTile.refresh", room.roomId, {}
-        );
+        this._delayedRefreshRoomList();
     },
 
     onRoomReceipt: function(receiptEvent, room) {
         // because if we read a notification, it will affect notification count
         // only bother updating if there's a receipt from us
         if (Receipt.findReadReceiptFromUserId(receiptEvent, MatrixClientPeg.get().credentials.userId)) {
-            var lists = this.listsForRoomId[room.roomId];
-            if (lists) {
-                lists.forEach(list=>{
-                    constantTimeDispatcher.dispatch(
-                        "RoomSubList.refreshHeader", list, { room: room }
-                    );
-                });
-            }
-
-            // we have to explicitly hit the roomtile which just changed
-            constantTimeDispatcher.dispatch(
-                "RoomTile.refresh", room.roomId, {}
-            );
+            this._delayedRefreshRoomList();
         }
     },
 
     onRoomName: function(room) {
-        constantTimeDispatcher.dispatch(
-            "RoomTile.refresh", room.roomId, {}
-        );
-    },
-
-    onRoomTags: function(event, room) {
-        // XXX: this happens rarely; ideally we should only update the correct
-        // sublists when it does (e.g. via a constantTimeDispatch to the right sublist)
         this._delayedRefreshRoomList();
     },
 
-    onRoomStateMember: function(ev, state, member) {
-        if (ev.getStateKey() === MatrixClientPeg.get().credentials.userId &&
-            ev.getPrevContent() && ev.getPrevContent().membership === "invite")
-        {
-            this._delayedRefreshRoomList();
-        }
-        else {
-            constantTimeDispatcher.dispatch(
-                "RoomTile.refresh", member.roomId, {}
-            );
-        }
+    onRoomTags: function(event, room) {
+        this._delayedRefreshRoomList();
+    },
+
+    onRoomStateEvents: function(ev, state) {
+        this._delayedRefreshRoomList();
     },
 
     onRoomMemberName: function(ev, member) {
-        constantTimeDispatcher.dispatch(
-            "RoomTile.refresh", member.roomId, {}
-        );
+        this._delayedRefreshRoomList();
     },
 
     onAccountData: function(ev) {
         if (ev.getType() == 'm.direct') {
-            // XXX: this happens rarely; ideally we should only update the correct
-            // sublists when it does (e.g. via a constantTimeDispatch to the right sublist)
-            this._delayedRefreshRoomList();
-        }
-        else if (ev.getType() == 'm.push_rules') {
             this._delayedRefreshRoomList();
         }
     },
 
     _delayedRefreshRoomList: new rate_limited_func(function() {
-        // if the mouse has been moving over the RoomList in the last 500ms
-        // then delay the refresh further to avoid bouncing around under the
-        // cursor
-        if (Date.now() - this._lastMouseOverTs > 500 || this._delayedRefreshRoomListLoopCount > 60) {
-            this.refreshRoomList();
-            this._delayedRefreshRoomListLoopCount = 0;
-        }
-        else {
-            this._delayedRefreshRoomListLoopCount++;
-            this._delayedRefreshRoomList();
-        }
+        this.refreshRoomList();
     }, 500),
 
     refreshRoomList: function() {
-        // console.log("DEBUG: Refresh room list delta=%s ms",
-        //     (!this._lastRefreshRoomListTs ? "-" : (Date.now() - this._lastRefreshRoomListTs))
-        // );
-
         // TODO: ideally we'd calculate this once at start, and then maintain
         // any changes to it incrementally, updating the appropriate sublists
         // as needed.
@@ -335,7 +248,7 @@ module.exports = React.createClass({
             lists: this.getRoomLists(),
             totalRoomCount: totalRooms,
         });
-        
+
         // this._lastRefreshRoomListTs = Date.now();
     },
 
@@ -350,9 +263,6 @@ module.exports = React.createClass({
         lists["m.lowpriority"] = [];
         lists["im.vector.fake.archived"] = [];
 
-        this.listsForRoomId = {};
-        var otherTagNames = {};
-
         const dmRoomMap = new DMRoomMap(MatrixClientPeg.get());
 
         MatrixClientPeg.get().getRooms().forEach(function(room) {
@@ -364,12 +274,7 @@ module.exports = React.createClass({
             //             ", target = " + me.events.member.getStateKey() +
             //             ", prevMembership = " + me.events.member.getPrevContent().membership);
 
-            if (!self.listsForRoomId[room.roomId]) {
-                self.listsForRoomId[room.roomId] = [];
-            }
-
             if (me.membership == "invite") {
-                self.listsForRoomId[room.roomId].push("im.vector.fake.invite");
                 lists["im.vector.fake.invite"].push(room);
             }
             else if (HIDE_CONFERENCE_CHANS && Rooms.isConfCallRoom(room, me, self.props.ConferenceHandler)) {
@@ -380,27 +285,23 @@ module.exports = React.createClass({
             {
                 // Used to split rooms via tags
                 var tagNames = Object.keys(room.tags);
+
                 if (tagNames.length) {
                     for (var i = 0; i < tagNames.length; i++) {
                         var tagName = tagNames[i];
                         lists[tagName] = lists[tagName] || [];
                         lists[tagName].push(room);
-                        self.listsForRoomId[room.roomId].push(tagName);
-                        otherTagNames[tagName] = 1;
                     }
                 }
                 else if (dmRoomMap.getUserIdForRoomId(room.roomId)) {
                     // "Direct Message" rooms (that we're still in and that aren't otherwise tagged)
-                    self.listsForRoomId[room.roomId].push("im.vector.fake.direct");
                     lists["im.vector.fake.direct"].push(room);
                 }
                 else {
-                    self.listsForRoomId[room.roomId].push("im.vector.fake.recent");
                     lists["im.vector.fake.recent"].push(room);
                 }
             }
             else if (me.membership === "leave") {
-                self.listsForRoomId[room.roomId].push("im.vector.fake.archived");
                 lists["im.vector.fake.archived"].push(room);
             }
             else {
@@ -429,13 +330,15 @@ module.exports = React.createClass({
     },
 
     _getScrollNode: function() {
+        if (!this.mounted) return null;
         var panel = ReactDOM.findDOMNode(this);
         if (!panel) return null;
 
-        // empirically, if we have gm-prevented for some reason, the scroll node
-        // is still the 3rd child (i.e. the view child).  This looks to be due
-        // to vdh's improved resize updater logic...?
-        return panel.children[2]; // XXX: Fragile!
+        if (panel.classList.contains('gm-prevented')) {
+            return panel;
+        } else {
+            return panel.children[2]; // XXX: Fragile!
+        }
     },
 
     _whenScrolling: function(e) {
@@ -483,7 +386,7 @@ module.exports = React.createClass({
         // Use the offset of the top of the scroll area from the window
         // as this is used to calculate the CSS fixed top position for the stickies
         var scrollAreaOffset = scrollArea.getBoundingClientRect().top + window.pageYOffset;
-        // Use the offset of the top of the component from the window
+        // Use the offset of the top of the componet from the window
         // as this is used to calculate the CSS fixed top position for the stickies
         var scrollAreaHeight = ReactDOM.findDOMNode(this).getBoundingClientRect().height;
 
