Merge branch 'develop' into travis/redact-to-remove
This commit is contained in:
commit
1b6685c5da
120 changed files with 7005 additions and 2054 deletions
|
@ -64,7 +64,7 @@ module.exports = {
|
||||||
// to JSX.
|
// to JSX.
|
||||||
ignorePattern: '^\\s*<',
|
ignorePattern: '^\\s*<',
|
||||||
ignoreComments: true,
|
ignoreComments: true,
|
||||||
code: 90,
|
code: 120,
|
||||||
}],
|
}],
|
||||||
"valid-jsdoc": ["warn"],
|
"valid-jsdoc": ["warn"],
|
||||||
"new-cap": ["warn"],
|
"new-cap": ["warn"],
|
||||||
|
|
3
.gitignore
vendored
3
.gitignore
vendored
|
@ -9,3 +9,6 @@ npm-debug.log
|
||||||
|
|
||||||
# test reports created by karma
|
# test reports created by karma
|
||||||
/karma-reports
|
/karma-reports
|
||||||
|
|
||||||
|
/.idea
|
||||||
|
/src/component-index.js
|
||||||
|
|
|
@ -9,11 +9,16 @@ set -ev
|
||||||
RIOT_WEB_DIR=riot-web
|
RIOT_WEB_DIR=riot-web
|
||||||
REACT_SDK_DIR=`pwd`
|
REACT_SDK_DIR=`pwd`
|
||||||
|
|
||||||
git clone --depth=1 --branch develop https://github.com/vector-im/riot-web.git \
|
curbranch="${TRAVIS_PULL_REQUEST_BRANCH:-$TRAVIS_BRANCH}"
|
||||||
|
echo "Determined branch to be $curbranch"
|
||||||
|
|
||||||
|
git clone https://github.com/vector-im/riot-web.git \
|
||||||
"$RIOT_WEB_DIR"
|
"$RIOT_WEB_DIR"
|
||||||
|
|
||||||
cd "$RIOT_WEB_DIR"
|
cd "$RIOT_WEB_DIR"
|
||||||
|
|
||||||
|
git checkout "$curbranch" || git checkout develop
|
||||||
|
|
||||||
mkdir node_modules
|
mkdir node_modules
|
||||||
npm install
|
npm install
|
||||||
|
|
||||||
|
|
172
CHANGELOG.md
172
CHANGELOG.md
|
@ -1,3 +1,175 @@
|
||||||
|
Changes in [0.8.9](https://github.com/matrix-org/matrix-react-sdk/releases/tag/v0.8.9) (2017-05-22)
|
||||||
|
===================================================================================================
|
||||||
|
[Full Changelog](https://github.com/matrix-org/matrix-react-sdk/compare/v0.8.9-rc.1...v0.8.9)
|
||||||
|
|
||||||
|
* No changes
|
||||||
|
|
||||||
|
|
||||||
|
Changes in [0.8.9-rc.1](https://github.com/matrix-org/matrix-react-sdk/releases/tag/v0.8.9-rc.1) (2017-05-19)
|
||||||
|
=============================================================================================================
|
||||||
|
[Full Changelog](https://github.com/matrix-org/matrix-react-sdk/compare/v0.8.8...v0.8.9-rc.1)
|
||||||
|
|
||||||
|
* Prevent an exception getting scroll node
|
||||||
|
[\#902](https://github.com/matrix-org/matrix-react-sdk/pull/902)
|
||||||
|
* Fix a few remaining snags with country dd
|
||||||
|
[\#901](https://github.com/matrix-org/matrix-react-sdk/pull/901)
|
||||||
|
* Add left_aligned class to CountryDropdown
|
||||||
|
[\#900](https://github.com/matrix-org/matrix-react-sdk/pull/900)
|
||||||
|
* Swap to new flag files (which are stored as GB.png)
|
||||||
|
[\#899](https://github.com/matrix-org/matrix-react-sdk/pull/899)
|
||||||
|
* Improve phone number country dropdown for registration and login (Act. 2,
|
||||||
|
Return of the Prefix)
|
||||||
|
[\#897](https://github.com/matrix-org/matrix-react-sdk/pull/897)
|
||||||
|
* Support for pasting files into normal composer
|
||||||
|
[\#892](https://github.com/matrix-org/matrix-react-sdk/pull/892)
|
||||||
|
* tell guests they can't use filepanel until they register
|
||||||
|
[\#887](https://github.com/matrix-org/matrix-react-sdk/pull/887)
|
||||||
|
* Prevent reskindex -w from running when file names have not changed
|
||||||
|
[\#888](https://github.com/matrix-org/matrix-react-sdk/pull/888)
|
||||||
|
* I broke UserSettings for webpack-dev-server
|
||||||
|
[\#884](https://github.com/matrix-org/matrix-react-sdk/pull/884)
|
||||||
|
* various fixes to RoomHeader
|
||||||
|
[\#880](https://github.com/matrix-org/matrix-react-sdk/pull/880)
|
||||||
|
* remove /me whether or not it has a space after it
|
||||||
|
[\#885](https://github.com/matrix-org/matrix-react-sdk/pull/885)
|
||||||
|
* show error if we can't set a filter because no room
|
||||||
|
[\#883](https://github.com/matrix-org/matrix-react-sdk/pull/883)
|
||||||
|
* Fix RM not updating if RR event unpaginated
|
||||||
|
[\#874](https://github.com/matrix-org/matrix-react-sdk/pull/874)
|
||||||
|
* change roomsettings wording
|
||||||
|
[\#878](https://github.com/matrix-org/matrix-react-sdk/pull/878)
|
||||||
|
* make reskindex windows friendly
|
||||||
|
[\#875](https://github.com/matrix-org/matrix-react-sdk/pull/875)
|
||||||
|
* Fixes 2 issues with Dialog closing
|
||||||
|
[\#867](https://github.com/matrix-org/matrix-react-sdk/pull/867)
|
||||||
|
* Automatic Reskindex
|
||||||
|
[\#871](https://github.com/matrix-org/matrix-react-sdk/pull/871)
|
||||||
|
* Put room name in 'leave room' confirmation dialog
|
||||||
|
[\#873](https://github.com/matrix-org/matrix-react-sdk/pull/873)
|
||||||
|
* Fix this/self fail in LeftPanel
|
||||||
|
[\#872](https://github.com/matrix-org/matrix-react-sdk/pull/872)
|
||||||
|
* Don't show null URL previews
|
||||||
|
[\#870](https://github.com/matrix-org/matrix-react-sdk/pull/870)
|
||||||
|
* Fix keys for AddressSelector
|
||||||
|
[\#869](https://github.com/matrix-org/matrix-react-sdk/pull/869)
|
||||||
|
* Make left panel better for new users (mk II)
|
||||||
|
[\#859](https://github.com/matrix-org/matrix-react-sdk/pull/859)
|
||||||
|
* Explicitly save composer content onUnload
|
||||||
|
[\#866](https://github.com/matrix-org/matrix-react-sdk/pull/866)
|
||||||
|
* Warn on unload
|
||||||
|
[\#851](https://github.com/matrix-org/matrix-react-sdk/pull/851)
|
||||||
|
* Log deviceid at login
|
||||||
|
[\#862](https://github.com/matrix-org/matrix-react-sdk/pull/862)
|
||||||
|
* Guests can't send RR so no point trying
|
||||||
|
[\#860](https://github.com/matrix-org/matrix-react-sdk/pull/860)
|
||||||
|
* Remove babelcheck
|
||||||
|
[\#861](https://github.com/matrix-org/matrix-react-sdk/pull/861)
|
||||||
|
* T3chguy/settings versions improvements
|
||||||
|
[\#857](https://github.com/matrix-org/matrix-react-sdk/pull/857)
|
||||||
|
* Change max-len 90->120
|
||||||
|
[\#852](https://github.com/matrix-org/matrix-react-sdk/pull/852)
|
||||||
|
* Remove DM-guessing code
|
||||||
|
[\#829](https://github.com/matrix-org/matrix-react-sdk/pull/829)
|
||||||
|
* Fix jumping to an unread event when in MELS
|
||||||
|
[\#855](https://github.com/matrix-org/matrix-react-sdk/pull/855)
|
||||||
|
* Validate phone number on login
|
||||||
|
[\#856](https://github.com/matrix-org/matrix-react-sdk/pull/856)
|
||||||
|
* Failed to enable HTML5 Notifications Error Dialogs
|
||||||
|
[\#827](https://github.com/matrix-org/matrix-react-sdk/pull/827)
|
||||||
|
* Pin filesize ver to fix break upstream
|
||||||
|
[\#854](https://github.com/matrix-org/matrix-react-sdk/pull/854)
|
||||||
|
* Improve RoomDirectory Look & Feel
|
||||||
|
[\#848](https://github.com/matrix-org/matrix-react-sdk/pull/848)
|
||||||
|
* Only show jumpToReadMarker bar when RM !== RR
|
||||||
|
[\#845](https://github.com/matrix-org/matrix-react-sdk/pull/845)
|
||||||
|
* Allow MELS to have its own RM
|
||||||
|
[\#846](https://github.com/matrix-org/matrix-react-sdk/pull/846)
|
||||||
|
* Use document.onkeydown instead of onkeypress
|
||||||
|
[\#844](https://github.com/matrix-org/matrix-react-sdk/pull/844)
|
||||||
|
* (Room)?Avatar: Request 96x96 avatars on high DPI screens
|
||||||
|
[\#808](https://github.com/matrix-org/matrix-react-sdk/pull/808)
|
||||||
|
* Add mx_EventTile_emote class
|
||||||
|
[\#842](https://github.com/matrix-org/matrix-react-sdk/pull/842)
|
||||||
|
* Fix dialog reappearing after hitting Enter
|
||||||
|
[\#841](https://github.com/matrix-org/matrix-react-sdk/pull/841)
|
||||||
|
* Fix spinner that shows until the first sync
|
||||||
|
[\#840](https://github.com/matrix-org/matrix-react-sdk/pull/840)
|
||||||
|
* Show spinner until first sync has completed
|
||||||
|
[\#839](https://github.com/matrix-org/matrix-react-sdk/pull/839)
|
||||||
|
* Style fixes for LoggedInView
|
||||||
|
[\#838](https://github.com/matrix-org/matrix-react-sdk/pull/838)
|
||||||
|
* Fix specifying custom server for registration
|
||||||
|
[\#834](https://github.com/matrix-org/matrix-react-sdk/pull/834)
|
||||||
|
* Improve country dropdown UX and expose +prefix
|
||||||
|
[\#833](https://github.com/matrix-org/matrix-react-sdk/pull/833)
|
||||||
|
* Fix user settings store
|
||||||
|
[\#836](https://github.com/matrix-org/matrix-react-sdk/pull/836)
|
||||||
|
* show the room name in the UDE Dialog
|
||||||
|
[\#832](https://github.com/matrix-org/matrix-react-sdk/pull/832)
|
||||||
|
* summarise profile changes in MELS
|
||||||
|
[\#826](https://github.com/matrix-org/matrix-react-sdk/pull/826)
|
||||||
|
* Transform h1 and h2 tags to h3 tags
|
||||||
|
[\#820](https://github.com/matrix-org/matrix-react-sdk/pull/820)
|
||||||
|
* limit our keyboard shortcut modifiers correctly
|
||||||
|
[\#825](https://github.com/matrix-org/matrix-react-sdk/pull/825)
|
||||||
|
* Specify cross platform regexes and add olm to noParse
|
||||||
|
[\#823](https://github.com/matrix-org/matrix-react-sdk/pull/823)
|
||||||
|
* Remember element that was in focus before rendering dialog
|
||||||
|
[\#822](https://github.com/matrix-org/matrix-react-sdk/pull/822)
|
||||||
|
* move user settings outward and use built in read receipts disabling
|
||||||
|
[\#824](https://github.com/matrix-org/matrix-react-sdk/pull/824)
|
||||||
|
* File Download Consistency
|
||||||
|
[\#802](https://github.com/matrix-org/matrix-react-sdk/pull/802)
|
||||||
|
* Show Access Token under Advanced in Settings
|
||||||
|
[\#806](https://github.com/matrix-org/matrix-react-sdk/pull/806)
|
||||||
|
* Link tags/commit hashes in the UserSettings version section
|
||||||
|
[\#810](https://github.com/matrix-org/matrix-react-sdk/pull/810)
|
||||||
|
* On return to RoomView from auxPanel, send focus back to Composer
|
||||||
|
[\#813](https://github.com/matrix-org/matrix-react-sdk/pull/813)
|
||||||
|
* Change presence status labels to 'for' instead of 'ago'
|
||||||
|
[\#817](https://github.com/matrix-org/matrix-react-sdk/pull/817)
|
||||||
|
* Disable Scalar Integrations if urls passed to it are falsey
|
||||||
|
[\#816](https://github.com/matrix-org/matrix-react-sdk/pull/816)
|
||||||
|
* Add option to hide other people's read receipts.
|
||||||
|
[\#818](https://github.com/matrix-org/matrix-react-sdk/pull/818)
|
||||||
|
* Add option to not send typing notifications
|
||||||
|
[\#819](https://github.com/matrix-org/matrix-react-sdk/pull/819)
|
||||||
|
* Sync RM across instances of Riot
|
||||||
|
[\#805](https://github.com/matrix-org/matrix-react-sdk/pull/805)
|
||||||
|
* First iteration on improving login UI
|
||||||
|
[\#811](https://github.com/matrix-org/matrix-react-sdk/pull/811)
|
||||||
|
* focus on composer after jumping to bottom
|
||||||
|
[\#809](https://github.com/matrix-org/matrix-react-sdk/pull/809)
|
||||||
|
* Improve RoomList performance via side-stepping React
|
||||||
|
[\#807](https://github.com/matrix-org/matrix-react-sdk/pull/807)
|
||||||
|
* Don't show link preview when link is inside of a quote
|
||||||
|
[\#762](https://github.com/matrix-org/matrix-react-sdk/pull/762)
|
||||||
|
* Escape closes UserSettings
|
||||||
|
[\#765](https://github.com/matrix-org/matrix-react-sdk/pull/765)
|
||||||
|
* Implement user power-level changes in timeline
|
||||||
|
[\#794](https://github.com/matrix-org/matrix-react-sdk/pull/794)
|
||||||
|
|
||||||
|
Changes in [0.8.8](https://github.com/matrix-org/matrix-react-sdk/releases/tag/v0.8.8) (2017-04-25)
|
||||||
|
===================================================================================================
|
||||||
|
[Full Changelog](https://github.com/matrix-org/matrix-react-sdk/compare/v0.8.8-rc.2...v0.8.8)
|
||||||
|
|
||||||
|
* No changes
|
||||||
|
|
||||||
|
|
||||||
|
Changes in [0.8.8-rc.2](https://github.com/matrix-org/matrix-react-sdk/releases/tag/v0.8.8-rc.2) (2017-04-24)
|
||||||
|
=============================================================================================================
|
||||||
|
[Full Changelog](https://github.com/matrix-org/matrix-react-sdk/compare/v0.8.8-rc.1...v0.8.8-rc.2)
|
||||||
|
|
||||||
|
* Fix bug where links to Riot would fail to open.
|
||||||
|
|
||||||
|
|
||||||
|
Changes in [0.8.8-rc.1](https://github.com/matrix-org/matrix-react-sdk/releases/tag/v0.8.8-rc.1) (2017-04-21)
|
||||||
|
=============================================================================================================
|
||||||
|
[Full Changelog](https://github.com/matrix-org/matrix-react-sdk/compare/v0.8.7...v0.8.8-rc.1)
|
||||||
|
|
||||||
|
* Update js-sdk to fix registration without a captcha (https://github.com/vector-im/riot-web/issues/3621)
|
||||||
|
|
||||||
|
|
||||||
Changes in [0.8.7](https://github.com/matrix-org/matrix-react-sdk/releases/tag/v0.8.7) (2017-04-12)
|
Changes in [0.8.7](https://github.com/matrix-org/matrix-react-sdk/releases/tag/v0.8.7) (2017-04-12)
|
||||||
===================================================================================================
|
===================================================================================================
|
||||||
[Full Changelog](https://github.com/matrix-org/matrix-react-sdk/compare/v0.8.7-rc.4...v0.8.7)
|
[Full Changelog](https://github.com/matrix-org/matrix-react-sdk/compare/v0.8.7-rc.4...v0.8.7)
|
||||||
|
|
|
@ -24,6 +24,10 @@ In the interim, `vector-im/riot-web` and `matrix-org/matrix-react-sdk` should
|
||||||
be considered as a single project (for instance, matrix-react-sdk bugs
|
be considered as a single project (for instance, matrix-react-sdk bugs
|
||||||
are currently filed against vector-im/riot-web rather than this project).
|
are currently filed against vector-im/riot-web rather than this project).
|
||||||
|
|
||||||
|
Translation Status
|
||||||
|
==================
|
||||||
|
[](https://translate.nordgedanken.de/engage/riot-web/?utm_source=widget)
|
||||||
|
|
||||||
Developer Guide
|
Developer Guide
|
||||||
===============
|
===============
|
||||||
|
|
||||||
|
@ -190,4 +194,3 @@ Alternative instructions:
|
||||||
* Create an index.html file pulling in your compiled javascript and the
|
* Create an index.html file pulling in your compiled javascript and the
|
||||||
CSS bundle from the skin you use. For now, you'll also need to manually
|
CSS bundle from the skin you use. For now, you'll also need to manually
|
||||||
import CSS from any skins that your skin inherts from.
|
import CSS from any skins that your skin inherts from.
|
||||||
|
|
||||||
|
|
|
@ -69,25 +69,41 @@ General Style
|
||||||
console.log("I am a fish"); // Bad
|
console.log("I am a fish"); // Bad
|
||||||
}
|
}
|
||||||
```
|
```
|
||||||
|
- No new line before else, catch, finally, etc:
|
||||||
|
|
||||||
|
```javascript
|
||||||
|
if (x) {
|
||||||
|
console.log("I am a fish");
|
||||||
|
} else {
|
||||||
|
console.log("I am a chimp"); // Good
|
||||||
|
}
|
||||||
|
|
||||||
|
if (x) {
|
||||||
|
console.log("I am a fish");
|
||||||
|
}
|
||||||
|
else {
|
||||||
|
console.log("I am a chimp"); // Bad
|
||||||
|
}
|
||||||
|
```
|
||||||
- Declare one variable per var statement (consistent with Node). Unless they
|
- Declare one variable per var statement (consistent with Node). Unless they
|
||||||
are simple and closely related. If you put the next declaration on a new line,
|
are simple and closely related. If you put the next declaration on a new line,
|
||||||
treat yourself to another `var`:
|
treat yourself to another `var`:
|
||||||
|
|
||||||
```javascript
|
```javascript
|
||||||
var key = "foo",
|
const key = "foo",
|
||||||
comparator = function(x, y) {
|
comparator = function(x, y) {
|
||||||
return x - y;
|
return x - y;
|
||||||
}; // Bad
|
}; // Bad
|
||||||
|
|
||||||
var key = "foo";
|
const key = "foo";
|
||||||
var comparator = function(x, y) {
|
const comparator = function(x, y) {
|
||||||
return x - y;
|
return x - y;
|
||||||
}; // Good
|
}; // Good
|
||||||
|
|
||||||
var x = 0, y = 0; // Fine
|
let x = 0, y = 0; // Fine
|
||||||
|
|
||||||
var x = 0;
|
let x = 0;
|
||||||
var y = 0; // Also fine
|
let y = 0; // Also fine
|
||||||
```
|
```
|
||||||
- A single line `if` is fine, all others have braces. This prevents errors when adding to the code.:
|
- A single line `if` is fine, all others have braces. This prevents errors when adding to the code.:
|
||||||
|
|
||||||
|
|
1
header
1
header
|
@ -1,5 +1,6 @@
|
||||||
/*
|
/*
|
||||||
Copyright 2015, 2016 OpenMarket Ltd
|
Copyright 2015, 2016 OpenMarket Ltd
|
||||||
|
Copyright 2017 Vector Creations Ltd
|
||||||
|
|
||||||
Licensed under the Apache License, Version 2.0 (the "License");
|
Licensed under the Apache License, Version 2.0 (the "License");
|
||||||
you may not use this file except in compliance with the License.
|
you may not use this file except in compliance with the License.
|
||||||
|
|
|
@ -55,11 +55,18 @@ module.exports = function (config) {
|
||||||
// some images to reduce noise from the tests
|
// some images to reduce noise from the tests
|
||||||
{pattern: 'test/img/*', watched: false, included: false,
|
{pattern: 'test/img/*', watched: false, included: false,
|
||||||
served: true, nocache: false},
|
served: true, nocache: false},
|
||||||
|
// translation files
|
||||||
|
{pattern: 'src/i18n/strings/*', watcheed: false, included: false, served: true},
|
||||||
|
{pattern: 'test/i18n/*', watched: false, included: false, served: true},
|
||||||
],
|
],
|
||||||
|
|
||||||
// redirect img links to the karma server
|
|
||||||
proxies: {
|
proxies: {
|
||||||
|
// redirect img links to the karma server
|
||||||
"/img/": "/base/test/img/",
|
"/img/": "/base/test/img/",
|
||||||
|
// special languages.json file for the tests
|
||||||
|
"/i18n/languages.json": "/base/test/i18n/languages.json",
|
||||||
|
// and redirect i18n requests
|
||||||
|
"/i18n/": "/base/src/i18n/strings/",
|
||||||
},
|
},
|
||||||
|
|
||||||
// list of files to exclude
|
// list of files to exclude
|
||||||
|
@ -166,7 +173,6 @@ module.exports = function (config) {
|
||||||
'sinon': 'sinon/pkg/sinon.js',
|
'sinon': 'sinon/pkg/sinon.js',
|
||||||
},
|
},
|
||||||
root: [
|
root: [
|
||||||
path.resolve('./src'),
|
|
||||||
path.resolve('./test'),
|
path.resolve('./test'),
|
||||||
],
|
],
|
||||||
},
|
},
|
||||||
|
|
17
package.json
17
package.json
|
@ -1,6 +1,6 @@
|
||||||
{
|
{
|
||||||
"name": "matrix-react-sdk",
|
"name": "matrix-react-sdk",
|
||||||
"version": "0.8.7",
|
"version": "0.8.9",
|
||||||
"description": "SDK for matrix.org using React",
|
"description": "SDK for matrix.org using React",
|
||||||
"author": "matrix.org",
|
"author": "matrix.org",
|
||||||
"repository": {
|
"repository": {
|
||||||
|
@ -31,9 +31,11 @@
|
||||||
"reskindex": "scripts/reskindex.js"
|
"reskindex": "scripts/reskindex.js"
|
||||||
},
|
},
|
||||||
"scripts": {
|
"scripts": {
|
||||||
"reskindex": "scripts/reskindex.js -h header",
|
"reskindex": "node scripts/reskindex.js -h header",
|
||||||
"build": "node scripts/babelcheck.js && babel src -d lib --source-maps",
|
"reskindex:watch": "node scripts/reskindex.js -h header -w",
|
||||||
"start": "node scripts/babelcheck.js && babel src -w -d lib --source-maps",
|
"build": "npm run reskindex && babel src -d lib --source-maps",
|
||||||
|
"build:watch": "babel src -w -d lib --source-maps",
|
||||||
|
"start": "parallelshell \"npm run build:watch\" \"npm run reskindex:watch\"",
|
||||||
"lint": "eslint src/",
|
"lint": "eslint src/",
|
||||||
"lintall": "eslint src/ test/",
|
"lintall": "eslint src/ test/",
|
||||||
"clean": "rimraf lib",
|
"clean": "rimraf lib",
|
||||||
|
@ -48,12 +50,13 @@
|
||||||
"browser-request": "^0.3.3",
|
"browser-request": "^0.3.3",
|
||||||
"classnames": "^2.1.2",
|
"classnames": "^2.1.2",
|
||||||
"commonmark": "^0.27.0",
|
"commonmark": "^0.27.0",
|
||||||
|
"counterpart": "^0.18.0",
|
||||||
"draft-js": "^0.8.1",
|
"draft-js": "^0.8.1",
|
||||||
"draft-js-export-html": "^0.5.0",
|
"draft-js-export-html": "^0.5.0",
|
||||||
"draft-js-export-markdown": "^0.2.0",
|
"draft-js-export-markdown": "^0.2.0",
|
||||||
"emojione": "2.2.3",
|
"emojione": "2.2.3",
|
||||||
"file-saver": "^1.3.3",
|
"file-saver": "^1.3.3",
|
||||||
"filesize": "^3.1.2",
|
"filesize": "3.5.6",
|
||||||
"flux": "^2.0.3",
|
"flux": "^2.0.3",
|
||||||
"fuse.js": "^2.2.0",
|
"fuse.js": "^2.2.0",
|
||||||
"glob": "^5.0.14",
|
"glob": "^5.0.14",
|
||||||
|
@ -67,7 +70,7 @@
|
||||||
"react": "^15.4.0",
|
"react": "^15.4.0",
|
||||||
"react-addons-css-transition-group": "15.3.2",
|
"react-addons-css-transition-group": "15.3.2",
|
||||||
"react-dom": "^15.4.0",
|
"react-dom": "^15.4.0",
|
||||||
"react-gemini-scrollbar": "matrix-org/react-gemini-scrollbar#39d858c",
|
"react-gemini-scrollbar": "matrix-org/react-gemini-scrollbar#5e97aef",
|
||||||
"sanitize-html": "^1.11.1",
|
"sanitize-html": "^1.11.1",
|
||||||
"text-encoding-utf-8": "^1.0.1",
|
"text-encoding-utf-8": "^1.0.1",
|
||||||
"velocity-vector": "vector-im/velocity#059e3b2",
|
"velocity-vector": "vector-im/velocity#059e3b2",
|
||||||
|
@ -88,6 +91,7 @@
|
||||||
"babel-preset-es2016": "^6.11.3",
|
"babel-preset-es2016": "^6.11.3",
|
||||||
"babel-preset-es2017": "^6.14.0",
|
"babel-preset-es2017": "^6.14.0",
|
||||||
"babel-preset-react": "^6.11.1",
|
"babel-preset-react": "^6.11.1",
|
||||||
|
"chokidar": "^1.6.1",
|
||||||
"eslint": "^3.13.1",
|
"eslint": "^3.13.1",
|
||||||
"eslint-config-google": "^0.7.1",
|
"eslint-config-google": "^0.7.1",
|
||||||
"eslint-plugin-babel": "^4.0.1",
|
"eslint-plugin-babel": "^4.0.1",
|
||||||
|
@ -104,6 +108,7 @@
|
||||||
"karma-sourcemap-loader": "^0.3.7",
|
"karma-sourcemap-loader": "^0.3.7",
|
||||||
"karma-webpack": "^1.7.0",
|
"karma-webpack": "^1.7.0",
|
||||||
"mocha": "^2.4.5",
|
"mocha": "^2.4.5",
|
||||||
|
"parallelshell": "^1.2.0",
|
||||||
"phantomjs-prebuilt": "^2.1.7",
|
"phantomjs-prebuilt": "^2.1.7",
|
||||||
"react-addons-test-utils": "^15.4.0",
|
"react-addons-test-utils": "^15.4.0",
|
||||||
"require-json": "0.0.1",
|
"require-json": "0.0.1",
|
||||||
|
|
|
@ -1,22 +0,0 @@
|
||||||
#!/usr/bin/env node
|
|
||||||
|
|
||||||
var exec = require('child_process').exec;
|
|
||||||
|
|
||||||
// Makes sure the babel executable in the path is babel 6 (or greater), not
|
|
||||||
// babel 5, which it is if you upgrade from an older version of react-sdk and
|
|
||||||
// run 'npm install' since the package has changed to babel-cli, so 'babel'
|
|
||||||
// remains installed and the executable in node_modules/.bin remains as babel
|
|
||||||
// 5.
|
|
||||||
|
|
||||||
exec("babel -V", function (error, stdout, stderr) {
|
|
||||||
if ((error && error.code) || parseInt(stdout.substr(0,1), 10) < 6) {
|
|
||||||
console.log("\033[31m\033[1m"+
|
|
||||||
'*****************************************\n'+
|
|
||||||
'* matrix-react-sdk has moved to babel 6 *\n'+
|
|
||||||
'* Please "rm -rf node_modules && npm i" *\n'+
|
|
||||||
'* then restore links as appropriate *\n'+
|
|
||||||
'*****************************************\n'+
|
|
||||||
"\033[91m");
|
|
||||||
process.exit(1);
|
|
||||||
}
|
|
||||||
});
|
|
192
scripts/check-i18n.pl
Executable file
192
scripts/check-i18n.pl
Executable file
|
@ -0,0 +1,192 @@
|
||||||
|
#!/usr/bin/perl
|
||||||
|
|
||||||
|
use strict;
|
||||||
|
use warnings;
|
||||||
|
use Cwd 'abs_path';
|
||||||
|
|
||||||
|
# script which checks how out of sync the i18ns are drifting
|
||||||
|
|
||||||
|
# example i18n format:
|
||||||
|
# "%(oneUser)sleft": "%(oneUser)sleft",
|
||||||
|
|
||||||
|
$|=1;
|
||||||
|
|
||||||
|
$0 =~ /^(.*\/)/;
|
||||||
|
my $i18ndir = abs_path($1."/../src/i18n/strings");
|
||||||
|
my $srcdir = abs_path($1."/../src");
|
||||||
|
|
||||||
|
my $en = read_i18n($i18ndir."/en_EN.json");
|
||||||
|
|
||||||
|
my $src_strings = read_src_strings($srcdir);
|
||||||
|
my $src = {};
|
||||||
|
|
||||||
|
print "Checking strings in src\n";
|
||||||
|
foreach my $tuple (@$src_strings) {
|
||||||
|
my ($s, $file) = (@$tuple);
|
||||||
|
$src->{$s} = $file;
|
||||||
|
if (!$en->{$s}) {
|
||||||
|
if ($en->{$s . '.'}) {
|
||||||
|
printf ("%50s %24s\t%s\n", $file, "en_EN has fullstop!", $s);
|
||||||
|
}
|
||||||
|
else {
|
||||||
|
$s =~ /^(.*)\.?$/;
|
||||||
|
if ($en->{$1}) {
|
||||||
|
printf ("%50s %24s\t%s\n", $file, "en_EN lacks fullstop!", $s);
|
||||||
|
}
|
||||||
|
else {
|
||||||
|
printf ("%50s %24s\t%s\n", $file, "Translation missing!", $s);
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
print "\nChecking en_EN\n";
|
||||||
|
my $count = 0;
|
||||||
|
my $remaining_src = {};
|
||||||
|
foreach (keys %$src) { $remaining_src->{$_}++ };
|
||||||
|
|
||||||
|
foreach my $k (sort keys %$en) {
|
||||||
|
# crappy heuristic to ignore country codes for now...
|
||||||
|
next if ($k =~ /^(..|..-..)$/);
|
||||||
|
|
||||||
|
if ($en->{$k} ne $k) {
|
||||||
|
printf ("%50s %24s\t%s\n", "en_EN", "en_EN is not symmetrical", $k);
|
||||||
|
}
|
||||||
|
|
||||||
|
if (!$src->{$k}) {
|
||||||
|
if ($src->{$k. '.'}) {
|
||||||
|
printf ("%50s %24s\t%s\n", $src->{$k. '.'}, "src has fullstop!", $k);
|
||||||
|
}
|
||||||
|
else {
|
||||||
|
$k =~ /^(.*)\.?$/;
|
||||||
|
if ($src->{$1}) {
|
||||||
|
printf ("%50s %24s\t%s\n", $src->{$1}, "src lacks fullstop!", $k);
|
||||||
|
}
|
||||||
|
else {
|
||||||
|
printf ("%50s %24s\t%s\n", '???', "Not present in src?", $k);
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
|
else {
|
||||||
|
$count++;
|
||||||
|
delete $remaining_src->{$k};
|
||||||
|
}
|
||||||
|
}
|
||||||
|
printf ("$count/" . (scalar keys %$src) . " strings found in src are present in en_EN\n");
|
||||||
|
foreach (keys %$remaining_src) {
|
||||||
|
print "missing: $_\n";
|
||||||
|
}
|
||||||
|
|
||||||
|
opendir(DIR, $i18ndir) || die $!;
|
||||||
|
my @files = readdir(DIR);
|
||||||
|
closedir(DIR);
|
||||||
|
foreach my $lang (grep { -f "$i18ndir/$_" && !/(basefile|en_EN)\.json/ } @files) {
|
||||||
|
print "\nChecking $lang\n";
|
||||||
|
|
||||||
|
my $map = read_i18n($i18ndir."/".$lang);
|
||||||
|
my $count = 0;
|
||||||
|
|
||||||
|
my $remaining_en = {};
|
||||||
|
foreach (keys %$en) { $remaining_en->{$_}++ };
|
||||||
|
|
||||||
|
foreach my $k (sort keys %$map) {
|
||||||
|
{
|
||||||
|
no warnings 'uninitialized';
|
||||||
|
my $vars = {};
|
||||||
|
while ($k =~ /%\((.*?)\)s/g) {
|
||||||
|
$vars->{$1}++;
|
||||||
|
}
|
||||||
|
while ($map->{$k} =~ /%\((.*?)\)s/g) {
|
||||||
|
$vars->{$1}--;
|
||||||
|
}
|
||||||
|
foreach my $var (keys %$vars) {
|
||||||
|
if ($vars->{$var} != 0) {
|
||||||
|
printf ("%10s %24s\t%s\n", $lang, "Broken var ($var)s", $k);
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
if ($en->{$k}) {
|
||||||
|
if ($map->{$k} eq $k) {
|
||||||
|
printf ("%10s %24s\t%s\n", $lang, "Untranslated string?", $k);
|
||||||
|
}
|
||||||
|
$count++;
|
||||||
|
delete $remaining_en->{$k};
|
||||||
|
}
|
||||||
|
else {
|
||||||
|
if ($en->{$k . "."}) {
|
||||||
|
printf ("%10s %24s\t%s\n", $lang, "en_EN has fullstop!", $k);
|
||||||
|
next;
|
||||||
|
}
|
||||||
|
|
||||||
|
$k =~ /^(.*)\.?$/;
|
||||||
|
if ($en->{$1}) {
|
||||||
|
printf ("%10s %24s\t%s\n", $lang, "en_EN lacks fullstop!", $k);
|
||||||
|
next;
|
||||||
|
}
|
||||||
|
|
||||||
|
printf ("%10s %24s\t%s\n", $lang, "Not present in en_EN", $k);
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
if (scalar keys %$remaining_en < 100) {
|
||||||
|
foreach (keys %$remaining_en) {
|
||||||
|
printf ("%10s %24s\t%s\n", $lang, "Not yet translated", $_);
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
printf ("$count/" . (scalar keys %$en) . " strings translated\n");
|
||||||
|
}
|
||||||
|
|
||||||
|
sub read_i18n {
|
||||||
|
my $path = shift;
|
||||||
|
my $map = {};
|
||||||
|
$path =~ /.*\/(.*)$/;
|
||||||
|
my $lang = $1;
|
||||||
|
|
||||||
|
open(FILE, "<", $path) || die $!;
|
||||||
|
while(<FILE>) {
|
||||||
|
if ($_ =~ m/^(\s+)"(.*?)"(: *)"(.*?)"(,?)$/) {
|
||||||
|
my ($indent, $src, $colon, $dst, $comma) = ($1, $2, $3, $4, $5);
|
||||||
|
$src =~ s/\\"/"/g;
|
||||||
|
$dst =~ s/\\"/"/g;
|
||||||
|
|
||||||
|
if ($map->{$src}) {
|
||||||
|
printf ("%10s %24s\t%s\n", $lang, "Duplicate translation!", $src);
|
||||||
|
}
|
||||||
|
$map->{$src} = $dst;
|
||||||
|
}
|
||||||
|
}
|
||||||
|
close(FILE);
|
||||||
|
|
||||||
|
return $map;
|
||||||
|
}
|
||||||
|
|
||||||
|
sub read_src_strings {
|
||||||
|
my $path = shift;
|
||||||
|
|
||||||
|
use File::Find;
|
||||||
|
use File::Slurp;
|
||||||
|
|
||||||
|
my $strings = [];
|
||||||
|
|
||||||
|
my @files;
|
||||||
|
find( sub { push @files, $File::Find::name if (-f $_ && /\.jsx?$/) }, $path );
|
||||||
|
foreach my $file (@files) {
|
||||||
|
my $src = read_file($file);
|
||||||
|
$src =~ s/'\s*\+\s*'//g;
|
||||||
|
$src =~ s/"\s*\+\s*"//g;
|
||||||
|
|
||||||
|
$file =~ s/^.*\/src/src/;
|
||||||
|
while ($src =~ /_t\(\s*'(.*?[^\\])'/sg) {
|
||||||
|
my $s = $1;
|
||||||
|
$s =~ s/\\'/'/g;
|
||||||
|
push @$strings, [$s, $file];
|
||||||
|
}
|
||||||
|
while ($src =~ /_t\(\s*"(.*?[^\\])"/sg) {
|
||||||
|
push @$strings, [$1, $file];
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
return $strings;
|
||||||
|
}
|
91
scripts/fix-i18n.pl
Executable file
91
scripts/fix-i18n.pl
Executable file
|
@ -0,0 +1,91 @@
|
||||||
|
#!/usr/bin/perl -ni
|
||||||
|
|
||||||
|
use strict;
|
||||||
|
use warnings;
|
||||||
|
|
||||||
|
# script which synchronises i18n strings to include punctuation.
|
||||||
|
# i've cherry-picked ones which seem to have diverged between the different translations
|
||||||
|
# from TextForEvent, causing missing events all over the place
|
||||||
|
|
||||||
|
BEGIN {
|
||||||
|
$::fixups = [split(/\n/, <<EOT
|
||||||
|
%(targetName)s accepted the invitation for %(displayName)s.
|
||||||
|
%(targetName)s accepted an invitation.
|
||||||
|
%(senderName)s requested a VoIP conference.
|
||||||
|
%(senderName)s invited %(targetName)s.
|
||||||
|
%(senderName)s banned %(targetName)s.
|
||||||
|
%(senderName)s changed their display name from %(oldDisplayName)s to %(displayName)s.
|
||||||
|
%(senderName)s set their display name to %(displayName)s.
|
||||||
|
%(senderName)s removed their display name (%(oldDisplayName)s).
|
||||||
|
%(senderName)s removed their profile picture.
|
||||||
|
%(senderName)s changed their profile picture.
|
||||||
|
%(senderName)s set a profile picture.
|
||||||
|
VoIP conference started.
|
||||||
|
%(targetName)s joined the room.
|
||||||
|
VoIP conference finished.
|
||||||
|
%(targetName)s rejected the invitation.
|
||||||
|
%(targetName)s left the room.
|
||||||
|
%(senderName)s unbanned %(targetName)s.
|
||||||
|
%(senderName)s kicked %(targetName)s.
|
||||||
|
%(senderName)s withdrew %(targetName)s's inivitation.
|
||||||
|
%(targetName)s left the room.
|
||||||
|
%(senderDisplayName)s changed the topic to "%(topic)s".
|
||||||
|
%(senderDisplayName)s changed the room name to %(roomName)s.
|
||||||
|
%(senderDisplayName)s sent an image.
|
||||||
|
%(senderName)s answered the call.
|
||||||
|
%(senderName)s ended the call.
|
||||||
|
%(senderName)s placed a %(callType)s call.
|
||||||
|
%(senderName)s sent an invitation to %(targetDisplayName)s to join the room.
|
||||||
|
%(senderName)s turned on end-to-end encryption (algorithm %(algorithm)s).
|
||||||
|
%(senderName)s changed the power level of %(powerLevelDiffText)s.
|
||||||
|
For security, this session has been signed out. Please sign in again.
|
||||||
|
You need to log back in to generate end-to-end encryption keys for this device and submit the public key to your homeserver. This is a once off; sorry for the inconvenience.
|
||||||
|
A new password must be entered.
|
||||||
|
Guests can't set avatars. Please register.
|
||||||
|
Failed to set avatar.
|
||||||
|
Unable to verify email address.
|
||||||
|
Guests can't use labs features. Please register.
|
||||||
|
A new password must be entered.
|
||||||
|
Resetting password will currently reset any end-to-end encryption keys on all devices, making encrypted chat history unreadable, unless you first export your room keys and re-import them afterwards. In future this will be improved.
|
||||||
|
Guests cannot join this room even if explicitly invited.
|
||||||
|
EOT
|
||||||
|
)];
|
||||||
|
}
|
||||||
|
|
||||||
|
# example i18n format:
|
||||||
|
# "%(oneUser)sleft": "%(oneUser)sleft",
|
||||||
|
|
||||||
|
# script called with the line of the file to be checked
|
||||||
|
my $sub = 0;
|
||||||
|
if ($_ =~ m/^(\s+)"(.*?)"(: *)"(.*?)"(,?)$/) {
|
||||||
|
my ($indent, $src, $colon, $dst, $comma) = ($1, $2, $3, $4, $5);
|
||||||
|
$src =~ s/\\"/"/g;
|
||||||
|
$dst =~ s/\\"/"/g;
|
||||||
|
|
||||||
|
foreach my $fixup (@{$::fixups}) {
|
||||||
|
my $dotless_fixup = substr($fixup, 0, -1);
|
||||||
|
|
||||||
|
if ($src eq $dotless_fixup) {
|
||||||
|
print STDERR "fixing up src: $src\n";
|
||||||
|
$src .= '.';
|
||||||
|
$sub = 1;
|
||||||
|
}
|
||||||
|
|
||||||
|
if ($src eq $fixup && $dst !~ /\.$/) {
|
||||||
|
print STDERR "fixing up dst: $dst\n";
|
||||||
|
$dst .= '.';
|
||||||
|
$sub = 1;
|
||||||
|
}
|
||||||
|
|
||||||
|
if ($sub) {
|
||||||
|
$src =~ s/"/\\"/g;
|
||||||
|
$dst =~ s/"/\\"/g;
|
||||||
|
print qq($indent"$src"$colon"$dst"$comma\n);
|
||||||
|
last;
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
if (!$sub) {
|
||||||
|
print $_;
|
||||||
|
}
|
|
@ -1,53 +1,99 @@
|
||||||
#!/usr/bin/env node
|
#!/usr/bin/env node
|
||||||
|
|
||||||
var fs = require('fs');
|
var fs = require('fs');
|
||||||
var path = require('path');
|
var path = require('path');
|
||||||
var glob = require('glob');
|
var glob = require('glob');
|
||||||
|
|
||||||
var args = require('optimist').argv;
|
var args = require('optimist').argv;
|
||||||
|
var chokidar = require('chokidar');
|
||||||
var header = args.h || args.header;
|
|
||||||
|
|
||||||
var componentsDir = path.join('src', 'components');
|
|
||||||
|
|
||||||
var componentIndex = path.join('src', 'component-index.js');
|
var componentIndex = path.join('src', 'component-index.js');
|
||||||
|
var componentIndexTmp = componentIndex+".tmp";
|
||||||
|
var componentsDir = path.join('src', 'components');
|
||||||
|
var componentGlob = '**/*.js';
|
||||||
|
var prevFiles = [];
|
||||||
|
|
||||||
var packageJson = JSON.parse(fs.readFileSync('./package.json'));
|
function reskindex() {
|
||||||
|
var files = glob.sync(componentGlob, {cwd: componentsDir}).sort();
|
||||||
|
if (!filesHaveChanged(files, prevFiles)) {
|
||||||
|
return;
|
||||||
|
}
|
||||||
|
prevFiles = files;
|
||||||
|
|
||||||
var strm = fs.createWriteStream(componentIndex);
|
var header = args.h || args.header;
|
||||||
|
var packageJson = JSON.parse(fs.readFileSync('./package.json'));
|
||||||
|
|
||||||
if (header) {
|
var strm = fs.createWriteStream(componentIndexTmp);
|
||||||
strm.write(fs.readFileSync(header));
|
|
||||||
strm.write('\n');
|
if (header) {
|
||||||
|
strm.write(fs.readFileSync(header));
|
||||||
|
strm.write('\n');
|
||||||
|
}
|
||||||
|
|
||||||
|
strm.write("/*\n");
|
||||||
|
strm.write(" * THIS FILE IS AUTO-GENERATED\n");
|
||||||
|
strm.write(" * You can edit it you like, but your changes will be overwritten,\n");
|
||||||
|
strm.write(" * so you'd just be trying to swim upstream like a salmon.\n");
|
||||||
|
strm.write(" * You are not a salmon.\n");
|
||||||
|
strm.write(" */\n\n");
|
||||||
|
|
||||||
|
if (packageJson['matrix-react-parent']) {
|
||||||
|
const parentIndex = packageJson['matrix-react-parent'] +
|
||||||
|
'/lib/component-index';
|
||||||
|
strm.write(
|
||||||
|
`let components = require('${parentIndex}').components;
|
||||||
|
if (!components) {
|
||||||
|
throw new Error("'${parentIndex}' didn't export components");
|
||||||
|
}
|
||||||
|
`);
|
||||||
|
} else {
|
||||||
|
strm.write("let components = {};\n");
|
||||||
|
}
|
||||||
|
|
||||||
|
for (var i = 0; i < files.length; ++i) {
|
||||||
|
var file = files[i].replace('.js', '');
|
||||||
|
|
||||||
|
var moduleName = (file.replace(/\//g, '.'));
|
||||||
|
var importName = moduleName.replace(/\./g, "$");
|
||||||
|
|
||||||
|
strm.write("import " + importName + " from './components/" + file + "';\n");
|
||||||
|
strm.write(importName + " && (components['"+moduleName+"'] = " + importName + ");");
|
||||||
|
strm.write('\n');
|
||||||
|
strm.uncork();
|
||||||
|
}
|
||||||
|
|
||||||
|
strm.write("export {components};\n");
|
||||||
|
strm.end();
|
||||||
|
fs.rename(componentIndexTmp, componentIndex, function(err) {
|
||||||
|
if(err) {
|
||||||
|
console.error("Error moving new index into place: " + err);
|
||||||
|
} else {
|
||||||
|
console.log('Reskindex: completed');
|
||||||
|
}
|
||||||
|
});
|
||||||
}
|
}
|
||||||
|
|
||||||
strm.write("/*\n");
|
// Expects both arrays of file names to be sorted
|
||||||
strm.write(" * THIS FILE IS AUTO-GENERATED\n");
|
function filesHaveChanged(files, prevFiles) {
|
||||||
strm.write(" * You can edit it you like, but your changes will be overwritten,\n");
|
if (files.length !== prevFiles.length) {
|
||||||
strm.write(" * so you'd just be trying to swim upstream like a salmon.\n");
|
return true;
|
||||||
strm.write(" * You are not a salmon.\n");
|
}
|
||||||
strm.write(" *\n");
|
// Check for name changes
|
||||||
strm.write(" * To update it, run:\n");
|
for (var i = 0; i < files.length; i++) {
|
||||||
strm.write(" * ./reskindex.js -h header\n");
|
if (prevFiles[i] !== files[i]) {
|
||||||
strm.write(" */\n\n");
|
return true;
|
||||||
|
}
|
||||||
if (packageJson['matrix-react-parent']) {
|
}
|
||||||
strm.write("module.exports.components = require('"+packageJson['matrix-react-parent']+"/lib/component-index').components;\n\n");
|
return false;
|
||||||
} else {
|
|
||||||
strm.write("module.exports.components = {};\n");
|
|
||||||
}
|
}
|
||||||
|
|
||||||
var files = glob.sync('**/*.js', {cwd: componentsDir}).sort();
|
// -w indicates watch mode where any FS events will trigger reskindex
|
||||||
for (var i = 0; i < files.length; ++i) {
|
if (!args.w) {
|
||||||
var file = files[i].replace('.js', '');
|
reskindex();
|
||||||
|
return;
|
||||||
var moduleName = (file.replace(/\//g, '.'));
|
|
||||||
var importName = moduleName.replace(/\./g, "$");
|
|
||||||
|
|
||||||
strm.write("import " + importName + " from './components/" + file + "';\n");
|
|
||||||
strm.write(importName + " && (module.exports.components['"+moduleName+"'] = " + importName + ");");
|
|
||||||
strm.write('\n');
|
|
||||||
strm.uncork();
|
|
||||||
}
|
}
|
||||||
|
|
||||||
strm.end();
|
var watchDebouncer = null;
|
||||||
|
chokidar.watch(path.join(componentsDir, componentGlob)).on('all', (event, path) => {
|
||||||
|
if (path === componentIndex) return;
|
||||||
|
if (watchDebouncer) clearTimeout(watchDebouncer);
|
||||||
|
watchDebouncer = setTimeout(reskindex, 1000);
|
||||||
|
});
|
||||||
|
|
|
@ -16,6 +16,7 @@ limitations under the License.
|
||||||
*/
|
*/
|
||||||
|
|
||||||
var MatrixClientPeg = require("./MatrixClientPeg");
|
var MatrixClientPeg = require("./MatrixClientPeg");
|
||||||
|
import { _t } from './languageHandler';
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Allows a user to add a third party identifier to their Home Server and,
|
* Allows a user to add a third party identifier to their Home Server and,
|
||||||
|
@ -44,7 +45,7 @@ class AddThreepid {
|
||||||
return res;
|
return res;
|
||||||
}, function(err) {
|
}, function(err) {
|
||||||
if (err.errcode == 'M_THREEPID_IN_USE') {
|
if (err.errcode == 'M_THREEPID_IN_USE') {
|
||||||
err.message = "This email address is already in use";
|
err.message = _t('This email address is already in use');
|
||||||
} else if (err.httpStatus) {
|
} else if (err.httpStatus) {
|
||||||
err.message = err.message + ` (Status ${err.httpStatus})`;
|
err.message = err.message + ` (Status ${err.httpStatus})`;
|
||||||
}
|
}
|
||||||
|
@ -69,7 +70,7 @@ class AddThreepid {
|
||||||
return res;
|
return res;
|
||||||
}, function(err) {
|
}, function(err) {
|
||||||
if (err.errcode == 'M_THREEPID_IN_USE') {
|
if (err.errcode == 'M_THREEPID_IN_USE') {
|
||||||
err.message = "This phone number is already in use";
|
err.message = _t('This phone number is already in use');
|
||||||
} else if (err.httpStatus) {
|
} else if (err.httpStatus) {
|
||||||
err.message = err.message + ` (Status ${err.httpStatus})`;
|
err.message = err.message + ` (Status ${err.httpStatus})`;
|
||||||
}
|
}
|
||||||
|
@ -91,7 +92,7 @@ class AddThreepid {
|
||||||
id_server: identityServerDomain
|
id_server: identityServerDomain
|
||||||
}, this.bind).catch(function(err) {
|
}, this.bind).catch(function(err) {
|
||||||
if (err.httpStatus === 401) {
|
if (err.httpStatus === 401) {
|
||||||
err.message = "Failed to verify email address: make sure you clicked the link in the email";
|
err.message = _t('Failed to verify email address: make sure you clicked the link in the email');
|
||||||
}
|
}
|
||||||
else if (err.httpStatus) {
|
else if (err.httpStatus) {
|
||||||
err.message += ` (Status ${err.httpStatus})`;
|
err.message += ` (Status ${err.httpStatus})`;
|
||||||
|
|
|
@ -22,8 +22,8 @@ module.exports = {
|
||||||
avatarUrlForMember: function(member, width, height, resizeMethod) {
|
avatarUrlForMember: function(member, width, height, resizeMethod) {
|
||||||
var url = member.getAvatarUrl(
|
var url = member.getAvatarUrl(
|
||||||
MatrixClientPeg.get().getHomeserverUrl(),
|
MatrixClientPeg.get().getHomeserverUrl(),
|
||||||
width,
|
Math.floor(width * window.devicePixelRatio),
|
||||||
height,
|
Math.floor(height * window.devicePixelRatio),
|
||||||
resizeMethod,
|
resizeMethod,
|
||||||
false,
|
false,
|
||||||
false
|
false
|
||||||
|
@ -40,7 +40,9 @@ module.exports = {
|
||||||
avatarUrlForUser: function(user, width, height, resizeMethod) {
|
avatarUrlForUser: function(user, width, height, resizeMethod) {
|
||||||
var url = ContentRepo.getHttpUriForMxc(
|
var url = ContentRepo.getHttpUriForMxc(
|
||||||
MatrixClientPeg.get().getHomeserverUrl(), user.avatarUrl,
|
MatrixClientPeg.get().getHomeserverUrl(), user.avatarUrl,
|
||||||
width, height, resizeMethod
|
Math.floor(width * window.devicePixelRatio),
|
||||||
|
Math.floor(height * window.devicePixelRatio),
|
||||||
|
resizeMethod
|
||||||
);
|
);
|
||||||
if (!url || url.length === 0) {
|
if (!url || url.length === 0) {
|
||||||
return null;
|
return null;
|
||||||
|
@ -57,4 +59,3 @@ module.exports = {
|
||||||
return 'img/' + images[total % images.length] + '.png';
|
return 'img/' + images[total % images.length] + '.png';
|
||||||
}
|
}
|
||||||
};
|
};
|
||||||
|
|
||||||
|
|
|
@ -55,6 +55,7 @@ var MatrixClientPeg = require('./MatrixClientPeg');
|
||||||
var PlatformPeg = require("./PlatformPeg");
|
var PlatformPeg = require("./PlatformPeg");
|
||||||
var Modal = require('./Modal');
|
var Modal = require('./Modal');
|
||||||
var sdk = require('./index');
|
var sdk = require('./index');
|
||||||
|
import { _t } from './languageHandler';
|
||||||
var Matrix = require("matrix-js-sdk");
|
var Matrix = require("matrix-js-sdk");
|
||||||
var dis = require("./dispatcher");
|
var dis = require("./dispatcher");
|
||||||
|
|
||||||
|
@ -142,8 +143,8 @@ function _setCallListeners(call) {
|
||||||
play("busyAudio");
|
play("busyAudio");
|
||||||
var ErrorDialog = sdk.getComponent("dialogs.ErrorDialog");
|
var ErrorDialog = sdk.getComponent("dialogs.ErrorDialog");
|
||||||
Modal.createDialog(ErrorDialog, {
|
Modal.createDialog(ErrorDialog, {
|
||||||
title: "Call Timeout",
|
title: _t('Call Timeout'),
|
||||||
description: "The remote side failed to pick up."
|
description: _t('The remote side failed to pick up') + '.',
|
||||||
});
|
});
|
||||||
}
|
}
|
||||||
else if (oldState === "invite_sent") {
|
else if (oldState === "invite_sent") {
|
||||||
|
@ -179,7 +180,8 @@ function _setCallState(call, roomId, status) {
|
||||||
}
|
}
|
||||||
dis.dispatch({
|
dis.dispatch({
|
||||||
action: 'call_state',
|
action: 'call_state',
|
||||||
room_id: roomId
|
room_id: roomId,
|
||||||
|
state: status,
|
||||||
});
|
});
|
||||||
}
|
}
|
||||||
|
|
||||||
|
@ -203,8 +205,8 @@ function _onAction(payload) {
|
||||||
console.log("Can't capture screen: " + screenCapErrorString);
|
console.log("Can't capture screen: " + screenCapErrorString);
|
||||||
const ErrorDialog = sdk.getComponent("dialogs.ErrorDialog");
|
const ErrorDialog = sdk.getComponent("dialogs.ErrorDialog");
|
||||||
Modal.createDialog(ErrorDialog, {
|
Modal.createDialog(ErrorDialog, {
|
||||||
title: "Unable to capture screen",
|
title: _t('Unable to capture screen'),
|
||||||
description: screenCapErrorString
|
description: screenCapErrorString,
|
||||||
});
|
});
|
||||||
return;
|
return;
|
||||||
}
|
}
|
||||||
|
@ -223,8 +225,8 @@ function _onAction(payload) {
|
||||||
if (module.exports.getAnyActiveCall()) {
|
if (module.exports.getAnyActiveCall()) {
|
||||||
const ErrorDialog = sdk.getComponent("dialogs.ErrorDialog");
|
const ErrorDialog = sdk.getComponent("dialogs.ErrorDialog");
|
||||||
Modal.createDialog(ErrorDialog, {
|
Modal.createDialog(ErrorDialog, {
|
||||||
title: "Existing Call",
|
title: _t('Existing Call'),
|
||||||
description: "You are already in a call."
|
description: _t('You are already in a call') + '.',
|
||||||
});
|
});
|
||||||
return; // don't allow >1 call to be placed.
|
return; // don't allow >1 call to be placed.
|
||||||
}
|
}
|
||||||
|
@ -233,8 +235,8 @@ function _onAction(payload) {
|
||||||
if (!MatrixClientPeg.get().supportsVoip()) {
|
if (!MatrixClientPeg.get().supportsVoip()) {
|
||||||
const ErrorDialog = sdk.getComponent("dialogs.ErrorDialog");
|
const ErrorDialog = sdk.getComponent("dialogs.ErrorDialog");
|
||||||
Modal.createDialog(ErrorDialog, {
|
Modal.createDialog(ErrorDialog, {
|
||||||
title: "VoIP is unsupported",
|
title: _t('VoIP is unsupported'),
|
||||||
description: "You cannot place VoIP calls in this browser."
|
description: _t('You cannot place VoIP calls in this browser') + '.',
|
||||||
});
|
});
|
||||||
return;
|
return;
|
||||||
}
|
}
|
||||||
|
@ -249,7 +251,7 @@ function _onAction(payload) {
|
||||||
if (members.length <= 1) {
|
if (members.length <= 1) {
|
||||||
const ErrorDialog = sdk.getComponent("dialogs.ErrorDialog");
|
const ErrorDialog = sdk.getComponent("dialogs.ErrorDialog");
|
||||||
Modal.createDialog(ErrorDialog, {
|
Modal.createDialog(ErrorDialog, {
|
||||||
description: "You cannot place a call with yourself."
|
description: _t('You cannot place a call with yourself') + '.',
|
||||||
});
|
});
|
||||||
return;
|
return;
|
||||||
}
|
}
|
||||||
|
@ -275,14 +277,14 @@ function _onAction(payload) {
|
||||||
if (!ConferenceHandler) {
|
if (!ConferenceHandler) {
|
||||||
const ErrorDialog = sdk.getComponent("dialogs.ErrorDialog");
|
const ErrorDialog = sdk.getComponent("dialogs.ErrorDialog");
|
||||||
Modal.createDialog(ErrorDialog, {
|
Modal.createDialog(ErrorDialog, {
|
||||||
description: "Conference calls are not supported in this client"
|
description: _t('Conference calls are not supported in this client'),
|
||||||
});
|
});
|
||||||
}
|
}
|
||||||
else if (!MatrixClientPeg.get().supportsVoip()) {
|
else if (!MatrixClientPeg.get().supportsVoip()) {
|
||||||
const ErrorDialog = sdk.getComponent("dialogs.ErrorDialog");
|
const ErrorDialog = sdk.getComponent("dialogs.ErrorDialog");
|
||||||
Modal.createDialog(ErrorDialog, {
|
Modal.createDialog(ErrorDialog, {
|
||||||
title: "VoIP is unsupported",
|
title: _t('VoIP is unsupported'),
|
||||||
description: "You cannot place VoIP calls in this browser."
|
description: _t('You cannot place VoIP calls in this browser') + '.',
|
||||||
});
|
});
|
||||||
}
|
}
|
||||||
else if (MatrixClientPeg.get().isRoomEncrypted(payload.room_id)) {
|
else if (MatrixClientPeg.get().isRoomEncrypted(payload.room_id)) {
|
||||||
|
@ -294,14 +296,14 @@ function _onAction(payload) {
|
||||||
// Therefore we disable conference calling in E2E rooms.
|
// Therefore we disable conference calling in E2E rooms.
|
||||||
const ErrorDialog = sdk.getComponent("dialogs.ErrorDialog");
|
const ErrorDialog = sdk.getComponent("dialogs.ErrorDialog");
|
||||||
Modal.createDialog(ErrorDialog, {
|
Modal.createDialog(ErrorDialog, {
|
||||||
description: "Conference calls are not supported in encrypted rooms",
|
description: _t('Conference calls are not supported in encrypted rooms'),
|
||||||
});
|
});
|
||||||
}
|
}
|
||||||
else {
|
else {
|
||||||
var QuestionDialog = sdk.getComponent("dialogs.QuestionDialog");
|
var QuestionDialog = sdk.getComponent("dialogs.QuestionDialog");
|
||||||
Modal.createDialog(QuestionDialog, {
|
Modal.createDialog(QuestionDialog, {
|
||||||
title: "Warning!",
|
title: _t('Warning!'),
|
||||||
description: "Conference calling is in development and may not be reliable.",
|
description: _t('Conference calling is in development and may not be reliable') + '.',
|
||||||
onFinished: confirm=>{
|
onFinished: confirm=>{
|
||||||
if (confirm) {
|
if (confirm) {
|
||||||
ConferenceHandler.createNewMatrixCall(
|
ConferenceHandler.createNewMatrixCall(
|
||||||
|
@ -312,8 +314,8 @@ function _onAction(payload) {
|
||||||
const ErrorDialog = sdk.getComponent("dialogs.ErrorDialog");
|
const ErrorDialog = sdk.getComponent("dialogs.ErrorDialog");
|
||||||
console.error("Conference call failed: " + err);
|
console.error("Conference call failed: " + err);
|
||||||
Modal.createDialog(ErrorDialog, {
|
Modal.createDialog(ErrorDialog, {
|
||||||
title: "Failed to set up conference call",
|
title: _t('Failed to set up conference call'),
|
||||||
description: "Conference call failed. " + ((err && err.message) ? err.message : ""),
|
description: _t('Conference call failed') + '. ' + ((err && err.message) ? err.message : ''),
|
||||||
});
|
});
|
||||||
});
|
});
|
||||||
}
|
}
|
||||||
|
|
|
@ -1,62 +0,0 @@
|
||||||
/*
|
|
||||||
Copyright 2017 Vector Creations Ltd
|
|
||||||
|
|
||||||
Licensed under the Apache License, Version 2.0 (the "License");
|
|
||||||
you may not use this file except in compliance with the License.
|
|
||||||
You may obtain a copy of the License at
|
|
||||||
|
|
||||||
http://www.apache.org/licenses/LICENSE-2.0
|
|
||||||
|
|
||||||
Unless required by applicable law or agreed to in writing, software
|
|
||||||
distributed under the License is distributed on an "AS IS" BASIS,
|
|
||||||
WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
|
||||||
See the License for the specific language governing permissions and
|
|
||||||
limitations under the License.
|
|
||||||
*/
|
|
||||||
|
|
||||||
// singleton which dispatches invocations of a given type & argument
|
|
||||||
// rather than just a type (as per EventEmitter and Flux's dispatcher etc)
|
|
||||||
//
|
|
||||||
// This means you can have a single point which listens for an EventEmitter event
|
|
||||||
// and then dispatches out to one of thousands of RoomTiles (for instance) rather than
|
|
||||||
// having each RoomTile register for the EventEmitter event and having to
|
|
||||||
// iterate over all of them.
|
|
||||||
class ConstantTimeDispatcher {
|
|
||||||
constructor() {
|
|
||||||
// type -> arg -> [ listener(arg, params) ]
|
|
||||||
this.listeners = {};
|
|
||||||
}
|
|
||||||
|
|
||||||
register(type, arg, listener) {
|
|
||||||
if (!this.listeners[type]) this.listeners[type] = {};
|
|
||||||
if (!this.listeners[type][arg]) this.listeners[type][arg] = [];
|
|
||||||
this.listeners[type][arg].push(listener);
|
|
||||||
}
|
|
||||||
|
|
||||||
unregister(type, arg, listener) {
|
|
||||||
if (this.listeners[type] && this.listeners[type][arg]) {
|
|
||||||
var i = this.listeners[type][arg].indexOf(listener);
|
|
||||||
if (i > -1) {
|
|
||||||
this.listeners[type][arg].splice(i, 1);
|
|
||||||
}
|
|
||||||
}
|
|
||||||
else {
|
|
||||||
console.warn("Unregistering unrecognised listener (type=" + type + ", arg=" + arg + ")");
|
|
||||||
}
|
|
||||||
}
|
|
||||||
|
|
||||||
dispatch(type, arg, params) {
|
|
||||||
if (!this.listeners[type] || !this.listeners[type][arg]) {
|
|
||||||
console.warn("No registered listeners for dispatch (type=" + type + ", arg=" + arg + ")");
|
|
||||||
return;
|
|
||||||
}
|
|
||||||
this.listeners[type][arg].forEach(listener=>{
|
|
||||||
listener.call(arg, params);
|
|
||||||
});
|
|
||||||
}
|
|
||||||
}
|
|
||||||
|
|
||||||
if (!global.constantTimeDispatcher) {
|
|
||||||
global.constantTimeDispatcher = new ConstantTimeDispatcher();
|
|
||||||
}
|
|
||||||
module.exports = global.constantTimeDispatcher;
|
|
|
@ -21,6 +21,7 @@ var extend = require('./extend');
|
||||||
var dis = require('./dispatcher');
|
var dis = require('./dispatcher');
|
||||||
var MatrixClientPeg = require('./MatrixClientPeg');
|
var MatrixClientPeg = require('./MatrixClientPeg');
|
||||||
var sdk = require('./index');
|
var sdk = require('./index');
|
||||||
|
import { _t } from './languageHandler';
|
||||||
var Modal = require('./Modal');
|
var Modal = require('./Modal');
|
||||||
|
|
||||||
var encrypt = require("browser-encrypt-attachment");
|
var encrypt = require("browser-encrypt-attachment");
|
||||||
|
@ -347,14 +348,14 @@ class ContentMessages {
|
||||||
}, function(err) {
|
}, function(err) {
|
||||||
error = err;
|
error = err;
|
||||||
if (!upload.canceled) {
|
if (!upload.canceled) {
|
||||||
var desc = "The file '"+upload.fileName+"' failed to upload.";
|
var desc = _t('The file \'%(fileName)s\' failed to upload', {fileName: upload.fileName}) + '.';
|
||||||
if (err.http_status == 413) {
|
if (err.http_status == 413) {
|
||||||
desc = "The file '"+upload.fileName+"' exceeds this home server's size limit for uploads";
|
desc = _t('The file \'%(fileName)s\' exceeds this home server\'s size limit for uploads', {fileName: upload.fileName});
|
||||||
}
|
}
|
||||||
var ErrorDialog = sdk.getComponent("dialogs.ErrorDialog");
|
var ErrorDialog = sdk.getComponent("dialogs.ErrorDialog");
|
||||||
Modal.createDialog(ErrorDialog, {
|
Modal.createDialog(ErrorDialog, {
|
||||||
title: "Upload Failed",
|
title: _t('Upload Failed'),
|
||||||
description: desc
|
description: desc,
|
||||||
});
|
});
|
||||||
}
|
}
|
||||||
}).finally(() => {
|
}).finally(() => {
|
||||||
|
|
|
@ -1,5 +1,6 @@
|
||||||
/*
|
/*
|
||||||
Copyright 2015, 2016 OpenMarket Ltd
|
Copyright 2015, 2016 OpenMarket Ltd
|
||||||
|
Copyright 2017 Vector Creations Ltd
|
||||||
|
|
||||||
Licensed under the Apache License, Version 2.0 (the "License");
|
Licensed under the Apache License, Version 2.0 (the "License");
|
||||||
you may not use this file except in compliance with the License.
|
you may not use this file except in compliance with the License.
|
||||||
|
@ -15,38 +16,89 @@ limitations under the License.
|
||||||
*/
|
*/
|
||||||
|
|
||||||
'use strict';
|
'use strict';
|
||||||
|
import { _t } from './languageHandler';
|
||||||
|
|
||||||
var days = ["Sun", "Mon", "Tue", "Wed", "Thu", "Fri", "Sat"];
|
function getDaysArray() {
|
||||||
var months = ["Jan", "Feb", "Mar", "Apr", "May", "Jun", "Jul", "Aug", "Sep", "Oct", "Nov", "Dec"];
|
return [
|
||||||
|
_t('Sun'),
|
||||||
|
_t('Mon'),
|
||||||
|
_t('Tue'),
|
||||||
|
_t('Wed'),
|
||||||
|
_t('Thu'),
|
||||||
|
_t('Fri'),
|
||||||
|
_t('Sat'),
|
||||||
|
];
|
||||||
|
}
|
||||||
|
|
||||||
|
function getMonthsArray() {
|
||||||
|
return [
|
||||||
|
_t('Jan'),
|
||||||
|
_t('Feb'),
|
||||||
|
_t('Mar'),
|
||||||
|
_t('Apr'),
|
||||||
|
_t('May'),
|
||||||
|
_t('Jun'),
|
||||||
|
_t('Jul'),
|
||||||
|
_t('Aug'),
|
||||||
|
_t('Sep'),
|
||||||
|
_t('Oct'),
|
||||||
|
_t('Nov'),
|
||||||
|
_t('Dec'),
|
||||||
|
];
|
||||||
|
}
|
||||||
|
|
||||||
|
function pad(n) {
|
||||||
|
return (n < 10 ? '0' : '') + n;
|
||||||
|
}
|
||||||
|
|
||||||
|
function twelveHourTime(date) {
|
||||||
|
let hours = date.getHours() % 12;
|
||||||
|
const minutes = pad(date.getMinutes());
|
||||||
|
const ampm = date.getHours() >= 12 ? 'PM' : 'AM';
|
||||||
|
hours = pad(hours ? hours : 12);
|
||||||
|
return `${hours}:${minutes} ${ampm}`;
|
||||||
|
}
|
||||||
|
|
||||||
module.exports = {
|
module.exports = {
|
||||||
formatDate: function(date) {
|
formatDate: function(date) {
|
||||||
// date.toLocaleTimeString is completely system dependent.
|
|
||||||
// just go 24h for now
|
|
||||||
function pad(n) {
|
|
||||||
return (n < 10 ? '0' : '') + n;
|
|
||||||
}
|
|
||||||
|
|
||||||
var now = new Date();
|
var now = new Date();
|
||||||
|
const days = getDaysArray();
|
||||||
|
const months = getMonthsArray();
|
||||||
if (date.toDateString() === now.toDateString()) {
|
if (date.toDateString() === now.toDateString()) {
|
||||||
return pad(date.getHours()) + ':' + pad(date.getMinutes());
|
return this.formatTime(date);
|
||||||
}
|
}
|
||||||
else if (now.getTime() - date.getTime() < 6 * 24 * 60 * 60 * 1000) {
|
else if (now.getTime() - date.getTime() < 6 * 24 * 60 * 60 * 1000) {
|
||||||
return days[date.getDay()] + " " + pad(date.getHours()) + ':' + pad(date.getMinutes());
|
// TODO: use standard date localize function provided in counterpart
|
||||||
|
return _t('%(weekDayName)s %(time)s', {weekDayName: days[date.getDay()], time: this.formatTime(date)});
|
||||||
}
|
}
|
||||||
else /* if (now.getFullYear() === date.getFullYear()) */ {
|
else if (now.getFullYear() === date.getFullYear()) {
|
||||||
return days[date.getDay()] + ", " + months[date.getMonth()] + " " + date.getDate() + " " + pad(date.getHours()) + ':' + pad(date.getMinutes());
|
// TODO: use standard date localize function provided in counterpart
|
||||||
|
return _t('%(weekDayName)s, %(monthName)s %(day)s %(time)s', {
|
||||||
|
weekDayName: days[date.getDay()],
|
||||||
|
monthName: months[date.getMonth()],
|
||||||
|
day: date.getDate(),
|
||||||
|
time: this.formatTime(date),
|
||||||
|
});
|
||||||
}
|
}
|
||||||
/*
|
return this.formatFullDate(date);
|
||||||
else {
|
|
||||||
return days[date.getDay()] + ", " + months[date.getMonth()] + " " + date.getDate() + " " + date.getFullYear() + " " + pad(date.getHours()) + ':' + pad(date.getMinutes());
|
|
||||||
}
|
|
||||||
*/
|
|
||||||
},
|
},
|
||||||
|
|
||||||
formatTime: function(date) {
|
formatFullDate: function(date) {
|
||||||
//return pad(date.getHours()) + ':' + pad(date.getMinutes());
|
const days = getDaysArray();
|
||||||
return ('00' + date.getHours()).slice(-2) + ':' + ('00' + date.getMinutes()).slice(-2);
|
const months = getMonthsArray();
|
||||||
}
|
return _t('%(weekDayName)s, %(monthName)s %(day)s %(fullYear)s %(time)s', {
|
||||||
};
|
weekDayName: days[date.getDay()],
|
||||||
|
monthName: months[date.getMonth()],
|
||||||
|
day: date.getDate(),
|
||||||
|
fullYear: date.getFullYear(),
|
||||||
|
time: this.formatTime(date),
|
||||||
|
});
|
||||||
|
},
|
||||||
|
|
||||||
|
formatTime: function(date, showTwelveHour=false) {
|
||||||
|
if (showTwelveHour) {
|
||||||
|
return twelveHourTime(date);
|
||||||
|
}
|
||||||
|
return pad(date.getHours()) + ':' + pad(date.getMinutes());
|
||||||
|
},
|
||||||
|
};
|
||||||
|
|
|
@ -111,8 +111,7 @@ var sanitizeHtmlParams = {
|
||||||
allowedTags: [
|
allowedTags: [
|
||||||
'font', // custom to matrix for IRC-style font coloring
|
'font', // custom to matrix for IRC-style font coloring
|
||||||
'del', // for markdown
|
'del', // for markdown
|
||||||
// deliberately no h1/h2 to stop people shouting.
|
'h1', 'h2', 'h3', 'h4', 'h5', 'h6', 'blockquote', 'p', 'a', 'ul', 'ol',
|
||||||
'h3', 'h4', 'h5', 'h6', 'blockquote', 'p', 'a', 'ul', 'ol',
|
|
||||||
'nl', 'li', 'b', 'i', 'u', 'strong', 'em', 'strike', 'code', 'hr', 'br', 'div',
|
'nl', 'li', 'b', 'i', 'u', 'strong', 'em', 'strike', 'code', 'hr', 'br', 'div',
|
||||||
'table', 'thead', 'caption', 'tbody', 'tr', 'th', 'td', 'pre', 'span',
|
'table', 'thead', 'caption', 'tbody', 'tr', 'th', 'td', 'pre', 'span',
|
||||||
],
|
],
|
||||||
|
@ -149,17 +148,18 @@ var sanitizeHtmlParams = {
|
||||||
attribs.href = m[1];
|
attribs.href = m[1];
|
||||||
delete attribs.target;
|
delete attribs.target;
|
||||||
}
|
}
|
||||||
|
else {
|
||||||
m = attribs.href.match(linkifyMatrix.MATRIXTO_URL_PATTERN);
|
m = attribs.href.match(linkifyMatrix.MATRIXTO_URL_PATTERN);
|
||||||
if (m) {
|
if (m) {
|
||||||
var entity = m[1];
|
var entity = m[1];
|
||||||
if (entity[0] === '@') {
|
if (entity[0] === '@') {
|
||||||
attribs.href = '#/user/' + entity;
|
attribs.href = '#/user/' + entity;
|
||||||
|
}
|
||||||
|
else if (entity[0] === '#' || entity[0] === '!') {
|
||||||
|
attribs.href = '#/room/' + entity;
|
||||||
|
}
|
||||||
|
delete attribs.target;
|
||||||
}
|
}
|
||||||
else if (entity[0] === '#' || entity[0] === '!') {
|
|
||||||
attribs.href = '#/room/' + entity;
|
|
||||||
}
|
|
||||||
delete attribs.target;
|
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
attribs.rel = 'noopener'; // https://mathiasbynens.github.io/rel-noopener/
|
attribs.rel = 'noopener'; // https://mathiasbynens.github.io/rel-noopener/
|
||||||
|
|
|
@ -32,5 +32,4 @@ module.exports = {
|
||||||
DELETE: 46,
|
DELETE: 46,
|
||||||
KEY_D: 68,
|
KEY_D: 68,
|
||||||
KEY_E: 69,
|
KEY_E: 69,
|
||||||
KEY_K: 75,
|
|
||||||
};
|
};
|
||||||
|
|
|
@ -27,6 +27,7 @@ import DMRoomMap from './utils/DMRoomMap';
|
||||||
import RtsClient from './RtsClient';
|
import RtsClient from './RtsClient';
|
||||||
import Modal from './Modal';
|
import Modal from './Modal';
|
||||||
import sdk from './index';
|
import sdk from './index';
|
||||||
|
import { _t } from './languageHandler';
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Called at startup, to attempt to build a logged-in Matrix session. It tries
|
* Called at startup, to attempt to build a logged-in Matrix session. It tries
|
||||||
|
@ -49,7 +50,7 @@ import sdk from './index';
|
||||||
* If any of steps 1-4 are successful, it will call {setLoggedIn}, which in
|
* If any of steps 1-4 are successful, it will call {setLoggedIn}, which in
|
||||||
* turn will raise on_logged_in and will_start_client events.
|
* turn will raise on_logged_in and will_start_client events.
|
||||||
*
|
*
|
||||||
* It returns a promise which resolves when the above process completes.
|
* @param {object} opts
|
||||||
*
|
*
|
||||||
* @param {object} opts.realQueryParams: string->string map of the
|
* @param {object} opts.realQueryParams: string->string map of the
|
||||||
* query-parameters extracted from the real query-string of the starting
|
* query-parameters extracted from the real query-string of the starting
|
||||||
|
@ -67,6 +68,7 @@ import sdk from './index';
|
||||||
* @params {string} opts.guestIsUrl: homeserver URL. Only used if enableGuest is
|
* @params {string} opts.guestIsUrl: homeserver URL. Only used if enableGuest is
|
||||||
* true; defines the IS to use.
|
* true; defines the IS to use.
|
||||||
*
|
*
|
||||||
|
* @returns {Promise} a promise which resolves when the above process completes.
|
||||||
*/
|
*/
|
||||||
export function loadSession(opts) {
|
export function loadSession(opts) {
|
||||||
const realQueryParams = opts.realQueryParams || {};
|
const realQueryParams = opts.realQueryParams || {};
|
||||||
|
@ -127,7 +129,7 @@ export function loadSession(opts) {
|
||||||
|
|
||||||
function _loginWithToken(queryParams, defaultDeviceDisplayName) {
|
function _loginWithToken(queryParams, defaultDeviceDisplayName) {
|
||||||
// create a temporary MatrixClient to do the login
|
// create a temporary MatrixClient to do the login
|
||||||
var client = Matrix.createClient({
|
const client = Matrix.createClient({
|
||||||
baseUrl: queryParams.homeserver,
|
baseUrl: queryParams.homeserver,
|
||||||
});
|
});
|
||||||
|
|
||||||
|
@ -159,7 +161,7 @@ function _registerAsGuest(hsUrl, isUrl, defaultDeviceDisplayName) {
|
||||||
// Not really sure where the right home for it is.
|
// Not really sure where the right home for it is.
|
||||||
|
|
||||||
// create a temporary MatrixClient to do the login
|
// create a temporary MatrixClient to do the login
|
||||||
var client = Matrix.createClient({
|
const client = Matrix.createClient({
|
||||||
baseUrl: hsUrl,
|
baseUrl: hsUrl,
|
||||||
});
|
});
|
||||||
|
|
||||||
|
@ -188,30 +190,30 @@ function _restoreFromLocalStorage() {
|
||||||
if (!localStorage) {
|
if (!localStorage) {
|
||||||
return q(false);
|
return q(false);
|
||||||
}
|
}
|
||||||
const hs_url = localStorage.getItem("mx_hs_url");
|
const hsUrl = localStorage.getItem("mx_hs_url");
|
||||||
const is_url = localStorage.getItem("mx_is_url") || 'https://matrix.org';
|
const isUrl = localStorage.getItem("mx_is_url") || 'https://matrix.org';
|
||||||
const access_token = localStorage.getItem("mx_access_token");
|
const accessToken = localStorage.getItem("mx_access_token");
|
||||||
const user_id = localStorage.getItem("mx_user_id");
|
const userId = localStorage.getItem("mx_user_id");
|
||||||
const device_id = localStorage.getItem("mx_device_id");
|
const deviceId = localStorage.getItem("mx_device_id");
|
||||||
|
|
||||||
let is_guest;
|
let isGuest;
|
||||||
if (localStorage.getItem("mx_is_guest") !== null) {
|
if (localStorage.getItem("mx_is_guest") !== null) {
|
||||||
is_guest = localStorage.getItem("mx_is_guest") === "true";
|
isGuest = localStorage.getItem("mx_is_guest") === "true";
|
||||||
} else {
|
} else {
|
||||||
// legacy key name
|
// legacy key name
|
||||||
is_guest = localStorage.getItem("matrix-is-guest") === "true";
|
isGuest = localStorage.getItem("matrix-is-guest") === "true";
|
||||||
}
|
}
|
||||||
|
|
||||||
if (access_token && user_id && hs_url) {
|
if (accessToken && userId && hsUrl) {
|
||||||
console.log("Restoring session for %s", user_id);
|
console.log("Restoring session for %s", userId);
|
||||||
try {
|
try {
|
||||||
setLoggedIn({
|
setLoggedIn({
|
||||||
userId: user_id,
|
userId: userId,
|
||||||
deviceId: device_id,
|
deviceId: deviceId,
|
||||||
accessToken: access_token,
|
accessToken: accessToken,
|
||||||
homeserverUrl: hs_url,
|
homeserverUrl: hsUrl,
|
||||||
identityServerUrl: is_url,
|
identityServerUrl: isUrl,
|
||||||
guest: is_guest,
|
guest: isGuest,
|
||||||
});
|
});
|
||||||
return q(true);
|
return q(true);
|
||||||
} catch (e) {
|
} catch (e) {
|
||||||
|
@ -228,14 +230,14 @@ function _handleRestoreFailure(e) {
|
||||||
|
|
||||||
let msg = e.message;
|
let msg = e.message;
|
||||||
if (msg == "OLM.BAD_LEGACY_ACCOUNT_PICKLE") {
|
if (msg == "OLM.BAD_LEGACY_ACCOUNT_PICKLE") {
|
||||||
msg = "You need to log back in to generate end-to-end encryption keys "
|
msg = _t(
|
||||||
+ "for this device and submit the public key to your homeserver. "
|
'You need to log back in to generate end-to-end encryption keys for this device and submit the public key to your homeserver. This is a once off; sorry for the inconvenience.'
|
||||||
+ "This is a once off; sorry for the inconvenience.";
|
);
|
||||||
|
|
||||||
_clearLocalStorage();
|
_clearLocalStorage();
|
||||||
|
|
||||||
return q.reject(new Error(
|
return q.reject(new Error(
|
||||||
"Unable to restore previous session: " + msg,
|
_t('Unable to restore previous session') + ': ' + msg,
|
||||||
));
|
));
|
||||||
}
|
}
|
||||||
|
|
||||||
|
@ -273,9 +275,13 @@ export function initRtsClient(url) {
|
||||||
*/
|
*/
|
||||||
export function setLoggedIn(credentials) {
|
export function setLoggedIn(credentials) {
|
||||||
credentials.guest = Boolean(credentials.guest);
|
credentials.guest = Boolean(credentials.guest);
|
||||||
console.log("setLoggedIn => %s (guest=%s) hs=%s",
|
|
||||||
credentials.userId, credentials.guest,
|
console.log(
|
||||||
credentials.homeserverUrl);
|
"setLoggedIn: mxid:", credentials.userId,
|
||||||
|
"deviceId:", credentials.deviceId,
|
||||||
|
"guest:", credentials.guest,
|
||||||
|
"hs:", credentials.homeserverUrl,
|
||||||
|
);
|
||||||
// This is dispatched to indicate that the user is still in the process of logging in
|
// This is dispatched to indicate that the user is still in the process of logging in
|
||||||
// because `teamPromise` may take some time to resolve, breaking the assumption that
|
// because `teamPromise` may take some time to resolve, breaking the assumption that
|
||||||
// `setLoggedIn` takes an "instant" to complete, and dispatch `on_logged_in` a few ms
|
// `setLoggedIn` takes an "instant" to complete, and dispatch `on_logged_in` a few ms
|
||||||
|
@ -352,7 +358,7 @@ export function logout() {
|
||||||
return;
|
return;
|
||||||
}
|
}
|
||||||
|
|
||||||
return MatrixClientPeg.get().logout().then(onLoggedOut,
|
MatrixClientPeg.get().logout().then(onLoggedOut,
|
||||||
(err) => {
|
(err) => {
|
||||||
// Just throwing an error here is going to be very unhelpful
|
// Just throwing an error here is going to be very unhelpful
|
||||||
// if you're trying to log out because your server's down and
|
// if you're trying to log out because your server's down and
|
||||||
|
@ -363,8 +369,8 @@ export function logout() {
|
||||||
// change your password).
|
// change your password).
|
||||||
console.log("Failed to call logout API: token will not be invalidated");
|
console.log("Failed to call logout API: token will not be invalidated");
|
||||||
onLoggedOut();
|
onLoggedOut();
|
||||||
}
|
},
|
||||||
);
|
).done();
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
|
@ -420,7 +426,7 @@ export function stopMatrixClient() {
|
||||||
UserActivity.stop();
|
UserActivity.stop();
|
||||||
Presence.stop();
|
Presence.stop();
|
||||||
if (DMRoomMap.shared()) DMRoomMap.shared().stop();
|
if (DMRoomMap.shared()) DMRoomMap.shared().stop();
|
||||||
var cli = MatrixClientPeg.get();
|
const cli = MatrixClientPeg.get();
|
||||||
if (cli) {
|
if (cli) {
|
||||||
cli.stopClient();
|
cli.stopClient();
|
||||||
cli.removeAllListeners();
|
cli.removeAllListeners();
|
||||||
|
|
|
@ -15,11 +15,14 @@ See the License for the specific language governing permissions and
|
||||||
limitations under the License.
|
limitations under the License.
|
||||||
*/
|
*/
|
||||||
|
|
||||||
var MatrixClientPeg = require("./MatrixClientPeg");
|
import MatrixClientPeg from './MatrixClientPeg';
|
||||||
var PlatformPeg = require("./PlatformPeg");
|
import PlatformPeg from './PlatformPeg';
|
||||||
var TextForEvent = require('./TextForEvent');
|
import TextForEvent from './TextForEvent';
|
||||||
var Avatar = require('./Avatar');
|
import Avatar from './Avatar';
|
||||||
var dis = require("./dispatcher");
|
import dis from './dispatcher';
|
||||||
|
import sdk from './index';
|
||||||
|
import { _t } from './languageHandler';
|
||||||
|
import Modal from './Modal';
|
||||||
|
|
||||||
/*
|
/*
|
||||||
* Dispatches:
|
* Dispatches:
|
||||||
|
@ -29,7 +32,7 @@ var dis = require("./dispatcher");
|
||||||
* }
|
* }
|
||||||
*/
|
*/
|
||||||
|
|
||||||
var Notifier = {
|
const Notifier = {
|
||||||
notifsByRoom: {},
|
notifsByRoom: {},
|
||||||
|
|
||||||
notificationMessageForEvent: function(ev) {
|
notificationMessageForEvent: function(ev) {
|
||||||
|
@ -48,16 +51,16 @@ var Notifier = {
|
||||||
return;
|
return;
|
||||||
}
|
}
|
||||||
|
|
||||||
var msg = this.notificationMessageForEvent(ev);
|
let msg = this.notificationMessageForEvent(ev);
|
||||||
if (!msg) return;
|
if (!msg) return;
|
||||||
|
|
||||||
var title;
|
let title;
|
||||||
if (!ev.sender || room.name == ev.sender.name) {
|
if (!ev.sender || room.name === ev.sender.name) {
|
||||||
title = room.name;
|
title = room.name;
|
||||||
// notificationMessageForEvent includes sender,
|
// notificationMessageForEvent includes sender,
|
||||||
// but we already have the sender here
|
// but we already have the sender here
|
||||||
if (ev.getContent().body) msg = ev.getContent().body;
|
if (ev.getContent().body) msg = ev.getContent().body;
|
||||||
} else if (ev.getType() == 'm.room.member') {
|
} else if (ev.getType() === 'm.room.member') {
|
||||||
// context is all in the message here, we don't need
|
// context is all in the message here, we don't need
|
||||||
// to display sender info
|
// to display sender info
|
||||||
title = room.name;
|
title = room.name;
|
||||||
|
@ -68,7 +71,7 @@ var Notifier = {
|
||||||
if (ev.getContent().body) msg = ev.getContent().body;
|
if (ev.getContent().body) msg = ev.getContent().body;
|
||||||
}
|
}
|
||||||
|
|
||||||
var avatarUrl = ev.sender ? Avatar.avatarUrlForMember(
|
const avatarUrl = ev.sender ? Avatar.avatarUrlForMember(
|
||||||
ev.sender, 40, 40, 'crop'
|
ev.sender, 40, 40, 'crop'
|
||||||
) : null;
|
) : null;
|
||||||
|
|
||||||
|
@ -83,7 +86,7 @@ var Notifier = {
|
||||||
},
|
},
|
||||||
|
|
||||||
_playAudioNotification: function(ev, room) {
|
_playAudioNotification: function(ev, room) {
|
||||||
var e = document.getElementById("messageAudio");
|
const e = document.getElementById("messageAudio");
|
||||||
if (e) {
|
if (e) {
|
||||||
e.load();
|
e.load();
|
||||||
e.play();
|
e.play();
|
||||||
|
@ -95,7 +98,7 @@ var Notifier = {
|
||||||
this.boundOnSyncStateChange = this.onSyncStateChange.bind(this);
|
this.boundOnSyncStateChange = this.onSyncStateChange.bind(this);
|
||||||
this.boundOnRoomReceipt = this.onRoomReceipt.bind(this);
|
this.boundOnRoomReceipt = this.onRoomReceipt.bind(this);
|
||||||
MatrixClientPeg.get().on('Room.timeline', this.boundOnRoomTimeline);
|
MatrixClientPeg.get().on('Room.timeline', this.boundOnRoomTimeline);
|
||||||
MatrixClientPeg.get().on("Room.receipt", this.boundOnRoomReceipt);
|
MatrixClientPeg.get().on('Room.receipt', this.boundOnRoomReceipt);
|
||||||
MatrixClientPeg.get().on("sync", this.boundOnSyncStateChange);
|
MatrixClientPeg.get().on("sync", this.boundOnSyncStateChange);
|
||||||
this.toolbarHidden = false;
|
this.toolbarHidden = false;
|
||||||
this.isSyncing = false;
|
this.isSyncing = false;
|
||||||
|
@ -104,7 +107,7 @@ var Notifier = {
|
||||||
stop: function() {
|
stop: function() {
|
||||||
if (MatrixClientPeg.get() && this.boundOnRoomTimeline) {
|
if (MatrixClientPeg.get() && this.boundOnRoomTimeline) {
|
||||||
MatrixClientPeg.get().removeListener('Room.timeline', this.boundOnRoomTimeline);
|
MatrixClientPeg.get().removeListener('Room.timeline', this.boundOnRoomTimeline);
|
||||||
MatrixClientPeg.get().removeListener("Room.receipt", this.boundOnRoomReceipt);
|
MatrixClientPeg.get().removeListener('Room.receipt', this.boundOnRoomReceipt);
|
||||||
MatrixClientPeg.get().removeListener('sync', this.boundOnSyncStateChange);
|
MatrixClientPeg.get().removeListener('sync', this.boundOnSyncStateChange);
|
||||||
}
|
}
|
||||||
this.isSyncing = false;
|
this.isSyncing = false;
|
||||||
|
@ -121,7 +124,7 @@ var Notifier = {
|
||||||
// make sure that we persist the current setting audio_enabled setting
|
// make sure that we persist the current setting audio_enabled setting
|
||||||
// before changing anything
|
// before changing anything
|
||||||
if (global.localStorage) {
|
if (global.localStorage) {
|
||||||
if(global.localStorage.getItem('audio_notifications_enabled') == null) {
|
if (global.localStorage.getItem('audio_notifications_enabled') === null) {
|
||||||
this.setAudioEnabled(this.isEnabled());
|
this.setAudioEnabled(this.isEnabled());
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
@ -131,6 +134,14 @@ var Notifier = {
|
||||||
plaf.requestNotificationPermission().done((result) => {
|
plaf.requestNotificationPermission().done((result) => {
|
||||||
if (result !== 'granted') {
|
if (result !== 'granted') {
|
||||||
// The permission request was dismissed or denied
|
// The permission request was dismissed or denied
|
||||||
|
const description = result === 'denied'
|
||||||
|
? _t('Riot does not have permission to send you notifications - please check your browser settings')
|
||||||
|
: _t('Riot was not given permission to send notifications - please try again');
|
||||||
|
const ErrorDialog = sdk.getComponent('dialogs.ErrorDialog');
|
||||||
|
Modal.createDialog(ErrorDialog, {
|
||||||
|
title: _t('Unable to enable Notifications'),
|
||||||
|
description,
|
||||||
|
});
|
||||||
return;
|
return;
|
||||||
}
|
}
|
||||||
|
|
||||||
|
@ -141,7 +152,7 @@ var Notifier = {
|
||||||
if (callback) callback();
|
if (callback) callback();
|
||||||
dis.dispatch({
|
dis.dispatch({
|
||||||
action: "notifier_enabled",
|
action: "notifier_enabled",
|
||||||
value: true
|
value: true,
|
||||||
});
|
});
|
||||||
});
|
});
|
||||||
// clear the notifications_hidden flag, so that if notifications are
|
// clear the notifications_hidden flag, so that if notifications are
|
||||||
|
@ -152,7 +163,7 @@ var Notifier = {
|
||||||
global.localStorage.setItem('notifications_enabled', 'false');
|
global.localStorage.setItem('notifications_enabled', 'false');
|
||||||
dis.dispatch({
|
dis.dispatch({
|
||||||
action: "notifier_enabled",
|
action: "notifier_enabled",
|
||||||
value: false
|
value: false,
|
||||||
});
|
});
|
||||||
}
|
}
|
||||||
},
|
},
|
||||||
|
@ -165,7 +176,7 @@ var Notifier = {
|
||||||
|
|
||||||
if (!global.localStorage) return true;
|
if (!global.localStorage) return true;
|
||||||
|
|
||||||
var enabled = global.localStorage.getItem('notifications_enabled');
|
const enabled = global.localStorage.getItem('notifications_enabled');
|
||||||
if (enabled === null) return true;
|
if (enabled === null) return true;
|
||||||
return enabled === 'true';
|
return enabled === 'true';
|
||||||
},
|
},
|
||||||
|
@ -173,12 +184,12 @@ var Notifier = {
|
||||||
setAudioEnabled: function(enable) {
|
setAudioEnabled: function(enable) {
|
||||||
if (!global.localStorage) return;
|
if (!global.localStorage) return;
|
||||||
global.localStorage.setItem('audio_notifications_enabled',
|
global.localStorage.setItem('audio_notifications_enabled',
|
||||||
enable ? 'true' : 'false');
|
enable ? 'true' : 'false');
|
||||||
},
|
},
|
||||||
|
|
||||||
isAudioEnabled: function(enable) {
|
isAudioEnabled: function(enable) {
|
||||||
if (!global.localStorage) return true;
|
if (!global.localStorage) return true;
|
||||||
var enabled = global.localStorage.getItem(
|
const enabled = global.localStorage.getItem(
|
||||||
'audio_notifications_enabled');
|
'audio_notifications_enabled');
|
||||||
// default to true if the popups are enabled
|
// default to true if the popups are enabled
|
||||||
if (enabled === null) return this.isEnabled();
|
if (enabled === null) return this.isEnabled();
|
||||||
|
@ -192,7 +203,7 @@ var Notifier = {
|
||||||
// this is nothing to do with notifier_enabled
|
// this is nothing to do with notifier_enabled
|
||||||
dis.dispatch({
|
dis.dispatch({
|
||||||
action: "notifier_enabled",
|
action: "notifier_enabled",
|
||||||
value: this.isEnabled()
|
value: this.isEnabled(),
|
||||||
});
|
});
|
||||||
|
|
||||||
// update the info to localStorage for persistent settings
|
// update the info to localStorage for persistent settings
|
||||||
|
@ -215,8 +226,7 @@ var Notifier = {
|
||||||
onSyncStateChange: function(state) {
|
onSyncStateChange: function(state) {
|
||||||
if (state === "SYNCING") {
|
if (state === "SYNCING") {
|
||||||
this.isSyncing = true;
|
this.isSyncing = true;
|
||||||
}
|
} else if (state === "STOPPED" || state === "ERROR") {
|
||||||
else if (state === "STOPPED" || state === "ERROR") {
|
|
||||||
this.isSyncing = false;
|
this.isSyncing = false;
|
||||||
}
|
}
|
||||||
},
|
},
|
||||||
|
@ -225,10 +235,10 @@ var Notifier = {
|
||||||
if (toStartOfTimeline) return;
|
if (toStartOfTimeline) return;
|
||||||
if (!room) return;
|
if (!room) return;
|
||||||
if (!this.isSyncing) return; // don't alert for any messages initially
|
if (!this.isSyncing) return; // don't alert for any messages initially
|
||||||
if (ev.sender && ev.sender.userId == MatrixClientPeg.get().credentials.userId) return;
|
if (ev.sender && ev.sender.userId === MatrixClientPeg.get().credentials.userId) return;
|
||||||
if (data.timeline.getTimelineSet() !== room.getUnfilteredTimelineSet()) return;
|
if (data.timeline.getTimelineSet() !== room.getUnfilteredTimelineSet()) return;
|
||||||
|
|
||||||
var actions = MatrixClientPeg.get().getPushActionsForEvent(ev);
|
const actions = MatrixClientPeg.get().getPushActionsForEvent(ev);
|
||||||
if (actions && actions.notify) {
|
if (actions && actions.notify) {
|
||||||
if (this.isEnabled()) {
|
if (this.isEnabled()) {
|
||||||
this._displayPopupNotification(ev, room);
|
this._displayPopupNotification(ev, room);
|
||||||
|
@ -240,7 +250,7 @@ var Notifier = {
|
||||||
},
|
},
|
||||||
|
|
||||||
onRoomReceipt: function(ev, room) {
|
onRoomReceipt: function(ev, room) {
|
||||||
if (room.getUnreadNotificationCount() == 0) {
|
if (room.getUnreadNotificationCount() === 0) {
|
||||||
// ideally we would clear each notification when it was read,
|
// ideally we would clear each notification when it was read,
|
||||||
// but we have no way, given a read receipt, to know whether
|
// but we have no way, given a read receipt, to know whether
|
||||||
// the receipt comes before or after an event, so we can't
|
// the receipt comes before or after an event, so we can't
|
||||||
|
@ -255,7 +265,7 @@ var Notifier = {
|
||||||
}
|
}
|
||||||
delete this.notifsByRoom[room.roomId];
|
delete this.notifsByRoom[room.roomId];
|
||||||
}
|
}
|
||||||
}
|
},
|
||||||
};
|
};
|
||||||
|
|
||||||
if (!global.mxNotifier) {
|
if (!global.mxNotifier) {
|
||||||
|
|
|
@ -15,6 +15,7 @@ limitations under the License.