@@ -587,27 +490,39 @@ module.exports = React.createClass({
         const StartChatButton = sdk.getComponent('elements.StartChatButton');
         const RoomDirectoryButton = sdk.getComponent('elements.RoomDirectoryButton');
         const CreateRoomButton = sdk.getComponent('elements.CreateRoomButton');
-        if (this.state.totalRoomCount === 0) {
-            const TintableSvg = sdk.getComponent('elements.TintableSvg');
-            switch (section) {
-                case 'im.vector.fake.direct':
-                    return <div className="mx_RoomList_emptySubListTip">
-                        Press
-                        <StartChatButton size="16" />
-                        to start a chat with someone
-                    </div>;
-                case 'im.vector.fake.recent':
-                    return <div className="mx_RoomList_emptySubListTip">
-                        You're not in any rooms yet! Press
-                        <CreateRoomButton size="16" />
-                        to make a room or
-                        <RoomDirectoryButton size="16" />
-                        to browse the directory
-                    </div>;
-            }
+
+        const TintableSvg = sdk.getComponent('elements.TintableSvg');
+        switch (section) {
+            case 'im.vector.fake.direct':
+                return <div className="mx_RoomList_emptySubListTip">
+                    {_tJsx(
+                        "Press <StartChatButton> to start a chat with someone",
+                        [/<StartChatButton>/],
+                        [
+                            (sub) => <StartChatButton size="16" callout={true}/>
+                        ]
+                    )}
+                </div>;
+            case 'im.vector.fake.recent':
+                return <div className="mx_RoomList_emptySubListTip">
+                    {_tJsx(
+                        "You're not in any rooms yet! Press <CreateRoomButton> to make a room or"+
+                        " <RoomDirectoryButton> to browse the directory",
+                        [/<CreateRoomButton>/, /<RoomDirectoryButton>/],
+                        [
+                            (sub) => <CreateRoomButton size="16" callout={true}/>,
+                            (sub) => <RoomDirectoryButton size="16" callout={true}/>
+                        ]
+                    )}
+                </div>;
         }
 
-        const labelText = 'Drop here to ' + (VERBS[section] || 'tag ' + section);
+        // We don't want to display drop targets if there are no room tiles to drag'n'drop
+        if (this.state.totalRoomCount === 0) {
+            return null;
+        }
+
+        const labelText = phraseForSection(section);
 
         return <RoomDropTarget label={labelText} />;
     },
@@ -632,66 +547,63 @@ module.exports = React.createClass({
     render: function() {
         var RoomSubList = sdk.getComponent('structures.RoomSubList');
         var self = this;
-
         return (
             <GeminiScrollbar className="mx_RoomList_scrollbar"
-                 autoshow={true} onScroll={ self._whenScrolling } onResize={ self._whenScrolling } ref="gemscroll">
-            <div className="mx_RoomList" onMouseOver={ this._onMouseOver }>
+                 autoshow={true} onScroll={ self._whenScrolling } ref="gemscroll">
+            <div className="mx_RoomList">
                 <RoomSubList list={ self.state.lists['im.vector.fake.invite'] }
-                             label="Invites"
-                             tagName="im.vector.fake.invite"
+                             label={ _t('Invites') }
                              editable={ false }
                              order="recent"
+                             selectedRoom={ self.props.selectedRoom }
                              incomingCall={ self.state.incomingCall }
                              collapsed={ self.props.collapsed }
-                             selectedRoom={ self.props.selectedRoom }
                              searchFilter={ self.props.searchFilter }
                              onHeaderClick={ self.onSubListHeaderClick }
                              onShowMoreRooms={ self.onShowMoreRooms } />
 
                 <RoomSubList list={ self.state.lists['m.favourite'] }
-                             label="Favourites"
+                             label={ _t('Favourites') }
                              tagName="m.favourite"
                              emptyContent={this._getEmptyContent('m.favourite')}
                              editable={ true }
                              order="manual"
+                             selectedRoom={ self.props.selectedRoom }
                              incomingCall={ self.state.incomingCall }
                              collapsed={ self.props.collapsed }
-                             selectedRoom={ self.props.selectedRoom }
                              searchFilter={ self.props.searchFilter }
                              onHeaderClick={ self.onSubListHeaderClick }
                              onShowMoreRooms={ self.onShowMoreRooms } />
 
                 <RoomSubList list={ self.state.lists['im.vector.fake.direct'] }
-                             label="People"
+                             label={ _t('People') }
                              tagName="im.vector.fake.direct"
                              emptyContent={this._getEmptyContent('im.vector.fake.direct')}
                              headerItems={this._getHeaderItems('im.vector.fake.direct')}
                              editable={ true }
                              order="recent"
+                             selectedRoom={ self.props.selectedRoom }
                              incomingCall={ self.state.incomingCall }
                              collapsed={ self.props.collapsed }
-                             selectedRoom={ self.props.selectedRoom }
                              alwaysShowHeader={ true }
                              searchFilter={ self.props.searchFilter }
                              onHeaderClick={ self.onSubListHeaderClick }
                              onShowMoreRooms={ self.onShowMoreRooms } />
 
                 <RoomSubList list={ self.state.lists['im.vector.fake.recent'] }
-                             label="Rooms"
-                             tagName="im.vector.fake.recent"
+                             label={ _t('Rooms') }
                              editable={ true }
                              emptyContent={this._getEmptyContent('im.vector.fake.recent')}
                              headerItems={this._getHeaderItems('im.vector.fake.recent')}
                              order="recent"
+                             selectedRoom={ self.props.selectedRoom }
                              incomingCall={ self.state.incomingCall }
                              collapsed={ self.props.collapsed }
-                             selectedRoom={ self.props.selectedRoom }
                              searchFilter={ self.props.searchFilter }
                              onHeaderClick={ self.onSubListHeaderClick }
                              onShowMoreRooms={ self.onShowMoreRooms } />
 
-                { Object.keys(self.state.lists).sort().map(function(tagName) {
+                { Object.keys(self.state.lists).map((tagName) => {
                     if (!tagName.match(/^(m\.(favourite|lowpriority)|im\.vector\.fake\.(invite|recent|direct|archived))$/)) {
                         return <RoomSubList list={ self.state.lists[tagName] }
                              key={ tagName }
@@ -700,9 +612,9 @@ module.exports = React.createClass({
                              emptyContent={this._getEmptyContent(tagName)}
                              editable={ true }
                              order="manual"
+                             selectedRoom={ self.props.selectedRoom }
                              incomingCall={ self.state.incomingCall }
                              collapsed={ self.props.collapsed }
-                             selectedRoom={ self.props.selectedRoom }
                              searchFilter={ self.props.searchFilter }
                              onHeaderClick={ self.onSubListHeaderClick }
                              onShowMoreRooms={ self.onShowMoreRooms } />;
@@ -711,25 +623,24 @@ module.exports = React.createClass({
                 }) }
 