|
||||||
*/
|
*/
|
||||||
|
|
||||||
var Matrix = require("matrix-js-sdk");
|
var Matrix = require("matrix-js-sdk");
|
||||||
|
import { _t } from './languageHandler';
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Allows a user to reset their password on a homeserver.
|
* Allows a user to reset their password on a homeserver.
|
||||||
|
@ -53,7 +54,7 @@ class PasswordReset {
|
||||||
return res;
|
return res;
|
||||||
}, function(err) {
|
}, function(err) {
|
||||||
if (err.errcode == 'M_THREEPID_NOT_FOUND') {
|
if (err.errcode == 'M_THREEPID_NOT_FOUND') {
|
||||||
err.message = "This email address was not found";
|
err.message = _t('This email address was not found');
|
||||||
} else if (err.httpStatus) {
|
} else if (err.httpStatus) {
|
||||||
err.message = err.message + ` (Status ${err.httpStatus})`;
|
err.message = err.message + ` (Status ${err.httpStatus})`;
|
||||||
}
|
}
|
||||||
|
@ -78,10 +79,10 @@ class PasswordReset {
|
||||||
}
|
}
|
||||||
}, this.password).catch(function(err) {
|
}, this.password).catch(function(err) {
|
||||||
if (err.httpStatus === 401) {
|
if (err.httpStatus === 401) {
|
||||||
err.message = "Failed to verify email address: make sure you clicked the link in the email";
|
err.message = _t('Failed to verify email address: make sure you clicked the link in the email');
|
||||||
}
|
}
|
||||||
else if (err.httpStatus === 404) {
|
else if (err.httpStatus === 404) {
|
||||||
err.message = "Your email address does not appear to be associated with a Matrix ID on this Homeserver.";
|
err.message = _t('Your email address does not appear to be associated with a Matrix ID on this Homeserver') + '.';
|
||||||
}
|
}
|
||||||
else if (err.httpStatus) {
|
else if (err.httpStatus) {
|
||||||
err.message += ` (Status ${err.httpStatus})`;
|
err.message += ` (Status ${err.httpStatus})`;
|
||||||
|
|
17
src/Roles.js
17
src/Roles.js
|
@ -13,14 +13,19 @@ WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
||||||
See the License for the specific language governing permissions and
|
See the License for the specific language governing permissions and
|
||||||
limitations under the License.
|
limitations under the License.
|
||||||
*/
|
*/
|
||||||
export const LEVEL_ROLE_MAP = {
|
import { _t } from './languageHandler';
|
||||||
undefined: 'Default',
|
|
||||||
0: 'User',
|
export function levelRoleMap() {
|
||||||
50: 'Moderator',
|
return {
|
||||||
100: 'Admin',
|
undefined: _t('Default'),
|
||||||
};
|
0: _t('User'),
|
||||||
|
50: _t('Moderator'),
|
||||||
|
100: _t('Admin'),
|
||||||
|
};
|
||||||
|
}
|
||||||
|
|
||||||
export function textualPowerLevel(level, userDefault) {
|
export function textualPowerLevel(level, userDefault) {
|
||||||
|
const LEVEL_ROLE_MAP = this.levelRoleMap();
|
||||||
if (LEVEL_ROLE_MAP[level]) {
|
if (LEVEL_ROLE_MAP[level]) {
|
||||||
return LEVEL_ROLE_MAP[level] + (level !== undefined ? ` (${level})` : ` (${userDefault})`);
|
return LEVEL_ROLE_MAP[level] + (level !== undefined ? ` (${level})` : ` (${userDefault})`);
|
||||||
} else {
|
} else {
|
||||||
|
|
|
@ -125,6 +125,7 @@ const SdkConfig = require('./SdkConfig');
|
||||||
const MatrixClientPeg = require("./MatrixClientPeg");
|
const MatrixClientPeg = require("./MatrixClientPeg");
|
||||||
const MatrixEvent = require("matrix-js-sdk").MatrixEvent;
|
const MatrixEvent = require("matrix-js-sdk").MatrixEvent;
|
||||||
const dis = require("./dispatcher");
|
const dis = require("./dispatcher");
|
||||||
|
import { _t } from './languageHandler';
|
||||||
|
|
||||||
function sendResponse(event, res) {
|
function sendResponse(event, res) {
|
||||||
const data = JSON.parse(JSON.stringify(event.data));
|
const data = JSON.parse(JSON.stringify(event.data));
|
||||||
|
@ -150,7 +151,7 @@ function inviteUser(event, roomId, userId) {
|
||||||
console.log(`Received request to invite ${userId} into room ${roomId}`);
|
console.log(`Received request to invite ${userId} into room ${roomId}`);
|
||||||
const client = MatrixClientPeg.get();
|
const client = MatrixClientPeg.get();
|
||||||
if (!client) {
|
if (!client) {
|
||||||
sendError(event, "You need to be logged in.");
|
sendError(event, _t('You need to be logged in.'));
|
||||||
return;
|
return;
|
||||||
}
|
}
|
||||||
const room = client.getRoom(roomId);
|
const room = client.getRoom(roomId);
|
||||||
|
@ -170,7 +171,7 @@ function inviteUser(event, roomId, userId) {
|
||||||
success: true,
|
success: true,
|
||||||
});
|
});
|
||||||
}, function(err) {
|
}, function(err) {
|
||||||
sendError(event, "You need to be able to invite users to do that.", err);
|
sendError(event, _t('You need to be able to invite users to do that.'), err);
|
||||||
});
|
});
|
||||||
}
|
}
|
||||||
|
|
||||||
|
@ -181,7 +182,7 @@ function setPlumbingState(event, roomId, status) {
|
||||||
console.log(`Received request to set plumbing state to status "${status}" in room ${roomId}`);
|
console.log(`Received request to set plumbing state to status "${status}" in room ${roomId}`);
|
||||||
const client = MatrixClientPeg.get();
|
const client = MatrixClientPeg.get();
|
||||||
if (!client) {
|
if (!client) {
|
||||||
sendError(event, "You need to be logged in.");
|
sendError(event, _t('You need to be logged in.'));
|
||||||
return;
|
return;
|
||||||
}
|
}
|
||||||
client.sendStateEvent(roomId, "m.room.plumbing", { status : status }).done(() => {
|
client.sendStateEvent(roomId, "m.room.plumbing", { status : status }).done(() => {
|
||||||
|
@ -189,7 +190,7 @@ function setPlumbingState(event, roomId, status) {
|
||||||
success: true,
|
success: true,
|
||||||
});
|
});
|
||||||
}, (err) => {
|
}, (err) => {
|
||||||
sendError(event, err.message ? err.message : "Failed to send request.", err);
|
sendError(event, err.message ? err.message : _t('Failed to send request.'), err);
|
||||||
});
|
});
|
||||||
}
|
}
|
||||||
|
|
||||||
|
@ -197,7 +198,7 @@ function setBotOptions(event, roomId, userId) {
|
||||||
console.log(`Received request to set options for bot ${userId} in room ${roomId}`);
|
console.log(`Received request to set options for bot ${userId} in room ${roomId}`);
|
||||||
const client = MatrixClientPeg.get();
|
const client = MatrixClientPeg.get();
|
||||||
if (!client) {
|
if (!client) {
|
||||||
sendError(event, "You need to be logged in.");
|
sendError(event, _t('You need to be logged in.'));
|
||||||
return;
|
return;
|
||||||
}
|
}
|
||||||
client.sendStateEvent(roomId, "m.room.bot.options", event.data.content, "_" + userId).done(() => {
|
client.sendStateEvent(roomId, "m.room.bot.options", event.data.content, "_" + userId).done(() => {
|
||||||
|
@ -205,20 +206,20 @@ function setBotOptions(event, roomId, userId) {
|
||||||
success: true,
|
success: true,
|
||||||
});
|
});
|
||||||
}, (err) => {
|
}, (err) => {
|
||||||
sendError(event, err.message ? err.message : "Failed to send request.", err);
|
sendError(event, err.message ? err.message : _t('Failed to send request.'), err);
|
||||||
});
|
});
|
||||||
}
|
}
|
||||||
|
|
||||||
function setBotPower(event, roomId, userId, level) {
|
function setBotPower(event, roomId, userId, level) {
|
||||||
if (!(Number.isInteger(level) && level >= 0)) {
|
if (!(Number.isInteger(level) && level >= 0)) {
|
||||||
sendError(event, "Power level must be positive integer.");
|
sendError(event, _t('Power level must be positive integer.'));
|
||||||
return;
|
return;
|
||||||
}
|
}
|
||||||
|
|
||||||
console.log(`Received request to set power level to ${level} for bot ${userId} in room ${roomId}.`);
|
console.log(`Received request to set power level to ${level} for bot ${userId} in room ${roomId}.`);
|
||||||
const client = MatrixClientPeg.get();
|
const client = MatrixClientPeg.get();
|
||||||
if (!client) {
|
if (!client) {
|
||||||
sendError(event, "You need to be logged in.");
|
sendError(event, _t('You need to be logged in.'));
|
||||||
return;
|
return;
|
||||||
}
|
}
|
||||||
|
|
||||||
|
@ -235,7 +236,7 @@ function setBotPower(event, roomId, userId, level) {
|
||||||
success: true,
|
success: true,
|
||||||
});
|
});
|
||||||
}, (err) => {
|
}, (err) => {
|
||||||
sendError(event, err.message ? err.message : "Failed to send request.", err);
|
sendError(event, err.message ? err.message : _t('Failed to send request.'), err);
|
||||||
});
|
});
|
||||||
});
|
});
|
||||||
}
|
}
|
||||||
|
@ -258,12 +259,12 @@ function botOptions(event, roomId, userId) {
|
||||||
function returnStateEvent(event, roomId, eventType, stateKey) {
|
function returnStateEvent(event, roomId, eventType, stateKey) {
|
||||||
const client = MatrixClientPeg.get();
|
const client = MatrixClientPeg.get();
|
||||||
if (!client) {
|
if (!client) {
|
||||||
sendError(event, "You need to be logged in.");
|
sendError(event, _t('You need to be logged in.'));
|
||||||
return;
|
return;
|
||||||
}
|
}
|
||||||
const room = client.getRoom(roomId);
|
const room = client.getRoom(roomId);
|
||||||
if (!room) {
|
if (!room) {
|
||||||
sendError(event, "This room is not recognised.");
|
sendError(event, _t('This room is not recognised.'));
|
||||||
return;
|
return;
|
||||||
}
|
}
|
||||||
const stateEvent = room.currentState.getStateEvents(eventType, stateKey);
|
const stateEvent = room.currentState.getStateEvents(eventType, stateKey);
|
||||||
|
@ -313,13 +314,13 @@ const onMessage = function(event) {
|
||||||
const roomId = event.data.room_id;
|
const roomId = event.data.room_id;
|
||||||
const userId = event.data.user_id;
|
const userId = event.data.user_id;
|
||||||
if (!roomId) {
|
if (!roomId) {
|
||||||
sendError(event, "Missing room_id in request");
|
sendError(event, _t('Missing room_id in request'));
|
||||||
return;
|
return;
|
||||||
}
|
}
|
||||||
let promise = Promise.resolve(currentRoomId);
|
let promise = Promise.resolve(currentRoomId);
|
||||||
if (!currentRoomId) {
|
if (!currentRoomId) {
|
||||||
if (!currentRoomAlias) {
|
if (!currentRoomAlias) {
|
||||||
sendError(event, "Must be viewing a room");
|
sendError(event, _t('Must be viewing a room'));
|
||||||
return;
|
return;
|
||||||
}
|
}
|
||||||
// no room ID but there is an alias, look it up.
|
// no room ID but there is an alias, look it up.
|
||||||
|
@ -331,7 +332,7 @@ const onMessage = function(event) {
|
||||||
|
|
||||||
promise.then((viewingRoomId) => {
|
promise.then((viewingRoomId) => {
|
||||||
if (roomId !== viewingRoomId) {
|
if (roomId !== viewingRoomId) {
|
||||||
sendError(event, "Room " + roomId + " not visible");
|
sendError(event, _t('Room %(roomId)s not visible', {roomId: roomId}));
|
||||||
return;
|
return;
|
||||||
}
|
}
|
||||||
|
|
||||||
|
@ -345,7 +346,7 @@ const onMessage = function(event) {
|
||||||
}
|
}
|
||||||
|
|
||||||
if (!userId) {
|
if (!userId) {
|
||||||
sendError(event, "Missing user_id in request");
|
sendError(event, _t('Missing user_id in request'));
|
||||||
return;
|
return;
|
||||||
}
|
}
|
||||||
switch (event.data.action) {
|
switch (event.data.action) {
|
||||||
|
@ -370,7 +371,7 @@ const onMessage = function(event) {
|
||||||
}
|
}
|
||||||
}, (err) => {
|
}, (err) => {
|
||||||
console.error(err);
|
console.error(err);
|
||||||
sendError(event, "Failed to lookup current room.");
|
sendError(event, _t('Failed to lookup current room') + '.');
|
||||||
});
|
});
|
||||||
};
|
};
|
||||||
|
|
||||||
|
|
|
@ -14,10 +14,11 @@ See the License for the specific language governing permissions and
|
||||||
limitations under the License.
|
limitations under the License.
|
||||||
*/
|
*/
|
||||||
|
|
||||||
var MatrixClientPeg = require("./MatrixClientPeg");
|
import MatrixClientPeg from "./MatrixClientPeg";
|
||||||
var dis = require("./dispatcher");
|
import dis from "./dispatcher";
|
||||||
var Tinter = require("./Tinter");
|
import Tinter from "./Tinter";
|
||||||
import sdk from './index';
|
import sdk from './index';
|
||||||
|
import { _t } from './languageHandler';
|
||||||
import Modal from './Modal';
|
import Modal from './Modal';
|
||||||
|
|
||||||
|
|
||||||
|
@ -41,58 +42,64 @@ class Command {
|
||||||
}
|
}
|
||||||
|
|
||||||
getUsage() {
|
getUsage() {
|
||||||
return "Usage: " + this.getCommandWithArgs();
|
return _t('Usage') + ': ' + this.getCommandWithArgs();
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
var reject = function(msg) {
|
function reject(msg) {
|
||||||
return {
|
return {
|
||||||
error: msg
|
error: msg,
|
||||||
};
|
};
|
||||||
};
|
}
|
||||||
|
|
||||||
var success = function(promise) {
|
function success(promise) {
|
||||||
return {
|
return {
|
||||||
promise: promise
|
promise: promise,
|
||||||
};
|
};
|
||||||
};
|
}
|
||||||
|
|
||||||
var commands = {
|
/* Disable the "unexpected this" error for these commands - all of the run
|
||||||
|
* functions are called with `this` bound to the Command instance.
|
||||||
|
*/
|
||||||
|
|
||||||
|
/* eslint-disable babel/no-invalid-this */
|
||||||
|
|
||||||
|
const commands = {
|
||||||
ddg: new Command("ddg", "<query>", function(roomId, args) {
|
ddg: new Command("ddg", "<query>", function(roomId, args) {
|
||||||
const ErrorDialog = sdk.getComponent('dialogs.ErrorDialog');
|
const ErrorDialog = sdk.getComponent('dialogs.ErrorDialog');
|
||||||
// TODO Don't explain this away, actually show a search UI here.
|
// TODO Don't explain this away, actually show a search UI here.
|
||||||
Modal.createDialog(ErrorDialog, {
|
Modal.createDialog(ErrorDialog, {
|
||||||
title: "/ddg is not a command",
|
title: _t('/ddg is not a command'),
|
||||||
description: "To use it, just wait for autocomplete results to load and tab through them.",
|
description: _t('To use it, just wait for autocomplete results to load and tab through them.'),
|
||||||
});
|
});
|
||||||
return success();
|
return success();
|
||||||
}),
|
}),
|
||||||
|
|
||||||
// Change your nickname
|
// Change your nickname
|
||||||
nick: new Command("nick", "<display_name>", function(room_id, args) {
|
nick: new Command("nick", "<display_name>", function(roomId, args) {
|
||||||
if (args) {
|
if (args) {
|
||||||
return success(
|
return success(
|
||||||
MatrixClientPeg.get().setDisplayName(args)
|
MatrixClientPeg.get().setDisplayName(args),
|
||||||
);
|
);
|
||||||
}
|
}
|
||||||
return reject(this.getUsage());
|
return reject(this.getUsage());
|
||||||
}),
|
}),
|
||||||
|
|
||||||
// Changes the colorscheme of your current room
|
// Changes the colorscheme of your current room
|
||||||
tint: new Command("tint", "<color1> [<color2>]", function(room_id, args) {
|
tint: new Command("tint", "<color1> [<color2>]", function(roomId, args) {
|
||||||
if (args) {
|
if (args) {
|
||||||
var matches = args.match(/^(#([0-9a-fA-F]{3}|[0-9a-fA-F]{6}))( +(#([0-9a-fA-F]{3}|[0-9a-fA-F]{6})))?$/);
|
const matches = args.match(/^(#([0-9a-fA-F]{3}|[0-9a-fA-F]{6}))( +(#([0-9a-fA-F]{3}|[0-9a-fA-F]{6})))?$/);
|
||||||
if (matches) {
|
if (matches) {
|
||||||
Tinter.tint(matches[1], matches[4]);
|
Tinter.tint(matches[1], matches[4]);
|
||||||
var colorScheme = {};
|
const colorScheme = {};
|
||||||
colorScheme.primary_color = matches[1];
|
colorScheme.primary_color = matches[1];
|
||||||
if (matches[4]) {
|
if (matches[4]) {
|
||||||
colorScheme.secondary_color = matches[4];
|
colorScheme.secondary_color = matches[4];
|
||||||
}
|
}
|
||||||
return success(
|
return success(
|
||||||
MatrixClientPeg.get().setRoomAccountData(
|
MatrixClientPeg.get().setRoomAccountData(
|
||||||
room_id, "org.matrix.room.color_scheme", colorScheme
|
roomId, "org.matrix.room.color_scheme", colorScheme,
|
||||||
)
|
),
|
||||||
);
|
);
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
@ -100,22 +107,22 @@ var commands = {
|
||||||
}),
|
}),
|
||||||
|
|
||||||
// Change the room topic
|
// Change the room topic
|
||||||
topic: new Command("topic", "<topic>", function(room_id, args) {
|
topic: new Command("topic", "<topic>", function(roomId, args) {
|
||||||
if (args) {
|
if (args) {
|
||||||
return success(
|
return success(
|
||||||
MatrixClientPeg.get().setRoomTopic(room_id, args)
|
MatrixClientPeg.get().setRoomTopic(roomId, args),
|
||||||
);
|
);
|
||||||
}
|
}
|
||||||
return reject(this.getUsage());
|
return reject(this.getUsage());
|
||||||
}),
|
}),
|
||||||
|
|
||||||
// Invite a user
|
// Invite a user
|
||||||
invite: new Command("invite", "<userId>", function(room_id, args) {
|
invite: new Command("invite", "<userId>", function(roomId, args) {
|
||||||
if (args) {
|
if (args) {
|
||||||
var matches = args.match(/^(\S+)$/);
|
const matches = args.match(/^(\S+)$/);
|
||||||
if (matches) {
|
if (matches) {
|
||||||
return success(
|
return success(
|
||||||
MatrixClientPeg.get().invite(room_id, matches[1])
|
MatrixClientPeg.get().invite(roomId, matches[1]),
|
||||||
);
|
);
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
@ -123,21 +130,21 @@ var commands = {
|
||||||
}),
|
}),
|
||||||
|
|
||||||
// Join a room
|
// Join a room
|
||||||
join: new Command("join", "#alias:domain", function(room_id, args) {
|
join: new Command("join", "#alias:domain", function(roomId, args) {
|
||||||
if (args) {
|
if (args) {
|
||||||
var matches = args.match(/^(\S+)$/);
|
const matches = args.match(/^(\S+)$/);
|
||||||
if (matches) {
|
if (matches) {
|
||||||
var room_alias = matches[1];
|
let roomAlias = matches[1];
|
||||||
if (room_alias[0] !== '#') {
|
if (roomAlias[0] !== '#') {
|
||||||
return reject(this.getUsage());
|
return reject(this.getUsage());
|
||||||
}
|
}
|
||||||
if (!room_alias.match(/:/)) {
|
if (!roomAlias.match(/:/)) {
|
||||||
room_alias += ':' + MatrixClientPeg.get().getDomain();
|
roomAlias += ':' + MatrixClientPeg.get().getDomain();
|
||||||
}
|
}
|
||||||
|
|
||||||
dis.dispatch({
|
dis.dispatch({
|
||||||
action: 'view_room',
|
action: 'view_room',
|
||||||
room_alias: room_alias,
|
room_alias: roomAlias,
|
||||||
auto_join: true,
|
auto_join: true,
|
||||||
});
|
});
|
||||||
|
|
||||||
|
@ -147,29 +154,29 @@ var commands = {
|
||||||
return reject(this.getUsage());
|
return reject(this.getUsage());
|
||||||
}),
|
}),
|
||||||
|
|
||||||
part: new Command("part", "[#alias:domain]", function(room_id, args) {
|
part: new Command("part", "[#alias:domain]", function(roomId, args) {
|
||||||
var targetRoomId;
|
let targetRoomId;
|
||||||
if (args) {
|
if (args) {
|
||||||
var matches = args.match(/^(\S+)$/);
|
const matches = args.match(/^(\S+)$/);
|
||||||
if (matches) {
|
if (matches) {
|
||||||
var room_alias = matches[1];
|
let roomAlias = matches[1];
|
||||||
if (room_alias[0] !== '#') {
|
if (roomAlias[0] !== '#') {
|
||||||
return reject(this.getUsage());
|
return reject(this.getUsage());
|
||||||
}
|
}
|
||||||
if (!room_alias.match(/:/)) {
|
if (!roomAlias.match(/:/)) {
|
||||||
room_alias += ':' + MatrixClientPeg.get().getDomain();
|
roomAlias += ':' + MatrixClientPeg.get().getDomain();
|
||||||
}
|
}
|
||||||
|
|
||||||
// Try to find a room with this alias
|
// Try to find a room with this alias
|
||||||
var rooms = MatrixClientPeg.get().getRooms();
|
const rooms = MatrixClientPeg.get().getRooms();
|
||||||
for (var i = 0; i < rooms.length; i++) {
|
for (let i = 0; i < rooms.length; i++) {
|
||||||
var aliasEvents = rooms[i].currentState.getStateEvents(
|
const aliasEvents = rooms[i].currentState.getStateEvents(
|
||||||
"m.room.aliases"
|
"m.room.aliases",
|
||||||
);
|
);
|
||||||
for (var j = 0; j < aliasEvents.length; j++) {
|
for (let j = 0; j < aliasEvents.length; j++) {
|
||||||
var aliases = aliasEvents[j].getContent().aliases || [];
|
const aliases = aliasEvents[j].getContent().aliases || [];
|
||||||
for (var k = 0; k < aliases.length; k++) {
|
for (let k = 0; k < aliases.length; k++) {
|
||||||
if (aliases[k] === room_alias) {
|
if (aliases[k] === roomAlias) {
|
||||||
targetRoomId = rooms[i].roomId;
|
targetRoomId = rooms[i].roomId;
|
||||||
break;
|
break;
|
||||||
}
|
}
|
||||||
|
@ -178,27 +185,28 @@ var commands = {
|
||||||
}
|
}
|
||||||
if (targetRoomId) { break; }
|
if (targetRoomId) { break; }
|
||||||
}
|
}
|
||||||
}
|
if (!targetRoomId) {
|
||||||
if (!targetRoomId) {
|
return reject("Unrecognised room alias: " + roomAlias);
|
||||||
return reject("Unrecognised room alias: " + room_alias);
|
}
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
if (!targetRoomId) targetRoomId = room_id;
|
if (!targetRoomId) targetRoomId = roomId;
|
||||||
return success(
|
return success(
|
||||||
MatrixClientPeg.get().leave(targetRoomId).then(
|
MatrixClientPeg.get().leave(targetRoomId).then(
|
||||||
function() {
|
function() {
|
||||||
dis.dispatch({action: 'view_next_room'});
|
dis.dispatch({action: 'view_next_room'});
|
||||||
})
|
},
|
||||||
|
),
|
||||||
);
|
);
|
||||||
}),
|
}),
|
||||||
|
|
||||||
// Kick a user from the room with an optional reason
|
// Kick a user from the room with an optional reason
|
||||||
kick: new Command("kick", "<userId> [<reason>]", function(room_id, args) {
|
kick: new Command("kick", "<userId> [<reason>]", function(roomId, args) {
|
||||||
if (args) {
|
if (args) {
|
||||||
var matches = args.match(/^(\S+?)( +(.*))?$/);
|
const matches = args.match(/^(\S+?)( +(.*))?$/);
|
||||||
if (matches) {
|
if (matches) {
|
||||||
return success(
|
return success(
|
||||||
MatrixClientPeg.get().kick(room_id, matches[1], matches[3])
|
MatrixClientPeg.get().kick(roomId, matches[1], matches[3]),
|
||||||
);
|
);
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
@ -206,12 +214,12 @@ var commands = {
|
||||||
}),
|
}),
|
||||||
|
|
||||||
// Ban a user from the room with an optional reason
|
// Ban a user from the room with an optional reason
|
||||||
ban: new Command("ban", "<userId> [<reason>]", function(room_id, args) {
|
ban: new Command("ban", "<userId> [<reason>]", function(roomId, args) {
|
||||||
if (args) {
|
if (args) {
|
||||||
var matches = args.match(/^(\S+?)( +(.*))?$/);
|
const matches = args.match(/^(\S+?)( +(.*))?$/);
|
||||||
if (matches) {
|
if (matches) {
|
||||||
return success(
|
return success(
|
||||||
MatrixClientPeg.get().ban(room_id, matches[1], matches[3])
|
MatrixClientPeg.get().ban(roomId, matches[1], matches[3]),
|
||||||
);
|
);
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
@ -219,13 +227,13 @@ var commands = {
|
||||||
}),
|
}),
|
||||||
|
|
||||||
// Unban a user from the room
|
// Unban a user from the room
|
||||||
unban: new Command("unban", "<userId>", function(room_id, args) {
|
unban: new Command("unban", "<userId>", function(roomId, args) {
|
||||||
if (args) {
|
if (args) {
|
||||||
var matches = args.match(/^(\S+)$/);
|
const matches = args.match(/^(\S+)$/);
|
||||||
if (matches) {
|
if (matches) {
|
||||||
// Reset the user membership to "leave" to unban him
|
// Reset the user membership to "leave" to unban him
|
||||||
return success(
|
return success(
|
||||||
MatrixClientPeg.get().unban(room_id, matches[1])
|
MatrixClientPeg.get().unban(roomId, matches[1]),
|
||||||
);
|
);
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
@ -233,27 +241,27 @@ var commands = {
|
||||||
}),
|
}),
|
||||||
|
|
||||||
// Define the power level of a user
|
// Define the power level of a user
|
||||||
op: new Command("op", "<userId> [<power level>]", function(room_id, args) {
|
op: new Command("op", "<userId> [<power level>]", function(roomId, args) {
|
||||||
if (args) {
|
if (args) {
|
||||||
var matches = args.match(/^(\S+?)( +(\d+))?$/);
|
const matches = args.match(/^(\S+?)( +(\d+))?$/);
|
||||||
var powerLevel = 50; // default power level for op
|
let powerLevel = 50; // default power level for op
|
||||||
if (matches) {
|
if (matches) {
|
||||||
var user_id = matches[1];
|
const userId = matches[1];
|
||||||
if (matches.length === 4 && undefined !== matches[3]) {
|
if (matches.length === 4 && undefined !== matches[3]) {
|
||||||
powerLevel = parseInt(matches[3]);
|
powerLevel = parseInt(matches[3]);
|
||||||
}
|
}
|
||||||
if (powerLevel !== NaN) {
|
if (!isNaN(powerLevel)) {
|
||||||
var room = MatrixClientPeg.get().getRoom(room_id);
|
const room = MatrixClientPeg.get().getRoom(roomId);
|
||||||
if (!room) {
|
if (!room) {
|
||||||
return reject("Bad room ID: " + room_id);
|
return reject("Bad room ID: " + roomId);
|
||||||
}
|
}
|
||||||
var powerLevelEvent = room.currentState.getStateEvents(
|
const powerLevelEvent = room.currentState.getStateEvents(
|
||||||
"m.room.power_levels", ""
|
"m.room.power_levels", "",
|
||||||
);
|
);
|
||||||
return success(
|
return success(
|
||||||
MatrixClientPeg.get().setPowerLevel(
|
MatrixClientPeg.get().setPowerLevel(
|
||||||
room_id, user_id, powerLevel, powerLevelEvent
|
roomId, userId, powerLevel, powerLevelEvent,
|
||||||
)
|
),
|
||||||
);
|
);
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
@ -262,32 +270,87 @@ var commands = {
|
||||||
}),
|
}),
|
||||||
|
|
||||||
// Reset the power level of a user
|
// Reset the power level of a user
|
||||||
deop: new Command("deop", "<userId>", function(room_id, args) {
|
deop: new Command("deop", "<userId>", function(roomId, args) {
|
||||||
if (args) {
|
if (args) {
|
||||||
var matches = args.match(/^(\S+)$/);
|
const matches = args.match(/^(\S+)$/);
|
||||||
if (matches) {
|
if (matches) {
|
||||||
var room = MatrixClientPeg.get().getRoom(room_id);
|
const room = MatrixClientPeg.get().getRoom(roomId);
|
||||||
if (!room) {
|
if (!room) {
|
||||||
return reject("Bad room ID: " + room_id);
|
return reject("Bad room ID: " + roomId);
|
||||||
}
|
}
|
||||||
|
|
||||||
var powerLevelEvent = room.currentState.getStateEvents(
|
const powerLevelEvent = room.currentState.getStateEvents(
|
||||||
"m.room.power_levels", ""
|
"m.room.power_levels", "",
|
||||||
);
|
);
|
||||||
return success(
|
return success(
|
||||||
MatrixClientPeg.get().setPowerLevel(
|
MatrixClientPeg.get().setPowerLevel(
|
||||||
room_id, args, undefined, powerLevelEvent
|
roomId, args, undefined, powerLevelEvent,
|
||||||
)
|
),
|
||||||
);
|
);
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
return reject(this.getUsage());
|
return reject(this.getUsage());
|
||||||
})
|
}),
|
||||||
|
|
||||||
|
// Verify a user, device, and pubkey tuple
|
||||||
|
verify: new Command("verify", "<userId> <deviceId> <deviceSigningKey>", function(roomId, args) {
|
||||||
|
if (args) {
|
||||||
|
const matches = args.match(/^(\S+) +(\S+) +(\S+)$/);
|
||||||
|
if (matches) {
|
||||||
|
const userId = matches[1];
|
||||||
|
const deviceId = matches[2];
|
||||||
|
const fingerprint = matches[3];
|
||||||
|
|
||||||
|
const device = MatrixClientPeg.get().getStoredDevice(userId, deviceId);
|
||||||
|
if (!device) {
|
||||||
|
return reject(`Unknown (user, device) pair: (${userId}, ${deviceId})`);
|
||||||
|
}
|
||||||
|
|
||||||
|
if (device.isVerified()) {
|
||||||
|
if (device.getFingerprint() === fingerprint) {
|
||||||
|
return reject(`Device already verified!`);
|
||||||
|
} else {
|
||||||
|
return reject(`WARNING: Device already verified, but keys do NOT MATCH!`);
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
if (device.getFingerprint() === fingerprint) {
|
||||||
|
MatrixClientPeg.get().setDeviceVerified(
|
||||||
|
userId, deviceId, true,
|
||||||
|
);
|
||||||
|
|
||||||
|
// Tell the user we verified everything!
|
||||||
|
const QuestionDialog = sdk.getComponent("dialogs.QuestionDialog");
|
||||||
|
Modal.createDialog(QuestionDialog, {
|
||||||
|
title: "Verified key",
|
||||||
|
description: (
|
||||||
|
<div>
|
||||||
|
<p>
|
||||||
|
The signing key you provided matches the signing key you received
|
||||||
|
from { userId }'s device { deviceId }. Device marked as verified.
|
||||||
|
</p>
|
||||||
|
</div>
|
||||||
|
),
|
||||||
|
hasCancelButton: false,
|
||||||
|
});
|
||||||
|
|
||||||
|
return success();
|
||||||
|
} else {
|
||||||
|
return reject(`WARNING: KEY VERIFICATION FAILED! The signing key for ${userId} and device
|
||||||
|
${deviceId} is "${device.getFingerprint()}" which does not match the provided key
|
||||||
|
"${fingerprint}". This could mean your communications are being intercepted!`);
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
|
return reject(this.getUsage());
|
||||||
|
}),
|
||||||
};
|
};
|
||||||
|
/* eslint-enable babel/no-invalid-this */
|
||||||
|
|
||||||
|
|
||||||
// helpful aliases
|
// helpful aliases
|
||||||
var aliases = {
|
const aliases = {
|
||||||
j: "join"
|
j: "join",
|
||||||
};
|
};
|
||||||
|
|
||||||
module.exports = {
|
module.exports = {
|
||||||
|
@ -304,13 +367,13 @@ module.exports = {
|
||||||
// IRC-style commands
|
// IRC-style commands
|
||||||
input = input.replace(/\s+$/, "");
|
input = input.replace(/\s+$/, "");
|
||||||
if (input[0] === "/" && input[1] !== "/") {
|
if (input[0] === "/" && input[1] !== "/") {
|
||||||
var bits = input.match(/^(\S+?)( +((.|\n)*))?$/);
|
const bits = input.match(/^(\S+?)( +((.|\n)*))?$/);
|
||||||
var cmd, args;
|
let cmd;
|
||||||
|
let args;
|
||||||
if (bits) {
|
if (bits) {
|
||||||
cmd = bits[1].substring(1).toLowerCase();
|
cmd = bits[1].substring(1).toLowerCase();
|
||||||
args = bits[3];
|
args = bits[3];
|
||||||
}
|
} else {
|
||||||
else {
|
|
||||||
cmd = input;
|
cmd = input;
|
||||||
}
|
}
|
||||||
if (cmd === "me") return null;
|
if (cmd === "me") return null;
|
||||||
|
@ -319,8 +382,7 @@ module.exports = {
|
||||||
}
|
}
|
||||||
if (commands[cmd]) {
|
if (commands[cmd]) {
|
||||||
return commands[cmd].run(roomId, args);
|
return commands[cmd].run(roomId, args);
|
||||||
}
|
} else {
|
||||||
else {
|
|
||||||
return reject("Unrecognised command: " + input);
|
return reject("Unrecognised command: " + input);
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
@ -329,12 +391,12 @@ module.exports = {
|
||||||
|
|
||||||
getCommandList: function() {
|
getCommandList: function() {
|
||||||
// Return all the commands plus /me and /markdown which aren't handled like normal commands
|
// Return all the commands plus /me and /markdown which aren't handled like normal commands
|
||||||
var cmds = Object.keys(commands).sort().map(function(cmdKey) {
|
const cmds = Object.keys(commands).sort().map(function(cmdKey) {
|
||||||
return commands[cmdKey];
|
return commands[cmdKey];
|
||||||
});
|
});
|
||||||
cmds.push(new Command("me", "<action>", function() {}));
|
cmds.push(new Command("me", "<action>", function() {}));
|
||||||
cmds.push(new Command("markdown", "<on|off>", function() {}));
|
cmds.push(new Command("markdown", "<on|off>", function() {}));
|
||||||
|
|
||||||
return cmds;
|
return cmds;
|
||||||
}
|
},
|
||||||
};
|
};
|
||||||
|
|
|
@ -16,7 +16,7 @@ limitations under the License.
|
||||||
|
|
||||||
var MatrixClientPeg = require("./MatrixClientPeg");
|
var MatrixClientPeg = require("./MatrixClientPeg");
|
||||||
var CallHandler = require("./CallHandler");
|
var CallHandler = require("./CallHandler");
|
||||||
|
import { _t } from './languageHandler';
|
||||||
import * as Roles from './Roles';
|
import * as Roles from './Roles';
|
||||||
|
|
||||||
function textForMemberEvent(ev) {
|
function textForMemberEvent(ev) {
|
||||||
|
@ -25,95 +25,100 @@ function textForMemberEvent(ev) {
|
||||||
var targetName = ev.target ? ev.target.name : ev.getStateKey();
|
var targetName = ev.target ? ev.target.name : ev.getStateKey();
|
||||||
var ConferenceHandler = CallHandler.getConferenceHandler();
|
var ConferenceHandler = CallHandler.getConferenceHandler();
|
||||||
var reason = ev.getContent().reason ? (
|
var reason = ev.getContent().reason ? (
|
||||||
" Reason: " + ev.getContent().reason
|
_t('Reason') + ': ' + ev.getContent().reason
|
||||||
) : "";
|
) : "";
|
||||||
switch (ev.getContent().membership) {
|
switch (ev.getContent().membership) {
|
||||||
case 'invite':
|
case 'invite':
|
||||||
var threePidContent = ev.getContent().third_party_invite;
|
var threePidContent = ev.getContent().third_party_invite;
|
||||||
if (threePidContent) {
|
if (threePidContent) {
|
||||||
if (threePidContent.display_name) {
|
if (threePidContent.display_name) {
|
||||||
return targetName + " accepted the invitation for " +
|
return _t('%(targetName)s accepted the invitation for %(displayName)s.', {targetName: targetName, displayName: threePidContent.display_name});
|
||||||
threePidContent.display_name + ".";
|
|
||||||
} else {
|
} else {
|
||||||
return targetName + " accepted an invitation.";
|
return _t('%(targetName)s accepted an invitation.', {targetName: targetName});
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
else {
|
else {
|
||||||
if (ConferenceHandler && ConferenceHandler.isConferenceUser(ev.getStateKey())) {
|
if (ConferenceHandler && ConferenceHandler.isConferenceUser(ev.getStateKey())) {
|
||||||
return senderName + " requested a VoIP conference";
|
return _t('%(senderName)s requested a VoIP conference.', {senderName: senderName});
|
||||||
}
|
}
|
||||||
else {
|
else {
|
||||||
return senderName + " invited " + targetName + ".";
|
return _t('%(senderName)s invited %(targetName)s.', {senderName: senderName, targetName: targetName});
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
case 'ban':
|
case 'ban':
|
||||||
return senderName + " banned " + targetName + "." + reason;
|
return _t(
|
||||||
|
'%(senderName)s banned %(targetName)s.',
|
||||||
|
{senderName: senderName, targetName: targetName}
|
||||||
|
) + ' ' + reason;
|
||||||
case 'join':
|
case 'join':
|
||||||
if (ev.getPrevContent() && ev.getPrevContent().membership == 'join') {
|
if (ev.getPrevContent() && ev.getPrevContent().membership == 'join') {
|
||||||
if (ev.getPrevContent().displayname && ev.getContent().displayname && ev.getPrevContent().displayname != ev.getContent().displayname) {
|
if (ev.getPrevContent().displayname && ev.getContent().displayname && ev.getPrevContent().displayname != ev.getContent().displayname) {
|
||||||
return ev.getSender() + " changed their display name from " +
|
return _t('%(senderName)s changed their display name from %(oldDisplayName)s to %(displayName)s.', {senderName: ev.getSender(), oldDisplayName: ev.getPrevContent().displayname, displayName: ev.getContent().displayname});
|
||||||
ev.getPrevContent().displayname + " to " +
|
|
||||||
ev.getContent().displayname;
|
|
||||||
} else if (!ev.getPrevContent().displayname && ev.getContent().displayname) {
|
} else if (!ev.getPrevContent().displayname && ev.getContent().displayname) {
|
||||||
return ev.getSender() + " set their display name to " + ev.getContent().displayname;
|
return _t('%(senderName)s set their display name to %(displayName)s.', {senderName: ev.getSender(), displayName: ev.getContent().displayname});
|
||||||
} else if (ev.getPrevContent().displayname && !ev.getContent().displayname) {
|
} else if (ev.getPrevContent().displayname && !ev.getContent().displayname) {
|
||||||
return ev.getSender() + " removed their display name (" + ev.getPrevContent().displayname + ")";
|
return _t('%(senderName)s removed their display name (%(oldDisplayName)s).', {senderName: ev.getSender(), oldDisplayName: ev.getPrevContent().displayname});
|
||||||
} else if (ev.getPrevContent().avatar_url && !ev.getContent().avatar_url) {
|
} else if (ev.getPrevContent().avatar_url && !ev.getContent().avatar_url) {
|
||||||
return senderName + " removed their profile picture";
|
return _t('%(senderName)s removed their profile picture.', {senderName: senderName});
|
||||||
} else if (ev.getPrevContent().avatar_url && ev.getContent().avatar_url && ev.getPrevContent().avatar_url != ev.getContent().avatar_url) {
|
} else if (ev.getPrevContent().avatar_url && ev.getContent().avatar_url && ev.getPrevContent().avatar_url != ev.getContent().avatar_url) {
|
||||||
return senderName + " changed their profile picture";
|
return _t('%(senderName)s changed their profile picture.', {senderName: senderName});
|
||||||
} else if (!ev.getPrevContent().avatar_url && ev.getContent().avatar_url) {
|
} else if (!ev.getPrevContent().avatar_url && ev.getContent().avatar_url) {
|
||||||
return senderName + " set a profile picture";
|
return _t('%(senderName)s set a profile picture.', {senderName: senderName});
|
||||||
} else {
|
} else {
|
||||||
// hacky hack for https://github.com/vector-im/vector-web/issues/2020
|
// suppress null rejoins
|
||||||
return senderName + " rejoined the room.";
|
return '';
|
||||||
}
|
}
|
||||||
} else {
|
} else {
|
||||||
if (!ev.target) console.warn("Join message has no target! -- " + ev.getContent().state_key);
|
if (!ev.target) console.warn("Join message has no target! -- " + ev.getContent().state_key);
|
||||||
if (ConferenceHandler && ConferenceHandler.isConferenceUser(ev.getStateKey())) {
|
if (ConferenceHandler && ConferenceHandler.isConferenceUser(ev.getStateKey())) {
|
||||||
return "VoIP conference started";
|
return _t('VoIP conference started.');
|
||||||
}
|
}
|
||||||
else {
|
else {
|
||||||
return targetName + " joined the room.";
|
return _t('%(targetName)s joined the room.', {targetName: targetName});
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
case 'leave':
|
case 'leave':
|
||||||
if (ev.getSender() === ev.getStateKey()) {
|
if (ev.getSender() === ev.getStateKey()) {
|
||||||
if (ConferenceHandler && ConferenceHandler.isConferenceUser(ev.getStateKey())) {
|
if (ConferenceHandler && ConferenceHandler.isConferenceUser(ev.getStateKey())) {
|
||||||
return "VoIP conference finished";
|
return _t('VoIP conference finished.');
|
||||||
}
|
}
|
||||||
else if (ev.getPrevContent().membership === "invite") {
|
else if (ev.getPrevContent().membership === "invite") {
|
||||||
return targetName + " rejected the invitation.";
|
return _t('%(targetName)s rejected the invitation.', {targetName: targetName});
|
||||||
}
|
}
|
||||||
else {
|
else {
|
||||||
return targetName + " left the room.";
|
return _t('%(targetName)s left the room.', {targetName: targetName});
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
else if (ev.getPrevContent().membership === "ban") {
|
else if (ev.getPrevContent().membership === "ban") {
|
||||||
return senderName + " unbanned " + targetName + ".";
|
return _t('%(senderName)s unbanned %(targetName)s.', {senderName: senderName, targetName: targetName});
|
||||||
}
|
}
|
||||||
else if (ev.getPrevContent().membership === "join") {
|
else if (ev.getPrevContent().membership === "join") {
|
||||||
return senderName + " kicked " + targetName + "." + reason;
|
return _t(
|
||||||
|
'%(senderName)s kicked %(targetName)s.',
|
||||||
|
{senderName: senderName, targetName: targetName}
|
||||||
|
) + ' ' + reason;
|
||||||
}
|
}
|
||||||
else if (ev.getPrevContent().membership === "invite") {
|
else if (ev.getPrevContent().membership === "invite") {
|
||||||
return senderName + " withdrew " + targetName + "'s invitation." + reason;
|
return _t(
|
||||||
|
'%(senderName)s withdrew %(targetName)s\'s invitation.',
|
||||||
|
{senderName: senderName, targetName: targetName}
|
||||||
|
) + ' ' + reason;
|
||||||
}
|
}
|
||||||
else {
|
else {
|
||||||
return targetName + " left the room.";
|
return _t('%(targetName)s left the room.', {targetName: targetName});
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
function textForTopicEvent(ev) {
|
function textForTopicEvent(ev) {
|
||||||
var senderDisplayName = ev.sender && ev.sender.name ? ev.sender.name : ev.getSender();
|
var senderDisplayName = ev.sender && ev.sender.name ? ev.sender.name : ev.getSender();
|
||||||
|
return _t('%(senderDisplayName)s changed the topic to "%(topic)s".', {senderDisplayName: senderDisplayName, topic: ev.getContent().topic});
|
||||||
return senderDisplayName + ' changed the topic to "' + ev.getContent().topic + '"';
|
|
||||||
}
|
}
|
||||||
|
|
||||||
function textForRoomNameEvent(ev) {
|
function textForRoomNameEvent(ev) {
|
||||||
var senderDisplayName = ev.sender && ev.sender.name ? ev.sender.name : ev.getSender();
|
var senderDisplayName = ev.sender && ev.sender.name ? ev.sender.name : ev.getSender();
|
||||||
|
|
||||||
return senderDisplayName + ' changed the room name to "' + ev.getContent().name + '"';
|
return _t('%(senderDisplayName)s changed the room name to %(roomName)s.', {senderDisplayName: senderDisplayName, roomName: ev.getContent().name});
|
||||||
}
|
}
|
||||||
|
|
||||||
function textForMessageEvent(ev) {
|
function textForMessageEvent(ev) {
|
||||||
|
@ -122,66 +127,66 @@ function textForMessageEvent(ev) {
|
||||||
if (ev.getContent().msgtype === "m.emote") {
|
if (ev.getContent().msgtype === "m.emote") {
|
||||||
message = "* " + senderDisplayName + " " + message;
|
message = "* " + senderDisplayName + " " + message;
|
||||||
} else if (ev.getContent().msgtype === "m.image") {
|
} else if (ev.getContent().msgtype === "m.image") {
|
||||||
message = senderDisplayName + " sent an image.";
|
message = _t('%(senderDisplayName)s sent an image.', {senderDisplayName: senderDisplayName});
|
||||||
}
|
}
|
||||||
return message;
|
return message;
|
||||||
}
|
}
|
||||||
|
|
||||||
function textForCallAnswerEvent(event) {
|
function textForCallAnswerEvent(event) {
|
||||||
var senderName = event.sender ? event.sender.name : "Someone";
|
var senderName = event.sender ? event.sender.name : _t('Someone');
|
||||||
var supported = MatrixClientPeg.get().supportsVoip() ? "" : " (not supported by this browser)";
|
var supported = MatrixClientPeg.get().supportsVoip() ? "" : _t('(not supported by this browser)');
|
||||||
return senderName + " answered the call." + supported;
|
return _t('%(senderName)s answered the call.', {senderName: senderName}) + ' ' + supported;
|
||||||
}
|
}
|
||||||
|
|
||||||
function textForCallHangupEvent(event) {
|
function textForCallHangupEvent(event) {
|
||||||
var senderName = event.sender ? event.sender.name : "Someone";
|
var senderName = event.sender ? event.sender.name : _t('Someone');
|
||||||
var supported = MatrixClientPeg.get().supportsVoip() ? "" : " (not supported by this browser)";
|
var supported = MatrixClientPeg.get().supportsVoip() ? "" : _t('(not supported by this browser)');
|
||||||
return senderName + " ended the call." + supported;
|
return _t('%(senderName)s ended the call.', {senderName: senderName}) + ' ' + supported;
|
||||||
}
|
}
|
||||||
|
|
||||||
function textForCallInviteEvent(event) {
|
function textForCallInviteEvent(event) {
|
||||||
var senderName = event.sender ? event.sender.name : "Someone";
|
var senderName = event.sender ? event.sender.name : _t('Someone');
|
||||||
// FIXME: Find a better way to determine this from the event?
|
// FIXME: Find a better way to determine this from the event?
|
||||||
var type = "voice";
|
var type = "voice";
|
||||||
if (event.getContent().offer && event.getContent().offer.sdp &&
|
if (event.getContent().offer && event.getContent().offer.sdp &&
|
||||||
event.getContent().offer.sdp.indexOf('m=video') !== -1) {
|
event.getContent().offer.sdp.indexOf('m=video') !== -1) {
|
||||||
type = "video";
|
type = "video";
|
||||||
}
|
}
|
||||||
var supported = MatrixClientPeg.get().supportsVoip() ? "" : " (not supported by this browser)";
|
var supported = MatrixClientPeg.get().supportsVoip() ? "" : _t('(not supported by this browser)');
|
||||||
return senderName + " placed a " + type + " call." + supported;
|
return _t('%(senderName)s placed a %(callType)s call.', {senderName: senderName, callType: type}) + ' ' + supported;
|
||||||
}
|
}
|
||||||
|
|
||||||
function textForThreePidInviteEvent(event) {
|
function textForThreePidInviteEvent(event) {
|
||||||
var senderName = event.sender ? event.sender.name : event.getSender();
|
var senderName = event.sender ? event.sender.name : event.getSender();
|
||||||
return senderName + " sent an invitation to " + event.getContent().display_name +
|
return _t('%(senderName)s sent an invitation to %(targetDisplayName)s to join the room.', {senderName: senderName, targetDisplayName: event.getContent().display_name});
|
||||||
" to join the room.";
|
|
||||||
}
|
}
|
||||||
|
|
||||||
function textForHistoryVisibilityEvent(event) {
|
function textForHistoryVisibilityEvent(event) {
|
||||||
var senderName = event.sender ? event.sender.name : event.getSender();
|
var senderName = event.sender ? event.sender.name : event.getSender();
|
||||||
var vis = event.getContent().history_visibility;
|
var vis = event.getContent().history_visibility;
|
||||||
var text = senderName + " made future room history visible to ";
|
// XXX: This i18n just isn't going to work for languages with different sentence structure.
|
||||||
|
var text = _t('%(senderName)s made future room history visible to', {senderName: senderName}) + ' ';
|
||||||
if (vis === "invited") {
|
if (vis === "invited") {
|
||||||
text += "all room members, from the point they are invited.";
|
text += _t('all room members, from the point they are invited') + '.';
|
||||||
}
|
}
|
||||||
else if (vis === "joined") {
|
else if (vis === "joined") {
|
||||||
text += "all room members, from the point they joined.";
|
text += _t('all room members, from the point they joined') + '.';
|
||||||
}
|
}
|
||||||
else if (vis === "shared") {
|
else if (vis === "shared") {
|
||||||
text += "all room members.";
|
text += _t('all room members') + '.';
|
||||||
}
|
}
|
||||||
else if (vis === "world_readable") {
|
else if (vis === "world_readable") {
|
||||||
text += "anyone.";
|
text += _t('anyone') + '.';
|
||||||
}
|
}
|
||||||
else {
|
else {
|
||||||
text += " unknown (" + vis + ")";
|
text += ' ' + _t('unknown') + ' (' + vis + ').';
|
||||||
}
|
}
|
||||||
return text;
|
return text;
|
||||||
}
|
}
|
||||||
|
|
||||||
function textForEncryptionEvent(event) {
|
function textForEncryptionEvent(event) {
|
||||||
var senderName = event.sender ? event.sender.name : event.getSender();
|
var senderName = event.sender ? event.sender.name : event.getSender();
|
||||||
return senderName + " turned on end-to-end encryption (algorithm " + event.getContent().algorithm + ")";
|
return _t('%(senderName)s turned on end-to-end encryption (algorithm %(algorithm)s).', {senderName: senderName, algorithm: event.getContent().algorithm});
|
||||||
}
|
}
|
||||||
|
|
||||||
// Currently will only display a change if a user's power level is changed
|
// Currently will only display a change if a user's power level is changed
|
||||||
|
@ -204,6 +209,7 @@ function textForPowerEvent(event) {
|
||||||
}
|
}
|
||||||
);
|
);
|
||||||
let diff = [];
|
let diff = [];
|
||||||
|
// XXX: This is also surely broken for i18n
|
||||||
users.forEach((userId) => {
|
users.forEach((userId) => {
|
||||||
// Previous power level
|
// Previous power level
|
||||||
const from = event.getPrevContent().users[userId];
|
const from = event.getPrevContent().users[userId];
|
||||||
|
@ -211,16 +217,21 @@ function textForPowerEvent(event) {
|
||||||
const to = event.getContent().users[userId];
|
const to = event.getContent().users[userId];
|
||||||
if (to !== from) {
|
if (to !== from) {
|
||||||
diff.push(
|
diff.push(
|
||||||
userId +
|
_t('%(userId)s from %(fromPowerLevel)s to %(toPowerLevel)s', {
|
||||||
' from ' + Roles.textualPowerLevel(from, userDefault) +
|
userId: userId,
|
||||||
' to ' + Roles.textualPowerLevel(to, userDefault)
|
fromPowerLevel: Roles.textualPowerLevel(from, userDefault),
|
||||||
|
toPowerLevel: Roles.textualPowerLevel(to, userDefault)
|
||||||
|
})
|
||||||
);
|
);
|
||||||
}
|
}
|
||||||
});
|
});
|
||||||
if (!diff.length) {
|
if (!diff.length) {
|
||||||
return '';
|
return '';
|
||||||
}
|
}
|
||||||
return senderName + ' changed the power level of ' + diff.join(', ');
|
return _t('%(senderName)s changed the power level of %(powerLevelDiffText)s.', {
|
||||||
|
senderName: senderName,
|
||||||
|
powerLevelDiffText: diff.join(", ")
|
||||||
|
});
|
||||||
}
|
}
|
||||||
|
|
||||||
var handlers = {
|
var handlers = {
|
||||||
|
|
|
@ -22,7 +22,7 @@ let isDialogOpen = false;
|
||||||
|
|
||||||
const onAction = function(payload) {
|
const onAction = function(payload) {
|
||||||
if (payload.action === 'unknown_device_error' && !isDialogOpen) {
|
if (payload.action === 'unknown_device_error' && !isDialogOpen) {
|
||||||
var UnknownDeviceDialog = sdk.getComponent("dialogs.UnknownDeviceDialog");
|
const UnknownDeviceDialog = sdk.getComponent('dialogs.UnknownDeviceDialog');
|
||||||
isDialogOpen = true;
|
isDialogOpen = true;
|
||||||
Modal.createDialog(UnknownDeviceDialog, {
|
Modal.createDialog(UnknownDeviceDialog, {
|
||||||
devices: payload.err.devices,
|
devices: payload.err.devices,
|
||||||
|
@ -33,17 +33,17 @@ const onAction = function(payload) {
|
||||||
// https://github.com/vector-im/riot-web/issues/3148
|
// https://github.com/vector-im/riot-web/issues/3148
|
||||||
console.log('UnknownDeviceDialog closed with '+r);
|
console.log('UnknownDeviceDialog closed with '+r);
|
||||||
},
|
},
|
||||||
}, "mx_Dialog_unknownDevice");
|
}, 'mx_Dialog_unknownDevice');
|
||||||
}
|
}
|
||||||
}
|
};
|
||||||
|
|
||||||
let ref = null;
|
let ref = null;
|
||||||
|
|
||||||
export function startListening () {
|
export function startListening() {
|
||||||
ref = dis.register(onAction);
|
ref = dis.register(onAction);
|
||||||
}
|
}
|
||||||
|
|
||||||
export function stopListening () {
|
export function stopListening() {
|
||||||
if (ref) {
|
if (ref) {
|
||||||
dis.unregister(ref);
|
dis.unregister(ref);
|
||||||
ref = null;
|
ref = null;
|
||||||
|
|
|
@ -25,7 +25,9 @@ module.exports = {
|
||||||
eventTriggersUnreadCount: function(ev) {
|
eventTriggersUnreadCount: function(ev) {
|
||||||
if (ev.sender && ev.sender.userId == MatrixClientPeg.get().credentials.userId) {
|
if (ev.sender && ev.sender.userId == MatrixClientPeg.get().credentials.userId) {
|
||||||
return false;
|
return false;
|
||||||
} else if (ev.getType() == "m.room.member") {
|
} else if (ev.getType() == 'm.room.member') {
|
||||||
|
return false;
|
||||||
|
} else if (ev.getType() == 'm.call.answer' || ev.getType() == 'm.call.hangup') {
|
||||||
return false;
|
return false;
|
||||||
} else if (ev.getType == 'm.room.message' && ev.getContent().msgtype == 'm.notify') {
|
} else if (ev.getType == 'm.room.message' && ev.getContent().msgtype == 'm.notify') {
|
||||||
return false;
|
return false;
|
||||||
|
|
|
@ -32,7 +32,7 @@ class UserActivity {
|
||||||
start() {
|
start() {
|
||||||
document.onmousedown = this._onUserActivity.bind(this);
|
document.onmousedown = this._onUserActivity.bind(this);
|
||||||
document.onmousemove = this._onUserActivity.bind(this);
|
document.onmousemove = this._onUserActivity.bind(this);
|
||||||
document.onkeypress = this._onUserActivity.bind(this);
|
document.onkeydown = this._onUserActivity.bind(this);
|
||||||
// can't use document.scroll here because that's only the document
|
// can't use document.scroll here because that's only the document
|
||||||
// itself being scrolled. Need to use addEventListener's useCapture.
|
// itself being scrolled. Need to use addEventListener's useCapture.
|
||||||
// also this needs to be the wheel event, not scroll, as scroll is
|
// also this needs to be the wheel event, not scroll, as scroll is
|
||||||
|
@ -50,7 +50,7 @@ class UserActivity {
|
||||||
stop() {
|
stop() {
|
||||||
document.onmousedown = undefined;
|
document.onmousedown = undefined;
|
||||||
document.onmousemove = undefined;
|
document.onmousemove = undefined;
|
||||||
document.onkeypress = undefined;
|
document.onkeydown = undefined;
|
||||||
window.removeEventListener('wheel', this._onUserActivity.bind(this),
|
window.removeEventListener('wheel', this._onUserActivity.bind(this),
|
||||||
{ passive: true, capture: true });
|
{ passive: true, capture: true });
|
||||||
}
|
}
|
||||||
|
|
|
@ -14,26 +14,29 @@ See the License for the specific language governing permissions and
|
||||||
limitations under the License.
|
limitations under the License.
|
||||||
*/
|
*/
|
||||||
|
|
||||||
'use strict';
|
import q from 'q';
|
||||||
var q = require("q");
|
import MatrixClientPeg from './MatrixClientPeg';
|
||||||
var MatrixClientPeg = require("./MatrixClientPeg");
|
import Notifier from './Notifier';
|
||||||
var Notifier = require("./Notifier");
|
|
||||||
|
|
||||||
/*
|
/*
|
||||||
* TODO: Make things use this. This is all WIP - see UserSettings.js for usage.
|
* TODO: Make things use this. This is all WIP - see UserSettings.js for usage.
|
||||||
*/
|
*/
|
||||||
|
|
||||||
module.exports = {
|
/*
|
||||||
|
* TODO: Find a way to translate the names of LABS_FEATURES. In other words, guarantee that languages were already loaded before building this array.
|
||||||
|
*/
|
||||||
|
|
||||||
|
export default {
|
||||||
LABS_FEATURES: [
|
LABS_FEATURES: [
|
||||||
{
|
{
|
||||||
name: 'New Composer & Autocomplete',
|
name: "New Composer & Autocomplete",
|
||||||
id: 'rich_text_editor',
|
id: 'rich_text_editor',
|
||||||
default: false,
|
default: false,
|
||||||
},
|
},
|
||||||
],
|
],
|
||||||
|
|
||||||
loadProfileInfo: function() {
|
loadProfileInfo: function() {
|
||||||
var cli = MatrixClientPeg.get();
|
const cli = MatrixClientPeg.get();
|
||||||
return cli.getProfileInfo(cli.credentials.userId);
|
return cli.getProfileInfo(cli.credentials.userId);
|
||||||
},
|
},
|
||||||
|
|
||||||
|
@ -44,7 +47,7 @@ module.exports = {
|
||||||
loadThreePids: function() {
|
loadThreePids: function() {
|
||||||
if (MatrixClientPeg.get().isGuest()) {
|
if (MatrixClientPeg.get().isGuest()) {
|
||||||
return q({
|
return q({
|
||||||
threepids: []
|
threepids: [],
|
||||||
}); // guests can't poke 3pid endpoint
|
}); // guests can't poke 3pid endpoint
|
||||||
}
|
}
|
||||||
return MatrixClientPeg.get().getThreePids();
|
return MatrixClientPeg.get().getThreePids();
|
||||||
|
@ -73,19 +76,19 @@ module.exports = {
|
||||||
Notifier.setAudioEnabled(enable);
|
Notifier.setAudioEnabled(enable);
|
||||||
},
|
},
|
||||||
|
|
||||||
changePassword: function(old_password, new_password) {
|
changePassword: function(oldPassword, newPassword) {
|
||||||
var cli = MatrixClientPeg.get();
|
const cli = MatrixClientPeg.get();
|
||||||
|
|
||||||
var authDict = {
|
const authDict = {
|
||||||
type: 'm.login.password',
|
type: 'm.login.password',
|
||||||
user: cli.credentials.userId,
|
user: cli.credentials.userId,
|
||||||
password: old_password
|
password: oldPassword,
|
||||||
};
|
};
|
||||||
|
|
||||||
return cli.setPassword(authDict, new_password);
|
return cli.setPassword(authDict, newPassword);
|
||||||
},
|
},
|
||||||
|
|
||||||
/**
|
/*
|
||||||
* Returns the email pusher (pusher of type 'email') for a given
|
* Returns the email pusher (pusher of type 'email') for a given
|
||||||
* email address. Email pushers all have the same app ID, so since
|
* email address. Email pushers all have the same app ID, so since
|
||||||
* pushers are unique over (app ID, pushkey), there will be at most
|
* pushers are unique over (app ID, pushkey), there will be at most
|
||||||
|
@ -95,8 +98,8 @@ module.exports = {
|
||||||
if (pushers === undefined) {
|
if (pushers === undefined) {
|
||||||
return undefined;
|
return undefined;
|
||||||
}
|
}
|
||||||
for (var i = 0; i < pushers.length; ++i) {
|
for (let i = 0; i < pushers.length; ++i) {
|
||||||
if (pushers[i].kind == 'email' && pushers[i].pushkey == address) {
|
if (pushers[i].kind === 'email' && pushers[i].pushkey === address) {
|
||||||
return pushers[i];
|
return pushers[i];
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
@ -110,7 +113,7 @@ module.exports = {
|
||||||
addEmailPusher: function(address, data) {
|
addEmailPusher: function(address, data) {
|
||||||
return MatrixClientPeg.get().setPusher({
|
return MatrixClientPeg.get().setPusher({
|
||||||
kind: 'email',
|
kind: 'email',
|
||||||
app_id: "m.email",
|
app_id: 'm.email',
|
||||||
pushkey: address,
|
pushkey: address,
|
||||||
app_display_name: 'Email Notifications',
|
app_display_name: 'Email Notifications',
|
||||||
device_display_name: address,
|
device_display_name: address,
|
||||||
|
@ -121,46 +124,46 @@ module.exports = {
|
||||||
},
|
},
|
||||||
|
|
||||||
getUrlPreviewsDisabled: function() {
|
getUrlPreviewsDisabled: function() {
|
||||||
var event = MatrixClientPeg.get().getAccountData("org.matrix.preview_urls");
|
const event = MatrixClientPeg.get().getAccountData('org.matrix.preview_urls');
|
||||||
return (event && event.getContent().disable);
|
return (event && event.getContent().disable);
|
||||||
},
|
},
|
||||||
|
|
||||||
setUrlPreviewsDisabled: function(disabled) {
|
setUrlPreviewsDisabled: function(disabled) {
|
||||||
// FIXME: handle errors
|
// FIXME: handle errors
|
||||||
return MatrixClientPeg.get().setAccountData("org.matrix.preview_urls", {
|
return MatrixClientPeg.get().setAccountData('org.matrix.preview_urls', {
|
||||||
disable: disabled
|
disable: disabled,
|
||||||
});
|
});
|
||||||
},
|
},
|
||||||
|
|
||||||
getSyncedSettings: function() {
|
getSyncedSettings: function() {
|
||||||
var event = MatrixClientPeg.get().getAccountData("im.vector.web.settings");
|
const event = MatrixClientPeg.get().getAccountData('im.vector.web.settings');
|
||||||
return event ? event.getContent() : {};
|
return event ? event.getContent() : {};
|
||||||
},
|
},
|
||||||
|
|
||||||
getSyncedSetting: function(type, defaultValue = null) {
|
getSyncedSetting: function(type, defaultValue = null) {
|
||||||
var settings = this.getSyncedSettings();
|
const settings = this.getSyncedSettings();
|
||||||
return settings.hasOwnProperty(type) ? settings[type] : null;
|
return settings.hasOwnProperty(type) ? settings[type] : defaultValue;
|
||||||
},
|
},
|
||||||
|
|
||||||
setSyncedSetting: function(type, value) {
|
setSyncedSetting: function(type, value) {
|
||||||
var settings = this.getSyncedSettings();
|
const settings = this.getSyncedSettings();
|
||||||
settings[type] = value;
|
settings[type] = value;
|
||||||
// FIXME: handle errors
|
// FIXME: handle errors
|
||||||
return MatrixClientPeg.get().setAccountData("im.vector.web.settings", settings);
|
return MatrixClientPeg.get().setAccountData('im.vector.web.settings', settings);
|
||||||
},
|
},
|
||||||
|
|
||||||
getLocalSettings: function() {
|
getLocalSettings: function() {
|
||||||
var localSettingsString = localStorage.getItem('mx_local_settings') || '{}';
|
const localSettingsString = localStorage.getItem('mx_local_settings') || '{}';
|
||||||
return JSON.parse(localSettingsString);
|
return JSON.parse(localSettingsString);
|
||||||
},
|
},
|
||||||
|
|
||||||
getLocalSetting: function(type, defaultValue = null) {
|
getLocalSetting: function(type, defaultValue = null) {
|
||||||
var settings = this.getLocalSettings();
|
const settings = this.getLocalSettings();
|
||||||
return settings.hasOwnProperty(type) ? settings[type] : null;
|
return settings.hasOwnProperty(type) ? settings[type] : defaultValue;
|
||||||
},
|
},
|
||||||
|
|
||||||
setLocalSetting: function(type, value) {
|
setLocalSetting: function(type, value) {
|
||||||
var settings = this.getLocalSettings();
|
const settings = this.getLocalSettings();
|
||||||
settings[type] = value;
|
settings[type] = value;
|
||||||
// FIXME: handle errors
|
// FIXME: handle errors
|
||||||
localStorage.setItem('mx_local_settings', JSON.stringify(settings));
|
localStorage.setItem('mx_local_settings', JSON.stringify(settings));
|
||||||
|
@ -171,8 +174,8 @@ module.exports = {
|
||||||
if (MatrixClientPeg.get().isGuest()) return false;
|
if (MatrixClientPeg.get().isGuest()) return false;
|
||||||
|
|
||||||
if (localStorage.getItem(`mx_labs_feature_${feature}`) === null) {
|
if (localStorage.getItem(`mx_labs_feature_${feature}`) === null) {
|
||||||
for (var i = 0; i < this.LABS_FEATURES.length; i++) {
|
for (let i = 0; i < this.LABS_FEATURES.length; i++) {
|
||||||
var f = this.LABS_FEATURES[i];
|
const f = this.LABS_FEATURES[i];
|
||||||
if (f.id === feature) {
|
if (f.id === feature) {
|
||||||
return f.default;
|
return f.default;
|
||||||
}
|
}
|
||||||
|
@ -183,5 +186,5 @@ module.exports = {
|
||||||
|
|
||||||
setFeatureEnabled: function(feature: string, enabled: boolean) {
|
setFeatureEnabled: function(feature: string, enabled: boolean) {
|
||||||
localStorage.setItem(`mx_labs_feature_${feature}`, enabled);
|
localStorage.setItem(`mx_labs_feature_${feature}`, enabled);
|
||||||
}
|
},
|
||||||
};
|
};
|
||||||
|
|
|
@ -15,6 +15,7 @@ limitations under the License.
|
||||||
*/
|
*/
|
||||||
|
|
||||||
var MatrixClientPeg = require("./MatrixClientPeg");
|
var MatrixClientPeg = require("./MatrixClientPeg");
|
||||||
|
import { _t } from './languageHandler';
|
||||||
|
|
||||||
module.exports = {
|
module.exports = {
|
||||||
usersTypingApartFromMe: function(room) {
|
usersTypingApartFromMe: function(room) {
|
||||||
|
@ -56,18 +57,18 @@ module.exports = {
|
||||||
if (whoIsTyping.length == 0) {
|
if (whoIsTyping.length == 0) {
|
||||||
return '';
|
return '';
|
||||||
} else if (whoIsTyping.length == 1) {
|
} else if (whoIsTyping.length == 1) {
|
||||||
return whoIsTyping[0].name + ' is typing';
|
return _t('%(displayName)s is typing', {displayName: whoIsTyping[0].name});
|
||||||
}
|
}
|
||||||
const names = whoIsTyping.map(function(m) {
|
const names = whoIsTyping.map(function(m) {
|
||||||
return m.name;
|
return m.name;
|
||||||
});
|
});
|
||||||
if (othersCount) {
|
if (othersCount==1) {
|
||||||
const other = ' other' + (othersCount > 1 ? 's' : '');
|
return _t('%(names)s and one other are typing', {names: names.slice(0, limit - 1).join(', ')});
|
||||||
return names.slice(0, limit - 1).join(', ') + ' and ' +
|
} else if (othersCount>1) {
|
||||||
othersCount + other + ' are typing';
|
return _t('%(names)s and %(count)s others are typing', {names: names.slice(0, limit - 1).join(', '), count: othersCount});
|
||||||
} else {
|
} else {
|
||||||
const lastPerson = names.pop();
|
const lastPerson = names.pop();
|
||||||
return names.join(', ') + ' and ' + lastPerson + ' are typing';
|
return _t('%(names)s and %(lastPerson)s are typing', {names: names.join(', '), lastPerson: lastPerson});
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
};
|
};
|
||||||
|
|
|
@ -15,6 +15,7 @@ limitations under the License.
|
||||||
*/
|
*/
|
||||||
|
|
||||||
var React = require("react");
|
var React = require("react");
|
||||||
|
import { _t } from '../../../languageHandler';
|
||||||
var sdk = require('../../../index');
|
var sdk = require('../../../index');
|
||||||
var MatrixClientPeg = require("../../../MatrixClientPeg");
|
var MatrixClientPeg = require("../../../MatrixClientPeg");
|
||||||
|
|
||||||
|
@ -78,33 +79,33 @@ module.exports = React.createClass({
|
||||||
_renderDeviceInfo: function() {
|
_renderDeviceInfo: function() {
|
||||||
var device = this.state.device;
|
var device = this.state.device;
|
||||||
if (!device) {
|
if (!device) {
|
||||||
return (<i>unknown device</i>);
|
return (<i>{ _t('unknown device') }</i>);
|
||||||
}
|
}
|
||||||
|
|
||||||
var verificationStatus = (<b>NOT verified</b>);
|
var verificationStatus = (<b>{ _t('NOT verified') }</b>);
|
||||||
if (device.isBlocked()) {
|
if (device.isBlocked()) {
|
||||||
verificationStatus = (<b>Blacklisted</b>);
|
verificationStatus = (<b>{ _t('Blacklisted') }</b>);
|
||||||
} else if (device.isVerified()) {
|
} else if (device.isVerified()) {
|
||||||
verificationStatus = "verified";
|
verificationStatus = _t('verified');
|
||||||
}
|
}
|
||||||
|
|
||||||
return (
|
return (
|
||||||
<table>
|
<table>
|
||||||
<tbody>
|
<tbody>
|
||||||
<tr>
|
<tr>
|
||||||
<td>Name</td>
|
<td>{ _t('Name') }</td>
|
||||||
<td>{ device.getDisplayName() }</td>
|
<td>{ device.getDisplayName() }</td>
|
||||||
</tr>
|
</tr>
|
||||||
<tr>
|
<tr>
|
||||||
<td>Device ID</td>
|
<td>{ _t('Device ID') }</td>
|
||||||
<td><code>{ device.deviceId }</code></td>
|
<td><code>{ device.deviceId }</code></td>
|
||||||
</tr>
|
</tr>
|
||||||
<tr>
|
<tr>
|
||||||
<td>Verification</td>
|
<td>{ _t('Verification') }</td>
|
||||||
<td>{ verificationStatus }</td>
|
<td>{ verificationStatus }</td>
|
||||||
</tr>
|
</tr>
|
||||||
<tr>
|
<tr>
|
||||||
<td>Ed25519 fingerprint</td>
|
<td>{ _t('Ed25519 fingerprint') }</td>
|
||||||
<td><code>{device.getFingerprint()}</code></td>
|
<td><code>{device.getFingerprint()}</code></td>
|
||||||
</tr>
|
</tr>
|
||||||
</tbody>
|
</tbody>
|
||||||
|
@ -119,32 +120,32 @@ module.exports = React.createClass({
|
||||||
<table>
|
<table>
|
||||||
<tbody>
|
<tbody>
|
||||||
<tr>
|
<tr>
|
||||||
<td>User ID</td>
|
<td>{ _t('User ID') }</td>
|
||||||
<td>{ event.getSender() }</td>
|
<td>{ event.getSender() }</td>
|
||||||
</tr>
|
</tr>
|
||||||
<tr>
|
<tr>
|
||||||
<td>Curve25519 identity key</td>
|
<td>{ _t('Curve25519 identity key') }</td>
|
||||||
<td><code>{ event.getSenderKey() || <i>none</i> }</code></td>
|
<td><code>{ event.getSenderKey() || <i>{ _t('none') }</i> }</code></td>
|
||||||
</tr>
|
</tr>
|
||||||
<tr>
|
<tr>
|
||||||
<td>Claimed Ed25519 fingerprint key</td>
|
<td>{ _t('Claimed Ed25519 fingerprint key') }</td>
|
||||||
<td><code>{ event.getKeysClaimed().ed25519 || <i>none</i> }</code></td>
|
<td><code>{ event.getKeysClaimed().ed25519 || <i>{ _t('none') }</i> }</code></td>
|
||||||
</tr>
|
</tr>
|
||||||
<tr>
|
<tr>
|
||||||
<td>Algorithm</td>
|
<td>{ _t('Algorithm') }</td>
|
||||||
<td>{ event.getWireContent().algorithm || <i>unencrypted</i> }</td>
|
<td>{ event.getWireContent().algorithm || <i>{ _t('unencrypted') }</i> }</td>
|
||||||
</tr>
|
</tr>
|
||||||
{
|
{
|
||||||
event.getContent().msgtype === 'm.bad.encrypted' ? (
|
event.getContent().msgtype === 'm.bad.encrypted' ? (
|
||||||
<tr>
|
<tr>
|
||||||
<td>Decryption error</td>
|
<td>{ _t('Decryption error') }</td>
|
||||||
<td>{ event.getContent().body }</td>
|
<td>{ event.getContent().body }</td>
|
||||||
</tr>
|
</tr>
|
||||||
) : null
|
) : null
|
||||||
}
|
}
|
||||||
<tr>
|
<tr>
|
||||||
<td>Session ID</td>
|
<td>{ _t('Session ID') }</td>
|
||||||
<td><code>{ event.getWireContent().session_id || <i>none</i> }</code></td>
|
<td><code>{ event.getWireContent().session_id || <i>{ _t('none') }</i> }</code></td>
|
||||||
</tr>
|
</tr>
|
||||||
</tbody>
|
</tbody>
|
||||||
</table>
|
</table>
|
||||||
|
@ -166,18 +167,18 @@ module.exports = React.createClass({
|
||||||
return (
|
return (
|
||||||
<div className="mx_EncryptedEventDialog" onKeyDown={ this.onKeyDown }>
|
<div className="mx_EncryptedEventDialog" onKeyDown={ this.onKeyDown }>
|
||||||
<div className="mx_Dialog_title">
|
<div className="mx_Dialog_title">
|
||||||
End-to-end encryption information
|
{ _t('End-to-end encryption information') }
|
||||||
</div>
|
</div>
|
||||||
<div className="mx_Dialog_content">
|
<div className="mx_Dialog_content">
|
||||||
<h4>Event information</h4>
|
<h4>{ _t('Event information') }</h4>
|
||||||
{this._renderEventInfo()}
|
{this._renderEventInfo()}
|
||||||
|
|
||||||
<h4>Sender device information</h4>
|
<h4>{ _t('Sender device information') }</h4>
|
||||||
{this._renderDeviceInfo()}
|
{this._renderDeviceInfo()}
|
||||||
</div>
|
</div>
|
||||||
<div className="mx_Dialog_buttons">
|
<div className="mx_Dialog_buttons">
|
||||||
<button className="mx_Dialog_primary" onClick={ this.props.onFinished } autoFocus={ true }>
|
<button className="mx_Dialog_primary" onClick={ this.props.onFinished } autoFocus={ true }>
|
||||||
OK
|
{ _t('OK') }
|
||||||
</button>
|
</button>
|
||||||
{buttons}
|
{buttons}
|
||||||
</div>
|
</div>
|
||||||
|
|
|
@ -1,8 +1,10 @@
|
||||||
import React from 'react';
|
import React from 'react';
|
||||||
|
import { _t } from '../languageHandler';
|
||||||
import AutocompleteProvider from './AutocompleteProvider';
|
import AutocompleteProvider from './AutocompleteProvider';
|
||||||
import Fuse from 'fuse.js';
|
import Fuse from 'fuse.js';
|
||||||
import {TextualCompletion} from './Components';
|
import {TextualCompletion} from './Components';
|
||||||
|
|
||||||
|
// Warning: Since the description string will be translated in _t(result.description), all these strings below must be in i18n/strings/en_EN.json file
|
||||||
const COMMANDS = [
|
const COMMANDS = [
|
||||||
{
|
{
|
||||||
command: '/me',
|
command: '/me',
|
||||||
|
@ -68,7 +70,7 @@ export default class CommandProvider extends AutocompleteProvider {
|
||||||
component: (<TextualCompletion
|
component: (<TextualCompletion
|
||||||
title={result.command}
|
title={result.command}
|
||||||
subtitle={result.args}
|
subtitle={result.args}
|
||||||
description={result.description}
|
description={ t_(result.description) }
|
||||||
/>),
|
/>),
|
||||||
range,
|
range,
|
||||||
};
|
};
|
||||||
|
@ -78,7 +80,7 @@ export default class CommandProvider extends AutocompleteProvider {
|
||||||
}
|
}
|
||||||
|
|
||||||
getName() {
|
getName() {
|
||||||
return '*️⃣ Commands';
|
return '*️⃣ ' + _t('Commands');
|
||||||
}
|
}
|
||||||
|
|
||||||
static getInstance(): CommandProvider {
|
static getInstance(): CommandProvider {
|
||||||
|
|
|
@ -1,4 +1,5 @@
|
||||||
import React from 'react';
|
import React from 'react';
|
||||||
|
import { _t } from '../languageHandler';
|
||||||
import AutocompleteProvider from './AutocompleteProvider';
|
import AutocompleteProvider from './AutocompleteProvider';
|
||||||
import {emojioneList, shortnameToImage, shortnameToUnicode} from 'emojione';
|
import {emojioneList, shortnameToImage, shortnameToUnicode} from 'emojione';
|
||||||
import Fuse from 'fuse.js';
|
import Fuse from 'fuse.js';
|
||||||
|
@ -14,7 +15,7 @@ let instance = null;
|
||||||
export default class EmojiProvider extends AutocompleteProvider {
|
export default class EmojiProvider extends AutocompleteProvider {
|
||||||
constructor() {
|
constructor() {
|
||||||
super(EMOJI_REGEX);
|
super(EMOJI_REGEX);
|
||||||
this.fuse = new Fuse(EMOJI_SHORTNAMES);
|
this.fuse = new Fuse(EMOJI_SHORTNAMES, {});
|
||||||
}
|
}
|
||||||
|
|
||||||
async getCompletions(query: string, selection: SelectionRange) {
|
async getCompletions(query: string, selection: SelectionRange) {
|
||||||
|
@ -39,7 +40,7 @@ export default class EmojiProvider extends AutocompleteProvider {
|
||||||
}
|
}
|
||||||
|
|
||||||
getName() {
|
getName() {
|
||||||
return '😃 Emoji';
|
return '😃 ' + _t('Emoji');
|
||||||
}
|
}
|
||||||
|
|
||||||
static getInstance() {
|
static getInstance() {
|
||||||
|
|
|
@ -1,4 +1,5 @@
|
||||||
import React from 'react';
|
import React from 'react';
|
||||||
|
import { _t } from '../languageHandler';
|
||||||
import AutocompleteProvider from './AutocompleteProvider';
|
import AutocompleteProvider from './AutocompleteProvider';
|
||||||
import MatrixClientPeg from '../MatrixClientPeg';
|
import MatrixClientPeg from '../MatrixClientPeg';
|
||||||
import Fuse from 'fuse.js';
|
import Fuse from 'fuse.js';
|
||||||
|
@ -50,7 +51,7 @@ export default class RoomProvider extends AutocompleteProvider {
|
||||||
}
|
}
|
||||||
|
|
||||||
getName() {
|
getName() {
|
||||||
return '💬 Rooms';
|
return '💬 ' + _t('Rooms');
|
||||||
}
|
}
|
||||||
|
|
||||||
static getInstance() {
|
static getInstance() {
|
||||||
|
|
|
@ -1,4 +1,5 @@
|
||||||
import React from 'react';
|
import React from 'react';
|
||||||
|
import { _t } from '../languageHandler';
|
||||||
import AutocompleteProvider from './AutocompleteProvider';
|
import AutocompleteProvider from './AutocompleteProvider';
|
||||||
import Q from 'q';
|
import Q from 'q';
|
||||||
import Fuse from 'fuse.js';
|
import Fuse from 'fuse.js';
|
||||||
|
@ -51,7 +52,7 @@ export default class UserProvider extends AutocompleteProvider {
|
||||||
}
|
}
|
||||||
|
|
||||||
getName() {
|
getName() {
|
||||||
return '👥 Users';
|
return '👥 ' + _t('Users');
|
||||||
}
|
}
|
||||||
|
|
||||||
setUserList(users) {
|
setUserList(users) {
|
||||||
|
|
|
@ -1,253 +0,0 @@
|
||||||
/*
|
|
||||||
Copyright 2015, 2016 OpenMarket Ltd
|
|
||||||
|
|
||||||
Licensed under the Apache License, Version 2.0 (the "License");
|
|
||||||
you may not use this file except in compliance with the License.
|
|
||||||
You may obtain a copy of the License at
|
|
||||||
|
|
||||||
http://www.apache.org/licenses/LICENSE-2.0
|
|
||||||
|
|
||||||
Unless required by applicable law or agreed to in writing, software
|
|
||||||
distributed under the License is distributed on an "AS IS" BASIS,
|
|
||||||
WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
|
||||||
See the License for the specific language governing permissions and
|
|
||||||
limitations under the License.
|
|
||||||
*/
|
|
||||||
|
|
||||||
/*
|
|
||||||
* THIS FILE IS AUTO-GENERATED
|
|
||||||
* You can edit it you like, but your changes will be overwritten,
|
|
||||||
* so you'd just be trying to swim upstream like a salmon.
|
|
||||||
* You are not a salmon.