                 <RoomSubList list={ self.state.lists['m.lowpriority'] }
-                             label="Low priority"
+                             label={ _t('Low priority') }
                              tagName="m.lowpriority"
                              emptyContent={this._getEmptyContent('m.lowpriority')}
                              editable={ true }
                              order="recent"
+                             selectedRoom={ self.props.selectedRoom }
                              incomingCall={ self.state.incomingCall }
                              collapsed={ self.props.collapsed }
-                             selectedRoom={ self.props.selectedRoom }
                              searchFilter={ self.props.searchFilter }
                              onHeaderClick={ self.onSubListHeaderClick }
                              onShowMoreRooms={ self.onShowMoreRooms } />
 
                 <RoomSubList list={ self.state.lists['im.vector.fake.archived'] }
-                             label="Historical"
-                             tagName="im.vector.fake.archived"
+                             label={ _t('Historical') }
                              editable={ false }
                              order="recent"
-                             collapsed={ self.props.collapsed }
                              selectedRoom={ self.props.selectedRoom }
+                             collapsed={ self.props.collapsed }
                              alwaysShowHeader={ true }
                              startAsHidden={ true }
                              showSpinner={ self.state.isLoadingLeftRooms }

src/components/views/rooms/RoomNameEditor.js

@@ -19,6 +19,7 @@ limitations under the License.
 var React = require('react');
 var sdk = require('../../../index');
 var MatrixClientPeg = require('../../../MatrixClientPeg');
+import { _t } from '../../../languageHandler';
 
 module.exports = React.createClass({
     displayName: 'RoomNameEditor',
@@ -35,8 +36,8 @@ module.exports = React.createClass({
 
         this._initialName = name ? name.getContent().name : '';
 
-        this._placeholderName = "Unnamed Room";
-        if (defaultName && defaultName !== 'Empty room') {
+        this._placeholderName = _t("Unnamed Room");
+        if (defaultName && defaultName !== 'Empty room') { // default name from JS SDK, needs no translation as we don't ever show it.
             this._placeholderName += " (" + defaultName + ")";
         }
     },
@@ -55,9 +56,9 @@ module.exports = React.createClass({
                          placeholderClassName="mx_RoomHeader_placeholder"
                          placeholder={ this._placeholderName }
                          blurToCancel={ false }
-                         initialValue={ this._initialName }/>
+                         initialValue={ this._initialName }
+                         dir="auto" />
                 </div>
         );
     },
 });
-

src/components/views/rooms/RoomPreviewBar.js

@@ -21,6 +21,8 @@ var React = require('react');
 var sdk = require('../../../index');
 var MatrixClientPeg = require('../../../MatrixClientPeg');
 
+import { _t, _tJsx } from '../../../languageHandler';
+
 module.exports = React.createClass({
     displayName: 'RoomPreviewBar',
 
@@ -47,7 +49,7 @@ module.exports = React.createClass({
         // The alias that was used to access this room, if appropriate
         // If given, this will be how the room is referred to (eg.
         // in error messages).
-        roomAlias: React.PropTypes.object,
+        roomAlias: React.PropTypes.string,
     },
 
     getDefaultProps: function() {
@@ -82,9 +84,9 @@ module.exports = React.createClass({
     },
 
     _roomNameElement: function(fallback) {
-        fallback = fallback || 'a room';
+        fallback = fallback || _t('a room');
         const name = this.props.room ? this.props.room.name : (this.props.room_alias || "");
-        return name ? <b>{ name }</b> : fallback;
+        return name ? name : fallback;
     },
 
     render: function() {
@@ -112,8 +114,7 @@ module.exports = React.createClass({
             if (this.props.invitedEmail) {
                 if (this.state.threePidFetchError) {
                     emailMatchBlock = <div className="error">
-                        Unable to ascertain that the address this invite was
-                        sent to matches one associated with your account.
+                        {_t("Unable to ascertain that the address this invite was sent to matches one associated with your account.")}
                     </div>;
                 } else if (this.state.invitedEmailMxid != MatrixClientPeg.get().credentials.userId) {
                     emailMatchBlock =
@@ -122,8 +123,10 @@ module.exports = React.createClass({
                                 <img src="img/warning.svg" width="24" height="23" title= "/!\\" alt="/!\\" />
                             </div>
                             <div className="mx_RoomPreviewBar_warningText">
-                                This invitation was sent to <b><span className="email">{this.props.invitedEmail}</span></b>, which is not associated with this account.<br/>
-                                You may wish to login with a different account, or add this email to this account.
+                                {_t("This invitation was sent to an email address which is not associated with this account:")}
+                                <b><span className="email">{this.props.invitedEmail}</span></b>
+                                <br/>
+                                {_t("You may wish to login with a different account, or add this email to this account.")}
                             </div>
                         </div>;
                 }
@@ -131,18 +134,24 @@ module.exports = React.createClass({
             joinBlock = (
                 <div>
                     <div className="mx_RoomPreviewBar_invite_text">
-                        You have been invited to join this room by <b>{ this.props.inviterName }</b>
+                        { _t('You have been invited to join this room by %(inviterName)s', {inviterName: this.props.inviterName}) }
                     </div>
                     <div className="mx_RoomPreviewBar_join_text">
-                        Would you like to <a onClick={ this.props.onJoinClick }>accept</a> or <a onClick={ this.props.onRejectClick }>decline</a> this invitation?
+                        { _tJsx(
+                            'Would you like to <acceptText>accept</acceptText> or <declineText>decline</declineText> this invitation?',
+                            [/<acceptText>(.*?)<\/acceptText>/, /<declineText>(.*?)<\/declineText>/],
+                            [
+                                (sub) => <a onClick={ this.props.onJoinClick }>{sub}</a>,
+                                (sub) => <a onClick={ this.props.onRejectClick }>{sub}</a>
+                            ]
+                        )}
                     </div>
                     {emailMatchBlock}
                 </div>
             );
 