|
|
||||||
*
|
|
||||||
* To update it, run:
|
|
||||||
* ./reskindex.js -h header
|
|
||||||
*/
|
|
||||||
|
|
||||||
module.exports.components = {};
|
|
||||||
import structures$ContextualMenu from './components/structures/ContextualMenu';
|
|
||||||
structures$ContextualMenu && (module.exports.components['structures.ContextualMenu'] = structures$ContextualMenu);
|
|
||||||
import structures$CreateRoom from './components/structures/CreateRoom';
|
|
||||||
structures$CreateRoom && (module.exports.components['structures.CreateRoom'] = structures$CreateRoom);
|
|
||||||
import structures$FilePanel from './components/structures/FilePanel';
|
|
||||||
structures$FilePanel && (module.exports.components['structures.FilePanel'] = structures$FilePanel);
|
|
||||||
import structures$InteractiveAuth from './components/structures/InteractiveAuth';
|
|
||||||
structures$InteractiveAuth && (module.exports.components['structures.InteractiveAuth'] = structures$InteractiveAuth);
|
|
||||||
import structures$LoggedInView from './components/structures/LoggedInView';
|
|
||||||
structures$LoggedInView && (module.exports.components['structures.LoggedInView'] = structures$LoggedInView);
|
|
||||||
import structures$MatrixChat from './components/structures/MatrixChat';
|
|
||||||
structures$MatrixChat && (module.exports.components['structures.MatrixChat'] = structures$MatrixChat);
|
|
||||||
import structures$MessagePanel from './components/structures/MessagePanel';
|
|
||||||
structures$MessagePanel && (module.exports.components['structures.MessagePanel'] = structures$MessagePanel);
|
|
||||||
import structures$NotificationPanel from './components/structures/NotificationPanel';
|
|
||||||
structures$NotificationPanel && (module.exports.components['structures.NotificationPanel'] = structures$NotificationPanel);
|
|
||||||
import structures$RoomStatusBar from './components/structures/RoomStatusBar';
|
|
||||||
structures$RoomStatusBar && (module.exports.components['structures.RoomStatusBar'] = structures$RoomStatusBar);
|
|
||||||
import structures$RoomView from './components/structures/RoomView';
|
|
||||||
structures$RoomView && (module.exports.components['structures.RoomView'] = structures$RoomView);
|
|
||||||
import structures$ScrollPanel from './components/structures/ScrollPanel';
|
|
||||||
structures$ScrollPanel && (module.exports.components['structures.ScrollPanel'] = structures$ScrollPanel);
|
|
||||||
import structures$TimelinePanel from './components/structures/TimelinePanel';
|
|
||||||
structures$TimelinePanel && (module.exports.components['structures.TimelinePanel'] = structures$TimelinePanel);
|
|
||||||
import structures$UploadBar from './components/structures/UploadBar';
|
|
||||||
structures$UploadBar && (module.exports.components['structures.UploadBar'] = structures$UploadBar);
|
|
||||||
import structures$UserSettings from './components/structures/UserSettings';
|
|
||||||
structures$UserSettings && (module.exports.components['structures.UserSettings'] = structures$UserSettings);
|
|
||||||
import structures$login$ForgotPassword from './components/structures/login/ForgotPassword';
|
|
||||||
structures$login$ForgotPassword && (module.exports.components['structures.login.ForgotPassword'] = structures$login$ForgotPassword);
|
|
||||||
import structures$login$Login from './components/structures/login/Login';
|
|
||||||
structures$login$Login && (module.exports.components['structures.login.Login'] = structures$login$Login);
|
|
||||||
import structures$login$PostRegistration from './components/structures/login/PostRegistration';
|
|
||||||
structures$login$PostRegistration && (module.exports.components['structures.login.PostRegistration'] = structures$login$PostRegistration);
|
|
||||||
import structures$login$Registration from './components/structures/login/Registration';
|
|
||||||
structures$login$Registration && (module.exports.components['structures.login.Registration'] = structures$login$Registration);
|
|
||||||
import views$avatars$BaseAvatar from './components/views/avatars/BaseAvatar';
|
|
||||||
views$avatars$BaseAvatar && (module.exports.components['views.avatars.BaseAvatar'] = views$avatars$BaseAvatar);
|
|
||||||
import views$avatars$MemberAvatar from './components/views/avatars/MemberAvatar';
|
|
||||||
views$avatars$MemberAvatar && (module.exports.components['views.avatars.MemberAvatar'] = views$avatars$MemberAvatar);
|
|
||||||
import views$avatars$RoomAvatar from './components/views/avatars/RoomAvatar';
|
|
||||||
views$avatars$RoomAvatar && (module.exports.components['views.avatars.RoomAvatar'] = views$avatars$RoomAvatar);
|
|
||||||
import views$create_room$CreateRoomButton from './components/views/create_room/CreateRoomButton';
|
|
||||||
views$create_room$CreateRoomButton && (module.exports.components['views.create_room.CreateRoomButton'] = views$create_room$CreateRoomButton);
|
|
||||||
import views$create_room$Presets from './components/views/create_room/Presets';
|
|
||||||
views$create_room$Presets && (module.exports.components['views.create_room.Presets'] = views$create_room$Presets);
|
|
||||||
import views$create_room$RoomAlias from './components/views/create_room/RoomAlias';
|
|
||||||
views$create_room$RoomAlias && (module.exports.components['views.create_room.RoomAlias'] = views$create_room$RoomAlias);
|
|
||||||
import views$dialogs$BaseDialog from './components/views/dialogs/BaseDialog';
|
|
||||||
views$dialogs$BaseDialog && (module.exports.components['views.dialogs.BaseDialog'] = views$dialogs$BaseDialog);
|
|
||||||
import views$dialogs$ChatCreateOrReuseDialog from './components/views/dialogs/ChatCreateOrReuseDialog';
|
|
||||||
views$dialogs$ChatCreateOrReuseDialog && (module.exports.components['views.dialogs.ChatCreateOrReuseDialog'] = views$dialogs$ChatCreateOrReuseDialog);
|
|
||||||
import views$dialogs$ChatInviteDialog from './components/views/dialogs/ChatInviteDialog';
|
|
||||||
views$dialogs$ChatInviteDialog && (module.exports.components['views.dialogs.ChatInviteDialog'] = views$dialogs$ChatInviteDialog);
|
|
||||||
import views$dialogs$ConfirmRedactDialog from './components/views/dialogs/ConfirmRedactDialog';
|
|
||||||
views$dialogs$ConfirmRedactDialog && (module.exports.components['views.dialogs.ConfirmRedactDialog'] = views$dialogs$ConfirmRedactDialog);
|
|
||||||
import views$dialogs$ConfirmUserActionDialog from './components/views/dialogs/ConfirmUserActionDialog';
|
|
||||||
views$dialogs$ConfirmUserActionDialog && (module.exports.components['views.dialogs.ConfirmUserActionDialog'] = views$dialogs$ConfirmUserActionDialog);
|
|
||||||
import views$dialogs$DeactivateAccountDialog from './components/views/dialogs/DeactivateAccountDialog';
|
|
||||||
views$dialogs$DeactivateAccountDialog && (module.exports.components['views.dialogs.DeactivateAccountDialog'] = views$dialogs$DeactivateAccountDialog);
|
|
||||||
import views$dialogs$ErrorDialog from './components/views/dialogs/ErrorDialog';
|
|
||||||
views$dialogs$ErrorDialog && (module.exports.components['views.dialogs.ErrorDialog'] = views$dialogs$ErrorDialog);
|
|
||||||
import views$dialogs$InteractiveAuthDialog from './components/views/dialogs/InteractiveAuthDialog';
|
|
||||||
views$dialogs$InteractiveAuthDialog && (module.exports.components['views.dialogs.InteractiveAuthDialog'] = views$dialogs$InteractiveAuthDialog);
|
|
||||||
import views$dialogs$NeedToRegisterDialog from './components/views/dialogs/NeedToRegisterDialog';
|
|
||||||
views$dialogs$NeedToRegisterDialog && (module.exports.components['views.dialogs.NeedToRegisterDialog'] = views$dialogs$NeedToRegisterDialog);
|
|
||||||
import views$dialogs$QuestionDialog from './components/views/dialogs/QuestionDialog';
|
|
||||||
views$dialogs$QuestionDialog && (module.exports.components['views.dialogs.QuestionDialog'] = views$dialogs$QuestionDialog);
|
|
||||||
import views$dialogs$SessionRestoreErrorDialog from './components/views/dialogs/SessionRestoreErrorDialog';
|
|
||||||
views$dialogs$SessionRestoreErrorDialog && (module.exports.components['views.dialogs.SessionRestoreErrorDialog'] = views$dialogs$SessionRestoreErrorDialog);
|
|
||||||
import views$dialogs$SetDisplayNameDialog from './components/views/dialogs/SetDisplayNameDialog';
|
|
||||||
views$dialogs$SetDisplayNameDialog && (module.exports.components['views.dialogs.SetDisplayNameDialog'] = views$dialogs$SetDisplayNameDialog);
|
|
||||||
import views$dialogs$TextInputDialog from './components/views/dialogs/TextInputDialog';
|
|
||||||
views$dialogs$TextInputDialog && (module.exports.components['views.dialogs.TextInputDialog'] = views$dialogs$TextInputDialog);
|
|
||||||
import views$dialogs$UnknownDeviceDialog from './components/views/dialogs/UnknownDeviceDialog';
|
|
||||||
views$dialogs$UnknownDeviceDialog && (module.exports.components['views.dialogs.UnknownDeviceDialog'] = views$dialogs$UnknownDeviceDialog);
|
|
||||||
import views$elements$AccessibleButton from './components/views/elements/AccessibleButton';
|
|
||||||
views$elements$AccessibleButton && (module.exports.components['views.elements.AccessibleButton'] = views$elements$AccessibleButton);
|
|
||||||
import views$elements$AddressSelector from './components/views/elements/AddressSelector';
|
|
||||||
views$elements$AddressSelector && (module.exports.components['views.elements.AddressSelector'] = views$elements$AddressSelector);
|
|
||||||
import views$elements$AddressTile from './components/views/elements/AddressTile';
|
|
||||||
views$elements$AddressTile && (module.exports.components['views.elements.AddressTile'] = views$elements$AddressTile);
|
|
||||||
import views$elements$DeviceVerifyButtons from './components/views/elements/DeviceVerifyButtons';
|
|
||||||
views$elements$DeviceVerifyButtons && (module.exports.components['views.elements.DeviceVerifyButtons'] = views$elements$DeviceVerifyButtons);
|
|
||||||
import views$elements$DirectorySearchBox from './components/views/elements/DirectorySearchBox';
|
|
||||||
views$elements$DirectorySearchBox && (module.exports.components['views.elements.DirectorySearchBox'] = views$elements$DirectorySearchBox);
|
|
||||||
import views$elements$Dropdown from './components/views/elements/Dropdown';
|
|
||||||
views$elements$Dropdown && (module.exports.components['views.elements.Dropdown'] = views$elements$Dropdown);
|
|
||||||
import views$elements$EditableText from './components/views/elements/EditableText';
|
|
||||||
views$elements$EditableText && (module.exports.components['views.elements.EditableText'] = views$elements$EditableText);
|
|
||||||
import views$elements$EditableTextContainer from './components/views/elements/EditableTextContainer';
|
|
||||||
views$elements$EditableTextContainer && (module.exports.components['views.elements.EditableTextContainer'] = views$elements$EditableTextContainer);
|
|
||||||
import views$elements$EmojiText from './components/views/elements/EmojiText';
|
|
||||||
views$elements$EmojiText && (module.exports.components['views.elements.EmojiText'] = views$elements$EmojiText);
|
|
||||||
import views$elements$MemberEventListSummary from './components/views/elements/MemberEventListSummary';
|
|
||||||
views$elements$MemberEventListSummary && (module.exports.components['views.elements.MemberEventListSummary'] = views$elements$MemberEventListSummary);
|
|
||||||
import views$elements$PowerSelector from './components/views/elements/PowerSelector';
|
|
||||||
views$elements$PowerSelector && (module.exports.components['views.elements.PowerSelector'] = views$elements$PowerSelector);
|
|
||||||
import views$elements$ProgressBar from './components/views/elements/ProgressBar';
|
|
||||||
views$elements$ProgressBar && (module.exports.components['views.elements.ProgressBar'] = views$elements$ProgressBar);
|
|
||||||
import views$elements$TintableSvg from './components/views/elements/TintableSvg';
|
|
||||||
views$elements$TintableSvg && (module.exports.components['views.elements.TintableSvg'] = views$elements$TintableSvg);
|
|
||||||
import views$elements$TruncatedList from './components/views/elements/TruncatedList';
|
|
||||||
views$elements$TruncatedList && (module.exports.components['views.elements.TruncatedList'] = views$elements$TruncatedList);
|
|
||||||
import views$elements$UserSelector from './components/views/elements/UserSelector';
|
|
||||||
views$elements$UserSelector && (module.exports.components['views.elements.UserSelector'] = views$elements$UserSelector);
|
|
||||||
import views$login$CaptchaForm from './components/views/login/CaptchaForm';
|
|
||||||
views$login$CaptchaForm && (module.exports.components['views.login.CaptchaForm'] = views$login$CaptchaForm);
|
|
||||||
import views$login$CasLogin from './components/views/login/CasLogin';
|
|
||||||
views$login$CasLogin && (module.exports.components['views.login.CasLogin'] = views$login$CasLogin);
|
|
||||||
import views$login$CountryDropdown from './components/views/login/CountryDropdown';
|
|
||||||
views$login$CountryDropdown && (module.exports.components['views.login.CountryDropdown'] = views$login$CountryDropdown);
|
|
||||||
import views$login$CustomServerDialog from './components/views/login/CustomServerDialog';
|
|
||||||
views$login$CustomServerDialog && (module.exports.components['views.login.CustomServerDialog'] = views$login$CustomServerDialog);
|
|
||||||
import views$login$InteractiveAuthEntryComponents from './components/views/login/InteractiveAuthEntryComponents';
|
|
||||||
views$login$InteractiveAuthEntryComponents && (module.exports.components['views.login.InteractiveAuthEntryComponents'] = views$login$InteractiveAuthEntryComponents);
|
|
||||||
import views$login$LoginFooter from './components/views/login/LoginFooter';
|
|
||||||
views$login$LoginFooter && (module.exports.components['views.login.LoginFooter'] = views$login$LoginFooter);
|
|
||||||
import views$login$LoginHeader from './components/views/login/LoginHeader';
|
|
||||||
views$login$LoginHeader && (module.exports.components['views.login.LoginHeader'] = views$login$LoginHeader);
|
|
||||||
import views$login$PasswordLogin from './components/views/login/PasswordLogin';
|
|
||||||
views$login$PasswordLogin && (module.exports.components['views.login.PasswordLogin'] = views$login$PasswordLogin);
|
|
||||||
import views$login$RegistrationForm from './components/views/login/RegistrationForm';
|
|
||||||
views$login$RegistrationForm && (module.exports.components['views.login.RegistrationForm'] = views$login$RegistrationForm);
|
|
||||||
import views$login$ServerConfig from './components/views/login/ServerConfig';
|
|
||||||
views$login$ServerConfig && (module.exports.components['views.login.ServerConfig'] = views$login$ServerConfig);
|
|
||||||
import views$messages$MAudioBody from './components/views/messages/MAudioBody';
|
|
||||||
views$messages$MAudioBody && (module.exports.components['views.messages.MAudioBody'] = views$messages$MAudioBody);
|
|
||||||
import views$messages$MFileBody from './components/views/messages/MFileBody';
|
|
||||||
views$messages$MFileBody && (module.exports.components['views.messages.MFileBody'] = views$messages$MFileBody);
|
|
||||||
import views$messages$MImageBody from './components/views/messages/MImageBody';
|
|
||||||
views$messages$MImageBody && (module.exports.components['views.messages.MImageBody'] = views$messages$MImageBody);
|
|
||||||
import views$messages$MVideoBody from './components/views/messages/MVideoBody';
|
|
||||||
views$messages$MVideoBody && (module.exports.components['views.messages.MVideoBody'] = views$messages$MVideoBody);
|
|
||||||
import views$messages$MessageEvent from './components/views/messages/MessageEvent';
|
|
||||||
views$messages$MessageEvent && (module.exports.components['views.messages.MessageEvent'] = views$messages$MessageEvent);
|
|
||||||
import views$messages$SenderProfile from './components/views/messages/SenderProfile';
|
|
||||||
views$messages$SenderProfile && (module.exports.components['views.messages.SenderProfile'] = views$messages$SenderProfile);
|
|
||||||
import views$messages$TextualBody from './components/views/messages/TextualBody';
|
|
||||||
views$messages$TextualBody && (module.exports.components['views.messages.TextualBody'] = views$messages$TextualBody);
|
|
||||||
import views$messages$TextualEvent from './components/views/messages/TextualEvent';
|
|
||||||
views$messages$TextualEvent && (module.exports.components['views.messages.TextualEvent'] = views$messages$TextualEvent);
|
|
||||||
import views$messages$UnknownBody from './components/views/messages/UnknownBody';
|
|
||||||
views$messages$UnknownBody && (module.exports.components['views.messages.UnknownBody'] = views$messages$UnknownBody);
|
|
||||||
import views$room_settings$AliasSettings from './components/views/room_settings/AliasSettings';
|
|
||||||
views$room_settings$AliasSettings && (module.exports.components['views.room_settings.AliasSettings'] = views$room_settings$AliasSettings);
|
|
||||||
import views$room_settings$ColorSettings from './components/views/room_settings/ColorSettings';
|
|
||||||
views$room_settings$ColorSettings && (module.exports.components['views.room_settings.ColorSettings'] = views$room_settings$ColorSettings);
|
|
||||||
import views$room_settings$UrlPreviewSettings from './components/views/room_settings/UrlPreviewSettings';
|
|
||||||
views$room_settings$UrlPreviewSettings && (module.exports.components['views.room_settings.UrlPreviewSettings'] = views$room_settings$UrlPreviewSettings);
|
|
||||||
import views$rooms$Autocomplete from './components/views/rooms/Autocomplete';
|
|
||||||
views$rooms$Autocomplete && (module.exports.components['views.rooms.Autocomplete'] = views$rooms$Autocomplete);
|
|
||||||
import views$rooms$AuxPanel from './components/views/rooms/AuxPanel';
|
|
||||||
views$rooms$AuxPanel && (module.exports.components['views.rooms.AuxPanel'] = views$rooms$AuxPanel);
|
|
||||||
import views$rooms$EntityTile from './components/views/rooms/EntityTile';
|
|
||||||
views$rooms$EntityTile && (module.exports.components['views.rooms.EntityTile'] = views$rooms$EntityTile);
|
|
||||||
import views$rooms$EventTile from './components/views/rooms/EventTile';
|
|
||||||
views$rooms$EventTile && (module.exports.components['views.rooms.EventTile'] = views$rooms$EventTile);
|
|
||||||
import views$rooms$LinkPreviewWidget from './components/views/rooms/LinkPreviewWidget';
|
|
||||||
views$rooms$LinkPreviewWidget && (module.exports.components['views.rooms.LinkPreviewWidget'] = views$rooms$LinkPreviewWidget);
|
|
||||||
import views$rooms$MemberDeviceInfo from './components/views/rooms/MemberDeviceInfo';
|
|
||||||
views$rooms$MemberDeviceInfo && (module.exports.components['views.rooms.MemberDeviceInfo'] = views$rooms$MemberDeviceInfo);
|
|
||||||
import views$rooms$MemberInfo from './components/views/rooms/MemberInfo';
|
|
||||||
views$rooms$MemberInfo && (module.exports.components['views.rooms.MemberInfo'] = views$rooms$MemberInfo);
|
|
||||||
import views$rooms$MemberList from './components/views/rooms/MemberList';
|
|
||||||
views$rooms$MemberList && (module.exports.components['views.rooms.MemberList'] = views$rooms$MemberList);
|
|
||||||
import views$rooms$MemberTile from './components/views/rooms/MemberTile';
|
|
||||||
views$rooms$MemberTile && (module.exports.components['views.rooms.MemberTile'] = views$rooms$MemberTile);
|
|
||||||
import views$rooms$MessageComposer from './components/views/rooms/MessageComposer';
|
|
||||||
views$rooms$MessageComposer && (module.exports.components['views.rooms.MessageComposer'] = views$rooms$MessageComposer);
|
|
||||||
import views$rooms$MessageComposerInput from './components/views/rooms/MessageComposerInput';
|
|
||||||
views$rooms$MessageComposerInput && (module.exports.components['views.rooms.MessageComposerInput'] = views$rooms$MessageComposerInput);
|
|
||||||
import views$rooms$MessageComposerInputOld from './components/views/rooms/MessageComposerInputOld';
|
|
||||||
views$rooms$MessageComposerInputOld && (module.exports.components['views.rooms.MessageComposerInputOld'] = views$rooms$MessageComposerInputOld);
|
|
||||||
import views$rooms$PresenceLabel from './components/views/rooms/PresenceLabel';
|
|
||||||
views$rooms$PresenceLabel && (module.exports.components['views.rooms.PresenceLabel'] = views$rooms$PresenceLabel);
|
|
||||||
import views$rooms$ReadReceiptMarker from './components/views/rooms/ReadReceiptMarker';
|
|
||||||
views$rooms$ReadReceiptMarker && (module.exports.components['views.rooms.ReadReceiptMarker'] = views$rooms$ReadReceiptMarker);
|
|
||||||
import views$rooms$RoomHeader from './components/views/rooms/RoomHeader';
|
|
||||||
views$rooms$RoomHeader && (module.exports.components['views.rooms.RoomHeader'] = views$rooms$RoomHeader);
|
|
||||||
import views$rooms$RoomList from './components/views/rooms/RoomList';
|
|
||||||
views$rooms$RoomList && (module.exports.components['views.rooms.RoomList'] = views$rooms$RoomList);
|
|
||||||
import views$rooms$RoomNameEditor from './components/views/rooms/RoomNameEditor';
|
|
||||||
views$rooms$RoomNameEditor && (module.exports.components['views.rooms.RoomNameEditor'] = views$rooms$RoomNameEditor);
|
|
||||||
import views$rooms$RoomPreviewBar from './components/views/rooms/RoomPreviewBar';
|
|
||||||
views$rooms$RoomPreviewBar && (module.exports.components['views.rooms.RoomPreviewBar'] = views$rooms$RoomPreviewBar);
|
|
||||||
import views$rooms$RoomSettings from './components/views/rooms/RoomSettings';
|
|
||||||
views$rooms$RoomSettings && (module.exports.components['views.rooms.RoomSettings'] = views$rooms$RoomSettings);
|
|
||||||
import views$rooms$RoomTile from './components/views/rooms/RoomTile';
|
|
||||||
views$rooms$RoomTile && (module.exports.components['views.rooms.RoomTile'] = views$rooms$RoomTile);
|
|
||||||
import views$rooms$RoomTopicEditor from './components/views/rooms/RoomTopicEditor';
|
|
||||||
views$rooms$RoomTopicEditor && (module.exports.components['views.rooms.RoomTopicEditor'] = views$rooms$RoomTopicEditor);
|
|
||||||
import views$rooms$SearchResultTile from './components/views/rooms/SearchResultTile';
|
|
||||||
views$rooms$SearchResultTile && (module.exports.components['views.rooms.SearchResultTile'] = views$rooms$SearchResultTile);
|
|
||||||
import views$rooms$SearchableEntityList from './components/views/rooms/SearchableEntityList';
|
|
||||||
views$rooms$SearchableEntityList && (module.exports.components['views.rooms.SearchableEntityList'] = views$rooms$SearchableEntityList);
|
|
||||||
import views$rooms$SimpleRoomHeader from './components/views/rooms/SimpleRoomHeader';
|
|
||||||
views$rooms$SimpleRoomHeader && (module.exports.components['views.rooms.SimpleRoomHeader'] = views$rooms$SimpleRoomHeader);
|
|
||||||
import views$rooms$TabCompleteBar from './components/views/rooms/TabCompleteBar';
|
|
||||||
views$rooms$TabCompleteBar && (module.exports.components['views.rooms.TabCompleteBar'] = views$rooms$TabCompleteBar);
|
|
||||||
import views$rooms$TopUnreadMessagesBar from './components/views/rooms/TopUnreadMessagesBar';
|
|
||||||
views$rooms$TopUnreadMessagesBar && (module.exports.components['views.rooms.TopUnreadMessagesBar'] = views$rooms$TopUnreadMessagesBar);
|
|
||||||
import views$rooms$UserTile from './components/views/rooms/UserTile';
|
|
||||||
views$rooms$UserTile && (module.exports.components['views.rooms.UserTile'] = views$rooms$UserTile);
|
|
||||||
import views$settings$AddPhoneNumber from './components/views/settings/AddPhoneNumber';
|
|
||||||
views$settings$AddPhoneNumber && (module.exports.components['views.settings.AddPhoneNumber'] = views$settings$AddPhoneNumber);
|
|
||||||
import views$settings$ChangeAvatar from './components/views/settings/ChangeAvatar';
|
|
||||||
views$settings$ChangeAvatar && (module.exports.components['views.settings.ChangeAvatar'] = views$settings$ChangeAvatar);
|
|
||||||
import views$settings$ChangeDisplayName from './components/views/settings/ChangeDisplayName';
|
|
||||||
views$settings$ChangeDisplayName && (module.exports.components['views.settings.ChangeDisplayName'] = views$settings$ChangeDisplayName);
|
|
||||||
import views$settings$ChangePassword from './components/views/settings/ChangePassword';
|
|
||||||
views$settings$ChangePassword && (module.exports.components['views.settings.ChangePassword'] = views$settings$ChangePassword);
|
|
||||||
import views$settings$DevicesPanel from './components/views/settings/DevicesPanel';
|
|
||||||
views$settings$DevicesPanel && (module.exports.components['views.settings.DevicesPanel'] = views$settings$DevicesPanel);
|
|
||||||
import views$settings$DevicesPanelEntry from './components/views/settings/DevicesPanelEntry';
|
|
||||||
views$settings$DevicesPanelEntry && (module.exports.components['views.settings.DevicesPanelEntry'] = views$settings$DevicesPanelEntry);
|
|
||||||
import views$settings$EnableNotificationsButton from './components/views/settings/EnableNotificationsButton';
|
|
||||||
views$settings$EnableNotificationsButton && (module.exports.components['views.settings.EnableNotificationsButton'] = views$settings$EnableNotificationsButton);
|
|
||||||
import views$voip$CallView from './components/views/voip/CallView';
|
|
||||||
views$voip$CallView && (module.exports.components['views.voip.CallView'] = views$voip$CallView);
|
|
||||||
import views$voip$IncomingCallBox from './components/views/voip/IncomingCallBox';
|
|
||||||
views$voip$IncomingCallBox && (module.exports.components['views.voip.IncomingCallBox'] = views$voip$IncomingCallBox);
|
|
||||||
import views$voip$VideoFeed from './components/views/voip/VideoFeed';
|
|
||||||
views$voip$VideoFeed && (module.exports.components['views.voip.VideoFeed'] = views$voip$VideoFeed);
|
|
||||||
import views$voip$VideoView from './components/views/voip/VideoView';
|
|
||||||
views$voip$VideoView && (module.exports.components['views.voip.VideoView'] = views$voip$VideoView);
|
|
|
@ -16,15 +16,16 @@ limitations under the License.
|
||||||
|
|
||||||
'use strict';
|
'use strict';
|
||||||
|
|
||||||
var React = require("react");
|
import React from 'react';
|
||||||
var MatrixClientPeg = require("../../MatrixClientPeg");
|
import q from 'q';
|
||||||
var PresetValues = {
|
import { _t } from '../../languageHandler';
|
||||||
|
import sdk from '../../index';
|
||||||
|
import MatrixClientPeg from '../../MatrixClientPeg';
|
||||||
|
const PresetValues = {
|
||||||
PrivateChat: "private_chat",
|
PrivateChat: "private_chat",
|
||||||
PublicChat: "public_chat",
|
PublicChat: "public_chat",
|
||||||
Custom: "custom",
|
Custom: "custom",
|
||||||
};
|
};
|
||||||
var q = require('q');
|
|
||||||
var sdk = require('../../index');
|
|
||||||
|
|
||||||
module.exports = React.createClass({
|
module.exports = React.createClass({
|
||||||
displayName: 'CreateRoom',
|
displayName: 'CreateRoom',
|
||||||
|
@ -231,7 +232,7 @@ module.exports = React.createClass({
|
||||||
if (curr_phase == this.phases.ERROR) {
|
if (curr_phase == this.phases.ERROR) {
|
||||||
error_box = (
|
error_box = (
|
||||||
<div className="mx_Error">
|
<div className="mx_Error">
|
||||||
An error occured: {this.state.error_string}
|
{_t('An error occured: %(error_string)s', {error_string: this.state.error_string})}
|
||||||
</div>
|
</div>
|
||||||
);
|
);
|
||||||
}
|
}
|
||||||
|
@ -248,27 +249,27 @@ module.exports = React.createClass({
|
||||||
<div className="mx_CreateRoom">
|
<div className="mx_CreateRoom">
|
||||||
<SimpleRoomHeader title="CreateRoom" collapsedRhs={ this.props.collapsedRhs }/>
|
<SimpleRoomHeader title="CreateRoom" collapsedRhs={ this.props.collapsedRhs }/>
|
||||||
<div className="mx_CreateRoom_body">
|
<div className="mx_CreateRoom_body">
|
||||||
<input type="text" ref="room_name" value={this.state.room_name} onChange={this.onNameChange} placeholder="Name"/> <br />
|
<input type="text" ref="room_name" value={this.state.room_name} onChange={this.onNameChange} placeholder={_t('Name')}/> <br />
|
||||||
<textarea className="mx_CreateRoom_description" ref="topic" value={this.state.topic} onChange={this.onTopicChange} placeholder="Topic"/> <br />
|
<textarea className="mx_CreateRoom_description" ref="topic" value={this.state.topic} onChange={this.onTopicChange} placeholder={_t('Topic')}/> <br />
|
||||||
<RoomAlias ref="alias" alias={this.state.alias} homeserver={ domain } onChange={this.onAliasChanged}/> <br />
|
<RoomAlias ref="alias" alias={this.state.alias} homeserver={ domain } onChange={this.onAliasChanged}/> <br />
|
||||||
<UserSelector ref="user_selector" selected_users={this.state.invited_users} onChange={this.onInviteChanged}/> <br />
|
<UserSelector ref="user_selector" selected_users={this.state.invited_users} onChange={this.onInviteChanged}/> <br />
|
||||||
<Presets ref="presets" onChange={this.onPresetChanged} preset={this.state.preset}/> <br />
|
<Presets ref="presets" onChange={this.onPresetChanged} preset={this.state.preset}/> <br />
|
||||||
<div>
|
<div>
|
||||||
<label>
|
<label>
|
||||||
<input type="checkbox" ref="is_private" checked={this.state.is_private} onChange={this.onPrivateChanged}/>
|
<input type="checkbox" ref="is_private" checked={this.state.is_private} onChange={this.onPrivateChanged}/>
|
||||||
Make this room private
|
{_t('Make this room private')}
|
||||||
</label>
|
</label>
|
||||||
</div>
|
</div>
|
||||||
<div>
|
<div>
|
||||||
<label>
|
<label>
|
||||||
<input type="checkbox" ref="share_history" checked={this.state.share_history} onChange={this.onShareHistoryChanged}/>
|
<input type="checkbox" ref="share_history" checked={this.state.share_history} onChange={this.onShareHistoryChanged}/>
|
||||||
Share message history with new users
|
{_t('Share message history with new users')}
|
||||||
</label>
|
</label>
|
||||||
</div>
|
</div>
|
||||||
<div className="mx_CreateRoom_encrypt">
|
<div className="mx_CreateRoom_encrypt">
|
||||||
<label>
|
<label>
|
||||||
<input type="checkbox" ref="encrypt" checked={this.state.encrypt} onChange={this.onEncryptChanged}/>
|
<input type="checkbox" ref="encrypt" checked={this.state.encrypt} onChange={this.onEncryptChanged}/>
|
||||||
Encrypt room
|
{_t('Encrypt room')}
|
||||||
</label>
|
</label>
|
||||||
</div>
|
</div>
|
||||||
<div>
|
<div>
|
||||||
|
|
|
@ -14,13 +14,12 @@ See the License for the specific language governing permissions and
|
||||||
limitations under the License.
|
limitations under the License.
|
||||||
*/
|
*/
|
||||||
|
|
||||||
var React = require('react');
|
import React from 'react';
|
||||||
var ReactDOM = require("react-dom");
|
|
||||||
|
|
||||||
var Matrix = require("matrix-js-sdk");
|
import Matrix from 'matrix-js-sdk';
|
||||||
var sdk = require('../../index');
|
import sdk from '../../index';
|
||||||
var MatrixClientPeg = require("../../MatrixClientPeg");
|
import MatrixClientPeg from '../../MatrixClientPeg';
|
||||||
var dis = require("../../dispatcher");
|
import { _t } from '../../languageHandler';
|
||||||
|
|
||||||
/*
|
/*
|
||||||
* Component which shows the filtered file using a TimelinePanel
|
* Component which shows the filtered file using a TimelinePanel
|
||||||
|
@ -59,6 +58,8 @@ var FilePanel = React.createClass({
|
||||||
var client = MatrixClientPeg.get();
|
var client = MatrixClientPeg.get();
|
||||||
var room = client.getRoom(roomId);
|
var room = client.getRoom(roomId);
|
||||||
|
|
||||||
|
this.noRoom = !room;
|
||||||
|
|
||||||
if (room) {
|
if (room) {
|
||||||
var filter = new Matrix.Filter(client.credentials.userId);
|
var filter = new Matrix.Filter(client.credentials.userId);
|
||||||
filter.setDefinition(
|
filter.setDefinition(
|
||||||
|
@ -82,13 +83,22 @@ var FilePanel = React.createClass({
|
||||||
console.error("Failed to get or create file panel filter", error);
|
console.error("Failed to get or create file panel filter", error);
|
||||||
}
|
}
|
||||||
);
|
);
|
||||||
}
|
} else {
|
||||||
else {
|
|
||||||
console.error("Failed to add filtered timelineSet for FilePanel as no room!");
|
console.error("Failed to add filtered timelineSet for FilePanel as no room!");
|
||||||
}
|
}
|
||||||
},
|
},
|
||||||
|
|
||||||
render: function() {
|
render: function() {
|
||||||
|
if (MatrixClientPeg.get().isGuest()) {
|
||||||
|
return <div className="mx_FilePanel mx_RoomView_messageListWrapper">
|
||||||
|
<div className="mx_RoomView_empty">You must <a href="#/register">register</a> to use this functionality</div>
|
||||||
|
</div>;
|
||||||
|
} else if (this.noRoom) {
|
||||||
|
return <div className="mx_FilePanel mx_RoomView_messageListWrapper">
|
||||||
|
<div className="mx_RoomView_empty">You must join the room to see its files</div>
|
||||||
|
</div>;
|
||||||
|
}
|
||||||
|
|
||||||
// wrap a TimelinePanel with the jump-to-event bits turned off.
|
// wrap a TimelinePanel with the jump-to-event bits turned off.
|
||||||
var TimelinePanel = sdk.getComponent("structures.TimelinePanel");
|
var TimelinePanel = sdk.getComponent("structures.TimelinePanel");
|
||||||
var Loader = sdk.getComponent("elements.Spinner");
|
var Loader = sdk.getComponent("elements.Spinner");
|
||||||
|
@ -105,7 +115,7 @@ var FilePanel = React.createClass({
|
||||||
showUrlPreview = { false }
|
showUrlPreview = { false }
|
||||||
tileShape="file_grid"
|
tileShape="file_grid"
|
||||||
opacity={ this.props.opacity }
|
opacity={ this.props.opacity }
|
||||||
empty="There are no visible files in this room"
|
empty={_t('There are no visible files in this room')}
|
||||||
/>
|
/>
|
||||||
);
|
);
|
||||||
}
|
}
|
||||||
|
|
|
@ -1,5 +1,6 @@
|
||||||
/*
|
/*
|
||||||
Copyright 2015, 2016 OpenMarket Ltd
|
Copyright 2015, 2016 OpenMarket Ltd
|
||||||
|
Copyright 2017 Vector Creations Ltd
|
||||||
|
|
||||||
Licensed under the Apache License, Version 2.0 (the "License");
|
Licensed under the Apache License, Version 2.0 (the "License");
|
||||||
you may not use this file except in compliance with the License.
|
you may not use this file except in compliance with the License.
|
||||||
|
@ -106,18 +107,6 @@ export default React.createClass({
|
||||||
var handled = false;
|
var handled = false;
|
||||||
|
|
||||||
switch (ev.keyCode) {
|
switch (ev.keyCode) {
|
||||||
case KeyCode.ESCAPE:
|
|
||||||
|
|
||||||
// Implemented this way so possible handling for other pages is neater
|
|
||||||
switch (this.props.page_type) {
|
|
||||||
case PageTypes.UserSettings:
|
|
||||||
this.props.onUserSettingsClose();
|
|
||||||
handled = true;
|
|
||||||
break;
|
|
||||||
}
|
|
||||||
|
|
||||||
break;
|
|
||||||
|
|
||||||
case KeyCode.UP:
|
case KeyCode.UP:
|
||||||
case KeyCode.DOWN:
|
case KeyCode.DOWN:
|
||||||
if (ev.altKey && !ev.shiftKey && !ev.ctrlKey && !ev.metaKey) {
|
if (ev.altKey && !ev.shiftKey && !ev.ctrlKey && !ev.metaKey) {
|
||||||
|
@ -162,19 +151,19 @@ export default React.createClass({
|
||||||
},
|
},
|
||||||
|
|
||||||
render: function() {
|
render: function() {
|
||||||
var LeftPanel = sdk.getComponent('structures.LeftPanel');
|
const LeftPanel = sdk.getComponent('structures.LeftPanel');
|
||||||
var RightPanel = sdk.getComponent('structures.RightPanel');
|
const RightPanel = sdk.getComponent('structures.RightPanel');
|
||||||
var RoomView = sdk.getComponent('structures.RoomView');
|
const RoomView = sdk.getComponent('structures.RoomView');
|
||||||
var UserSettings = sdk.getComponent('structures.UserSettings');
|
const UserSettings = sdk.getComponent('structures.UserSettings');
|
||||||
var CreateRoom = sdk.getComponent('structures.CreateRoom');
|
const CreateRoom = sdk.getComponent('structures.CreateRoom');
|
||||||
var RoomDirectory = sdk.getComponent('structures.RoomDirectory');
|
const RoomDirectory = sdk.getComponent('structures.RoomDirectory');
|
||||||
var HomePage = sdk.getComponent('structures.HomePage');
|
const HomePage = sdk.getComponent('structures.HomePage');
|
||||||
var MatrixToolbar = sdk.getComponent('globals.MatrixToolbar');
|
const MatrixToolbar = sdk.getComponent('globals.MatrixToolbar');
|
||||||
var GuestWarningBar = sdk.getComponent('globals.GuestWarningBar');
|
const GuestWarningBar = sdk.getComponent('globals.GuestWarningBar');
|
||||||
var NewVersionBar = sdk.getComponent('globals.NewVersionBar');
|
const NewVersionBar = sdk.getComponent('globals.NewVersionBar');
|
||||||
|
|
||||||
var page_element;
|
let page_element;
|
||||||
var right_panel = '';
|
let right_panel = '';
|
||||||
|
|
||||||
switch (this.props.page_type) {
|
switch (this.props.page_type) {
|
||||||
case PageTypes.RoomView:
|
case PageTypes.RoomView:
|
||||||
|
@ -194,7 +183,7 @@ export default React.createClass({
|
||||||
ConferenceHandler={this.props.ConferenceHandler}
|
ConferenceHandler={this.props.ConferenceHandler}
|
||||||
scrollStateMap={this._scrollStateMap}
|
scrollStateMap={this._scrollStateMap}
|
||||||
/>;
|
/>;
|
||||||
if (!this.props.collapse_rhs) right_panel = <RightPanel roomId={this.props.currentRoomId} opacity={this.props.sideOpacity} />;
|
if (!this.props.collapse_rhs) right_panel = <RightPanel roomId={this.props.currentRoomId} opacity={this.props.rightOpacity} />;
|
||||||
break;
|
break;
|
||||||
|
|
||||||
case PageTypes.UserSettings:
|
case PageTypes.UserSettings:
|
||||||
|
@ -206,7 +195,7 @@ export default React.createClass({
|
||||||
referralBaseUrl={this.props.config.referralBaseUrl}
|
referralBaseUrl={this.props.config.referralBaseUrl}
|
||||||
teamToken={this.props.teamToken}
|
teamToken={this.props.teamToken}
|
||||||
/>;
|
/>;
|
||||||
if (!this.props.collapse_rhs) right_panel = <RightPanel opacity={this.props.sideOpacity}/>;
|
if (!this.props.collapse_rhs) right_panel = <RightPanel opacity={this.props.rightOpacity}/>;
|
||||||
break;
|
break;
|
||||||
|
|
||||||
case PageTypes.CreateRoom:
|
case PageTypes.CreateRoom:
|
||||||
|
@ -214,16 +203,14 @@ export default React.createClass({
|
||||||
onRoomCreated={this.props.onRoomCreated}
|
onRoomCreated={this.props.onRoomCreated}
|
||||||
collapsedRhs={this.props.collapse_rhs}
|
collapsedRhs={this.props.collapse_rhs}
|
||||||
/>;
|
/>;
|
||||||
if (!this.props.collapse_rhs) right_panel = <RightPanel opacity={this.props.sideOpacity}/>;
|
if (!this.props.collapse_rhs) right_panel = <RightPanel opacity={this.props.rightOpacity}/>;
|
||||||
break;
|
break;
|
||||||
|
|
||||||
case PageTypes.RoomDirectory:
|
case PageTypes.RoomDirectory:
|
||||||
page_element = <RoomDirectory
|
page_element = <RoomDirectory
|
||||||
ref="roomDirectory"
|
ref="roomDirectory"
|
||||||
collapsedRhs={this.props.collapse_rhs}
|
|
||||||
config={this.props.config.roomDirectory}
|
config={this.props.config.roomDirectory}
|
||||||
/>;
|
/>;
|
||||||
if (!this.props.collapse_rhs) right_panel = <RightPanel opacity={this.props.sideOpacity}/>;
|
|
||||||
break;
|
break;
|
||||||
|
|
||||||
case PageTypes.HomePage:
|
case PageTypes.HomePage:
|
||||||
|
@ -232,12 +219,12 @@ export default React.createClass({
|
||||||
teamServerUrl={this.props.config.teamServerConfig.teamServerURL}
|
teamServerUrl={this.props.config.teamServerConfig.teamServerURL}
|
||||||
teamToken={this.props.teamToken}
|
teamToken={this.props.teamToken}
|
||||||
/>
|
/>
|
||||||
if (!this.props.collapse_rhs) right_panel = <RightPanel opacity={this.props.sideOpacity}/>
|
if (!this.props.collapse_rhs) right_panel = <RightPanel opacity={this.props.rightOpacity}/>
|
||||||
break;
|
break;
|
||||||
|
|
||||||
case PageTypes.UserView:
|
case PageTypes.UserView:
|
||||||
page_element = null; // deliberately null for now
|
page_element = null; // deliberately null for now
|
||||||
right_panel = <RightPanel userId={this.props.viewUserId} opacity={this.props.sideOpacity} />;
|
right_panel = <RightPanel userId={this.props.viewUserId} opacity={this.props.rightOpacity} />;
|
||||||
break;
|
break;
|
||||||
}
|
}
|
||||||
|
|
||||||
|
@ -266,7 +253,7 @@ export default React.createClass({
|
||||||
<LeftPanel
|
<LeftPanel
|
||||||
selectedRoom={this.props.currentRoomId}
|
selectedRoom={this.props.currentRoomId}
|
||||||
collapsed={this.props.collapse_lhs || false}
|
collapsed={this.props.collapse_lhs || false}
|
||||||
opacity={this.props.sideOpacity}
|
opacity={this.props.leftOpacity}
|
||||||
teamToken={this.props.teamToken}
|
teamToken={this.props.teamToken}
|
||||||
/>
|
/>
|
||||||
<main className='mx_MatrixChat_middlePanel'>
|
<main className='mx_MatrixChat_middlePanel'>
|
||||||
|
|
|
@ -17,28 +17,26 @@ limitations under the License.
|
||||||
|
|
||||||
import q from 'q';
|
import q from 'q';
|
||||||
|
|
||||||
var React = require('react');
|
import React from 'react';
|
||||||
var Matrix = require("matrix-js-sdk");
|
import Matrix from "matrix-js-sdk";
|
||||||
|
|
||||||
var MatrixClientPeg = require("../../MatrixClientPeg");
|
import MatrixClientPeg from "../../MatrixClientPeg";
|
||||||
var PlatformPeg = require("../../PlatformPeg");
|
import PlatformPeg from "../../PlatformPeg";
|
||||||
var SdkConfig = require("../../SdkConfig");
|
import SdkConfig from "../../SdkConfig";
|
||||||
var ContextualMenu = require("./ContextualMenu");
|
import * as RoomListSorter from "../../RoomListSorter";
|
||||||
var RoomListSorter = require("../../RoomListSorter");
|
import dis from "../../dispatcher";
|
||||||
var UserActivity = require("../../UserActivity");
|
|
||||||
var Presence = require("../../Presence");
|
|
||||||
var dis = require("../../dispatcher");
|
|
||||||
|
|
||||||
var Modal = require("../../Modal");
|
import Modal from "../../Modal";
|
||||||
var Tinter = require("../../Tinter");
|
import Tinter from "../../Tinter";
|
||||||
var sdk = require('../../index');
|
import sdk from '../../index';
|
||||||
var Rooms = require('../../Rooms');
|
import * as Rooms from '../../Rooms';
|
||||||
var linkifyMatrix = require("../../linkify-matrix");
|
import linkifyMatrix from "../../linkify-matrix";
|
||||||
var Lifecycle = require('../../Lifecycle');
|
import * as Lifecycle from '../../Lifecycle';
|
||||||
var PageTypes = require('../../PageTypes');
|
import PageTypes from '../../PageTypes';
|
||||||
|
|
||||||
var createRoom = require("../../createRoom");
|
import createRoom from "../../createRoom";
|
||||||
import * as UDEHandler from '../../UnknownDeviceErrorHandler';
|
import * as UDEHandler from '../../UnknownDeviceErrorHandler';
|
||||||
|
import { _t } from '../../languageHandler';
|
||||||
|
|
||||||
module.exports = React.createClass({
|
module.exports = React.createClass({
|
||||||
displayName: 'MatrixChat',
|
displayName: 'MatrixChat',
|
||||||
|
@ -89,7 +87,7 @@ module.exports = React.createClass({
|
||||||
},
|
},
|
||||||
|
|
||||||
getInitialState: function() {
|
getInitialState: function() {
|
||||||
var s = {
|
const s = {
|
||||||
loading: true,
|
loading: true,
|
||||||
screen: undefined,
|
screen: undefined,
|
||||||
screenAfterLogin: this.props.initialScreenAfterLogin,
|
screenAfterLogin: this.props.initialScreenAfterLogin,
|
||||||
|
@ -119,8 +117,9 @@ module.exports = React.createClass({
|
||||||
collapse_rhs: false,
|
collapse_rhs: false,
|
||||||
ready: false,
|
ready: false,
|
||||||
width: 10000,
|
width: 10000,
|
||||||
sideOpacity: 1.0,
|
leftOpacity: 1.0,
|
||||||
middleOpacity: 1.0,
|
middleOpacity: 1.0,
|
||||||
|
rightOpacity: 1.0,
|
||||||
|
|
||||||
version: null,
|
version: null,
|
||||||
newVersion: null,
|
newVersion: null,
|
||||||
|
@ -156,11 +155,9 @@ module.exports = React.createClass({
|
||||||
return this.state.register_hs_url;
|
return this.state.register_hs_url;
|
||||||
} else if (MatrixClientPeg.get()) {
|
} else if (MatrixClientPeg.get()) {
|
||||||
return MatrixClientPeg.get().getHomeserverUrl();
|
return MatrixClientPeg.get().getHomeserverUrl();
|
||||||
}
|
} else if (window.localStorage && window.localStorage.getItem("mx_hs_url")) {
|
||||||
else if (window.localStorage && window.localStorage.getItem("mx_hs_url")) {
|
|
||||||
return window.localStorage.getItem("mx_hs_url");
|
return window.localStorage.getItem("mx_hs_url");
|
||||||
}
|
} else {
|
||||||
else {
|
|
||||||
return this.getDefaultHsUrl();
|
return this.getDefaultHsUrl();
|
||||||
}
|
}
|
||||||
},
|
},
|
||||||
|
@ -178,11 +175,9 @@ module.exports = React.createClass({
|
||||||
return this.state.register_is_url;
|
return this.state.register_is_url;
|
||||||
} else if (MatrixClientPeg.get()) {
|
} else if (MatrixClientPeg.get()) {
|
||||||
return MatrixClientPeg.get().getIdentityServerUrl();
|
return MatrixClientPeg.get().getIdentityServerUrl();
|
||||||
}
|
} else if (window.localStorage && window.localStorage.getItem("mx_is_url")) {
|
||||||
else if (window.localStorage && window.localStorage.getItem("mx_is_url")) {
|
|
||||||
return window.localStorage.getItem("mx_is_url");
|
return window.localStorage.getItem("mx_is_url");
|
||||||
}
|
} else {
|
||||||
else {
|
|
||||||
return this.getDefaultIsUrl();
|
return this.getDefaultIsUrl();
|
||||||
}
|
}
|
||||||
},
|
},
|
||||||
|
@ -253,7 +248,6 @@ module.exports = React.createClass({
|
||||||
UDEHandler.startListening();
|
UDEHandler.startListening();
|
||||||
|
|
||||||
this.focusComposer = false;
|
this.focusComposer = false;
|
||||||
window.addEventListener("focus", this.onFocus);
|
|
||||||
|
|
||||||
// this can technically be done anywhere but doing this here keeps all
|
// this can technically be done anywhere but doing this here keeps all
|
||||||
// the routing url path logic together.
|
// the routing url path logic together.
|
||||||
|
@ -324,28 +318,14 @@ module.exports = React.createClass({
|
||||||
onAction: function(payload) {
|
onAction: function(payload) {
|
||||||
const ErrorDialog = sdk.getComponent("dialogs.ErrorDialog");
|
const ErrorDialog = sdk.getComponent("dialogs.ErrorDialog");
|
||||||
const QuestionDialog = sdk.getComponent("dialogs.QuestionDialog");
|
const QuestionDialog = sdk.getComponent("dialogs.QuestionDialog");
|
||||||
var roomIndexDelta = 1;
|
const TextInputDialog = sdk.getComponent("dialogs.TextInputDialog");
|
||||||
|
|
||||||
var self = this;
|
|
||||||
switch (payload.action) {
|
switch (payload.action) {
|
||||||
case 'logout':
|
case 'logout':
|
||||||
Lifecycle.logout();
|
Lifecycle.logout();
|
||||||
break;
|
break;
|
||||||
case 'start_registration':
|
case 'start_registration':
|
||||||
const params = payload.params || {};
|
this._startRegistration(payload.params || {});
|
||||||
this.setStateForNewScreen({
|
|
||||||
screen: 'register',
|
|
||||||
// these params may be undefined, but if they are,
|
|
||||||
// unset them from our state: we don't want to
|
|
||||||
// resume a previous registration session if the
|
|
||||||
// user just clicked 'register'
|
|
||||||
register_client_secret: params.client_secret,
|
|
||||||
register_session_id: params.session_id,
|
|
||||||
register_hs_url: params.hs_url,
|
|
||||||
register_is_url: params.is_url,
|
|
||||||
register_id_sid: params.sid,
|
|
||||||
});
|
|
||||||
this.notifyNewScreen('register');
|
|
||||||
break;
|
break;
|
||||||
case 'start_login':
|
case 'start_login':
|
||||||
if (MatrixClientPeg.get() &&
|
if (MatrixClientPeg.get() &&
|
||||||
|
@ -362,7 +342,7 @@ module.exports = React.createClass({
|
||||||
break;
|
break;
|
||||||
case 'start_post_registration':
|
case 'start_post_registration':
|
||||||
this.setState({ // don't clobber loggedIn status
|
this.setState({ // don't clobber loggedIn status
|
||||||
screen: 'post_registration'
|
screen: 'post_registration',
|
||||||
});
|
});
|
||||||
break;
|
break;
|
||||||
case 'start_upgrade_registration':
|
case 'start_upgrade_registration':
|
||||||
|
@ -392,38 +372,12 @@ module.exports = React.createClass({
|
||||||
this.notifyNewScreen('forgot_password');
|
this.notifyNewScreen('forgot_password');
|
||||||
break;
|
break;
|
||||||
case 'leave_room':
|
case 'leave_room':
|
||||||
Modal.createDialog(QuestionDialog, {
|
this._leaveRoom(payload.room_id);
|
||||||
title: "Leave room",
|
|
||||||
description: "Are you sure you want to leave the room?",
|
|
||||||
onFinished: (should_leave) => {
|
|
||||||
if (should_leave) {
|
|
||||||
const d = MatrixClientPeg.get().leave(payload.room_id);
|
|
||||||
|
|
||||||
// FIXME: controller shouldn't be loading a view :(
|
|
||||||
const Loader = sdk.getComponent("elements.Spinner");
|
|
||||||
const modal = Modal.createDialog(Loader, null, 'mx_Dialog_spinner');
|
|
||||||
|
|
||||||
d.then(() => {
|
|
||||||
modal.close();
|
|
||||||
if (this.currentRoomId === payload.room_id) {
|
|
||||||
dis.dispatch({action: 'view_next_room'});
|
|
||||||
}
|
|
||||||
}, (err) => {
|
|
||||||
modal.close();
|
|
||||||
console.error("Failed to leave room " + payload.room_id + " " + err);
|
|
||||||
Modal.createDialog(ErrorDialog, {
|
|
||||||
title: "Failed to leave room",
|
|
||||||
description: (err && err.message ? err.message : "Server may be unavailable, overloaded, or you hit a bug."),
|
|
||||||
});
|
|
||||||
});
|
|
||||||
}
|
|
||||||
}
|
|
||||||
});
|
|
||||||
break;
|
break;
|
||||||
case 'reject_invite':
|
case 'reject_invite':
|
||||||
Modal.createDialog(QuestionDialog, {
|
Modal.createDialog(QuestionDialog, {
|
||||||
title: "Reject invitation",
|
title: _t('Reject invitation'),
|
||||||
description: "Are you sure you want to reject the invitation?",
|
description: _t('Are you sure you want to reject the invitation?'),
|
||||||
onFinished: (confirm) => {
|
onFinished: (confirm) => {
|
||||||
if (confirm) {
|
if (confirm) {
|
||||||
// FIXME: controller shouldn't be loading a view :(
|
// FIXME: controller shouldn't be loading a view :(
|
||||||
|
@ -438,12 +392,12 @@ module.exports = React.createClass({
|
||||||
}, (err) => {
|
}, (err) => {
|
||||||
modal.close();
|
modal.close();
|
||||||
Modal.createDialog(ErrorDialog, {
|
Modal.createDialog(ErrorDialog, {
|
||||||
title: "Failed to reject invitation",
|
title: _t('Failed to reject invitation'),
|
||||||
description: err.toString()
|
description: err.toString(),
|
||||||
});
|
});
|
||||||
});
|
});
|
||||||
}
|
}
|
||||||
}
|
},
|
||||||
});
|
});
|
||||||
break;
|
break;
|
||||||
case 'view_user':
|
case 'view_user':
|
||||||
|
@ -468,30 +422,13 @@ module.exports = React.createClass({
|
||||||
this._viewRoom(payload);
|
this._viewRoom(payload);
|
||||||
break;
|
break;
|
||||||
case 'view_prev_room':
|
case 'view_prev_room':
|
||||||
roomIndexDelta = -1;
|
this._viewNextRoom(-1);
|
||||||
|
break;
|
||||||
case 'view_next_room':
|
case 'view_next_room':
|
||||||
var allRooms = RoomListSorter.mostRecentActivityFirst(
|
this._viewNextRoom(1);
|
||||||
MatrixClientPeg.get().getRooms()
|
|
||||||
);
|
|
||||||
var roomIndex = -1;
|
|
||||||
for (var i = 0; i < allRooms.length; ++i) {
|
|
||||||
if (allRooms[i].roomId == this.state.currentRoomId) {
|
|
||||||
roomIndex = i;
|
|
||||||
break;
|
|
||||||
}
|
|
||||||
}
|
|
||||||
roomIndex = (roomIndex + roomIndexDelta) % allRooms.length;
|
|
||||||
if (roomIndex < 0) roomIndex = allRooms.length - 1;
|
|
||||||
this._viewRoom({ room_id: allRooms[roomIndex].roomId });
|
|
||||||
break;
|
break;
|
||||||
case 'view_indexed_room':
|
case 'view_indexed_room':
|
||||||
var allRooms = RoomListSorter.mostRecentActivityFirst(
|
this._viewIndexedRoom(payload.roomIndex);
|
||||||
MatrixClientPeg.get().getRooms()
|
|
||||||
);
|
|
||||||
var roomIndex = payload.roomIndex;
|
|
||||||
if (allRooms[roomIndex]) {
|
|
||||||
this._viewRoom({ room_id: allRooms[roomIndex].roomId });
|
|
||||||
}
|
|
||||||
break;
|
break;
|
||||||
case 'view_user_settings':
|
case 'view_user_settings':
|
||||||
this._setPage(PageTypes.UserSettings);
|
this._setPage(PageTypes.UserSettings);
|
||||||
|
@ -500,19 +437,17 @@ module.exports = React.createClass({
|
||||||
case 'view_create_room':
|
case 'view_create_room':
|
||||||
//this._setPage(PageTypes.CreateRoom);
|
//this._setPage(PageTypes.CreateRoom);
|
||||||
//this.notifyNewScreen('new');
|
//this.notifyNewScreen('new');
|
||||||
|
|
||||||
var TextInputDialog = sdk.getComponent("dialogs.TextInputDialog");
|
|
||||||
Modal.createDialog(TextInputDialog, {
|
Modal.createDialog(TextInputDialog, {
|
||||||
title: "Create Room",
|
title: _t('Create Room'),
|
||||||
description: "Room name (optional)",
|
description: _t('Room name (optional)'),
|
||||||
button: "Create Room",
|
button: _t('Create Room'),
|
||||||
onFinished: (should_create, name) => {
|
onFinished: (should_create, name) => {
|
||||||
if (should_create) {
|
if (should_create) {
|
||||||
const createOpts = {};
|
const createOpts = {};
|
||||||
if (name) createOpts.name = name;
|
if (name) createOpts.name = name;
|
||||||
createRoom({createOpts}).done();
|
createRoom({createOpts}).done();
|
||||||
}
|
}
|
||||||
}
|
},
|
||||||
});
|
});
|
||||||
break;
|
break;
|
||||||
case 'view_room_directory':
|
case 'view_room_directory':
|
||||||
|
@ -556,12 +491,14 @@ module.exports = React.createClass({
|
||||||
collapse_rhs: false,
|
collapse_rhs: false,
|
||||||
});
|
});
|
||||||
break;
|
break;
|
||||||
case 'ui_opacity':
|
case 'ui_opacity': {
|
||||||
|
const sideDefault = payload.sideOpacity >= 0.0 ? payload.sideOpacity : 1.0;
|
||||||
this.setState({
|
this.setState({
|
||||||
sideOpacity: payload.sideOpacity,
|
leftOpacity: payload.leftOpacity >= 0.0 ? payload.leftOpacity : sideDefault,
|
||||||
middleOpacity: payload.middleOpacity,
|
middleOpacity: payload.middleOpacity || 1.0,
|
||||||
|
rightOpacity: payload.rightOpacity >= 0.0 ? payload.rightOpacity : sideDefault,
|
||||||
});
|
});
|
||||||
break;
|
break; }
|
||||||
case 'set_theme':
|
case 'set_theme':
|
||||||
this._onSetTheme(payload.value);
|
this._onSetTheme(payload.value);
|
||||||
break;
|
break;
|
||||||
|
@ -583,7 +520,7 @@ module.exports = React.createClass({
|
||||||
case 'new_version':
|
case 'new_version':
|
||||||
this.onVersion(
|
this.onVersion(
|
||||||
payload.currentVersion, payload.newVersion,
|
payload.currentVersion, payload.newVersion,
|
||||||
payload.releaseNotes
|
payload.releaseNotes,
|
||||||
);
|
);
|
||||||
break;
|
break;
|
||||||
}
|
}
|
||||||
|
@ -595,6 +532,47 @@ module.exports = React.createClass({
|
||||||
});
|
});
|
||||||
},
|
},
|
||||||
|
|
||||||
|
_startRegistration: function(params) {
|
||||||
|
this.setStateForNewScreen({
|
||||||
|
screen: 'register',
|
||||||
|
// these params may be undefined, but if they are,
|
||||||
|
// unset them from our state: we don't want to
|
||||||
|
// resume a previous registration session if the
|
||||||
|
// user just clicked 'register'
|
||||||
|
register_client_secret: params.client_secret,
|
||||||
|
register_session_id: params.session_id,
|
||||||
|
register_hs_url: params.hs_url,
|
||||||
|
register_is_url: params.is_url,
|
||||||
|
register_id_sid: params.sid,
|
||||||
|
});
|
||||||
|
this.notifyNewScreen('register');
|
||||||
|
},
|
||||||
|
|
||||||
|
_viewNextRoom: function(roomIndexDelta) {
|
||||||
|
const allRooms = RoomListSorter.mostRecentActivityFirst(
|
||||||
|
MatrixClientPeg.get().getRooms(),
|
||||||
|
);
|
||||||
|
let roomIndex = -1;
|
||||||
|
for (let i = 0; i < allRooms.length; ++i) {
|
||||||
|
if (allRooms[i].roomId == this.state.currentRoomId) {
|
||||||
|
roomIndex = i;
|
||||||
|
break;
|
||||||
|
}
|
||||||
|
}
|
||||||
|
roomIndex = (roomIndex + roomIndexDelta) % allRooms.length;
|
||||||
|
if (roomIndex < 0) roomIndex = allRooms.length - 1;
|
||||||
|
this._viewRoom({ room_id: allRooms[roomIndex].roomId });
|
||||||
|
},
|
||||||
|
|
||||||
|
_viewIndexedRoom: function(roomIndex) {
|
||||||
|
const allRooms = RoomListSorter.mostRecentActivityFirst(
|
||||||
|
MatrixClientPeg.get().getRooms(),
|
||||||
|
);
|
||||||
|
if (allRooms[roomIndex]) {
|
||||||
|
this._viewRoom({ room_id: allRooms[roomIndex].roomId });
|
||||||
|
}
|
||||||
|
},
|
||||||
|
|
||||||
// switch view to the given room
|
// switch view to the given room
|
||||||
//
|
//
|
||||||
// @param {Object} room_info Object containing data about the room to be joined
|
// @param {Object} room_info Object containing data about the room to be joined
|
||||||
|
@ -614,7 +592,7 @@ module.exports = React.createClass({
|
||||||
_viewRoom: function(room_info) {
|
_viewRoom: function(room_info) {
|
||||||
this.focusComposer = true;
|
this.focusComposer = true;
|
||||||
|
|
||||||
var newState = {
|
const newState = {
|
||||||
initialEventId: room_info.event_id,
|
initialEventId: room_info.event_id,
|
||||||
highlightedEventId: room_info.event_id,
|
highlightedEventId: room_info.event_id,
|
||||||
initialEventPixelOffset: undefined,
|
initialEventPixelOffset: undefined,
|
||||||
|
@ -634,7 +612,7 @@ module.exports = React.createClass({
|
||||||
//
|
//
|
||||||
// TODO: do this in RoomView rather than here
|
// TODO: do this in RoomView rather than here
|
||||||
if (!room_info.event_id && this.refs.loggedInView) {
|
if (!room_info.event_id && this.refs.loggedInView) {
|
||||||
var scrollState = this.refs.loggedInView.getScrollStateForRoom(room_info.room_id);
|
const scrollState = this.refs.loggedInView.getScrollStateForRoom(room_info.room_id);
|
||||||
if (scrollState) {
|
if (scrollState) {
|
||||||
newState.initialEventId = scrollState.focussedEvent;
|
newState.initialEventId = scrollState.focussedEvent;
|
||||||
newState.initialEventPixelOffset = scrollState.pixelOffset;
|
newState.initialEventPixelOffset = scrollState.pixelOffset;
|
||||||
|
@ -676,22 +654,61 @@ module.exports = React.createClass({
|
||||||
},
|
},
|
||||||
|
|
||||||
_createChat: function() {
|
_createChat: function() {
|
||||||
var ChatInviteDialog = sdk.getComponent("dialogs.ChatInviteDialog");
|
const ChatInviteDialog = sdk.getComponent("dialogs.ChatInviteDialog");
|
||||||
Modal.createDialog(ChatInviteDialog, {
|
Modal.createDialog(ChatInviteDialog, {
|
||||||
title: "Start a new chat",
|
title: _t('Start a chat'),
|
||||||
|
description: _t("Who would you like to communicate with?"),
|
||||||
|
placeholder: _t("Email, name or matrix ID"),
|
||||||
|
button: _t("Start Chat")
|
||||||
});
|
});
|
||||||
},
|
},
|
||||||
|
|
||||||
_invite: function(roomId) {
|
_invite: function(roomId) {
|
||||||
var ChatInviteDialog = sdk.getComponent("dialogs.ChatInviteDialog");
|
const ChatInviteDialog = sdk.getComponent("dialogs.ChatInviteDialog");
|
||||||
Modal.createDialog(ChatInviteDialog, {
|
Modal.createDialog(ChatInviteDialog, {
|
||||||
title: "Invite new room members",
|
title: _t('Invite new room members'),
|
||||||
button: "Send Invites",
|
description: _t('Who would you like to add to this room?'),
|
||||||
description: "Who would you like to add to this room?",
|
button: _t('Send Invites'),
|
||||||
|
placeholder: _t("Email, name or matrix ID"),
|
||||||
roomId: roomId,
|
roomId: roomId,
|
||||||
});
|
});
|
||||||
},
|
},
|
||||||
|
|
||||||
|
_leaveRoom: function(roomId) {
|
||||||
|
const QuestionDialog = sdk.getComponent("dialogs.QuestionDialog");
|
||||||
|
const ErrorDialog = sdk.getComponent("dialogs.ErrorDialog");
|
||||||
|
|
||||||
|
const roomToLeave = MatrixClientPeg.get().getRoom(roomId);
|
||||||
|
Modal.createDialog(QuestionDialog, {
|
||||||
|
title: "Leave room",
|
||||||
|
description: <span>Are you sure you want to leave the room <i>{roomToLeave.name}</i>?</span>,
|
||||||
|
onFinished: (shouldLeave) => {
|
||||||
|
if (shouldLeave) {
|
||||||
|
const d = MatrixClientPeg.get().leave(roomId);
|
||||||
|
|
||||||
|
// FIXME: controller shouldn't be loading a view :(
|
||||||
|
const Loader = sdk.getComponent("elements.Spinner");
|
||||||
|
const modal = Modal.createDialog(Loader, null, 'mx_Dialog_spinner');
|
||||||
|
|
||||||
|
d.then(() => {
|
||||||
|
modal.close();
|
||||||
|
if (this.currentRoomId === roomId) {
|
||||||
|
dis.dispatch({action: 'view_next_room'});
|
||||||
|
}
|
||||||
|
}, (err) => {
|
||||||
|
modal.close();
|
||||||
|
console.error("Failed to leave room " + roomId + " " + err);
|
||||||
|
Modal.createDialog(ErrorDialog, {
|
||||||
|
title: "Failed to leave room",
|
||||||
|
description: (err && err.message ? err.message :
|
||||||
|
"Server may be unavailable, overloaded, or you hit a bug."),
|
||||||
|
});
|
||||||
|
});
|
||||||
|
}
|
||||||
|
},
|
||||||
|
});
|
||||||
|
},
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Called when the sessionloader has finished
|
* Called when the sessionloader has finished
|
||||||
*/
|
*/
|
||||||
|
@ -710,6 +727,8 @@ module.exports = React.createClass({
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Called whenever someone changes the theme
|
* Called whenever someone changes the theme
|
||||||
|
*
|
||||||
|
* @param {string} theme new theme
|
||||||
*/
|
*/
|
||||||
_onSetTheme: function(theme) {
|
_onSetTheme: function(theme) {
|
||||||
if (!theme) {
|
if (!theme) {
|
||||||
|
@ -718,12 +737,12 @@ module.exports = React.createClass({
|
||||||
|
|
||||||
// look for the stylesheet elements.
|
// look for the stylesheet elements.
|
||||||
// styleElements is a map from style name to HTMLLinkElement.
|
// styleElements is a map from style name to HTMLLinkElement.
|
||||||
var styleElements = Object.create(null);
|
const styleElements = Object.create(null);
|
||||||
var i, a;
|
let a;
|
||||||
for (i = 0; (a = document.getElementsByTagName("link")[i]); i++) {
|
for (let i = 0; (a = document.getElementsByTagName("link")[i]); i++) {
|
||||||
var href = a.getAttribute("href");
|
const href = a.getAttribute("href");
|
||||||
// shouldn't we be using the 'title' tag rather than the href?
|
// shouldn't we be using the 'title' tag rather than the href?
|
||||||
var match = href.match(/^bundles\/.*\/theme-(.*)\.css$/);
|
const match = href.match(/^bundles\/.*\/theme-(.*)\.css$/);
|
||||||
if (match) {
|
if (match) {
|
||||||
styleElements[match[1]] = a;
|
styleElements[match[1]] = a;
|
||||||
}
|
}
|
||||||
|
@ -746,14 +765,15 @@ module.exports = React.createClass({
|
||||||
// abuse the tinter to change all the SVG's #fff to #2d2d2d
|
// abuse the tinter to change all the SVG's #fff to #2d2d2d
|
||||||
// XXX: obviously this shouldn't be hardcoded here.
|
// XXX: obviously this shouldn't be hardcoded here.
|
||||||
Tinter.tintSvgWhite('#2d2d2d');
|
Tinter.tintSvgWhite('#2d2d2d');
|
||||||
}
|
} else {
|
||||||
else {
|
|
||||||
Tinter.tintSvgWhite('#ffffff');
|
Tinter.tintSvgWhite('#ffffff');
|
||||||
}
|
}
|
||||||
},
|
},
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Called when a new logged in session has started
|
* Called when a new logged in session has started
|
||||||
|
*
|
||||||
|
* @param {string} teamToken
|
||||||
*/
|
*/
|
||||||
_onLoggedIn: function(teamToken) {
|
_onLoggedIn: function(teamToken) {
|
||||||
this.setState({
|
this.setState({
|
||||||
|
@ -767,8 +787,12 @@ module.exports = React.createClass({
|
||||||
this._teamToken = teamToken;
|
this._teamToken = teamToken;
|
||||||
dis.dispatch({action: 'view_home_page'});
|
dis.dispatch({action: 'view_home_page'});
|
||||||
} else if (this._is_registered) {
|
} else if (this._is_registered) {
|
||||||
|
if (this.props.config.welcomeUserId) {
|
||||||
|
createRoom({dmUserId: this.props.config.welcomeUserId});
|
||||||
|
return;
|
||||||
|
}
|
||||||
// The user has just logged in after registering
|
// The user has just logged in after registering
|
||||||
dis.dispatch({action: 'view_user_settings'});
|
dis.dispatch({action: 'view_room_directory'});
|
||||||
} else {
|
} else {
|
||||||
this._showScreenAfterLogin();
|
this._showScreenAfterLogin();
|
||||||
}
|
}
|
||||||
|
@ -780,7 +804,7 @@ module.exports = React.createClass({
|
||||||
if (this.state.screenAfterLogin && this.state.screenAfterLogin.screen) {
|
if (this.state.screenAfterLogin && this.state.screenAfterLogin.screen) {
|
||||||
this.showScreen(
|
this.showScreen(
|
||||||
this.state.screenAfterLogin.screen,
|
this.state.screenAfterLogin.screen,
|
||||||
this.state.screenAfterLogin.params
|
this.state.screenAfterLogin.params,
|
||||||
);
|
);
|
||||||
this.notifyNewScreen(this.state.screenAfterLogin.screen);
|
this.notifyNewScreen(this.state.screenAfterLogin.screen);
|
||||||
this.setState({screenAfterLogin: null});
|
this.setState({screenAfterLogin: null});
|
||||||
|
@ -821,8 +845,8 @@ module.exports = React.createClass({
|
||||||
* (useful for setting listeners)
|
* (useful for setting listeners)
|
||||||
*/
|
*/
|
||||||
_onWillStartClient() {
|
_onWillStartClient() {
|
||||||
var self = this;
|
const self = this;
|
||||||
var cli = MatrixClientPeg.get();
|
const cli = MatrixClientPeg.get();
|
||||||
|
|
||||||
// Allow the JS SDK to reap timeline events. This reduces the amount of
|
// Allow the JS SDK to reap timeline events. This reduces the amount of
|
||||||
// memory consumed as the JS SDK stores multiple distinct copies of room
|
// memory consumed as the JS SDK stores multiple distinct copies of room
|
||||||
|
@ -863,17 +887,17 @@ module.exports = React.createClass({
|
||||||
cli.on('Call.incoming', function(call) {
|
cli.on('Call.incoming', function(call) {
|
||||||
dis.dispatch({
|
dis.dispatch({
|
||||||
action: 'incoming_call',
|
action: 'incoming_call',
|
||||||
call: call
|
call: call,
|
||||||
});
|
});
|
||||||
});
|
});
|
||||||
cli.on('Session.logged_out', function(call) {
|
cli.on('Session.logged_out', function(call) {
|
||||||
var ErrorDialog = sdk.getComponent("dialogs.ErrorDialog");
|
const ErrorDialog = sdk.getComponent("dialogs.ErrorDialog");
|
||||||
Modal.createDialog(ErrorDialog, {
|
Modal.createDialog(ErrorDialog, {
|
||||||
title: "Signed Out",
|
title: _t('Signed Out'),
|
||||||
description: "For security, this session has been signed out. Please sign in again."
|
description: _t('For security, this session has been signed out. Please sign in again.'),
|
||||||
});
|
});
|
||||||
dis.dispatch({
|
dis.dispatch({
|
||||||
action: 'logout'
|
action: 'logout',
|
||||||
});
|
});
|
||||||
});
|
});
|
||||||
cli.on("accountData", function(ev) {
|
cli.on("accountData", function(ev) {
|
||||||
|
@ -888,25 +912,21 @@ module.exports = React.createClass({
|
||||||
});
|
});
|
||||||
},
|
},
|
||||||
|
|
||||||
onFocus: function(ev) {
|
|
||||||
dis.dispatch({action: 'focus_composer'});
|
|
||||||
},
|
|
||||||
|
|
||||||
showScreen: function(screen, params) {
|
showScreen: function(screen, params) {
|
||||||
if (screen == 'register') {
|
if (screen == 'register') {
|
||||||
dis.dispatch({
|
dis.dispatch({
|
||||||
action: 'start_registration',
|
action: 'start_registration',
|
||||||
params: params
|
params: params,
|
||||||
});
|
});
|
||||||
} else if (screen == 'login') {
|
} else if (screen == 'login') {
|
||||||
dis.dispatch({
|
dis.dispatch({
|
||||||
action: 'start_login',
|
action: 'start_login',
|
||||||
params: params
|
params: params,
|
||||||
});
|
});
|
||||||
} else if (screen == 'forgot_password') {
|
} else if (screen == 'forgot_password') {
|
||||||
dis.dispatch({
|
dis.dispatch({
|
||||||
action: 'start_password_recovery',
|
action: 'start_password_recovery',
|
||||||
params: params
|
params: params,
|
||||||
});
|
});
|
||||||
} else if (screen == 'new') {
|
} else if (screen == 'new') {
|
||||||
dis.dispatch({
|
dis.dispatch({
|
||||||
|
@ -929,26 +949,26 @@ module.exports = React.createClass({
|
||||||
action: 'start_post_registration',
|
action: 'start_post_registration',
|
||||||
});
|
});
|
||||||
} else if (screen.indexOf('room/') == 0) {
|
} else if (screen.indexOf('room/') == 0) {
|
||||||
var segments = screen.substring(5).split('/');
|
const segments = screen.substring(5).split('/');
|
||||||
var roomString = segments[0];
|
const roomString = segments[0];
|
||||||
var eventId = segments[1]; // undefined if no event id given
|
const eventId = segments[1]; // undefined if no event id given
|
||||||
|
|
||||||
// FIXME: sort_out caseConsistency
|
// FIXME: sort_out caseConsistency
|
||||||
var third_party_invite = {
|
const thirdPartyInvite = {
|
||||||
inviteSignUrl: params.signurl,
|
inviteSignUrl: params.signurl,
|
||||||
invitedEmail: params.email,
|
invitedEmail: params.email,
|
||||||
};
|
};
|
||||||
var oob_data = {
|
const oobData = {
|
||||||
name: params.room_name,
|
name: params.room_name,
|
||||||
avatarUrl: params.room_avatar_url,
|
avatarUrl: params.room_avatar_url,
|
||||||
inviterName: params.inviter_name,
|
inviterName: params.inviter_name,
|
||||||
};
|
};
|
||||||
|
|
||||||
var payload = {
|
const payload = {
|
||||||
action: 'view_room',
|
action: 'view_room',
|
||||||
event_id: eventId,
|
event_id: eventId,
|
||||||
third_party_invite: third_party_invite,
|
third_party_invite: thirdPartyInvite,
|
||||||
oob_data: oob_data,
|
oob_data: oobData,
|
||||||
};
|
};
|
||||||
if (roomString[0] == '#') {
|
if (roomString[0] == '#') {
|
||||||
payload.room_alias = roomString;
|
payload.room_alias = roomString;
|
||||||
|
@ -962,19 +982,18 @@ module.exports = React.createClass({
|
||||||
dis.dispatch(payload);
|
dis.dispatch(payload);
|
||||||
}
|
}
|
||||||
} else if (screen.indexOf('user/') == 0) {
|
} else if (screen.indexOf('user/') == 0) {
|
||||||
var userId = screen.substring(5);
|
const userId = screen.substring(5);
|
||||||
this.setState({ viewUserId: userId });
|
this.setState({ viewUserId: userId });
|
||||||
this._setPage(PageTypes.UserView);
|
this._setPage(PageTypes.UserView);
|
||||||
this.notifyNewScreen('user/' + userId);
|
this.notifyNewScreen('user/' + userId);
|
||||||
var member = new Matrix.RoomMember(null, userId);
|
const member = new Matrix.RoomMember(null, userId);
|
||||||
if (member) {
|
if (member) {
|
||||||
dis.dispatch({
|
dis.dispatch({
|
||||||
action: 'view_user',
|
action: 'view_user',
|
||||||
member: member,
|
member: member,
|
||||||
});
|
});
|
||||||
}
|
}
|
||||||
}
|
} else {
|
||||||
else {
|
|
||||||
console.info("Ignoring showScreen for '%s'", screen);
|
console.info("Ignoring showScreen for '%s'", screen);
|
||||||
}
|
}
|
||||||
},
|
},
|
||||||
|
@ -993,7 +1012,7 @@ module.exports = React.createClass({
|
||||||
onUserClick: function(event, userId) {
|
onUserClick: function(event, userId) {
|
||||||
event.preventDefault();
|
event.preventDefault();
|
||||||
|
|
||||||
var member = new Matrix.RoomMember(null, userId);
|
const member = new Matrix.RoomMember(null, userId);
|
||||||
if (!member) { return; }
|
if (!member) { return; }
|
||||||
dis.dispatch({
|
dis.dispatch({
|
||||||
action: 'view_user',
|
action: 'view_user',
|
||||||
|
@ -1003,17 +1022,17 @@ module.exports = React.createClass({
|
||||||
|
|
||||||
onLogoutClick: function(event) {
|
onLogoutClick: function(event) {
|
||||||
dis.dispatch({
|
dis.dispatch({
|
||||||
action: 'logout'
|
action: 'logout',
|
||||||
});
|
});
|
||||||
event.stopPropagation();
|
event.stopPropagation();
|
||||||
event.preventDefault();
|
event.preventDefault();
|
||||||
},
|
},
|
||||||
|
|
||||||
handleResize: function(e) {
|
handleResize: function(e) {
|
||||||
var hideLhsThreshold = 1000;
|
const hideLhsThreshold = 1000;
|
||||||
var showLhsThreshold = 1000;
|
const showLhsThreshold = 1000;
|
||||||
var hideRhsThreshold = 820;
|
const hideRhsThreshold = 820;
|
||||||
var showRhsThreshold = 820;
|
const showRhsThreshold = 820;
|
||||||
|
|
||||||
if (this.state.width > hideLhsThreshold && window.innerWidth <= hideLhsThreshold) {
|
if (this.state.width > hideLhsThreshold && window.innerWidth <= hideLhsThreshold) {
|
||||||
dis.dispatch({ action: 'hide_left_panel' });
|
dis.dispatch({ action: 'hide_left_panel' });
|
||||||
|
@ -1031,10 +1050,10 @@ module.exports = React.createClass({
|
||||||
this.setState({width: window.innerWidth});
|
this.setState({width: window.innerWidth});
|
||||||
},
|
},
|
||||||
|
|
||||||
onRoomCreated: function(room_id) {
|
onRoomCreated: function(roomId) {
|
||||||
dis.dispatch({
|
dis.dispatch({
|
||||||
action: "view_room",
|
action: "view_room",
|
||||||
room_id: room_id,
|
room_id: roomId,
|
||||||
});
|
});
|
||||||
},
|
},
|
||||||
|
|
||||||
|
@ -1068,7 +1087,7 @@ module.exports = React.createClass({
|
||||||
onFinishPostRegistration: function() {
|
onFinishPostRegistration: function() {
|
||||||
// Don't confuse this with "PageType" which is the middle window to show
|
// Don't confuse this with "PageType" which is the middle window to show
|
||||||
this.setState({
|
this.setState({
|
||||||
screen: undefined
|
screen: undefined,
|
||||||
});
|
});
|
||||||
this.showScreen("settings");
|
this.showScreen("settings");
|
||||||
},
|
},
|
||||||
|
@ -1083,10 +1102,10 @@ module.exports = React.createClass({
|
||||||
},
|
},
|
||||||
|
|
||||||
updateStatusIndicator: function(state, prevState) {
|
updateStatusIndicator: function(state, prevState) {
|
||||||
var notifCount = 0;
|
let notifCount = 0;
|
||||||
|
|
||||||
var rooms = MatrixClientPeg.get().getRooms();
|
const rooms = MatrixClientPeg.get().getRooms();
|
||||||
for (var i = 0; i < rooms.length; ++i) {
|
for (let i = 0; i < rooms.length; ++i) {
|
||||||
if (rooms[i].hasMembershipState(MatrixClientPeg.get().credentials.userId, 'invite')) {
|
if (rooms[i].hasMembershipState(MatrixClientPeg.get().credentials.userId, 'invite')) {
|
||||||
notifCount++;
|
notifCount++;
|
||||||
} else if (rooms[i].getUnreadNotificationCount()) {
|
} else if (rooms[i].getUnreadNotificationCount()) {
|
||||||
|
@ -1113,19 +1132,18 @@ module.exports = React.createClass({
|
||||||
action: 'view_room',
|
action: 'view_room',
|
||||||
room_id: this.state.currentRoomId,
|
room_id: this.state.currentRoomId,
|
||||||
});
|
});
|
||||||
}
|
} else {
|
||||||
else {
|
|
||||||
dis.dispatch({
|
dis.dispatch({
|
||||||
action: 'view_room_directory',
|
action: 'view_room_directory',
|
||||||
});
|
});
|
||||||
}
|
}
|
||||||
},
|
},
|
||||||
|
|
||||||
onRoomIdResolved: function(room_id) {
|
onRoomIdResolved: function(roomId) {
|
||||||
// It's the RoomView's resposibility to look up room aliases, but we need the
|
// It's the RoomView's resposibility to look up room aliases, but we need the
|
||||||
// ID to pass into things like the Member List, so the Room View tells us when
|
// ID to pass into things like the Member List, so the Room View tells us when
|
||||||
// its done that resolution so we can display things that take a room ID.
|
// its done that resolution so we can display things that take a room ID.
|
||||||
this.setState({currentRoomId: room_id});
|
this.setState({currentRoomId: roomId});
|
||||||
},
|
},
|
||||||
|
|
||||||
_makeRegistrationUrl: function(params) {
|
_makeRegistrationUrl: function(params) {
|
||||||
|
@ -1148,14 +1166,20 @@ module.exports = React.createClass({
|
||||||
</div>
|
</div>
|
||||||
);
|
);
|
||||||
}
|
}
|
||||||
|
|
||||||
// needs to be before normal PageTypes as you are logged in technically
|
// needs to be before normal PageTypes as you are logged in technically
|
||||||
else if (this.state.screen == 'post_registration') {
|
if (this.state.screen == 'post_registration') {
|
||||||
const PostRegistration = sdk.getComponent('structures.login.PostRegistration');
|
const PostRegistration = sdk.getComponent('structures.login.PostRegistration');
|
||||||
return (
|
return (
|
||||||
<PostRegistration
|
<PostRegistration
|
||||||
onComplete={this.onFinishPostRegistration} />
|
onComplete={this.onFinishPostRegistration} />
|
||||||
);
|
);
|
||||||
} else if (this.state.loggedIn && this.state.ready) {
|
}
|
||||||
|
|
||||||
|
// `ready` and `loggedIn` may be set before `page_type` (because the
|
||||||
|
// latter is set via the dispatcher). If we don't yet have a `page_type`,
|
||||||
|
// keep showing the spinner for now.
|
||||||
|
if (this.state.loggedIn && this.state.ready && this.state.page_type) {
|
||||||
/* for now, we stuff the entirety of our props and state into the LoggedInView.
|
/* for now, we stuff the entirety of our props and state into the LoggedInView.
|
||||||
* we should go through and figure out what we actually need to pass down, as well
|
* we should go through and figure out what we actually need to pass down, as well
|
||||||
* as using something like redux to avoid having a billion bits of state kicking around.
|
* as using something like redux to avoid having a billion bits of state kicking around.
|
||||||
|
@ -1178,7 +1202,7 @@ module.exports = React.createClass({
|
||||||
<div className="mx_MatrixChat_splash">
|
<div className="mx_MatrixChat_splash">
|
||||||
<Spinner />
|
<Spinner />
|
||||||
<a href="#" className="mx_MatrixChat_splashButtons" onClick={ this.onLogoutClick }>
|
<a href="#" className="mx_MatrixChat_splashButtons" onClick={ this.onLogoutClick }>
|
||||||
Logout
|
{ _t('Logout') }
|
||||||
</a>
|
</a>
|
||||||
</div>
|
</div>
|
||||||
);
|
);
|
||||||
|
@ -1237,5 +1261,5 @@ module.exports = React.createClass({
|
||||||
/>
|
/>
|
||||||
);
|
);
|
||||||
}
|
}
|
||||||
}
|
},
|
||||||
});
|
});
|
||||||
|
|
|
@ -84,6 +84,12 @@ module.exports = React.createClass({
|
||||||
|
|
||||||
// shape parameter to be passed to EventTiles
|
// shape parameter to be passed to EventTiles
|
||||||
tileShape: React.PropTypes.string,
|
tileShape: React.PropTypes.string,
|
||||||
|
|
||||||
|
// show twelve hour timestamps
|
||||||
|
isTwelveHour: React.PropTypes.bool,
|
||||||
|
|
||||||
|
// show timestamps always
|
||||||
|
alwaysShowTimestamps: React.PropTypes.bool,
|
||||||
},
|
},
|
||||||
|
|
||||||
componentWillMount: function() {
|
componentWillMount: function() {
|
||||||
|
@ -230,8 +236,8 @@ module.exports = React.createClass({
|
||||||
},
|
},
|
||||||
|
|
||||||
_getEventTiles: function() {
|
_getEventTiles: function() {
|
||||||
var EventTile = sdk.getComponent('rooms.EventTile');
|
const EventTile = sdk.getComponent('rooms.EventTile');
|
||||||
var DateSeparator = sdk.getComponent('messages.DateSeparator');
|
const DateSeparator = sdk.getComponent('messages.DateSeparator');
|
||||||
const MemberEventListSummary = sdk.getComponent('views.elements.MemberEventListSummary');
|
const MemberEventListSummary = sdk.getComponent('views.elements.MemberEventListSummary');
|
||||||
|
|
||||||
this.eventNodes = {};
|
this.eventNodes = {};
|
||||||
|
@ -279,20 +285,19 @@ module.exports = React.createClass({
|
||||||
this.currentGhostEventId = null;
|
this.currentGhostEventId = null;
|
||||||
}
|
}
|
||||||
|
|
||||||
var isMembershipChange = (e) =>
|
var isMembershipChange = (e) => e.getType() === 'm.room.member';
|
||||||
e.getType() === 'm.room.member'
|
|
||||||
&& (!e.getPrevContent() || e.getContent().membership !== e.getPrevContent().membership);
|
|
||||||
|
|
||||||
for (i = 0; i < this.props.events.length; i++) {
|
for (i = 0; i < this.props.events.length; i++) {
|
||||||
var mxEv = this.props.events[i];
|
let mxEv = this.props.events[i];
|
||||||
var wantTile = true;
|
let wantTile = true;
|
||||||
var eventId = mxEv.getId();
|
let eventId = mxEv.getId();
|
||||||
|
let readMarkerInMels = false;
|
||||||
|
|
||||||
if (!EventTile.haveTileForEvent(mxEv)) {
|
if (!EventTile.haveTileForEvent(mxEv)) {
|
||||||
wantTile = false;
|
wantTile = false;
|
||||||
}
|
}
|
||||||
|
|
||||||
var last = (i == lastShownEventIndex);
|
let last = (i == lastShownEventIndex);
|
||||||
|
|
||||||
// Wrap consecutive member events in a ListSummary, ignore if redacted
|
// Wrap consecutive member events in a ListSummary, ignore if redacted
|
||||||
if (isMembershipChange(mxEv) &&
|
if (isMembershipChange(mxEv) &&
|
||||||
|
@ -334,6 +339,9 @@ module.exports = React.createClass({
|
||||||
|
|
||||||
let eventTiles = summarisedEvents.map(
|
let eventTiles = summarisedEvents.map(
|
||||||
(e) => {
|
(e) => {
|
||||||
|
if (e.getId() === this.props.readMarkerEventId) {
|
||||||
|
readMarkerInMels = true;
|
||||||
|
}
|
||||||
// In order to prevent DateSeparators from appearing in the expanded form
|
// In order to prevent DateSeparators from appearing in the expanded form
|
||||||
// of MemberEventListSummary, render each member event as if the previous
|
// of MemberEventListSummary, render each member event as if the previous
|
||||||
// one was itself. This way, the timestamp of the previous event === the
|
// one was itself. This way, the timestamp of the previous event === the
|
||||||
|
@ -352,12 +360,16 @@ module.exports = React.createClass({
|
||||||
<MemberEventListSummary
|
<MemberEventListSummary
|
||||||
key={key}
|
key={key}
|
||||||
events={summarisedEvents}
|
events={summarisedEvents}
|
||||||
data-scroll-token={eventId}
|
|
||||||
onToggle={this._onWidgetLoad} // Update scroll state
|
onToggle={this._onWidgetLoad} // Update scroll state
|
||||||
>
|
>
|
||||||
{eventTiles}
|
{eventTiles}
|
||||||
</MemberEventListSummary>
|
</MemberEventListSummary>
|
||||||
);
|
);
|
||||||
|
|
||||||
|
if (readMarkerInMels) {
|
||||||
|
ret.push(this._getReadMarkerTile(visible));
|
||||||
|
}
|
||||||
|
|
||||||
continue;
|
continue;
|
||||||
}
|
}
|
||||||
|
|
||||||
|
@ -407,8 +419,8 @@ module.exports = React.createClass({
|
||||||
},
|
},
|
||||||
|
|
||||||
_getTilesForEvent: function(prevEvent, mxEv, last) {
|
_getTilesForEvent: function(prevEvent, mxEv, last) {
|
||||||
var EventTile = sdk.getComponent('rooms.EventTile');
|
const EventTile = sdk.getComponent('rooms.EventTile');
|
||||||
var DateSeparator = sdk.getComponent('messages.DateSeparator');
|
const DateSeparator = sdk.getComponent('messages.DateSeparator');
|
||||||
var ret = [];
|
var ret = [];
|
||||||
|
|
||||||
// is this a continuation of the previous message?
|
// is this a continuation of the previous message?
|
||||||
|
@ -462,11 +474,10 @@ module.exports = React.createClass({
|
||||||
if (this.props.manageReadReceipts) {
|
if (this.props.manageReadReceipts) {
|
||||||
readReceipts = this._getReadReceiptsForEvent(mxEv);
|
readReceipts = this._getReadReceiptsForEvent(mxEv);
|
||||||
}
|
}
|
||||||
|
|
||||||
ret.push(
|
ret.push(
|
||||||
<li key={eventId}
|
<li key={eventId}
|
||||||
ref={this._collectEventNode.bind(this, eventId)}
|
ref={this._collectEventNode.bind(this, eventId)}
|
||||||
data-scroll-token={scrollToken}>
|
data-scroll-tokens={scrollToken}>
|
||||||
<EventTile mxEvent={mxEv} continuation={continuation}
|
<EventTile mxEvent={mxEv} continuation={continuation}
|
||||||
isRedacted={mxEv.isRedacted()}
|
isRedacted={mxEv.isRedacted()}
|
||||||
onWidgetLoad={this._onWidgetLoad}
|
onWidgetLoad={this._onWidgetLoad}
|
||||||
|
@ -476,6 +487,7 @@ module.exports = React.createClass({
|
||||||
checkUnmounting={this._isUnmounting}
|
checkUnmounting={this._isUnmounting}
|
||||||
eventSendStatus={mxEv.status}
|
eventSendStatus={mxEv.status}
|
||||||
tileShape={this.props.tileShape}
|
tileShape={this.props.tileShape}
|
||||||
|
isTwelveHour={this.props.isTwelveHour}
|
||||||
last={last} isSelectedEvent={highlight}/>
|
last={last} isSelectedEvent={highlight}/>
|
||||||
</li>
|
</li>
|
||||||
);
|
);
|
||||||
|
@ -609,8 +621,13 @@ module.exports = React.createClass({
|
||||||
var style = this.props.hidden ? { display: 'none' } : {};
|
var style = this.props.hidden ? { display: 'none' } : {};
|
||||||
style.opacity = this.props.opacity;
|
style.opacity = this.props.opacity;
|
||||||
|
|
||||||
|
var className = this.props.className + " mx_fadable";
|
||||||
|
if (this.props.alwaysShowTimestamps) {
|
||||||
|
className += " mx_MessagePanel_alwaysShowTimestamps";
|
||||||
|
}
|
||||||
|
|
||||||
return (
|
return (
|
||||||
<ScrollPanel ref="scrollPanel" className={ this.props.className + " mx_fadable" }
|
<ScrollPanel ref="scrollPanel" className={ className }
|
||||||
onScroll={ this.props.onScroll }
|
onScroll={ this.props.onScroll }
|
||||||
onResize={ this.onResize }
|
onResize={ this.onResize }
|
||||||
onFillRequest={ this.props.onFillRequest }
|
onFillRequest={ this.props.onFillRequest }
|
||||||
|
|
|
@ -16,7 +16,7 @@ limitations under the License.
|
||||||
|
|
||||||
var React = require('react');
|
var React = require('react');
|
||||||
var ReactDOM = require("react-dom");
|
var ReactDOM = require("react-dom");
|
||||||
|
import { _t } from '../../languageHandler';
|
||||||
var Matrix = require("matrix-js-sdk");
|
var Matrix = require("matrix-js-sdk");
|
||||||
var sdk = require('../../index');
|
var sdk = require('../../index');
|
||||||
var MatrixClientPeg = require("../../MatrixClientPeg");
|
var MatrixClientPeg = require("../../MatrixClientPeg");
|
||||||
|
@ -37,7 +37,6 @@ var NotificationPanel = React.createClass({
|
||||||
var Loader = sdk.getComponent("elements.Spinner");
|
var Loader = sdk.getComponent("elements.Spinner");
|
||||||
|
|
||||||
var timelineSet = MatrixClientPeg.get().getNotifTimelineSet();
|
var timelineSet = MatrixClientPeg.get().getNotifTimelineSet();
|
||||||
|
|
||||||
if (timelineSet) {
|
if (timelineSet) {
|
||||||
return (
|
return (
|
||||||
<TimelinePanel key={"NotificationPanel_" + this.props.roomId}
|
<TimelinePanel key={"NotificationPanel_" + this.props.roomId}
|
||||||
|
@ -48,7 +47,7 @@ var NotificationPanel = React.createClass({
|
||||||
showUrlPreview = { false }
|
showUrlPreview = { false }
|
||||||
opacity={ this.props.opacity }
|
opacity={ this.props.opacity }
|
||||||
tileShape="notif"
|
tileShape="notif"
|
||||||
empty="You have no visible notifications"
|
empty={ _t('You have no visible notifications') }
|
||||||
/>
|
/>
|
||||||
);
|
);
|
||||||
}
|
}
|
||||||
|
|
|
@ -14,12 +14,13 @@ See the License for the specific language governing permissions and
|
||||||
limitations under the License.
|
limitations under the License.
|
||||||
*/
|
*/
|
||||||
|
|
||||||
var React = require('react');
|
import React from 'react';
|
||||||
var sdk = require('../../index');
|
import { _t } from '../../languageHandler';
|
||||||
var dis = require("../../dispatcher");
|
import sdk from '../../index';
|
||||||
var WhoIsTyping = require("../../WhoIsTyping");
|
import dis from '../../dispatcher';
|
||||||
var MatrixClientPeg = require("../../MatrixClientPeg");
|
import WhoIsTyping from '../../WhoIsTyping';
|
||||||
const MemberAvatar = require("../views/avatars/MemberAvatar");
|
import MatrixClientPeg from '../../MatrixClientPeg';
|
||||||
|
import MemberAvatar from '../views/avatars/MemberAvatar';
|
||||||
|
|
||||||
const HIDE_DEBOUNCE_MS = 10000;
|
const HIDE_DEBOUNCE_MS = 10000;
|
||||||
const STATUS_BAR_HIDDEN = 0;
|
const STATUS_BAR_HIDDEN = 0;
|
||||||
|
@ -175,8 +176,8 @@ module.exports = React.createClass({
|
||||||
<div className="mx_RoomStatusBar_scrollDownIndicator"
|
<div className="mx_RoomStatusBar_scrollDownIndicator"
|
||||||
onClick={ this.props.onScrollToBottomClick }>
|
onClick={ this.props.onScrollToBottomClick }>
|
||||||
<img src="img/scrolldown.svg" width="24" height="24"
|
<img src="img/scrolldown.svg" width="24" height="24"
|
||||||
alt="Scroll to bottom of page"
|
alt={ _t("Scroll to bottom of page") }
|
||||||
title="Scroll to bottom of page"/>
|
title={ _t("Scroll to bottom of page") }/>
|
||||||
</div>
|
</div>
|
||||||
);
|
);
|
||||||
}
|
}
|
||||||
|
@ -250,10 +251,10 @@ module.exports = React.createClass({
|
||||||
<div className="mx_RoomStatusBar_connectionLostBar">
|
<div className="mx_RoomStatusBar_connectionLostBar">
|
||||||
<img src="img/warning.svg" width="24" height="23" title="/!\ " alt="/!\ "/>
|
<img src="img/warning.svg" width="24" height="23" title="/!\ " alt="/!\ "/>
|
||||||
<div className="mx_RoomStatusBar_connectionLostBar_title">
|
<div className="mx_RoomStatusBar_connectionLostBar_title">
|
||||||
Connectivity to the server has been lost.
|
{_t('Connectivity to the server has been lost.')}
|
||||||
</div>
|
</div>
|
||||||
<div className="mx_RoomStatusBar_connectionLostBar_desc">
|
<div className="mx_RoomStatusBar_connectionLostBar_desc">
|
||||||
Sent messages will be stored until your connection has returned.
|
{_t('Sent messages will be stored until your connection has returned.')}
|
||||||
</div>
|
</div>
|
||||||
</div>
|
</div>
|
||||||
);
|
);
|
||||||
|
@ -266,7 +267,7 @@ module.exports = React.createClass({
|
||||||
<TabCompleteBar tabComplete={this.props.tabComplete} />
|
<TabCompleteBar tabComplete={this.props.tabComplete} />
|
||||||
<div className="mx_RoomStatusBar_tabCompleteEol" title="->|">
|
<div className="mx_RoomStatusBar_tabCompleteEol" title="->|">
|
||||||
<TintableSvg src="img/eol.svg" width="22" height="16"/>
|
<TintableSvg src="img/eol.svg" width="22" height="16"/>
|
||||||
Auto-complete
|
{_t('Auto-complete')}
|
||||||
</div>
|
</div>
|
||||||
</div>
|
</div>
|
||||||
</div>
|
</div>
|
||||||
|
@ -283,13 +284,12 @@ module.exports = React.createClass({
|
||||||
<div className="mx_RoomStatusBar_connectionLostBar_desc">
|
<div className="mx_RoomStatusBar_connectionLostBar_desc">
|
||||||
<a className="mx_RoomStatusBar_resend_link"
|
<a className="mx_RoomStatusBar_resend_link"
|
||||||
onClick={ this.props.onResendAllClick }>
|
onClick={ this.props.onResendAllClick }>
|
||||||
Resend all
|
{_t('Resend all')}
|
||||||
</a> or <a
|
</a> {_t('or')} <a
|
||||||
className="mx_RoomStatusBar_resend_link"
|
className="mx_RoomStatusBar_resend_link"
|
||||||
onClick={ this.props.onCancelAllClick }>
|
onClick={ this.props.onCancelAllClick }>
|
||||||
cancel all
|
{_t('cancel all')}
|
||||||
</a> now. You can also select individual messages to
|
</a> {_t('now. You can also select individual messages to resend or cancel.')}
|
||||||
resend or cancel.