         } else if (kicked || banned) {
-            const verb = kicked ? 'kicked' : 'banned';
-            const roomName = this._roomNameElement('this room');
+            const roomName = this._roomNameElement(_t('This room'));
             const kickerMember = this.props.room.currentState.getMember(
                 myMember.events.member.getSender()
             );
@@ -150,29 +159,39 @@ module.exports = React.createClass({
                 kickerMember.name : myMember.events.member.getSender();
             let reason;
             if (myMember.events.member.getContent().reason) {
-                reason = <div>Reason: {myMember.events.member.getContent().reason}</div>
+                reason = <div>{_t("Reason: %(reasonText)s", {reasonText: myMember.events.member.getContent().reason})}</div>
             }
             let rejoinBlock;
             if (!banned) {
-                rejoinBlock = <div><a onClick={ this.props.onJoinClick }><b>Rejoin</b></a></div>;
+                rejoinBlock = <div><a onClick={ this.props.onJoinClick }><b>{_t("Rejoin")}</b></a></div>;
             }
+
+            let actionText;
+            if (kicked) {
+                actionText = _t("You have been kicked from %(roomName)s by %(userName)s.", {roomName: roomName, userName: kickerName});
+            }
+            else if (banned) {
+                actionText = _t("You have been banned from %(roomName)s by %(userName)s.", {roomName: roomName, userName: kickerName});
+            } // no other options possible due to the kicked || banned check above.
+
             joinBlock = (
                 <div>
                     <div className="mx_RoomPreviewBar_join_text">
-                        You have been {verb} from {roomName} by {kickerName}.<br />
+                        {actionText}
+                        <br />
                         {reason}
                         {rejoinBlock}
-                        <a onClick={ this.props.onForgetClick }><b>Forget</b></a>
+                        <a onClick={ this.props.onForgetClick }><b>{_t("Forget room")}</b></a>
                     </div>
                 </div>
             );
         } else if (this.props.error) {
-            var name = this.props.roomAlias || "This room";
+            var name = this.props.roomAlias || _t("This room");
             var error;
             if (this.props.error.errcode == 'M_NOT_FOUND') {
-                error = name + " does not exist";
+                error = _t("%(roomName)s does not exist.", {roomName: name});
             } else {
-                error = name + " is not accessible at this time";
+                error = _t("%(roomName)s is not accessible at this time.", {roomName: name});
             }
             joinBlock = (
                 <div>
@@ -186,8 +205,12 @@ module.exports = React.createClass({
             joinBlock = (
                 <div>
                     <div className="mx_RoomPreviewBar_join_text">
-                        You are trying to access { name }.<br/>
-                        <a onClick={ this.props.onJoinClick }><b>Click here</b></a> to join the discussion!
+                        { _t('You are trying to access %(roomName)s.', {roomName: name}) }
+                        <br/>
+                        { _tJsx("<a>Click here</a> to join the discussion!",
+                            /<a>(.*?)<\/a>/,
+                            (sub) => <a onClick={ this.props.onJoinClick }><b>{sub}</b></a>
+                        )}
                     </div>
                 </div>
             );
@@ -196,7 +219,7 @@ module.exports = React.createClass({
         if (this.props.canPreview) {
             previewBlock = (
                 <div className="mx_RoomPreviewBar_preview_text">
-                    This is a preview of this room. Room interactions have been disabled.
+                    { _t('This is a preview of this room. Room interactions have been disabled') }.
                 </div>
             );
         }

src/components/views/rooms/RoomSettings.js

@@ -17,6 +17,7 @@ limitations under the License.
 
 import q from 'q';
 import React from 'react';
+import { _t, _tJsx } from '../../../languageHandler';
 import MatrixClientPeg from '../../../MatrixClientPeg';
 import SdkConfig from '../../../SdkConfig';
 import sdk from '../../../index';
@@ -39,13 +40,14 @@ function parseIntWithDefault(val, def) {
 const BannedUser = React.createClass({
     propTypes: {
         member: React.PropTypes.object.isRequired, // js-sdk RoomMember
+        reason: React.PropTypes.string,
     },
 
     _onUnbanClick: function() {
         const ConfirmUserActionDialog = sdk.getComponent("dialogs.ConfirmUserActionDialog");
         Modal.createDialog(ConfirmUserActionDialog, {
             member: this.props.member,
-            action: 'Unban',
+            action: _t('Unban'),
             danger: false,
             onFinished: (proceed) => {
                 if (!proceed) return;
@@ -56,8 +58,8 @@ const BannedUser = React.createClass({
                     const ErrorDialog = sdk.getComponent("dialogs.ErrorDialog");
                     console.error("Failed to unban: " + err);
                     Modal.createDialog(ErrorDialog, {
-                        title: "Error",
-                        description: "Failed to unban",
+                        title: _t('Error'),
+                        description: _t('Failed to unban'),
                     });
                 }).done();
             },
@@ -70,12 +72,13 @@ const BannedUser = React.createClass({
                 <AccessibleButton className="mx_RoomSettings_unbanButton"
                     onClick={this._onUnbanClick}
                 >
-                    Unban
+                    { _t('Unban') }
                 </AccessibleButton>
-                {this.props.member.userId}
+                <strong>{this.props.member.name}</strong> {this.props.member.userId}
+                {this.props.reason ? " " +_t('Reason') + ": " + this.props.reason : ""}
             </li>
         );
-    }
+    },
 });
 
 module.exports = React.createClass({
@@ -400,13 +403,13 @@ module.exports = React.createClass({
         var value = ev.target.value;
 
         Modal.createDialog(QuestionDialog, {
-            title: "Privacy warning",
+            title: _t('Privacy warning'),
             description:
                 <div>
-                    Changes to who can read history will only apply to future messages in this room.<br/>
-                    The visibility of existing history will be unchanged.
+                    { _t('Changes to who can read history will only apply to future messages in this room') }.<br/>
+                    { _t('The visibility of existing history will be unchanged') }.
                 </div>,
-            button: "Continue",
+            button: _t('Continue'),
             onFinished: function(confirmed) {
                 if (confirmed) {
                     self.setState({
@@ -523,11 +526,11 @@ module.exports = React.createClass({
         MatrixClientPeg.get().forget(this.props.room.roomId).done(function() {
             dis.dispatch({ action: 'view_next_room' });
         }, function(err) {
-            var errCode = err.errcode || "unknown error code";
+            var errCode = err.errcode || _t('unknown error code');
             var ErrorDialog = sdk.getComponent("dialogs.ErrorDialog");
             Modal.createDialog(ErrorDialog, {
-                title: "Error",
-                description: `Failed to forget room (${errCode})`
+                title: _t('Error'),
+                description: _t("Failed to forget room %(errCode)s", { errCode: errCode }),
             });
         });
     },
@@ -537,14 +540,14 @@ module.exports = React.createClass({
 
         var QuestionDialog = sdk.getComponent("dialogs.QuestionDialog");
         Modal.createDialog(QuestionDialog, {
-            title: "Warning!",
+            title: _t('Warning!'),
             description: (
                 <div>
-                    <p>End-to-end encryption is in beta and may not be reliable.</p>
-                    <p>You should <b>not</b> yet trust it to secure data.</p>
-                    <p>Devices will <b>not</b> yet be able to decrypt history from before they joined the room.</p>
-                    <p>Once encryption is enabled for a room it <b>cannot</b> be turned off again (for now).</p>
-                    <p>Encrypted messages will not be visible on clients that do not yet implement encryption.</p>
+                    <p>{ _t('End-to-end encryption is in beta and may not be reliable') }.</p>
+                    <p>{ _t('You should not yet trust it to secure data') }.</p>
+                    <p>{ _t('Devices will not yet be able to decrypt history from before they joined the room') }.</p>
+                    <p>{ _t('Once encryption is enabled for a room it cannot be turned off again (for now)') }.</p>
+                    <p>{ _t('Encrypted messages will not be visible on clients that do not yet implement encryption') }.</p>
                 </div>
             ),
             onFinished: confirm=>{
@@ -572,31 +575,29 @@ module.exports = React.createClass({
                 <input type="checkbox" ref="blacklistUnverified"
                        defaultChecked={ isGlobalBlacklistUnverified || isRoomBlacklistUnverified }
                        disabled={ isGlobalBlacklistUnverified || (this.refs.encrypt && !this.refs.encrypt.checked) }/>
-                Never send encrypted messages to unverified devices in this room from this device.
+                { _t('Never send encrypted messages to unverified devices in this room from this device') }.
             </label>;
 