|
|
||||||
</div>
|
</div>
|
||||||
</div>
|
</div>
|
||||||
);
|
);
|
||||||
|
@ -324,7 +324,7 @@ module.exports = React.createClass({
|
||||||
if (this.props.hasActiveCall) {
|
if (this.props.hasActiveCall) {
|
||||||
return (
|
return (
|
||||||
<div className="mx_RoomStatusBar_callBar">
|
<div className="mx_RoomStatusBar_callBar">
|
||||||
<b>Active call</b>
|
<b>{_t('Active call')}</b>
|
||||||
</div>
|
</div>
|
||||||
);
|
);
|
||||||
}
|
}
|
||||||
|
|
|
@ -25,6 +25,7 @@ var ReactDOM = require("react-dom");
|
||||||
var q = require("q");
|
var q = require("q");
|
||||||
var classNames = require("classnames");
|
var classNames = require("classnames");
|
||||||
var Matrix = require("matrix-js-sdk");
|
var Matrix = require("matrix-js-sdk");
|
||||||
|
import { _t } from '../../languageHandler';
|
||||||
|
|
||||||
var UserSettingsStore = require('../../UserSettingsStore');
|
var UserSettingsStore = require('../../UserSettingsStore');
|
||||||
var MatrixClientPeg = require("../../MatrixClientPeg");
|
var MatrixClientPeg = require("../../MatrixClientPeg");
|
||||||
|
@ -124,6 +125,8 @@ module.exports = React.createClass({
|
||||||
room: null,
|
room: null,
|
||||||
roomId: null,
|
roomId: null,
|
||||||
roomLoading: true,
|
roomLoading: true,
|
||||||
|
|
||||||
|
forwardingEvent: null,
|
||||||
editingRoomSettings: false,
|
editingRoomSettings: false,
|
||||||
uploadingRoomSettings: false,
|
uploadingRoomSettings: false,
|
||||||
numUnreadMessages: 0,
|
numUnreadMessages: 0,
|
||||||
|
@ -271,6 +274,7 @@ module.exports = React.createClass({
|
||||||
|
|
||||||
this._updateConfCallNotification();
|
this._updateConfCallNotification();
|
||||||
|
|
||||||
|
window.addEventListener('beforeunload', this.onPageUnload);
|
||||||
window.addEventListener('resize', this.onResize);
|
window.addEventListener('resize', this.onResize);
|
||||||
this.onResize();
|
this.onResize();
|
||||||
|
|
||||||
|
@ -295,7 +299,7 @@ module.exports = React.createClass({
|
||||||
|
|
||||||
componentWillReceiveProps: function(newProps) {
|
componentWillReceiveProps: function(newProps) {
|
||||||
if (newProps.roomAddress != this.props.roomAddress) {
|
if (newProps.roomAddress != this.props.roomAddress) {
|
||||||
throw new Error("changing room on a RoomView is not supported");
|
throw new Error(_t("changing room on a RoomView is not supported"));
|
||||||
}
|
}
|
||||||
|
|
||||||
if (newProps.eventId != this.props.eventId) {
|
if (newProps.eventId != this.props.eventId) {
|
||||||
|
@ -353,6 +357,7 @@ module.exports = React.createClass({
|
||||||
MatrixClientPeg.get().removeListener("accountData", this.onAccountData);
|
MatrixClientPeg.get().removeListener("accountData", this.onAccountData);
|
||||||
}
|
}
|
||||||
|
|
||||||
|
window.removeEventListener('beforeunload', this.onPageUnload);
|
||||||
window.removeEventListener('resize', this.onResize);
|
window.removeEventListener('resize', this.onResize);
|
||||||
|
|
||||||
document.removeEventListener("keydown", this.onKeyDown);
|
document.removeEventListener("keydown", this.onKeyDown);
|
||||||
|
@ -365,6 +370,17 @@ module.exports = React.createClass({
|
||||||
// Tinter.tint(); // reset colourscheme
|
// Tinter.tint(); // reset colourscheme
|
||||||
},
|
},
|
||||||
|
|
||||||
|
onPageUnload(event) {
|
||||||
|
if (ContentMessages.getCurrentUploads().length > 0) {
|
||||||
|
return event.returnValue =
|
||||||
|
_t("You seem to be uploading files, are you sure you want to quit?");
|
||||||
|
} else if (this._getCallForRoom() && this.state.callState !== 'ended') {
|
||||||
|
return event.returnValue =
|
||||||
|
_t("You seem to be in a call, are you sure you want to quit?");
|
||||||
|
}
|
||||||
|
},
|
||||||
|
|
||||||
|
|
||||||
onKeyDown: function(ev) {
|
onKeyDown: function(ev) {
|
||||||
let handled = false;
|
let handled = false;
|
||||||
const isMac = navigator.platform.toUpperCase().indexOf('MAC') >= 0;
|
const isMac = navigator.platform.toUpperCase().indexOf('MAC') >= 0;
|
||||||
|
@ -438,6 +454,11 @@ module.exports = React.createClass({
|
||||||
callState: callState
|
callState: callState
|
||||||
});
|
});
|
||||||
|
|
||||||
|
break;
|
||||||
|
case 'forward_event':
|
||||||
|
this.setState({
|
||||||
|
forwardingEvent: payload.content,
|
||||||
|
});
|
||||||
break;
|
break;
|
||||||
}
|
}
|
||||||
},
|
},
|
||||||
|
@ -517,14 +538,14 @@ module.exports = React.createClass({
|
||||||
if (!userHasUsedEncryption) {
|
if (!userHasUsedEncryption) {
|
||||||
const QuestionDialog = sdk.getComponent("dialogs.QuestionDialog");
|
const QuestionDialog = sdk.getComponent("dialogs.QuestionDialog");
|
||||||
Modal.createDialog(QuestionDialog, {
|
Modal.createDialog(QuestionDialog, {
|
||||||
title: "Warning!",
|
title: _t("Warning!"),
|
||||||
hasCancelButton: false,
|
hasCancelButton: false,
|
||||||
description: (
|
description: (
|
||||||
<div>
|
<div>
|
||||||
<p>End-to-end encryption is in beta and may not be reliable.</p>
|
<p>{ _t("End-to-end encryption is in beta and may not be reliable") }.</p>
|
||||||
<p>You should <b>not</b> yet trust it to secure data.</p>
|
<p>{ _t("You should not yet trust it to secure data") }.</p>
|
||||||
<p>Devices will <b>not</b> yet be able to decrypt history from before they joined the room.</p>
|
<p>{ _t("Devices will not yet be able to decrypt history from before they joined the room") }.</p>
|
||||||
<p>Encrypted messages will not be visible on clients that do not yet implement encryption.</p>
|
<p>{ _t("Encrypted messages will not be visible on clients that do not yet implement encryption") }.</p>
|
||||||
</div>
|
</div>
|
||||||
),
|
),
|
||||||
});
|
});
|
||||||
|
@ -695,10 +716,10 @@ module.exports = React.createClass({
|
||||||
if (!unsentMessages.length) return "";
|
if (!unsentMessages.length) return "";
|
||||||
for (const event of unsentMessages) {
|
for (const event of unsentMessages) {
|
||||||
if (!event.error || event.error.name !== "UnknownDeviceError") {
|
if (!event.error || event.error.name !== "UnknownDeviceError") {
|
||||||
return "Some of your messages have not been sent.";
|
return _t("Some of your messages have not been sent") + ".";
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
return "Message not sent due to unknown devices being present";
|
return _t("Message not sent due to unknown devices being present");
|
||||||
},
|
},
|
||||||
|
|
||||||
_getUnsentMessages: function(room) {
|
_getUnsentMessages: function(room) {
|
||||||
|
@ -858,15 +879,15 @@ module.exports = React.createClass({
|
||||||
) {
|
) {
|
||||||
var NeedToRegisterDialog = sdk.getComponent("dialogs.NeedToRegisterDialog");
|
var NeedToRegisterDialog = sdk.getComponent("dialogs.NeedToRegisterDialog");
|
||||||
Modal.createDialog(NeedToRegisterDialog, {
|
Modal.createDialog(NeedToRegisterDialog, {
|
||||||
title: "Failed to join the room",
|
title: _t("Failed to join the room"),
|
||||||
description: "This room is private or inaccessible to guests. You may be able to join if you register."
|
description: _t("This room is private or inaccessible to guests. You may be able to join if you register") + "."
|
||||||
});
|
});
|
||||||
} else {
|
} else {
|
||||||
var msg = error.message ? error.message : JSON.stringify(error);
|
var msg = error.message ? error.message : JSON.stringify(error);
|
||||||
var ErrorDialog = sdk.getComponent("dialogs.ErrorDialog");
|
var ErrorDialog = sdk.getComponent("dialogs.ErrorDialog");
|
||||||
Modal.createDialog(ErrorDialog, {
|
Modal.createDialog(ErrorDialog, {
|
||||||
title: "Failed to join room",
|
title: _t("Failed to join room"),
|
||||||
description: msg
|
description: msg,
|
||||||
});
|
});
|
||||||
}
|
}
|
||||||
}).done();
|
}).done();
|
||||||
|
@ -926,8 +947,8 @@ module.exports = React.createClass({
|
||||||
if (MatrixClientPeg.get().isGuest()) {
|
if (MatrixClientPeg.get().isGuest()) {
|
||||||
var NeedToRegisterDialog = sdk.getComponent("dialogs.NeedToRegisterDialog");
|
var NeedToRegisterDialog = sdk.getComponent("dialogs.NeedToRegisterDialog");
|
||||||
Modal.createDialog(NeedToRegisterDialog, {
|
Modal.createDialog(NeedToRegisterDialog, {
|
||||||
title: "Please Register",
|
title: _t("Please Register"),
|
||||||
description: "Guest users can't upload files. Please register to upload."
|
description: _t("Guest users can't upload files. Please register to upload") + "."
|
||||||
});
|
});
|
||||||
return;
|
return;
|
||||||
}
|
}
|
||||||
|
@ -946,8 +967,8 @@ module.exports = React.createClass({
|
||||||
const ErrorDialog = sdk.getComponent("dialogs.ErrorDialog");
|
const ErrorDialog = sdk.getComponent("dialogs.ErrorDialog");
|
||||||
console.error("Failed to upload file " + file + " " + error);
|
console.error("Failed to upload file " + file + " " + error);
|
||||||
Modal.createDialog(ErrorDialog, {
|
Modal.createDialog(ErrorDialog, {
|
||||||
title: "Failed to upload file",
|
title: _t('Failed to upload file'),
|
||||||
description: ((error && error.message) ? error.message : "Server may be unavailable, overloaded, or the file too big"),
|
description: ((error && error.message) ? error.message : _t("Server may be unavailable, overloaded, or the file too big")),
|
||||||
});
|
});
|
||||||
});
|
});
|
||||||
},
|
},
|
||||||
|
@ -1033,8 +1054,8 @@ module.exports = React.createClass({
|
||||||
var ErrorDialog = sdk.getComponent("dialogs.ErrorDialog");
|
var ErrorDialog = sdk.getComponent("dialogs.ErrorDialog");
|
||||||
console.error("Search failed: " + error);
|
console.error("Search failed: " + error);
|
||||||
Modal.createDialog(ErrorDialog, {
|
Modal.createDialog(ErrorDialog, {
|
||||||
title: "Search failed",
|
title: _t("Search failed"),
|
||||||
description: ((error && error.message) ? error.message : "Server may be unavailable, overloaded, or search timed out :("),
|
description: ((error && error.message) ? error.message : _t("Server may be unavailable, overloaded, or search timed out :(")),
|
||||||
});
|
});
|
||||||
}).finally(function() {
|
}).finally(function() {
|
||||||
self.setState({
|
self.setState({
|
||||||
|
@ -1069,12 +1090,12 @@ module.exports = React.createClass({
|
||||||
if (!this.state.searchResults.next_batch) {
|
if (!this.state.searchResults.next_batch) {
|
||||||
if (this.state.searchResults.results.length == 0) {
|
if (this.state.searchResults.results.length == 0) {
|
||||||
ret.push(<li key="search-top-marker">
|
ret.push(<li key="search-top-marker">
|
||||||
<h2 className="mx_RoomView_topMarker">No results</h2>
|
<h2 className="mx_RoomView_topMarker">{ _t("No results") }</h2>
|
||||||
</li>
|
</li>
|
||||||
);
|
);
|
||||||
} else {
|
} else {
|
||||||
ret.push(<li key="search-top-marker">
|
ret.push(<li key="search-top-marker">
|
||||||
<h2 className="mx_RoomView_topMarker">No more results</h2>
|
<h2 className="mx_RoomView_topMarker">{ _t("No more results") }</h2>
|
||||||
</li>
|
</li>
|
||||||
);
|
);
|
||||||
}
|
}
|
||||||
|
@ -1111,10 +1132,10 @@ module.exports = React.createClass({
|
||||||
// it. We should tell the js sdk to go and find out about
|
// it. We should tell the js sdk to go and find out about
|
||||||
// it. But that's not an issue currently, as synapse only
|
// it. But that's not an issue currently, as synapse only
|
||||||
// returns results for rooms we're joined to.
|
// returns results for rooms we're joined to.
|
||||||
var roomName = room ? room.name : "Unknown room "+roomId;
|
var roomName = room ? room.name : _t("Unknown room %(roomId)s", { roomId: roomId });
|
||||||
|
|
||||||
ret.push(<li key={mxEv.getId() + "-room"}>
|
ret.push(<li key={mxEv.getId() + "-room"}>
|
||||||
<h1>Room: { roomName }</h1>
|
<h1>{ _t("Room") }: { roomName }</h1>
|
||||||
</li>);
|
</li>);
|
||||||
lastRoomId = roomId;
|
lastRoomId = roomId;
|
||||||
}
|
}
|
||||||
|
@ -1160,7 +1181,7 @@ module.exports = React.createClass({
|
||||||
});
|
});
|
||||||
var ErrorDialog = sdk.getComponent("dialogs.ErrorDialog");
|
var ErrorDialog = sdk.getComponent("dialogs.ErrorDialog");
|
||||||
Modal.createDialog(ErrorDialog, {
|
Modal.createDialog(ErrorDialog, {
|
||||||
title: "Failed to save settings",
|
title: _t("Failed to save settings"),
|
||||||
description: fails.map(function(result) { return result.reason; }).join("\n"),
|
description: fails.map(function(result) { return result.reason; }).join("\n"),
|
||||||
});
|
});
|
||||||
// still editing room settings
|
// still editing room settings
|
||||||
|
@ -1181,7 +1202,10 @@ module.exports = React.createClass({
|
||||||
onCancelClick: function() {
|
onCancelClick: function() {
|
||||||
console.log("updateTint from onCancelClick");
|
console.log("updateTint from onCancelClick");
|
||||||
this.updateTint();
|
this.updateTint();
|
||||||
this.setState({editingRoomSettings: false});
|
this.setState({
|
||||||
|
editingRoomSettings: false,
|
||||||
|
forwardingEvent: null,
|
||||||
|
});
|
||||||
dis.dispatch({action: 'focus_composer'});
|
dis.dispatch({action: 'focus_composer'});
|
||||||
},
|
},
|
||||||
|
|
||||||
|
@ -1196,11 +1220,11 @@ module.exports = React.createClass({
|
||||||
MatrixClientPeg.get().forget(this.state.room.roomId).done(function() {
|
MatrixClientPeg.get().forget(this.state.room.roomId).done(function() {
|
||||||
dis.dispatch({ action: 'view_next_room' });
|
dis.dispatch({ action: 'view_next_room' });
|
||||||
}, function(err) {
|
}, function(err) {
|
||||||
var errCode = err.errcode || "unknown error code";
|
var errCode = err.errcode || _t("unknown error code");
|
||||||
var ErrorDialog = sdk.getComponent("dialogs.ErrorDialog");
|
var ErrorDialog = sdk.getComponent("dialogs.ErrorDialog");
|
||||||
Modal.createDialog(ErrorDialog, {
|
Modal.createDialog(ErrorDialog, {
|
||||||
title: "Error",
|
title: _t("Error"),
|
||||||
description: `Failed to forget room (${errCode})`
|
description: _t("Failed to forget room %(errCode)s", { errCode: errCode }),
|
||||||
});
|
});
|
||||||
});
|
});
|
||||||
},
|
},
|
||||||
|
@ -1221,8 +1245,8 @@ module.exports = React.createClass({
|
||||||
var msg = error.message ? error.message : JSON.stringify(error);
|
var msg = error.message ? error.message : JSON.stringify(error);
|
||||||
var ErrorDialog = sdk.getComponent("dialogs.ErrorDialog");
|
var ErrorDialog = sdk.getComponent("dialogs.ErrorDialog");
|
||||||
Modal.createDialog(ErrorDialog, {
|
Modal.createDialog(ErrorDialog, {
|
||||||
title: "Failed to reject invite",
|
title: _t("Failed to reject invite"),
|
||||||
description: msg
|
description: msg,
|
||||||
});
|
});
|
||||||
|
|
||||||
self.setState({
|
self.setState({
|
||||||
|
@ -1276,12 +1300,7 @@ module.exports = React.createClass({
|
||||||
return;
|
return;
|
||||||
}
|
}
|
||||||
|
|
||||||
var pos = this.refs.messagePanel.getReadMarkerPosition();
|
const showBar = this.refs.messagePanel.canJumpToReadMarker();
|
||||||
|
|
||||||
// we want to show the bar if the read-marker is off the top of the
|
|
||||||
// screen.
|
|
||||||
var showBar = (pos < 0);
|
|
||||||
|
|
||||||
if (this.state.showTopUnreadMessagesBar != showBar) {
|
if (this.state.showTopUnreadMessagesBar != showBar) {
|
||||||
this.setState({showTopUnreadMessagesBar: showBar},
|
this.setState({showTopUnreadMessagesBar: showBar},
|
||||||
this.onChildResize);
|
this.onChildResize);
|
||||||
|
@ -1464,16 +1483,17 @@ module.exports = React.createClass({
|
||||||
},
|
},
|
||||||
|
|
||||||
render: function() {
|
render: function() {
|
||||||
var RoomHeader = sdk.getComponent('rooms.RoomHeader');
|
const RoomHeader = sdk.getComponent('rooms.RoomHeader');
|
||||||
var MessageComposer = sdk.getComponent('rooms.MessageComposer');
|
const MessageComposer = sdk.getComponent('rooms.MessageComposer');
|
||||||
var RoomSettings = sdk.getComponent("rooms.RoomSettings");
|
const ForwardMessage = sdk.getComponent("rooms.ForwardMessage");
|
||||||
var AuxPanel = sdk.getComponent("rooms.AuxPanel");
|
const RoomSettings = sdk.getComponent("rooms.RoomSettings");
|
||||||
var SearchBar = sdk.getComponent("rooms.SearchBar");
|
const AuxPanel = sdk.getComponent("rooms.AuxPanel");
|
||||||
var ScrollPanel = sdk.getComponent("structures.ScrollPanel");
|
const SearchBar = sdk.getComponent("rooms.SearchBar");
|
||||||
var TintableSvg = sdk.getComponent("elements.TintableSvg");
|
const ScrollPanel = sdk.getComponent("structures.ScrollPanel");
|
||||||
var RoomPreviewBar = sdk.getComponent("rooms.RoomPreviewBar");
|
const TintableSvg = sdk.getComponent("elements.TintableSvg");
|
||||||
var Loader = sdk.getComponent("elements.Spinner");
|
const RoomPreviewBar = sdk.getComponent("rooms.RoomPreviewBar");
|
||||||
var TimelinePanel = sdk.getComponent("structures.TimelinePanel");
|
const Loader = sdk.getComponent("elements.Spinner");
|
||||||
|
const TimelinePanel = sdk.getComponent("structures.TimelinePanel");
|
||||||
|
|
||||||
if (!this.state.room) {
|
if (!this.state.room) {
|
||||||
if (this.state.roomLoading) {
|
if (this.state.roomLoading) {
|
||||||
|
@ -1601,17 +1621,16 @@ module.exports = React.createClass({
|
||||||
/>;
|
/>;
|
||||||
}
|
}
|
||||||
|
|
||||||
var aux = null;
|
let aux = null;
|
||||||
if (this.state.editingRoomSettings) {
|
if (this.state.forwardingEvent !== null) {
|
||||||
|
aux = <ForwardMessage onCancelClick={this.onCancelClick} currentRoomId={this.state.room.roomId} mxEvent={this.state.forwardingEvent} />;
|
||||||
|
} else if (this.state.editingRoomSettings) {
|
||||||
aux = <RoomSettings ref="room_settings" onSaveClick={this.onSettingsSaveClick} onCancelClick={this.onCancelClick} room={this.state.room} />;
|
aux = <RoomSettings ref="room_settings" onSaveClick={this.onSettingsSaveClick} onCancelClick={this.onCancelClick} room={this.state.room} />;
|
||||||
}
|
} else if (this.state.uploadingRoomSettings) {
|
||||||
else if (this.state.uploadingRoomSettings) {
|
|
||||||
aux = <Loader/>;
|
aux = <Loader/>;
|
||||||
}
|
} else if (this.state.searching) {
|
||||||
else if (this.state.searching) {
|
|
||||||
aux = <SearchBar ref="search_bar" searchInProgress={this.state.searchInProgress } onCancelClick={this.onCancelSearchClick} onSearch={this.onSearch}/>;
|
aux = <SearchBar ref="search_bar" searchInProgress={this.state.searchInProgress } onCancelClick={this.onCancelSearchClick} onSearch={this.onSearch}/>;
|
||||||
}
|
} else if (!myMember || myMember.membership !== "join") {
|
||||||
else if (!myMember || myMember.membership !== "join") {
|
|
||||||
// We do have a room object for this room, but we're not currently in it.
|
// We do have a room object for this room, but we're not currently in it.
|
||||||
// We may have a 3rd party invite to it.
|
// We may have a 3rd party invite to it.
|
||||||
var inviterName = undefined;
|
var inviterName = undefined;
|
||||||
|
@ -1673,7 +1692,7 @@ module.exports = React.createClass({
|
||||||
|
|
||||||
if (call.type === "video") {
|
if (call.type === "video") {
|
||||||
zoomButton = (
|
zoomButton = (
|
||||||
<div className="mx_RoomView_voipButton" onClick={this.onFullscreenClick} title="Fill screen">
|
<div className="mx_RoomView_voipButton" onClick={this.onFullscreenClick} title={ _t("Fill screen") }>
|
||||||
<TintableSvg src="img/fullscreen.svg" width="29" height="22" style={{ marginTop: 1, marginRight: 4 }}/>
|
<TintableSvg src="img/fullscreen.svg" width="29" height="22" style={{ marginTop: 1, marginRight: 4 }}/>
|
||||||
</div>
|
</div>
|
||||||
);
|
);
|
||||||
|
@ -1681,14 +1700,14 @@ module.exports = React.createClass({
|
||||||
videoMuteButton =
|
videoMuteButton =
|
||||||
<div className="mx_RoomView_voipButton" onClick={this.onMuteVideoClick}>
|
<div className="mx_RoomView_voipButton" onClick={this.onMuteVideoClick}>
|
||||||
<TintableSvg src={call.isLocalVideoMuted() ? "img/video-unmute.svg" : "img/video-mute.svg"}
|
<TintableSvg src={call.isLocalVideoMuted() ? "img/video-unmute.svg" : "img/video-mute.svg"}
|
||||||
alt={call.isLocalVideoMuted() ? "Click to unmute video" : "Click to mute video"}
|
alt={call.isLocalVideoMuted() ? _t("Click to unmute video") : _t("Click to mute video")}
|
||||||
width="31" height="27"/>
|
width="31" height="27"/>
|
||||||
</div>;
|
</div>;
|
||||||
}
|
}
|
||||||
voiceMuteButton =
|
voiceMuteButton =
|
||||||
<div className="mx_RoomView_voipButton" onClick={this.onMuteAudioClick}>
|
<div className="mx_RoomView_voipButton" onClick={this.onMuteAudioClick}>
|
||||||
<TintableSvg src={call.isMicrophoneMuted() ? "img/voice-unmute.svg" : "img/voice-mute.svg"}
|
<TintableSvg src={call.isMicrophoneMuted() ? "img/voice-unmute.svg" : "img/voice-mute.svg"}
|
||||||
alt={call.isMicrophoneMuted() ? "Click to unmute audio" : "Click to mute audio"}
|
alt={call.isMicrophoneMuted() ? _t("Click to unmute audio") : _t("Click to mute audio")}
|
||||||
width="21" height="26"/>
|
width="21" height="26"/>
|
||||||
</div>;
|
</div>;
|
||||||
|
|
||||||
|
@ -1724,14 +1743,13 @@ module.exports = React.createClass({
|
||||||
}
|
}
|
||||||
|
|
||||||
// console.log("ShowUrlPreview for %s is %s", this.state.room.roomId, this.state.showUrlPreview);
|
// console.log("ShowUrlPreview for %s is %s", this.state.room.roomId, this.state.showUrlPreview);
|
||||||
|
|
||||||
var messagePanel = (
|
var messagePanel = (
|
||||||
<TimelinePanel ref={this._gatherTimelinePanelRef}
|
<TimelinePanel ref={this._gatherTimelinePanelRef}
|
||||||
timelineSet={this.state.room.getUnfilteredTimelineSet()}
|
timelineSet={this.state.room.getUnfilteredTimelineSet()}
|
||||||
manageReadReceipts={!UserSettingsStore.getSyncedSetting('hideReadReceipts', false)}
|
manageReadReceipts={!UserSettingsStore.getSyncedSetting('hideReadReceipts', false)}
|
||||||
manageReadMarkers={true}
|
manageReadMarkers={true}
|
||||||
hidden={hideMessagePanel}
|
hidden={hideMessagePanel}
|
||||||
highlightedEventId={this.props.highlightedEventId}
|
highlightedEventId={this.state.forwardingEvent ? this.state.forwardingEvent.getId() : this.props.highlightedEventId}
|
||||||
eventId={this.props.eventId}
|
eventId={this.props.eventId}
|
||||||
eventPixelOffset={this.props.eventPixelOffset}
|
eventPixelOffset={this.props.eventPixelOffset}
|
||||||
onScroll={ this.onMessageListScroll }
|
onScroll={ this.onMessageListScroll }
|
||||||
|
@ -1764,11 +1782,12 @@ module.exports = React.createClass({
|
||||||
oobData={this.props.oobData}
|
oobData={this.props.oobData}
|
||||||
editing={this.state.editingRoomSettings}
|
editing={this.state.editingRoomSettings}
|
||||||
saving={this.state.uploadingRoomSettings}
|
saving={this.state.uploadingRoomSettings}
|
||||||
|
inRoom={myMember && myMember.membership === 'join'}
|
||||||
collapsedRhs={ this.props.collapsedRhs }
|
collapsedRhs={ this.props.collapsedRhs }
|
||||||
onSearchClick={this.onSearchClick}
|
onSearchClick={this.onSearchClick}
|
||||||
onSettingsClick={this.onSettingsClick}
|
onSettingsClick={this.onSettingsClick}
|
||||||
onSaveClick={this.onSettingsSaveClick}
|
onSaveClick={this.onSettingsSaveClick}
|
||||||
onCancelClick={this.onCancelClick}
|
onCancelClick={aux ? this.onCancelClick : null}
|
||||||
onForgetClick={
|
onForgetClick={
|
||||||
(myMember && myMember.membership === "leave") ? this.onForgetClick : null
|
(myMember && myMember.membership === "leave") ? this.onForgetClick : null
|
||||||
}
|
}
|
||||||
|
|
|
@ -46,9 +46,13 @@ if (DEBUG_SCROLL) {
|
||||||
* It also provides a hook which allows parents to provide more list elements
|
* It also provides a hook which allows parents to provide more list elements
|
||||||
* when we get close to the start or end of the list.
|
* when we get close to the start or end of the list.
|
||||||
*
|
*
|
||||||
* Each child element should have a 'data-scroll-token'. This token is used to
|
* Each child element should have a 'data-scroll-tokens'. This string of
|
||||||
* serialise the scroll state, and returned as the 'trackedScrollToken'
|
* comma-separated tokens may contain a single token or many, where many indicates
|
||||||
* attribute by getScrollState().
|
* that the element contains elements that have scroll tokens themselves. The first
|
||||||
|
* token in 'data-scroll-tokens' is used to serialise the scroll state, and returned
|
||||||
|
* as the 'trackedScrollToken' attribute by getScrollState().
|
||||||
|
*
|
||||||
|
* IMPORTANT: INDIVIDUAL TOKENS WITHIN 'data-scroll-tokens' MUST NOT CONTAIN COMMAS.
|
||||||
*
|
*
|
||||||
* Some notes about the implementation:
|
* Some notes about the implementation:
|
||||||
*
|
*
|
||||||
|
@ -349,8 +353,8 @@ module.exports = React.createClass({
|
||||||
// Subtract height of tile as if it were unpaginated
|
// Subtract height of tile as if it were unpaginated
|
||||||
excessHeight -= tile.clientHeight;
|
excessHeight -= tile.clientHeight;
|
||||||
// The tile may not have a scroll token, so guard it
|
// The tile may not have a scroll token, so guard it
|
||||||
if (tile.dataset.scrollToken) {
|
if (tile.dataset.scrollTokens) {
|
||||||
markerScrollToken = tile.dataset.scrollToken;
|
markerScrollToken = tile.dataset.scrollTokens.split(',')[0];
|
||||||
}
|
}
|
||||||
if (tile.clientHeight > excessHeight) {
|
if (tile.clientHeight > excessHeight) {
|
||||||
break;
|
break;
|
||||||
|
@ -419,7 +423,8 @@ module.exports = React.createClass({
|
||||||
* scroll. false if we are tracking a particular child.
|
* scroll. false if we are tracking a particular child.
|
||||||
*
|
*
|
||||||
* string trackedScrollToken: undefined if stuckAtBottom is true; if it is
|
* string trackedScrollToken: undefined if stuckAtBottom is true; if it is
|
||||||
* false, the data-scroll-token of the child which we are tracking.
|
* false, the first token in data-scroll-tokens of the child which we are
|
||||||
|
* tracking.
|
||||||
*
|
*
|
||||||
* number pixelOffset: undefined if stuckAtBottom is true; if it is false,
|
* number pixelOffset: undefined if stuckAtBottom is true; if it is false,
|
||||||
* the number of pixels the bottom of the tracked child is above the
|
* the number of pixels the bottom of the tracked child is above the
|
||||||
|
@ -551,8 +556,10 @@ module.exports = React.createClass({
|
||||||
var messages = this.refs.itemlist.children;
|
var messages = this.refs.itemlist.children;
|
||||||
for (var i = messages.length-1; i >= 0; --i) {
|
for (var i = messages.length-1; i >= 0; --i) {
|
||||||
var m = messages[i];
|
var m = messages[i];
|
||||||
if (!m.dataset.scrollToken) continue;
|
// 'data-scroll-tokens' is a DOMString of comma-separated scroll tokens
|
||||||
if (m.dataset.scrollToken == scrollToken) {
|
// There might only be one scroll token
|
||||||
|
if (m.dataset.scrollTokens &&
|
||||||
|
m.dataset.scrollTokens.split(',').indexOf(scrollToken) !== -1) {
|
||||||
node = m;
|
node = m;
|
||||||
break;
|
break;
|
||||||
}
|
}
|
||||||
|
@ -568,7 +575,7 @@ module.exports = React.createClass({
|
||||||
var boundingRect = node.getBoundingClientRect();
|
var boundingRect = node.getBoundingClientRect();
|
||||||
var scrollDelta = boundingRect.bottom + pixelOffset - wrapperRect.bottom;
|
var scrollDelta = boundingRect.bottom + pixelOffset - wrapperRect.bottom;
|
||||||
|
|
||||||
debuglog("ScrollPanel: scrolling to token '" + node.dataset.scrollToken + "'+" +
|
debuglog("ScrollPanel: scrolling to token '" + scrollToken + "'+" +
|
||||||
pixelOffset + " (delta: "+scrollDelta+")");
|
pixelOffset + " (delta: "+scrollDelta+")");
|
||||||
|
|
||||||
if(scrollDelta != 0) {
|
if(scrollDelta != 0) {
|
||||||
|
@ -591,12 +598,12 @@ module.exports = React.createClass({
|
||||||
|
|
||||||
for (var i = messages.length-1; i >= 0; --i) {
|
for (var i = messages.length-1; i >= 0; --i) {
|
||||||
var node = messages[i];
|
var node = messages[i];
|
||||||
if (!node.dataset.scrollToken) continue;
|
if (!node.dataset.scrollTokens) continue;
|
||||||
|
|
||||||
var boundingRect = node.getBoundingClientRect();
|
var boundingRect = node.getBoundingClientRect();
|
||||||
newScrollState = {
|
newScrollState = {
|
||||||
stuckAtBottom: false,
|
stuckAtBottom: false,
|
||||||
trackedScrollToken: node.dataset.scrollToken,
|
trackedScrollToken: node.dataset.scrollTokens.split(',')[0],
|
||||||
pixelOffset: wrapperRect.bottom - boundingRect.bottom,
|
pixelOffset: wrapperRect.bottom - boundingRect.bottom,
|
||||||
};
|
};
|
||||||
// If the bottom of the panel intersects the ClientRect of node, use this node
|
// If the bottom of the panel intersects the ClientRect of node, use this node
|
||||||
|
@ -608,7 +615,7 @@ module.exports = React.createClass({
|
||||||
break;
|
break;
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
// This is only false if there were no nodes with `node.dataset.scrollToken` set.
|
// This is only false if there were no nodes with `node.dataset.scrollTokens` set.
|
||||||
if (newScrollState) {
|
if (newScrollState) {
|
||||||
this.scrollState = newScrollState;
|
this.scrollState = newScrollState;
|
||||||
debuglog("ScrollPanel: saved scroll state", this.scrollState);
|
debuglog("ScrollPanel: saved scroll state", this.scrollState);
|
||||||
|
|
|
@ -1,5 +1,6 @@
|
||||||
/*
|
/*
|
||||||
Copyright 2016 OpenMarket Ltd
|
Copyright 2016 OpenMarket Ltd
|
||||||
|
Copyright 2017 Vector Creations Ltd
|
||||||
|
|
||||||
Licensed under the Apache License, Version 2.0 (the "License");
|
Licensed under the Apache License, Version 2.0 (the "License");
|
||||||
you may not use this file except in compliance with the License.
|
you may not use this file except in compliance with the License.
|
||||||
|
@ -22,12 +23,14 @@ var Matrix = require("matrix-js-sdk");
|
||||||
var EventTimeline = Matrix.EventTimeline;
|
var EventTimeline = Matrix.EventTimeline;
|
||||||
|
|
||||||
var sdk = require('../../index');
|
var sdk = require('../../index');
|
||||||
|
import { _t } from '../../languageHandler';
|
||||||
var MatrixClientPeg = require("../../MatrixClientPeg");
|
var MatrixClientPeg = require("../../MatrixClientPeg");
|
||||||
var dis = require("../../dispatcher");
|
var dis = require("../../dispatcher");
|
||||||
var ObjectUtils = require('../../ObjectUtils');
|
var ObjectUtils = require('../../ObjectUtils');
|
||||||
var Modal = require("../../Modal");
|
var Modal = require("../../Modal");
|
||||||
var UserActivity = require("../../UserActivity");
|
var UserActivity = require("../../UserActivity");
|
||||||
var KeyCode = require('../../KeyCode');
|
var KeyCode = require('../../KeyCode');
|
||||||
|
import UserSettingsStore from '../../UserSettingsStore';
|
||||||
|
|
||||||
var PAGINATE_SIZE = 20;
|
var PAGINATE_SIZE = 20;
|
||||||
var INITIAL_SIZE = 20;
|
var INITIAL_SIZE = 20;
|
||||||
|
@ -121,7 +124,7 @@ var TimelinePanel = React.createClass({
|
||||||
let initialReadMarker = null;
|
let initialReadMarker = null;
|
||||||
if (this.props.manageReadMarkers) {
|
if (this.props.manageReadMarkers) {
|
||||||
const readmarker = this.props.timelineSet.room.getAccountData('m.fully_read');
|
const readmarker = this.props.timelineSet.room.getAccountData('m.fully_read');
|
||||||
if (readmarker){
|
if (readmarker) {
|
||||||
initialReadMarker = readmarker.getContent().event_id;
|
initialReadMarker = readmarker.getContent().event_id;
|
||||||
} else {
|
} else {
|
||||||
initialReadMarker = this._getCurrentReadReceipt();
|
initialReadMarker = this._getCurrentReadReceipt();
|
||||||
|
@ -167,14 +170,23 @@ var TimelinePanel = React.createClass({
|
||||||
|
|
||||||
backPaginating: false,
|
backPaginating: false,
|
||||||
forwardPaginating: false,
|
forwardPaginating: false,
|
||||||
|
|
||||||
|
// cache of matrixClient.getSyncState() (but from the 'sync' event)
|
||||||
|
clientSyncState: MatrixClientPeg.get().getSyncState(),
|
||||||
|
|
||||||
|
// should the event tiles have twelve hour times
|
||||||
|
isTwelveHour: UserSettingsStore.getSyncedSetting('showTwelveHourTimestamps'),
|
||||||
|
|
||||||
|
// always show timestamps on event tiles?
|
||||||
|
alwaysShowTimestamps: UserSettingsStore.getSyncedSetting('alwaysShowTimestamps'),
|
||||||
};
|
};
|
||||||
},
|
},
|
||||||
|
|
||||||
componentWillMount: function() {
|
componentWillMount: function() {
|
||||||
debuglog("TimelinePanel: mounting");
|
debuglog("TimelinePanel: mounting");
|
||||||
|
|
||||||
this.last_rr_sent_event_id = undefined;
|
this.lastRRSentEventId = undefined;
|
||||||
this.last_rm_sent_event_id = undefined;
|
this.lastRMSentEventId = undefined;
|
||||||
|
|
||||||
this.dispatcherRef = dis.register(this.onAction);
|
this.dispatcherRef = dis.register(this.onAction);
|
||||||
MatrixClientPeg.get().on("Room.timeline", this.onRoomTimeline);
|
MatrixClientPeg.get().on("Room.timeline", this.onRoomTimeline);
|
||||||
|
@ -183,6 +195,7 @@ var TimelinePanel = React.createClass({
|
||||||
MatrixClientPeg.get().on("Room.receipt", this.onRoomReceipt);
|
MatrixClientPeg.get().on("Room.receipt", this.onRoomReceipt);
|
||||||
MatrixClientPeg.get().on("Room.localEchoUpdated", this.onLocalEchoUpdated);
|
MatrixClientPeg.get().on("Room.localEchoUpdated", this.onLocalEchoUpdated);
|
||||||
MatrixClientPeg.get().on("Room.accountData", this.onAccountData);
|
MatrixClientPeg.get().on("Room.accountData", this.onAccountData);
|
||||||
|
MatrixClientPeg.get().on("sync", this.onSync);
|
||||||
|
|
||||||
this._initTimeline(this.props);
|
this._initTimeline(this.props);
|
||||||
},
|
},
|
||||||
|
@ -251,6 +264,7 @@ var TimelinePanel = React.createClass({
|
||||||
client.removeListener("Room.receipt", this.onRoomReceipt);
|
client.removeListener("Room.receipt", this.onRoomReceipt);
|
||||||
client.removeListener("Room.localEchoUpdated", this.onLocalEchoUpdated);
|
client.removeListener("Room.localEchoUpdated", this.onLocalEchoUpdated);
|
||||||
client.removeListener("Room.accountData", this.onAccountData);
|
client.removeListener("Room.accountData", this.onAccountData);
|
||||||
|
client.removeListener("sync", this.onSync);
|
||||||
}
|
}
|
||||||
},
|
},
|
||||||
|
|
||||||
|
@ -487,17 +501,24 @@ var TimelinePanel = React.createClass({
|
||||||
}, this.props.onReadMarkerUpdated);
|
}, this.props.onReadMarkerUpdated);
|
||||||
},
|
},
|
||||||
|
|
||||||
|
onSync: function(state, prevState, data) {
|
||||||
|
this.setState({clientSyncState: state});
|
||||||
|
},
|
||||||
|
|
||||||
sendReadReceipt: function() {
|
sendReadReceipt: function() {
|
||||||
if (!this.refs.messagePanel) return;
|
if (!this.refs.messagePanel) return;
|
||||||
if (!this.props.manageReadReceipts) return;
|
if (!this.props.manageReadReceipts) return;
|
||||||
// This happens on user_activity_end which is delayed, and it's
|
// This happens on user_activity_end which is delayed, and it's
|
||||||
// very possible have logged out within that timeframe, so check
|
// very possible have logged out within that timeframe, so check
|
||||||
// we still have a client.
|
// we still have a client.
|
||||||
if (!MatrixClientPeg.get()) return;
|
const cli = MatrixClientPeg.get();
|
||||||
|
// if no client or client is guest don't send RR or RM
|
||||||
|
if (!cli || cli.isGuest()) return;
|
||||||
|
|
||||||
var currentReadUpToEventId = this._getCurrentReadReceipt(true);
|
let shouldSendRR = true;
|
||||||
var currentReadUpToEventIndex = this._indexForEventId(currentReadUpToEventId);
|
|
||||||
|
|
||||||
|
const currentRREventId = this._getCurrentReadReceipt(true);
|
||||||
|
const currentRREventIndex = this._indexForEventId(currentRREventId);
|
||||||
// We want to avoid sending out read receipts when we are looking at
|
// We want to avoid sending out read receipts when we are looking at
|
||||||
// events in the past which are before the latest RR.
|
// events in the past which are before the latest RR.
|
||||||
//
|
//
|
||||||
|
@ -511,43 +532,60 @@ var TimelinePanel = React.createClass({
|
||||||
// RRs) - but that is a bit of a niche case. It will sort itself out when
|
// RRs) - but that is a bit of a niche case. It will sort itself out when
|
||||||
// the user eventually hits the live timeline.
|
// the user eventually hits the live timeline.
|
||||||
//
|
//
|
||||||
if (currentReadUpToEventId && currentReadUpToEventIndex === null &&
|
if (currentRREventId && currentRREventIndex === null &&
|
||||||
this._timelineWindow.canPaginate(EventTimeline.FORWARDS)) {
|
this._timelineWindow.canPaginate(EventTimeline.FORWARDS)) {
|
||||||
return;
|
shouldSendRR = false;
|
||||||
}
|
}
|
||||||
|
|
||||||
var lastReadEventIndex = this._getLastDisplayedEventIndex({
|
const lastReadEventIndex = this._getLastDisplayedEventIndex({
|
||||||
ignoreOwn: true
|
ignoreOwn: true,
|
||||||
});
|
});
|
||||||
if (lastReadEventIndex === null) return;
|
if (lastReadEventIndex === null) {
|
||||||
|
shouldSendRR = false;
|
||||||
|
}
|
||||||
|
let lastReadEvent = this.state.events[lastReadEventIndex];
|
||||||
|
shouldSendRR = shouldSendRR &&
|
||||||
|
// Only send a RR if the last read event is ahead in the timeline relative to
|
||||||
|
// the current RR event.
|
||||||
|
lastReadEventIndex > currentRREventIndex &&
|
||||||
|
// Only send a RR if the last RR set != the one we would send
|
||||||
|
this.lastRRSentEventId != lastReadEvent.getId();
|
||||||
|
|
||||||
var lastReadEvent = this.state.events[lastReadEventIndex];
|
// Only send a RM if the last RM sent != the one we would send
|
||||||
|
const shouldSendRM =
|
||||||
|
this.lastRMSentEventId != this.state.readMarkerEventId;
|
||||||
|
|
||||||
// we also remember the last read receipt we sent to avoid spamming the
|
// we also remember the last read receipt we sent to avoid spamming the
|
||||||
// same one at the server repeatedly
|
// same one at the server repeatedly
|
||||||
if ((lastReadEventIndex > currentReadUpToEventIndex &&
|
if (shouldSendRR || shouldSendRM) {
|
||||||
this.last_rr_sent_event_id != lastReadEvent.getId()) ||
|
if (shouldSendRR) {
|
||||||
this.last_rm_sent_event_id != this.state.readMarkerEventId) {
|
this.lastRRSentEventId = lastReadEvent.getId();
|
||||||
|
} else {
|
||||||
this.last_rr_sent_event_id = lastReadEvent.getId();
|
lastReadEvent = null;
|
||||||
this.last_rm_sent_event_id = this.state.readMarkerEventId;
|
}
|
||||||
|
this.lastRMSentEventId = this.state.readMarkerEventId;
|
||||||
|
|
||||||
|
debuglog('TimelinePanel: Sending Read Markers for ',
|
||||||
|
this.props.timelineSet.room.roomId,
|
||||||
|
'rm', this.state.readMarkerEventId,
|
||||||
|
lastReadEvent ? 'rr ' + lastReadEvent.getId() : '',
|
||||||
|
);
|
||||||
MatrixClientPeg.get().setRoomReadMarkers(
|
MatrixClientPeg.get().setRoomReadMarkers(
|
||||||
this.props.timelineSet.room.roomId,
|
this.props.timelineSet.room.roomId,
|
||||||
this.state.readMarkerEventId,
|
this.state.readMarkerEventId,
|
||||||
lastReadEvent
|
lastReadEvent, // Could be null, in which case no RR is sent
|
||||||
).catch((e) => {
|
).catch((e) => {
|
||||||
// /read_markers API is not implemented on this HS, fallback to just RR
|
// /read_markers API is not implemented on this HS, fallback to just RR
|
||||||
if (e.errcode === 'M_UNRECOGNIZED') {
|
if (e.errcode === 'M_UNRECOGNIZED' && lastReadEvent) {
|
||||||
return MatrixClientPeg.get().sendReadReceipt(
|
return MatrixClientPeg.get().sendReadReceipt(
|
||||||
lastReadEvent
|
lastReadEvent,
|
||||||
).catch(() => {
|
).catch(() => {
|
||||||
this.last_rr_sent_event_id = undefined;
|
this.lastRRSentEventId = undefined;
|
||||||
});
|
});
|
||||||
}
|
}
|
||||||
// it failed, so allow retries next time the user is active
|
// it failed, so allow retries next time the user is active
|
||||||
this.last_rr_sent_event_id = undefined;
|
this.lastRRSentEventId = undefined;
|
||||||
this.last_rm_sent_event_id = undefined;
|
this.lastRMSentEventId = undefined;
|
||||||
});
|
});
|
||||||
|
|
||||||
// do a quick-reset of our unreadNotificationCount to avoid having
|
// do a quick-reset of our unreadNotificationCount to avoid having
|
||||||
|
@ -560,7 +598,6 @@ var TimelinePanel = React.createClass({
|
||||||
this.props.timelineSet.room.setUnreadNotificationCount('highlight', 0);
|
this.props.timelineSet.room.setUnreadNotificationCount('highlight', 0);
|
||||||
dis.dispatch({
|
dis.dispatch({
|
||||||
action: 'on_room_read',
|
action: 'on_room_read',
|
||||||
room: this.props.timelineSet.room,
|
|
||||||
});
|
});
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
@ -756,6 +793,19 @@ var TimelinePanel = React.createClass({
|
||||||
return null;
|
return null;
|
||||||
},
|
},
|
||||||
|
|
||||||
|
canJumpToReadMarker: function() {
|
||||||
|
// 1. Do not show jump bar if neither the RM nor the RR are set.
|
||||||
|
// 2. Only show jump bar if RR !== RM. If they are the same, there are only fully
|
||||||
|
// read messages and unread messages. We already have a badge count and the bottom
|
||||||
|
// bar to jump to "live" when we have unread messages.
|
||||||
|
// 3. We want to show the bar if the read-marker is off the top of the screen.
|
||||||
|
// 4. Also, if pos === null, the event might not be paginated - show the unread bar
|
||||||
|
const pos = this.getReadMarkerPosition();
|
||||||
|
return this.state.readMarkerEventId !== null && // 1.
|
||||||
|
this.state.readMarkerEventId !== this._getCurrentReadReceipt() && // 2.
|
||||||
|
(pos < 0 || pos === null); // 3., 4.
|
||||||
|
},
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* called by the parent component when PageUp/Down/etc is pressed.
|
* called by the parent component when PageUp/Down/etc is pressed.
|
||||||
*
|
*
|
||||||
|
@ -865,14 +915,11 @@ var TimelinePanel = React.createClass({
|
||||||
});
|
});
|
||||||
};
|
};
|
||||||
}
|
}
|
||||||
var message = "Tried to load a specific point in this room's timeline, but ";
|
var message = (error.errcode == 'M_FORBIDDEN')
|
||||||
if (error.errcode == 'M_FORBIDDEN') {
|
? _t("Tried to load a specific point in this room's timeline, but you do not have permission to view the message in question") + "."