-        if (!isEncrypted &&
-                roomState.mayClientSendStateEvent("m.room.encryption", cli)) {
+        if (!isEncrypted && roomState.mayClientSendStateEvent("m.room.encryption", cli)) {
             return (
                 <div>
                     <label>
                         <input type="checkbox" ref="encrypt" onClick={ this.onEnableEncryptionClick }/>
-                        <img className="mx_RoomSettings_e2eIcon" src="img/e2e-unencrypted.svg" width="12" height="12" />
-                        Enable encryption (warning: cannot be disabled again!)
+                        <img className="mx_RoomSettings_e2eIcon mx_filterFlipColor" src="img/e2e-unencrypted.svg" width="12" height="12" />
+                        { _t('Enable encryption') } { _t('(warning: cannot be disabled again!)') }
                     </label>
                     { settings }
                 </div>
             );
-        }
-        else {
+        } else {
             return (
                 <div>
                     <label>
                     { isEncrypted
                       ? <img className="mx_RoomSettings_e2eIcon" src="img/e2e-verified.svg" width="10" height="12" />
-                      : <img className="mx_RoomSettings_e2eIcon" src="img/e2e-unencrypted.svg" width="12" height="12" />
+                      : <img className="mx_RoomSettings_e2eIcon mx_filterFlipColor" src="img/e2e-unencrypted.svg" width="12" height="12" />
                     }
-                    Encryption is { isEncrypted ? "" : "not " } enabled in this room.
+                    { isEncrypted ? _t("Encryption is enabled in this room") : _t("Encryption is not enabled in this room") }.
                     </label>
                     { settings }
                 </div>
@@ -647,12 +648,12 @@ module.exports = React.createClass({
         if (Object.keys(user_levels).length) {
             userLevelsSection =
                 <div>
-                    <h3>Privileged Users</h3>
+                    <h3>{ _t('Privileged Users') }</h3>
                     <ul className="mx_RoomSettings_userLevels">
                         {Object.keys(user_levels).map(function(user, i) {
                             return (
                                 <li className="mx_RoomSettings_userLevel" key={user}>
-                                    { user } is a <PowerSelector value={ user_levels[user] } disabled={true}/>
+                                    { _t("%(user)s is a", {user: user}) } <PowerSelector value={ user_levels[user] } disabled={true}/>
                                 </li>
                             );
                         })}
@@ -660,19 +661,20 @@ module.exports = React.createClass({
                 </div>;
         }
         else {
-            userLevelsSection = <div>No users have specific privileges in this room.</div>;
+            userLevelsSection = <div>{ _t('No users have specific privileges in this room') }.</div>;
         }
 
-        var banned = this.props.room.getMembersWithMembership("ban");
-        var bannedUsersSection;
+        const banned = this.props.room.getMembersWithMembership("ban");
+        let bannedUsersSection;
         if (banned.length) {
             bannedUsersSection =
                 <div>
-                    <h3>Banned users</h3>
+                    <h3>{ _t('Banned users') }</h3>
                     <ul className="mx_RoomSettings_banned">
                         {banned.map(function(member) {
+                            const banEvent = member.events.member.getContent();
                             return (
-                                <BannedUser key={member.userId} member={member} />
+                                <BannedUser key={member.userId} member={member} reason={banEvent.reason} />
                             );
                         })}
                     </ul>
@@ -683,7 +685,7 @@ module.exports = React.createClass({
         if (this._yankValueFromEvent("m.room.create", "m.federate") === false) {
              unfederatableSection = (
                 <div className="mx_RoomSettings_powerLevel">
-                Ths room is not accessible by remote Matrix servers.
+                { _t('This room is not accessible by remote Matrix servers') }.
                 </div>
             );
         }
@@ -694,14 +696,14 @@ module.exports = React.createClass({
             if (myMember.membership === "join") {
                 leaveButton = (
                     <AccessibleButton className="mx_RoomSettings_leaveButton" onClick={ this.onLeaveClick }>
-                        Leave room
+                        { _t('Leave room') }
                     </AccessibleButton>
                 );
             }
             else if (myMember.membership === "leave") {
                 leaveButton = (
                     <AccessibleButton className="mx_RoomSettings_leaveButton" onClick={ this.onForgetClick }>
-                        Forget room
+                        { _t('Forget room') }
                     </AccessibleButton>
                 );
             }
@@ -711,8 +713,8 @@ module.exports = React.createClass({
         // TODO: support editing custom user_levels
 
         var tags = [
-            { name: "m.favourite", label: "Favourite", ref: "tag_favourite" },
-            { name: "m.lowpriority", label: "Low priority", ref: "tag_lowpriority" },
+            { name: "m.favourite", label: _t('Favourite'), ref: "tag_favourite" },
+            { name: "m.lowpriority", label: _t('Low priority'), ref: "tag_lowpriority" },
         ];
 
         Object.keys(this.state.tags).sort().forEach(function(tagName) {
@@ -725,7 +727,7 @@ module.exports = React.createClass({
         if (canSetTag || self.state.tags) {
             var tagsSection =
                 <div className="mx_RoomSettings_tags">
-                    Tagged as: { canSetTag ?
+                    {_t("Tagged as: ")}{ canSetTag ?
                         (tags.map(function(tag, i) {
                             return (<label key={ i }>
                                         <input type="checkbox"
@@ -753,7 +755,11 @@ module.exports = React.createClass({
         if (this.state.join_rule === "public" && aliasCount == 0) {
             addressWarning =
                 <div className="mx_RoomSettings_warning">
-                    To link to a room it must have <a href="#addresses">an address</a>.
+                        { _tJsx(
+                            'To link to a room it must have <a>an address</a>.',
+                            /<a>(.*?)<\/a>/,
+                            (sub) => <a href="#addresses">{sub}</a>
+                        )}
                 </div>;
         }
 
@@ -761,10 +767,10 @@ module.exports = React.createClass({
         if (this.state.join_rule !== "public" && this.state.guest_access === "forbidden") {
             inviteGuestWarning =
                 <div className="mx_RoomSettings_warning">
-                    Guests cannot join this room even if explicitly invited. <a href="#" onClick={ (e) => {
+                    { _t('Guests cannot join this room even if explicitly invited.') } <a href="#" onClick={ (e) => {
                         this.setState({ join_rule: "invite", guest_access: "can_join" });
                         e.preventDefault();
-                    }}>Click here to fix</a>.
+                    }}>{ _t('Click here to fix') }</a>.
                 </div>;
         }
 
@@ -776,7 +782,7 @@ module.exports = React.createClass({
                 console.error(this.state.scalar_error);
                 integrationsError = (
                     <span className="mx_RoomSettings_integrationsButton_errorPopup">
-                        Could not connect to the integration server
+                        { _t('Could not connect to the integration server') }
                     </span>
                 );
             }
@@ -784,7 +790,7 @@ module.exports = React.createClass({
             if (this.scalarClient.hasCredentials()) {
                 integrationsButton = (
                     <div className="mx_RoomSettings_integrationsButton" onClick={ this.onManageIntegrations }>
-                        Manage Integrations
+                        { _t('Manage Integrations') }
                     </div>
                 );
             } else if (this.state.scalar_error) {
@@ -797,7 +803,7 @@ module.exports = React.createClass({
             } else {
                 integrationsButton = (
                     <div className="mx_RoomSettings_integrationsButton" style={{opacity: 0.5}}>
-                        Manage Integrations
+                        { _t('Manage Integrations') }
                     </div>
                 );
             }
@@ -813,28 +819,28 @@ module.exports = React.createClass({
 
                 <div className="mx_RoomSettings_toggles">
                     <div className="mx_RoomSettings_settings">
-                        <h3>Who can access this room?</h3>
+                        <h3>{ _t('Who can access this room?') }</h3>
                         { inviteGuestWarning }
                         <label>
                             <input type="radio" name="roomVis" value="invite_only"
                                 disabled={ !this.mayChangeRoomAccess() }
                                 onChange={this._onRoomAccessRadioToggle}
                                 checked={this.state.join_rule !== "public"}/>
-                            Only people who have been invited
+                            { _t('Only people who have been invited') }
                         </label>
                         <label>
                             <input type="radio" name="roomVis" value="public_no_guests"
                                 disabled={ !this.mayChangeRoomAccess() }
                                 onChange={this._onRoomAccessRadioToggle}
                                 checked={this.state.join_rule === "public" && this.state.guest_access !== "can_join"}/>
-                            Anyone who knows the room's link, apart from guests
+                            { _t('Anyone who knows the room\'s link, apart from guests') }
                         </label>
                         <label>
                             <input type="radio" name="roomVis" value="public_with_guests"
                                 disabled={ !this.mayChangeRoomAccess() }
                                 onChange={this._onRoomAccessRadioToggle}
                                 checked={this.state.join_rule === "public" && this.state.guest_access === "can_join"}/>
-                            Anyone who knows the room's link, including guests
+                            { _t('Anyone who knows the room\'s link, including guests') }
                         </label>
                         { addressWarning }
                         <br/>
@@ -843,45 +849,45 @@ module.exports = React.createClass({
                             <input type="checkbox" disabled={ !roomState.mayClientSendStateEvent("m.room.aliases", cli) }
                                    onChange={ this._onToggle.bind(this, "isRoomPublished", true, false)}
                                    checked={this.state.isRoomPublished}/>
-                            List this room in { MatrixClientPeg.get().getDomain() }'s room directory?
+                            {_t("List this room in %(domain)s's room directory?", { domain: MatrixClientPeg.get().getDomain() })}
                         </label>
                     </div>
                     <div className="mx_RoomSettings_settings">
-                        <h3>Who can read history?</h3>
+                        <h3>{ _t('Who can read history?') }</h3>
                         <label>
                             <input type="radio" name="historyVis" value="world_readable"
                                     disabled={ !roomState.mayClientSendStateEvent("m.room.history_visibility", cli) }
                                     checked={historyVisibility === "world_readable"}
                                     onChange={this._onHistoryRadioToggle} />
-                            Anyone
+                            {_t("Anyone")}
                         </label>
                         <label>
                             <input type="radio" name="historyVis" value="shared"
                                     disabled={ !roomState.mayClientSendStateEvent("m.room.history_visibility", cli) }
                                     checked={historyVisibility === "shared"}
                                     onChange={this._onHistoryRadioToggle} />
-                            Members only (since the point in time of selecting this option)
+                            { _t('Members only') } ({ _t('since the point in time of selecting this option') })
                         </label>
                         <label>
                             <input type="radio" name="historyVis" value="invited"
                                     disabled={ !roomState.mayClientSendStateEvent("m.room.history_visibility", cli) }
                                     checked={historyVisibility === "invited"}
                                     onChange={this._onHistoryRadioToggle} />
-                            Members only (since they were invited)
+                            { _t('Members only') } ({ _t('since they were invited') })
                         </label>
                         <label >
                             <input type="radio" name="historyVis" value="joined"
                                     disabled={ !roomState.mayClientSendStateEvent("m.room.history_visibility", cli) }
                                     checked={historyVisibility === "joined"}
                                     onChange={this._onHistoryRadioToggle} />
-                            Members only (since they joined)
+                            { _t('Members only') } ({ _t('since they joined') })
                         </label>
                     </div>
                 </div>
 
 
                 <div>
-                    <h3>Room Colour</h3>
+                    <h3>{ _t('Room Colour') }</h3>
                     <ColorSettings ref="color_settings" room={this.props.room} />
                 </div>
 
@@ -899,41 +905,41 @@ module.exports = React.createClass({
 
                 <UrlPreviewSettings ref="url_preview_settings" room={this.props.room} />
 
-                <h3>Permissions</h3>
+                <h3>{ _t('Permissions') }</h3>
                 <div className="mx_RoomSettings_powerLevels mx_RoomSettings_settings">
                     <div className="mx_RoomSettings_powerLevel">
-                        <span className="mx_RoomSettings_powerLevelKey">The default role for new room members is </span>
+                        <span className="mx_RoomSettings_powerLevelKey">{ _t('The default role for new room members is') } </span>
                         <PowerSelector ref="users_default" value={default_user_level} controlled={false} disabled={!can_change_levels || current_user_level < default_user_level} onChange={this.onPowerLevelsChanged}/>
                     </div>
                     <div className="mx_RoomSettings_powerLevel">
-                        <span className="mx_RoomSettings_powerLevelKey">To send messages, you must be a </span>
+                        <span className="mx_RoomSettings_powerLevelKey">{ _t('To send messages') }, { _t('you must be a') } </span>
                         <PowerSelector ref="events_default" value={send_level} controlled={false} disabled={!can_change_levels || current_user_level < send_level} onChange={this.onPowerLevelsChanged}/>
                     </div>
                     <div className="mx_RoomSettings_powerLevel">
-                        <span className="mx_RoomSettings_powerLevelKey">To invite users into the room, you must be a </span>
+                        <span className="mx_RoomSettings_powerLevelKey">{ _t('To invite users into the room') }, { _t('you must be a') } </span>
                         <PowerSelector ref="invite" value={invite_level} controlled={false} disabled={!can_change_levels || current_user_level < invite_level} onChange={this.onPowerLevelsChanged}/>
                     </div>
                     <div className="mx_RoomSettings_powerLevel">
-                        <span className="mx_RoomSettings_powerLevelKey">To configure the room, you must be a </span>
+                        <span className="mx_RoomSettings_powerLevelKey">{ _t('To configure the room') }, { _t('you must be a') } </span>
                         <PowerSelector ref="state_default" value={state_level} controlled={false} disabled={!can_change_levels || current_user_level < state_level} onChange={this.onPowerLevelsChanged}/>
                     </div>
                     <div className="mx_RoomSettings_powerLevel">
-                        <span className="mx_RoomSettings_powerLevelKey">To kick users, you must be a </span>
+                        <span className="mx_RoomSettings_powerLevelKey">{ _t('To kick users') }, { _t('you must be a') } </span>
                         <PowerSelector ref="kick" value={kick_level} controlled={false} disabled={!can_change_levels || current_user_level < kick_level} onChange={this.onPowerLevelsChanged}/>
                     </div>
                     <div className="mx_RoomSettings_powerLevel">
-                        <span className="mx_RoomSettings_powerLevelKey">To ban users, you must be a </span>
+                        <span className="mx_RoomSettings_powerLevelKey">{ _t('To ban users') }, { _t('you must be a') } </span>
                         <PowerSelector ref="ban" value={ban_level} controlled={false} disabled={!can_change_levels || current_user_level < ban_level} onChange={this.onPowerLevelsChanged}/>
                     </div>
                     <div className="mx_RoomSettings_powerLevel">
-                        <span className="mx_RoomSettings_powerLevelKey">To redact messages, you must be a </span>
+                        <span className="mx_RoomSettings_powerLevelKey">{ _t('To remove other users\' messages') }, { _t('you must be a') } </span>
                         <PowerSelector ref="redact" value={redact_level} controlled={false} disabled={!can_change_levels || current_user_level < redact_level} onChange={this.onPowerLevelsChanged}/>
                     </div>
 
                     {Object.keys(events_levels).map(function(event_type, i) {
                         return (
                             <div className="mx_RoomSettings_powerLevel" key={event_type}>
-                                <span className="mx_RoomSettings_powerLevelKey">To send events of type <code>{ event_type }</code>, you must be a </span>
+                                <span className="mx_RoomSettings_powerLevelKey">{ _t('To send events of type') } <code>{ event_type }</code>, { _t('you must be a') } </span>
                                 <PowerSelector value={ events_levels[event_type] } controlled={false} disabled={true} onChange={self.onPowerLevelsChanged}/>
                             </div>
                         );
@@ -946,9 +952,9 @@ module.exports = React.createClass({
 
                 { bannedUsersSection }
 
-                <h3>Advanced</h3>
+                <h3>{ _t('Advanced') }</h3>
                 <div className="mx_RoomSettings_settings">
-                    This room's internal ID is <code>{ this.props.room.roomId }</code>
+                    { _t('This room\'s internal ID is') } <code>{ this.props.room.roomId }</code>
                 </div>
             </div>
         );

src/components/views/rooms/RoomTile.js

@@ -27,8 +27,6 @@ var RoomNotifs = require('../../../RoomNotifs');
 var FormattingUtils = require('../../../utils/FormattingUtils');
 import AccessibleButton from '../elements/AccessibleButton';
 var UserSettingsStore = require('../../../UserSettingsStore');
-var constantTimeDispatcher = require('../../../ConstantTimeDispatcher');
-var Unread = require('../../../Unread');
 
 module.exports = React.createClass({
     displayName: 'RoomTile',
@@ -38,10 +36,12 @@ module.exports = React.createClass({
         connectDropTarget: React.PropTypes.func,
         onClick: React.PropTypes.func,
         isDragging: React.PropTypes.bool,
-        selectedRoom: React.PropTypes.string,
 
         room: React.PropTypes.object.isRequired,
         collapsed: React.PropTypes.bool.isRequired,
+        selected: React.PropTypes.bool.isRequired,
+        unread: React.PropTypes.bool.isRequired,
+        highlight: React.PropTypes.bool.isRequired,
         isInvite: React.PropTypes.bool.isRequired,
         incomingCall: React.PropTypes.object,
     },
@@ -54,11 +54,10 @@ module.exports = React.createClass({
 
     getInitialState: function() {
         return({
-            hover: false,
-            badgeHover: false,
+            hover : false,
+            badgeHover : false,
             menuDisplayed: false,
             notifState: RoomNotifs.getRoomNotifsState(this.props.room.roomId),
-            selected: this.props.room ? (this.props.selectedRoom === this.props.room.roomId) : false,
         });
     },
 
@@ -80,32 +79,23 @@ module.exports = React.createClass({
         }
     },
 
+    onAccountData: function(accountDataEvent) {
+        if (accountDataEvent.getType() == 'm.push_rules') {
+            this.setState({
+                notifState: RoomNotifs.getRoomNotifsState(this.props.room.roomId),
+            });
+        }
+    },
+
     componentWillMount: function() {
-        constantTimeDispatcher.register("RoomTile.refresh", this.props.room.roomId, this.onRefresh);
-        constantTimeDispatcher.register("RoomTile.select", this.props.room.roomId, this.onSelect);
-        this.onRefresh();
+        MatrixClientPeg.get().on("accountData", this.onAccountData);
     },
 
     componentWillUnmount: function() {
-        constantTimeDispatcher.unregister("RoomTile.refresh", this.props.room.roomId, this.onRefresh);
-        constantTimeDispatcher.unregister("RoomTile.select", this.props.room.roomId, this.onSelect);
-    },
-
-    componentWillReceiveProps: function(nextProps) {
-        this.onRefresh();
-    },
-
-    onRefresh: function(params) {
-        this.setState({
-            unread: Unread.doesRoomHaveUnreadMessages(this.props.room),
-            highlight: this.props.room.getUnreadNotificationCount('highlight') > 0 || this.props.isInvite,
-        });
-    },
-
-    onSelect: function(params) {
-        this.setState({
-            selected: params.selected,
-        });
+        var cli = MatrixClientPeg.get();
+        if (cli) {
+            MatrixClientPeg.get().removeListener("accountData", this.onAccountData);
+        }
     },
 
     onClick: function(ev) {
@@ -179,13 +169,13 @@ module.exports = React.createClass({
         // var highlightCount = this.props.room.getUnreadNotificationCount("highlight");
 
         const notifBadges = notificationCount > 0 && this._shouldShowNotifBadge();
-        const mentionBadges = this.state.highlight && this._shouldShowMentionBadge();
+        const mentionBadges = this.props.highlight && this._shouldShowMentionBadge();
         const badges = notifBadges || mentionBadges;
 
         var classes = classNames({
             'mx_RoomTile': true,
-            'mx_RoomTile_selected': this.state.selected,
-            'mx_RoomTile_unread': this.state.unread,
+            'mx_RoomTile_selected': this.props.selected,
+            'mx_RoomTile_unread': this.props.unread,
             'mx_RoomTile_unreadNotify': notifBadges,
             'mx_RoomTile_highlight': mentionBadges,
             'mx_RoomTile_invited': (me && me.membership == 'invite'),
@@ -231,16 +221,16 @@ module.exports = React.createClass({
                 'mx_RoomTile_badgeShown': badges || this.state.badgeHover || this.state.menuDisplayed,
             });
 
-            if (this.state.selected) {
+            if (this.props.selected) {
                 let nameSelected = <EmojiText>{name}</EmojiText>;
 
-                label = <div title={ name } className={ nameClasses }>{ nameSelected }</div>;
+                label = <div title={ name } className={ nameClasses } dir="auto">{ nameSelected }</div>;
             } else {
-                label = <EmojiText element="div" title={ name } className={ nameClasses }>{name}</EmojiText>;
+                label = <EmojiText element="div" title={ name } className={ nameClasses } dir="auto">{name}</EmojiText>;
             }
         } else if (this.state.hover) {
             var RoomTooltip = sdk.getComponent("rooms.RoomTooltip");
-            tooltip = <RoomTooltip className="mx_RoomTile_tooltip" room={this.props.room} />;
+            tooltip = <RoomTooltip className="mx_RoomTile_tooltip" room={this.props.room} dir="auto" />;
         }
 
         //var incomingCallBox;
@@ -265,8 +255,7 @@ module.exports = React.createClass({
 
         let ret = (
             <div> { /* Only native elements can be wrapped in a DnD object. */}
-            <AccessibleButton className={classes} tabIndex="0" onClick={this.onClick}
-                              onMouseEnter={this.onMouseEnter} onMouseLeave={this.onMouseLeave}>
+            <AccessibleButton className={classes} tabIndex="0" onClick={this.onClick} onMouseEnter={this.onMouseEnter} onMouseLeave={this.onMouseLeave}>
                 <div className={avatarClasses}>
                     <div className="mx_RoomTile_avatar_container">
                         <RoomAvatar room={this.props.room} width={24} height={24} />

src/components/views/rooms/RoomTopicEditor.js

@@ -18,6 +18,7 @@ limitations under the License.
 
 var React = require('react');
 var sdk = require('../../../index');
+import { _t } from "../../../languageHandler";
 
 module.exports = React.createClass({
     displayName: 'RoomTopicEditor',
@@ -43,9 +44,10 @@ module.exports = React.createClass({
                 <EditableText ref="editor"
                      className="mx_RoomHeader_topic mx_RoomHeader_editable"
                      placeholderClassName="mx_RoomHeader_placeholder"
-                     placeholder="Add a topic"
+                     placeholder={_t("Add a topic")}
                      blurToCancel={ false }
-                     initialValue={ this._initialTopic }/>
+                     initialValue={ this._initialTopic }
+                     dir="auto" />
         );
     },
 });

src/components/views/rooms/SearchableEntityList.js

@@ -17,6 +17,7 @@ var React = require('react');
 var MatrixClientPeg = require("../../../MatrixClientPeg");
 var Modal = require("../../../Modal");
 var sdk = require("../../../index");
+import { _t } from '../../../languageHandler';
 var GeminiScrollbar = require('react-gemini-scrollbar');
 
 // A list capable of displaying entities which conform to the SearchableEntity
@@ -25,7 +26,6 @@ var SearchableEntityList = React.createClass({
     displayName: 'SearchableEntityList',
 
     propTypes: {
-        searchPlaceholderText: React.PropTypes.string,
         emptyQueryShowsAll: React.PropTypes.bool,
         showInputBox: React.PropTypes.bool,
         onQueryChanged: React.PropTypes.func, // fn(inputText)
@@ -37,7 +37,6 @@ var SearchableEntityList = React.createClass({
     getDefaultProps: function() {
         return {
             showInputBox: true,
-            searchPlaceholderText: "Search",
             entities: [],
             emptyQueryShowsAll: false,
             onSubmit: function() {},
@@ -118,7 +117,9 @@ var SearchableEntityList = React.createClass({
     _createOverflowEntity: function(overflowCount, totalCount) {
         var EntityTile = sdk.getComponent("rooms.EntityTile");
         var BaseAvatar = sdk.getComponent("avatars.BaseAvatar");
-        var text = "and " + overflowCount + " other" + (overflowCount > 1 ? "s" : "") + "...";
+        var text = (overflowCount > 1)
+        	? _t("and %(overflowCount)s others...", { overflowCount: overflowCount })
+        	: _t("and one other...");
         return (
             <EntityTile className="mx_EntityTile_ellipsis" avatarJsx={
                 <BaseAvatar url="img/ellipsis.svg" name="..." width={36} height={36} />
@@ -137,7 +138,7 @@ var SearchableEntityList = React.createClass({
                         onChange={this.onQueryChanged} value={this.state.query}
                         onFocus= {() => { this.setState({ focused: true }); }}
                         onBlur= {() => { this.setState({ focused: false }); }}
-                        placeholder={this.props.searchPlaceholderText} />
+                        placeholder={ _t("Search") } />
                 </form>
             );
         }

src/components/views/rooms/SimpleRoomHeader.js

@@ -14,12 +14,10 @@ See the License for the specific language governing permissions and
 limitations under the License.
 */
 
-'use strict';
-
 import React from 'react';
-import dis from '../../../dispatcher';
 import AccessibleButton from '../elements/AccessibleButton';
 import sdk from '../../../index';
+import { _t } from '../../../languageHandler';
 
 // cancel button which is shared between room header and simple room header
 export function CancelButton(props) {
@@ -28,7 +26,7 @@ export function CancelButton(props) {
     return (
         <AccessibleButton className='mx_RoomHeader_cancelButton' onClick={onClick}>
             <img src="img/cancel.svg" className='mx_filterFlipColor'
-                width="18" height="18" alt="Cancel"/>
+                width="18" height="18" alt={_t("Cancel")}/>
         </AccessibleButton>
     );
 }
@@ -44,17 +42,10 @@ export default React.createClass({
         title: React.PropTypes.string,
         onCancelClick: React.PropTypes.func,
 
-        // is the RightPanel collapsed?
-        collapsedRhs: React.PropTypes.bool,
-
         // `src` to a TintableSvg. Optional.
         icon: React.PropTypes.string,
     },
 
-    onShowRhsClick: function(ev) {
-        dis.dispatch({ action: 'show_right_panel' });
-    },
-
     render: function() {
         let cancelButton;
         let icon;
@@ -69,25 +60,12 @@ export default React.createClass({
             />;
         }
 
-        let showRhsButton;
-        /* // don't bother cluttering things up with this for now.
-        const TintableSvg = sdk.getComponent("elements.TintableSvg");
-
-        if (this.props.collapsedRhs) {
-            showRhsButton =
-                <div className="mx_RoomHeader_button" style={{ float: 'right' }} onClick={this.onShowRhsClick} title=">">
-                    <TintableSvg src="img/minimise.svg" width="10" height="16"/>
-                </div>
-        }
-        */
-
         return (
             <div className="mx_RoomHeader" >
                 <div className="mx_RoomHeader_wrapper">
                     <div className="mx_RoomHeader_simpleHeader">
                         { icon }
                         { this.props.title }
-                        { showRhsButton }
                         { cancelButton }
                     </div>
                 </div>

src/components/views/rooms/TopUnreadMessagesBar.js

@@ -18,6 +18,7 @@ limitations under the License.
 'use strict';
 
 var React = require('react');
+import { _t } from '../../../languageHandler';
 var sdk = require('../../../index');
 
 module.exports = React.createClass({
@@ -34,16 +35,15 @@ module.exports = React.createClass({
                 <div className="mx_TopUnreadMessagesBar_scrollUp"
                         onClick={this.props.onScrollUpClick}>
                     <img src="img/scrollto.svg" width="24" height="24"
-                        alt="Scroll to unread messages"
-                        title="Scroll to unread messages"/>
-                    Jump to first unread message.
+                        alt={ _t('Scroll to unread messages') }
+                        title={ _t('Scroll to unread messages') }/>
+                    { _t("Jump to first unread message.") }
                 </div>
-                <img className="mx_TopUnreadMessagesBar_close"
+                <img className="mx_TopUnreadMessagesBar_close mx_filterFlipColor"
                     src="img/cancel.svg" width="18" height="18"
-                    alt="Close" title="Close"
+                    alt={_t("Close")} title={_t("Close")}
                     onClick={this.props.onCloseClick} />
             </div>
         );
     },
 });
-