|
||||||
message += "you do not have permission to view the message in question.";
|
: _t("Tried to load a specific point in this room's timeline, but was unable to find it") + ".";
|
||||||
} else {
|
|
||||||
message += "was unable to find it.";
|
|
||||||
}
|
|
||||||
Modal.createDialog(ErrorDialog, {
|
Modal.createDialog(ErrorDialog, {
|
||||||
title: "Failed to load timeline position",
|
title: _t("Failed to load timeline position"),
|
||||||
description: message,
|
description: message,
|
||||||
onFinished: onFinished,
|
onFinished: onFinished,
|
||||||
});
|
});
|
||||||
|
@ -1058,11 +1105,17 @@ var TimelinePanel = React.createClass({
|
||||||
// events when viewing historical messages, we get stuck in a loop
|
// events when viewing historical messages, we get stuck in a loop
|
||||||
// of paginating our way through the entire history of the room.
|
// of paginating our way through the entire history of the room.
|
||||||
var stickyBottom = !this._timelineWindow.canPaginate(EventTimeline.FORWARDS);
|
var stickyBottom = !this._timelineWindow.canPaginate(EventTimeline.FORWARDS);
|
||||||
|
|
||||||
|
// If the state is PREPARED, we're still waiting for the js-sdk to sync with
|
||||||
|
// the HS and fetch the latest events, so we are effectively forward paginating.
|
||||||
|
const forwardPaginating = (
|
||||||
|
this.state.forwardPaginating || this.state.clientSyncState == 'PREPARED'
|
||||||
|
);
|
||||||
return (
|
return (
|
||||||
<MessagePanel ref="messagePanel"
|
<MessagePanel ref="messagePanel"
|
||||||
hidden={ this.props.hidden }
|
hidden={ this.props.hidden }
|
||||||
backPaginating={ this.state.backPaginating }
|
backPaginating={ this.state.backPaginating }
|
||||||
forwardPaginating={ this.state.forwardPaginating }
|
forwardPaginating={ forwardPaginating }
|
||||||
events={ this.state.events }
|
events={ this.state.events }
|
||||||
highlightedEventId={ this.props.highlightedEventId }
|
highlightedEventId={ this.props.highlightedEventId }
|
||||||
readMarkerEventId={ this.state.readMarkerEventId }
|
readMarkerEventId={ this.state.readMarkerEventId }
|
||||||
|
@ -1076,6 +1129,8 @@ var TimelinePanel = React.createClass({
|
||||||
onFillRequest={ this.onMessageListFillRequest }
|
onFillRequest={ this.onMessageListFillRequest }
|
||||||
onUnfillRequest={ this.onMessageListUnfillRequest }
|
onUnfillRequest={ this.onMessageListUnfillRequest }
|
||||||
opacity={ this.props.opacity }
|
opacity={ this.props.opacity }
|
||||||
|
isTwelveHour={ this.state.isTwelveHour }
|
||||||
|
alwaysShowTimestamps={ this.state.alwaysShowTimestamps }
|
||||||
className={ this.props.className }
|
className={ this.props.className }
|
||||||
tileShape={ this.props.tileShape }
|
tileShape={ this.props.tileShape }
|
||||||
/>
|
/>
|
||||||
|
|
|
@ -14,35 +14,49 @@ WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
||||||
See the License for the specific language governing permissions and
|
See the License for the specific language governing permissions and
|
||||||
limitations under the License.
|
limitations under the License.
|
||||||
*/
|
*/
|
||||||
var React = require('react');
|
const React = require('react');
|
||||||
var ReactDOM = require('react-dom');
|
const ReactDOM = require('react-dom');
|
||||||
var sdk = require('../../index');
|
const sdk = require('../../index');
|
||||||
var MatrixClientPeg = require("../../MatrixClientPeg");
|
const MatrixClientPeg = require("../../MatrixClientPeg");
|
||||||
var PlatformPeg = require("../../PlatformPeg");
|
const PlatformPeg = require("../../PlatformPeg");
|
||||||
var Modal = require('../../Modal');
|
const Modal = require('../../Modal');
|
||||||
var dis = require("../../dispatcher");
|
const dis = require("../../dispatcher");
|
||||||
var q = require('q');
|
const q = require('q');
|
||||||
var package_json = require('../../../package.json');
|
const packageJson = require('../../../package.json');
|
||||||
var UserSettingsStore = require('../../UserSettingsStore');
|
const UserSettingsStore = require('../../UserSettingsStore');
|
||||||
var GeminiScrollbar = require('react-gemini-scrollbar');
|
const GeminiScrollbar = require('react-gemini-scrollbar');
|
||||||
var Email = require('../../email');
|
const Email = require('../../email');
|
||||||
var AddThreepid = require('../../AddThreepid');
|
const AddThreepid = require('../../AddThreepid');
|
||||||
var SdkConfig = require('../../SdkConfig');
|
const SdkConfig = require('../../SdkConfig');
|
||||||
import AccessibleButton from '../views/elements/AccessibleButton';
|
import AccessibleButton from '../views/elements/AccessibleButton';
|
||||||
|
import { _t } from '../../languageHandler';
|
||||||
|
import * as languageHandler from '../../languageHandler';
|
||||||
|
import * as FormattingUtils from '../../utils/FormattingUtils';
|
||||||
|
|
||||||
// if this looks like a release, use the 'version' from package.json; else use
|
// if this looks like a release, use the 'version' from package.json; else use
|
||||||
// the git sha. Prepend version with v, to look like riot-web version
|
// the git sha. Prepend version with v, to look like riot-web version
|
||||||
const REACT_SDK_VERSION = 'dist' in package_json ? `v${package_json.version}` : package_json.gitHead || '<local>';
|
const REACT_SDK_VERSION = 'dist' in packageJson ? packageJson.version : packageJson.gitHead || '<local>';
|
||||||
|
|
||||||
// Simple method to help prettify GH Release Tags and Commit Hashes.
|
// Simple method to help prettify GH Release Tags and Commit Hashes.
|
||||||
const GHVersionUrl = function(repo, token) {
|
const semVerRegex = /^v?(\d+\.\d+\.\d+(?:-rc.+)?)(?:-(?:\d+-g)?([0-9a-fA-F]+))?(?:-dirty)?$/i;
|
||||||
const uriTail = (token.startsWith('v') && token.includes('.')) ? `releases/tag/${token}` : `commit/${token}`;
|
const gHVersionLabel = function(repo, token='') {
|
||||||
return `https://github.com/${repo}/${uriTail}`;
|
const match = token.match(semVerRegex);
|
||||||
}
|
let url;
|
||||||
|
if (match && match[1]) { // basic semVer string possibly with commit hash
|
||||||
|
url = (match.length > 1 && match[2])
|
||||||
|
? `https://github.com/${repo}/commit/${match[2]}`
|
||||||
|
: `https://github.com/${repo}/releases/tag/v${match[1]}`;
|
||||||
|
} else {
|
||||||
|
url = `https://github.com/${repo}/commit/${token.split('-')[0]}`;
|
||||||
|
}
|
||||||
|
return <a target="_blank" rel="noopener" href={url}>{token}</a>;
|
||||||
|
};
|
||||||
|
|
||||||
// Enumerate some simple 'flip a bit' UI settings (if any).
|
// Enumerate some simple 'flip a bit' UI settings (if any).
|
||||||
// 'id' gives the key name in the im.vector.web.settings account data event
|
// 'id' gives the key name in the im.vector.web.settings account data event
|
||||||
// 'label' is how we describe it in the UI.
|
// 'label' is how we describe it in the UI.
|
||||||
|
// Warning: Each "label" string below must be added to i18n/strings/en_EN.json,
|
||||||
|
// since they will be translated when rendered.
|
||||||
const SETTINGS_LABELS = [
|
const SETTINGS_LABELS = [
|
||||||
{
|
{
|
||||||
id: 'autoplayGifsAndVideos',
|
id: 'autoplayGifsAndVideos',
|
||||||
|
@ -50,13 +64,12 @@ const SETTINGS_LABELS = [
|
||||||
},
|
},
|
||||||
{
|
{
|
||||||
id: 'hideReadReceipts',
|
id: 'hideReadReceipts',
|
||||||
label: 'Hide read receipts'
|
label: 'Hide read receipts',
|
||||||
},
|
},
|
||||||
{
|
{
|
||||||
id: 'dontSendTypingNotifications',
|
id: 'dontSendTypingNotifications',
|
||||||
label: "Don't send typing notifications",
|
label: "Don't send typing notifications",
|
||||||
},
|
},
|
||||||
/*
|
|
||||||
{
|
{
|
||||||
id: 'alwaysShowTimestamps',
|
id: 'alwaysShowTimestamps',
|
||||||
label: 'Always show message timestamps',
|
label: 'Always show message timestamps',
|
||||||
|
@ -65,6 +78,7 @@ const SETTINGS_LABELS = [
|
||||||
id: 'showTwelveHourTimestamps',
|
id: 'showTwelveHourTimestamps',
|
||||||
label: 'Show timestamps in 12 hour format (e.g. 2:30pm)',
|
label: 'Show timestamps in 12 hour format (e.g. 2:30pm)',
|
||||||
},
|
},
|
||||||
|
/*
|
||||||
{
|
{
|
||||||
id: 'useCompactLayout',
|
id: 'useCompactLayout',
|
||||||
label: 'Use compact timeline layout',
|
label: 'Use compact timeline layout',
|
||||||
|
@ -76,6 +90,8 @@ const SETTINGS_LABELS = [
|
||||||
*/
|
*/
|
||||||
];
|
];
|
||||||
|
|
||||||
|
// Warning: Each "label" string below must be added to i18n/strings/en_EN.json,
|
||||||
|
// since they will be translated when rendered.
|
||||||
const CRYPTO_SETTINGS_LABELS = [
|
const CRYPTO_SETTINGS_LABELS = [
|
||||||
{
|
{
|
||||||
id: 'blacklistUnverifiedDevices',
|
id: 'blacklistUnverifiedDevices',
|
||||||
|
@ -106,10 +122,9 @@ const THEMES = [
|
||||||
id: 'theme',
|
id: 'theme',
|
||||||
label: 'Dark theme',
|
label: 'Dark theme',
|
||||||
value: 'dark',
|
value: 'dark',
|
||||||
}
|
},
|
||||||
];
|
];
|
||||||
|
|
||||||
|
|
||||||
module.exports = React.createClass({
|
module.exports = React.createClass({
|
||||||
displayName: 'UserSettings',
|
displayName: 'UserSettings',
|
||||||
|
|
||||||
|
@ -142,10 +157,10 @@ module.exports = React.createClass({
|
||||||
getInitialState: function() {
|
getInitialState: function() {
|
||||||
return {
|
return {
|
||||||
avatarUrl: null,
|
avatarUrl: null,
|
||||||
threePids: [],
|
threepids: [],
|
||||||
phase: "UserSettings.LOADING", // LOADING, DISPLAY
|
phase: "UserSettings.LOADING", // LOADING, DISPLAY
|
||||||
email_add_pending: false,
|
email_add_pending: false,
|
||||||
vectorVersion: null,
|
vectorVersion: undefined,
|
||||||
rejectingInvites: false,
|
rejectingInvites: false,
|
||||||
};
|
};
|
||||||
},
|
},
|
||||||
|
@ -180,13 +195,17 @@ module.exports = React.createClass({
|
||||||
});
|
});
|
||||||
this._refreshFromServer();
|
this._refreshFromServer();
|
||||||
|
|
||||||
var syncedSettings = UserSettingsStore.getSyncedSettings();
|
const syncedSettings = UserSettingsStore.getSyncedSettings();
|
||||||
if (!syncedSettings.theme) {
|
if (!syncedSettings.theme) {
|
||||||
syncedSettings.theme = 'light';
|
syncedSettings.theme = 'light';
|
||||||
}
|
}
|
||||||
this._syncedSettings = syncedSettings;
|
this._syncedSettings = syncedSettings;
|
||||||
|
|
||||||
this._localSettings = UserSettingsStore.getLocalSettings();
|
this._localSettings = UserSettingsStore.getLocalSettings();
|
||||||
|
|
||||||
|
this.setState({
|
||||||
|
language: languageHandler.getCurrentLanguage(),
|
||||||
|
});
|
||||||
},
|
},
|
||||||
|
|
||||||
componentDidMount: function() {
|
componentDidMount: function() {
|
||||||
|
@ -202,16 +221,16 @@ module.exports = React.createClass({
|
||||||
middleOpacity: 1.0,
|
middleOpacity: 1.0,
|
||||||
});
|
});
|
||||||
dis.unregister(this.dispatcherRef);
|
dis.unregister(this.dispatcherRef);
|
||||||
let cli = MatrixClientPeg.get();
|
const cli = MatrixClientPeg.get();
|
||||||
if (cli) {
|
if (cli) {
|
||||||
cli.removeListener("RoomMember.membership", this._onInviteStateChange);
|
cli.removeListener("RoomMember.membership", this._onInviteStateChange);
|
||||||
}
|
}
|
||||||
},
|
},
|
||||||
|
|
||||||
_refreshFromServer: function() {
|
_refreshFromServer: function() {
|
||||||
var self = this;
|
const self = this;
|
||||||
q.all([
|
q.all([
|
||||||
UserSettingsStore.loadProfileInfo(), UserSettingsStore.loadThreePids()
|
UserSettingsStore.loadProfileInfo(), UserSettingsStore.loadThreePids(),
|
||||||
]).done(function(resps) {
|
]).done(function(resps) {
|
||||||
self.setState({
|
self.setState({
|
||||||
avatarUrl: resps[0].avatar_url,
|
avatarUrl: resps[0].avatar_url,
|
||||||
|
@ -219,11 +238,11 @@ module.exports = React.createClass({
|
||||||
phase: "UserSettings.DISPLAY",
|
phase: "UserSettings.DISPLAY",
|
||||||
});
|
});
|
||||||
}, function(error) {
|
}, function(error) {
|
||||||
var ErrorDialog = sdk.getComponent("dialogs.ErrorDialog");
|
const ErrorDialog = sdk.getComponent("dialogs.ErrorDialog");
|
||||||
console.error("Failed to load user settings: " + error);
|
console.error("Failed to load user settings: " + error);
|
||||||
Modal.createDialog(ErrorDialog, {
|
Modal.createDialog(ErrorDialog, {
|
||||||
title: "Can't load user settings",
|
title: _t("Can't load user settings"),
|
||||||
description: ((error && error.message) ? error.message : "Server may be unavailable or overloaded"),
|
description: ((error && error.message) ? error.message : _t("Server may be unavailable or overloaded")),
|
||||||
});
|
});
|
||||||
});
|
});
|
||||||
},
|
},
|
||||||
|
@ -236,10 +255,10 @@ module.exports = React.createClass({
|
||||||
|
|
||||||
onAvatarPickerClick: function(ev) {
|
onAvatarPickerClick: function(ev) {
|
||||||
if (MatrixClientPeg.get().isGuest()) {
|
if (MatrixClientPeg.get().isGuest()) {
|
||||||
var NeedToRegisterDialog = sdk.getComponent("dialogs.NeedToRegisterDialog");
|
const NeedToRegisterDialog = sdk.getComponent("dialogs.NeedToRegisterDialog");
|
||||||
Modal.createDialog(NeedToRegisterDialog, {
|
Modal.createDialog(NeedToRegisterDialog, {
|
||||||
title: "Please Register",
|
title: _t("Please Register"),
|
||||||
description: "Guests can't set avatars. Please register.",
|
description: _t("Guests can't set avatars. Please register."),
|
||||||
});
|
});
|
||||||
return;
|
return;
|
||||||
}
|
}
|
||||||
|
@ -250,8 +269,8 @@ module.exports = React.createClass({
|
||||||
},
|
},
|
||||||
|
|
||||||
onAvatarSelected: function(ev) {
|
onAvatarSelected: function(ev) {
|
||||||
var self = this;
|
const self = this;
|
||||||
var changeAvatar = this.refs.changeAvatar;
|
const changeAvatar = this.refs.changeAvatar;
|
||||||
if (!changeAvatar) {
|
if (!changeAvatar) {
|
||||||
console.error("No ChangeAvatar found to upload image to!");
|
console.error("No ChangeAvatar found to upload image to!");
|
||||||
return;
|
return;
|
||||||
|
@ -260,33 +279,33 @@ module.exports = React.createClass({
|
||||||
// dunno if the avatar changed, re-check it.
|
// dunno if the avatar changed, re-check it.
|
||||||
self._refreshFromServer();
|
self._refreshFromServer();
|
||||||
}, function(err) {
|
}, function(err) {
|
||||||
var errMsg = (typeof err === "string") ? err : (err.error || "");
|
// const errMsg = (typeof err === "string") ? err : (err.error || "");
|
||||||
console.error("Failed to set avatar: " + err);
|
console.error("Failed to set avatar: " + err);
|
||||||
var ErrorDialog = sdk.getComponent("dialogs.ErrorDialog");
|
const ErrorDialog = sdk.getComponent("dialogs.ErrorDialog");
|
||||||
Modal.createDialog(ErrorDialog, {
|
Modal.createDialog(ErrorDialog, {
|
||||||
title: "Failed to set avatar",
|
title: _t("Failed to set avatar."),
|
||||||
description: ((err && err.message) ? err.message : "Operation failed"),
|
description: ((err && err.message) ? err.message : _t("Operation failed")),
|
||||||
});
|
});
|
||||||
});
|
});
|
||||||
},
|
},
|
||||||
|
|
||||||
onLogoutClicked: function(ev) {
|
onLogoutClicked: function(ev) {
|
||||||
var QuestionDialog = sdk.getComponent("dialogs.QuestionDialog");
|
const QuestionDialog = sdk.getComponent("dialogs.QuestionDialog");
|
||||||
Modal.createDialog(QuestionDialog, {
|
Modal.createDialog(QuestionDialog, {
|
||||||
title: "Sign out?",
|
title: _t("Sign out"),
|
||||||
description:
|
description:
|
||||||
<div>
|
<div>
|
||||||
For security, logging out will delete any end-to-end encryption keys from this browser.
|
{ _t("For security, logging out will delete any end-to-end " +
|
||||||
|
"encryption keys from this browser. If you want to be able " +
|
||||||
If you want to be able to decrypt your conversation history from future Riot sessions,
|
"to decrypt your conversation history from future Riot sessions, " +
|
||||||
please export your room keys for safe-keeping.
|
"please export your room keys for safe-keeping.") }.
|
||||||
</div>,
|
</div>,
|
||||||
button: "Sign out",
|
button: _t("Sign out"),
|
||||||
extraButtons: [
|
extraButtons: [
|
||||||
<button key="export" className="mx_Dialog_primary"
|
<button key="export" className="mx_Dialog_primary"
|
||||||
onClick={this._onExportE2eKeysClicked}>
|
onClick={this._onExportE2eKeysClicked}>
|
||||||
Export E2E room keys
|
{ _t("Export E2E room keys") }
|
||||||
</button>
|
</button>,
|
||||||
],
|
],
|
||||||
onFinished: (confirmed) => {
|
onFinished: (confirmed) => {
|
||||||
if (confirmed) {
|
if (confirmed) {
|
||||||
|
@ -300,34 +319,31 @@ module.exports = React.createClass({
|
||||||
},
|
},
|
||||||
|
|
||||||
onPasswordChangeError: function(err) {
|
onPasswordChangeError: function(err) {
|
||||||
var errMsg = err.error || "";
|
let errMsg = err.error || "";
|
||||||
if (err.httpStatus === 403) {
|
if (err.httpStatus === 403) {
|
||||||
errMsg = "Failed to change password. Is your password correct?";
|
errMsg = _t("Failed to change password. Is your password correct?");
|
||||||
}
|
} else if (err.httpStatus) {
|
||||||
else if (err.httpStatus) {
|
|
||||||
errMsg += ` (HTTP status ${err.httpStatus})`;
|
errMsg += ` (HTTP status ${err.httpStatus})`;
|
||||||
}
|
}
|
||||||
var ErrorDialog = sdk.getComponent("dialogs.ErrorDialog");
|
const ErrorDialog = sdk.getComponent("dialogs.ErrorDialog");
|
||||||
console.error("Failed to change password: " + errMsg);
|
console.error("Failed to change password: " + errMsg);
|
||||||
Modal.createDialog(ErrorDialog, {
|
Modal.createDialog(ErrorDialog, {
|
||||||
title: "Error",
|
title: _t("Error"),
|
||||||
description: errMsg
|
description: errMsg,
|
||||||
});
|
});
|
||||||
},
|
},
|
||||||
|
|
||||||
onPasswordChanged: function() {
|
onPasswordChanged: function() {
|
||||||
var ErrorDialog = sdk.getComponent("dialogs.ErrorDialog");
|
const ErrorDialog = sdk.getComponent("dialogs.ErrorDialog");
|
||||||
Modal.createDialog(ErrorDialog, {
|
Modal.createDialog(ErrorDialog, {
|
||||||
title: "Success",
|
title: _t("Success"),
|
||||||
description: `Your password was successfully changed. You will not
|
description: _t("Your password was successfully changed. You will not receive push notifications on other devices until you log back in to them") + ".",
|
||||||
receive push notifications on other devices until you
|
|
||||||
log back in to them.`
|
|
||||||
});
|
});
|
||||||
},
|
},
|
||||||
|
|
||||||
onUpgradeClicked: function() {
|
onUpgradeClicked: function() {
|
||||||
dis.dispatch({
|
dis.dispatch({
|
||||||
action: "start_upgrade_registration"
|
action: "start_upgrade_registration",
|
||||||
});
|
});
|
||||||
},
|
},
|
||||||
|
|
||||||
|
@ -341,33 +357,33 @@ module.exports = React.createClass({
|
||||||
},
|
},
|
||||||
|
|
||||||
_addEmail: function() {
|
_addEmail: function() {
|
||||||
var ErrorDialog = sdk.getComponent("dialogs.ErrorDialog");
|
const ErrorDialog = sdk.getComponent("dialogs.ErrorDialog");
|
||||||
var QuestionDialog = sdk.getComponent("dialogs.QuestionDialog");
|
const QuestionDialog = sdk.getComponent("dialogs.QuestionDialog");
|
||||||
|
|
||||||
var email_address = this.refs.add_email_input.value;
|
const emailAddress = this.refs.add_email_input.value;
|
||||||
if (!Email.looksValid(email_address)) {
|
if (!Email.looksValid(emailAddress)) {
|
||||||
Modal.createDialog(ErrorDialog, {
|
Modal.createDialog(ErrorDialog, {
|
||||||
title: "Invalid Email Address",
|
title: _t("Invalid Email Address"),
|
||||||
description: "This doesn't appear to be a valid email address",
|
description: _t("This doesn't appear to be a valid email address"),
|
||||||
});
|
});
|
||||||
return;
|
return;
|
||||||
}
|
}
|
||||||
this._addThreepid = new AddThreepid();
|
this._addThreepid = new AddThreepid();
|
||||||
// we always bind emails when registering, so let's do the
|
// we always bind emails when registering, so let's do the
|
||||||
// same here.
|
// same here.
|
||||||
this._addThreepid.addEmailAddress(email_address, true).done(() => {
|
this._addThreepid.addEmailAddress(emailAddress, true).done(() => {
|
||||||
Modal.createDialog(QuestionDialog, {
|
Modal.createDialog(QuestionDialog, {
|
||||||
title: "Verification Pending",
|
title: _t("Verification Pending"),
|
||||||
description: "Please check your email and click on the link it contains. Once this is done, click continue.",
|
description: _t("Please check your email and click on the link it contains. Once this is done, click continue."),
|
||||||
button: 'Continue',
|
button: _t('Continue'),
|
||||||
onFinished: this.onEmailDialogFinished,
|
onFinished: this.onEmailDialogFinished,
|
||||||
});
|
});
|
||||||
}, (err) => {
|
}, (err) => {
|
||||||
this.setState({email_add_pending: false});
|
this.setState({email_add_pending: false});
|
||||||
console.error("Unable to add email address " + email_address + " " + err);
|
console.error("Unable to add email address " + emailAddress + " " + err);
|
||||||
Modal.createDialog(ErrorDialog, {
|
Modal.createDialog(ErrorDialog, {
|
||||||
title: "Unable to add email address",
|
title: _t("Unable to add email address"),
|
||||||
description: ((err && err.message) ? err.message : "Operation failed"),
|
description: ((err && err.message) ? err.message : _t("Operation failed")),
|
||||||
});
|
});
|
||||||
});
|
});
|
||||||
ReactDOM.findDOMNode(this.refs.add_email_input).blur();
|
ReactDOM.findDOMNode(this.refs.add_email_input).blur();
|
||||||
|
@ -377,9 +393,9 @@ module.exports = React.createClass({
|
||||||
onRemoveThreepidClicked: function(threepid) {
|
onRemoveThreepidClicked: function(threepid) {
|
||||||
const QuestionDialog = sdk.getComponent("dialogs.QuestionDialog");
|
const QuestionDialog = sdk.getComponent("dialogs.QuestionDialog");
|
||||||
Modal.createDialog(QuestionDialog, {
|
Modal.createDialog(QuestionDialog, {
|
||||||
title: "Remove Contact Information?",
|
title: _t("Remove Contact Information?"),
|
||||||
description: "Remove " + threepid.address + "?",
|
description: _t("Remove %(threePid)s?", { threePid : threepid.address }),
|
||||||
button: 'Remove',
|
button: _t('Remove'),
|
||||||
onFinished: (submit) => {
|
onFinished: (submit) => {
|
||||||
if (submit) {
|
if (submit) {
|
||||||
this.setState({
|
this.setState({
|
||||||
|
@ -391,8 +407,8 @@ module.exports = React.createClass({
|
||||||
const ErrorDialog = sdk.getComponent("dialogs.ErrorDialog");
|
const ErrorDialog = sdk.getComponent("dialogs.ErrorDialog");
|
||||||
console.error("Unable to remove contact information: " + err);
|
console.error("Unable to remove contact information: " + err);
|
||||||
Modal.createDialog(ErrorDialog, {
|
Modal.createDialog(ErrorDialog, {
|
||||||
title: "Unable to remove contact information",
|
title: _t("Unable to remove contact information"),
|
||||||
description: ((err && err.message) ? err.message : "Operation failed"),
|
description: ((err && err.message) ? err.message : _t("Operation failed")),
|
||||||
});
|
});
|
||||||
}).done();
|
}).done();
|
||||||
}
|
}
|
||||||
|
@ -419,21 +435,21 @@ module.exports = React.createClass({
|
||||||
}, (err) => {
|
}, (err) => {
|
||||||
this.setState({email_add_pending: false});
|
this.setState({email_add_pending: false});
|
||||||
if (err.errcode == 'M_THREEPID_AUTH_FAILED') {
|
if (err.errcode == 'M_THREEPID_AUTH_FAILED') {
|
||||||
var QuestionDialog = sdk.getComponent("dialogs.QuestionDialog");
|
const QuestionDialog = sdk.getComponent("dialogs.QuestionDialog");
|
||||||
var message = "Unable to verify email address. ";
|
let message = _t("Unable to verify email address.") + " " +
|
||||||
message += "Please check your email and click on the link it contains. Once this is done, click continue.";
|
_t("Please check your email and click on the link it contains. Once this is done, click continue.");
|
||||||
Modal.createDialog(QuestionDialog, {
|
Modal.createDialog(QuestionDialog, {
|
||||||
title: "Verification Pending",
|
title: _t("Verification Pending"),
|
||||||
description: message,
|
description: message,
|
||||||
button: 'Continue',
|
button: _t('Continue'),
|
||||||
onFinished: this.onEmailDialogFinished,
|
onFinished: this.onEmailDialogFinished,
|
||||||
});
|
});
|
||||||
} else {
|
} else {
|
||||||
var ErrorDialog = sdk.getComponent("dialogs.ErrorDialog");
|
const ErrorDialog = sdk.getComponent("dialogs.ErrorDialog");
|
||||||
console.error("Unable to verify email address: " + err);
|
console.error("Unable to verify email address: " + err);
|
||||||
Modal.createDialog(ErrorDialog, {
|
Modal.createDialog(ErrorDialog, {
|
||||||
title: "Unable to verify email address",
|
title: _t("Unable to verify email address."),
|
||||||
description: ((err && err.message) ? err.message : "Operation failed"),
|
description: ((err && err.message) ? err.message : _t("Operation failed")),
|
||||||
});
|
});
|
||||||
}
|
}
|
||||||
});
|
});
|
||||||
|
@ -469,17 +485,17 @@ module.exports = React.createClass({
|
||||||
|
|
||||||
_onRejectAllInvitesClicked: function(rooms, ev) {
|
_onRejectAllInvitesClicked: function(rooms, ev) {
|
||||||
this.setState({
|
this.setState({
|
||||||
rejectingInvites: true
|
rejectingInvites: true,
|
||||||
});
|
});
|
||||||
// reject the invites
|
// reject the invites
|
||||||
let promises = rooms.map((room) => {
|
const promises = rooms.map((room) => {
|
||||||
return MatrixClientPeg.get().leave(room.roomId);
|
return MatrixClientPeg.get().leave(room.roomId);
|
||||||
});
|
});
|
||||||
// purposefully drop errors to the floor: we'll just have a non-zero number on the UI
|
// purposefully drop errors to the floor: we'll just have a non-zero number on the UI
|
||||||
// after trying to reject all the invites.
|
// after trying to reject all the invites.
|
||||||
q.allSettled(promises).then(() => {
|
q.allSettled(promises).then(() => {
|
||||||
this.setState({
|
this.setState({
|
||||||
rejectingInvites: false
|
rejectingInvites: false,
|
||||||
});
|
});
|
||||||
}).done();
|
}).done();
|
||||||
},
|
},
|
||||||
|
@ -492,7 +508,7 @@ module.exports = React.createClass({
|
||||||
}, "e2e-export");
|
}, "e2e-export");
|
||||||
}, {
|
}, {
|
||||||
matrixClient: MatrixClientPeg.get(),
|
matrixClient: MatrixClientPeg.get(),
|
||||||
}
|
},
|
||||||
);
|
);
|
||||||
},
|
},
|
||||||
|
|
||||||
|
@ -504,7 +520,7 @@ module.exports = React.createClass({
|
||||||
}, "e2e-export");
|
}, "e2e-export");
|
||||||
}, {
|
}, {
|
||||||
matrixClient: MatrixClientPeg.get(),
|
matrixClient: MatrixClientPeg.get(),
|
||||||
}
|
},
|
||||||
);
|
);
|
||||||
},
|
},
|
||||||
|
|
||||||
|
@ -523,22 +539,43 @@ module.exports = React.createClass({
|
||||||
<div>
|
<div>
|
||||||
<h3>Referral</h3>
|
<h3>Referral</h3>
|
||||||
<div className="mx_UserSettings_section">
|
<div className="mx_UserSettings_section">
|
||||||
Refer a friend to Riot: <a href={href}>{href}</a>
|
{_t("Refer a friend to Riot:")} <a href={href}>{href}</a>
|
||||||
</div>
|
</div>
|
||||||
</div>
|
</div>
|
||||||
);
|
);
|
||||||
},
|
},
|
||||||
|
|
||||||
_renderUserInterfaceSettings: function() {
|
onLanguageChange: function(newLang) {
|
||||||
var client = MatrixClientPeg.get();
|
if(this.state.language !== newLang) {
|
||||||
|
UserSettingsStore.setLocalSetting('language', newLang);
|
||||||
|
this.setState({
|
||||||
|
language: newLang,
|
||||||
|
});
|
||||||
|
PlatformPeg.get().reload();
|
||||||
|
}
|
||||||
|
},
|
||||||
|
|
||||||
|
_renderLanguageSetting: function () {
|
||||||
|
const LanguageDropdown = sdk.getComponent('views.elements.LanguageDropdown');
|
||||||
|
return <div>
|
||||||
|
<label htmlFor="languageSelector">{_t('Interface Language')}</label>
|
||||||
|
<LanguageDropdown ref="language" onOptionChange={this.onLanguageChange}
|
||||||
|
className="mx_UserSettings_language"
|
||||||
|
value={this.state.language}
|
||||||
|
/>
|
||||||
|
</div>;
|
||||||
|
},
|
||||||
|
|
||||||
|
_renderUserInterfaceSettings: function() {
|
||||||
return (
|
return (
|
||||||
<div>
|
<div>
|
||||||
<h3>User Interface</h3>
|
<h3>{ _t("User Interface") }</h3>
|
||||||
<div className="mx_UserSettings_section">
|
<div className="mx_UserSettings_section">
|
||||||
{ this._renderUrlPreviewSelector() }
|
{ this._renderUrlPreviewSelector() }
|
||||||
{ SETTINGS_LABELS.map( this._renderSyncedSetting ) }
|
{ SETTINGS_LABELS.map( this._renderSyncedSetting ) }
|
||||||
{ THEMES.map( this._renderThemeSelector ) }
|
{ THEMES.map( this._renderThemeSelector ) }
|
||||||
|
{ this._renderLanguageSetting() }
|
||||||
|
|
||||||
</div>
|
</div>
|
||||||
</div>
|
</div>
|
||||||
);
|
);
|
||||||
|
@ -549,10 +586,10 @@ module.exports = React.createClass({
|
||||||
<input id="urlPreviewsDisabled"
|
<input id="urlPreviewsDisabled"
|
||||||
type="checkbox"
|
type="checkbox"
|
||||||
defaultChecked={ UserSettingsStore.getUrlPreviewsDisabled() }
|
defaultChecked={ UserSettingsStore.getUrlPreviewsDisabled() }
|
||||||
onChange={ e => UserSettingsStore.setUrlPreviewsDisabled(e.target.checked) }
|
onChange={ (e) => UserSettingsStore.setUrlPreviewsDisabled(e.target.checked) }
|
||||||
/>
|
/>
|
||||||
<label htmlFor="urlPreviewsDisabled">
|
<label htmlFor="urlPreviewsDisabled">
|
||||||
Disable inline URL previews by default
|
{ _t("Disable inline URL previews by default") }
|
||||||
</label>
|
</label>
|
||||||
</div>;
|
</div>;
|
||||||
},
|
},
|
||||||
|
@ -562,10 +599,10 @@ module.exports = React.createClass({
|
||||||
<input id={ setting.id }
|
<input id={ setting.id }
|
||||||
type="checkbox"
|
type="checkbox"
|
||||||
defaultChecked={ this._syncedSettings[setting.id] }
|
defaultChecked={ this._syncedSettings[setting.id] }
|
||||||
onChange={ e => UserSettingsStore.setSyncedSetting(setting.id, e.target.checked) }
|
onChange={ (e) => UserSettingsStore.setSyncedSetting(setting.id, e.target.checked) }
|
||||||
/>
|
/>
|
||||||
<label htmlFor={ setting.id }>
|
<label htmlFor={ setting.id }>
|
||||||
{ setting.label }
|
{ _t(setting.label) }
|
||||||
</label>
|
</label>
|
||||||
</div>;
|
</div>;
|
||||||
},
|
},
|
||||||
|
@ -577,7 +614,7 @@ module.exports = React.createClass({
|
||||||
name={ setting.id }
|
name={ setting.id }
|
||||||
value={ setting.value }
|
value={ setting.value }
|
||||||
defaultChecked={ this._syncedSettings[setting.id] === setting.value }
|
defaultChecked={ this._syncedSettings[setting.id] === setting.value }
|
||||||
onChange={ e => {
|
onChange={ (e) => {
|
||||||
if (e.target.checked) {
|
if (e.target.checked) {
|
||||||
UserSettingsStore.setSyncedSetting(setting.id, setting.value);
|
UserSettingsStore.setSyncedSetting(setting.id, setting.value);
|
||||||
}
|
}
|
||||||
|
@ -597,7 +634,12 @@ module.exports = React.createClass({
|
||||||
_renderCryptoInfo: function() {
|
_renderCryptoInfo: function() {
|
||||||
const client = MatrixClientPeg.get();
|
const client = MatrixClientPeg.get();
|
||||||
const deviceId = client.deviceId;
|
const deviceId = client.deviceId;
|
||||||
const identityKey = client.getDeviceEd25519Key() || "<not supported>";
|
let identityKey = client.getDeviceEd25519Key();
|
||||||
|
if (!identityKey) {
|
||||||
|
identityKey = _t("<not supported>");
|
||||||
|
} else {
|
||||||
|
identityKey = FormattingUtils.formatCryptoKey(identityKey);
|
||||||
|
}
|
||||||
|
|
||||||
let importExportButtons = null;
|
let importExportButtons = null;
|
||||||
|
|
||||||
|
@ -606,18 +648,18 @@ module.exports = React.createClass({
|
||||||
<div className="mx_UserSettings_importExportButtons">
|
<div className="mx_UserSettings_importExportButtons">
|
||||||
<AccessibleButton className="mx_UserSettings_button"
|
<AccessibleButton className="mx_UserSettings_button"
|
||||||
onClick={this._onExportE2eKeysClicked}>
|
onClick={this._onExportE2eKeysClicked}>
|
||||||
Export E2E room keys
|
{ _t("Export E2E room keys") }
|
||||||
</AccessibleButton>
|
</AccessibleButton>
|
||||||
<AccessibleButton className="mx_UserSettings_button"
|
<AccessibleButton className="mx_UserSettings_button"
|
||||||
onClick={this._onImportE2eKeysClicked}>
|
onClick={this._onImportE2eKeysClicked}>
|
||||||
Import E2E room keys
|
{ _t("Import E2E room keys") }
|
||||||
</AccessibleButton>
|
</AccessibleButton>
|
||||||
</div>
|
</div>
|
||||||
);
|
);
|
||||||
}
|
}
|
||||||
return (
|
return (
|
||||||
<div>
|
<div>
|
||||||
<h3>Cryptography</h3>
|
<h3>{ _t("Cryptography") }</h3>
|
||||||
<div className="mx_UserSettings_section mx_UserSettings_cryptoSection">
|
<div className="mx_UserSettings_section mx_UserSettings_cryptoSection">
|
||||||
<ul>
|
<ul>
|
||||||
<li><label>Device ID:</label> <span><code>{deviceId}</code></span></li>
|
<li><label>Device ID:</label> <span><code>{deviceId}</code></span></li>
|
||||||
|
@ -639,8 +681,8 @@ module.exports = React.createClass({
|
||||||
type="checkbox"
|
type="checkbox"
|
||||||
defaultChecked={ this._localSettings[setting.id] }
|
defaultChecked={ this._localSettings[setting.id] }
|
||||||
onChange={
|
onChange={
|
||||||
e => {
|
(e) => {
|
||||||
UserSettingsStore.setLocalSetting(setting.id, e.target.checked)
|
UserSettingsStore.setLocalSetting(setting.id, e.target.checked);
|
||||||
if (setting.id === 'blacklistUnverifiedDevices') { // XXX: this is a bit ugly
|
if (setting.id === 'blacklistUnverifiedDevices') { // XXX: this is a bit ugly
|
||||||
client.setGlobalBlacklistUnverifiedDevices(e.target.checked);
|
client.setGlobalBlacklistUnverifiedDevices(e.target.checked);
|
||||||
}
|
}
|
||||||
|
@ -648,13 +690,13 @@ module.exports = React.createClass({
|
||||||
}
|
}
|
||||||
/>
|
/>
|
||||||
<label htmlFor={ setting.id }>
|
<label htmlFor={ setting.id }>
|
||||||
{ setting.label }
|
{ _t(setting.label) }
|
||||||
</label>
|
</label>
|
||||||
</div>;
|
</div>;
|
||||||
},
|
},
|
||||||
|
|
||||||
_renderDevicesPanel: function() {
|
_renderDevicesPanel: function() {
|
||||||
var DevicesPanel = sdk.getComponent('settings.DevicesPanel');
|
const DevicesPanel = sdk.getComponent('settings.DevicesPanel');
|
||||||
return (
|
return (
|
||||||
<div>
|
<div>
|
||||||
<h3>Devices</h3>
|
<h3>Devices</h3>
|
||||||
|
@ -665,15 +707,15 @@ module.exports = React.createClass({
|
||||||
|
|
||||||
_renderBugReport: function() {
|
_renderBugReport: function() {
|
||||||
if (!SdkConfig.get().bug_report_endpoint_url) {
|
if (!SdkConfig.get().bug_report_endpoint_url) {
|
||||||
return <div />
|
return <div />;
|
||||||
}
|
}
|
||||||
return (
|
return (
|
||||||
<div>
|
<div>
|
||||||
<h3>Bug Report</h3>
|
<h3>{ _t("Bug Report") }</h3>
|
||||||
<div className="mx_UserSettings_section">
|
<div className="mx_UserSettings_section">
|
||||||
<p>Found a bug?</p>
|
<p>{ _t("Found a bug?") }</p>
|
||||||
<button className="mx_UserSettings_button danger"
|
<button className="mx_UserSettings_button danger"
|
||||||
onClick={this._onBugReportClicked}>Report it
|
onClick={this._onBugReportClicked}>{_t('Report it')}
|
||||||
</button>
|
</button>
|
||||||
</div>
|
</div>
|
||||||
</div>
|
</div>
|
||||||
|
@ -684,20 +726,20 @@ module.exports = React.createClass({
|
||||||
// default to enabled if undefined
|
// default to enabled if undefined
|
||||||
if (this.props.enableLabs === false) return null;
|
if (this.props.enableLabs === false) return null;
|
||||||
|
|
||||||
let features = UserSettingsStore.LABS_FEATURES.map(feature => (
|
const features = UserSettingsStore.LABS_FEATURES.map((feature) => (
|
||||||
<div key={feature.id} className="mx_UserSettings_toggle">
|
<div key={feature.id} className="mx_UserSettings_toggle">
|
||||||
<input
|
<input
|
||||||
type="checkbox"
|
type="checkbox"
|
||||||
id={feature.id}
|
id={feature.id}
|
||||||
name={feature.id}
|
name={feature.id}
|
||||||
defaultChecked={ UserSettingsStore.isFeatureEnabled(feature.id) }
|
defaultChecked={ UserSettingsStore.isFeatureEnabled(feature.id) }
|
||||||
onChange={e => {
|
onChange={(e) => {
|
||||||
if (MatrixClientPeg.get().isGuest()) {
|
if (MatrixClientPeg.get().isGuest()) {
|
||||||
e.target.checked = false;
|
e.target.checked = false;
|
||||||
var NeedToRegisterDialog = sdk.getComponent("dialogs.NeedToRegisterDialog");
|
const NeedToRegisterDialog = sdk.getComponent("dialogs.NeedToRegisterDialog");
|
||||||
Modal.createDialog(NeedToRegisterDialog, {
|
Modal.createDialog(NeedToRegisterDialog, {
|
||||||
title: "Please Register",
|
title: _t("Please Register"),
|
||||||
description: "Guests can't use labs features. Please register.",
|
description: _t("Guests can't use labs features. Please register."),
|
||||||
});
|
});
|
||||||
return;
|
return;
|
||||||
}
|
}
|
||||||
|
@ -710,9 +752,9 @@ module.exports = React.createClass({
|
||||||
));
|
));
|
||||||
return (
|
return (
|
||||||
<div>
|
<div>
|
||||||
<h3>Labs</h3>
|
<h3>{ _t("Labs") }</h3>
|
||||||
<div className="mx_UserSettings_section">
|
<div className="mx_UserSettings_section">
|
||||||
<p>These are experimental features that may break in unexpected ways. Use with caution.</p>
|
<p>{ _t("These are experimental features that may break in unexpected ways") }. { _t("Use with caution") }.</p>
|
||||||
{features}
|
{features}
|
||||||
</div>
|
</div>
|
||||||
</div>
|
</div>
|
||||||
|
@ -724,10 +766,10 @@ module.exports = React.createClass({
|
||||||
if (MatrixClientPeg.get().isGuest()) return null;
|
if (MatrixClientPeg.get().isGuest()) return null;
|
||||||
|
|
||||||
return <div>
|
return <div>
|
||||||
<h3>Deactivate Account</h3>
|
<h3>{ _t("Deactivate Account") }</h3>
|
||||||
<div className="mx_UserSettings_section">
|
<div className="mx_UserSettings_section">
|
||||||
<AccessibleButton className="mx_UserSettings_button danger"
|
<AccessibleButton className="mx_UserSettings_button danger"
|
||||||
onClick={this._onDeactivateAccountClicked}>Deactivate my account
|
onClick={this._onDeactivateAccountClicked}> { _t("Deactivate my account") }
|
||||||
</AccessibleButton>
|
</AccessibleButton>
|
||||||
</div>
|
</div>
|
||||||
</div>;
|
</div>;
|
||||||
|
@ -735,25 +777,25 @@ module.exports = React.createClass({
|
||||||
|
|
||||||
_renderClearCache: function() {
|
_renderClearCache: function() {
|
||||||
return <div>
|
return <div>
|
||||||
<h3>Clear Cache</h3>
|
<h3>{ _t("Clear Cache") }</h3>
|
||||||
<div className="mx_UserSettings_section">
|
<div className="mx_UserSettings_section">
|
||||||
<AccessibleButton className="mx_UserSettings_button danger"
|
<AccessibleButton className="mx_UserSettings_button danger"
|
||||||
onClick={this._onClearCacheClicked}>
|
onClick={this._onClearCacheClicked}>
|
||||||
Clear Cache and Reload
|
{ _t("Clear Cache and Reload") }
|
||||||
</AccessibleButton>
|
</AccessibleButton>
|
||||||
</div>
|
</div>
|
||||||
</div>;
|
</div>;
|
||||||
},
|
},
|
||||||
|
|
||||||
_renderBulkOptions: function() {
|
_renderBulkOptions: function() {
|
||||||
let invitedRooms = MatrixClientPeg.get().getRooms().filter((r) => {
|
const invitedRooms = MatrixClientPeg.get().getRooms().filter((r) => {
|
||||||
return r.hasMembershipState(this._me, "invite");
|
return r.hasMembershipState(this._me, "invite");
|
||||||
});
|
});
|
||||||
if (invitedRooms.length === 0) {
|
if (invitedRooms.length === 0) {
|
||||||
return null;
|
return null;
|
||||||
}
|
}
|
||||||
|
|
||||||
let Spinner = sdk.getComponent("elements.Spinner");
|
const Spinner = sdk.getComponent("elements.Spinner");
|
||||||
|
|
||||||
let reject = <Spinner />;
|
let reject = <Spinner />;
|
||||||
if (!this.state.rejectingInvites) {
|
if (!this.state.rejectingInvites) {
|
||||||
|
@ -768,7 +810,7 @@ module.exports = React.createClass({
|
||||||
}
|
}
|
||||||
|
|
||||||
return <div>
|
return <div>
|
||||||
<h3>Bulk Options</h3>
|
<h3>{ _t("Bulk Options") }</h3>
|
||||||
<div className="mx_UserSettings_section">
|
<div className="mx_UserSettings_section">
|
||||||
{reject}
|
{reject}
|
||||||
</div>
|
</div>
|
||||||
|
@ -777,9 +819,7 @@ module.exports = React.createClass({
|
||||||
|
|
||||||
_showSpoiler: function(event) {
|
_showSpoiler: function(event) {
|
||||||
const target = event.target;
|
const target = event.target;
|
||||||
const hidden = target.getAttribute('data-spoiler');
|
target.innerHTML = target.getAttribute('data-spoiler');
|
||||||
|
|
||||||
target.innerHTML = hidden;
|
|
||||||
|
|
||||||
const range = document.createRange();
|
const range = document.createRange();
|
||||||
range.selectNodeContents(target);
|
range.selectNodeContents(target);
|
||||||
|
@ -790,12 +830,13 @@ module.exports = React.createClass({
|
||||||
},
|
},
|
||||||
|
|
||||||
nameForMedium: function(medium) {
|
nameForMedium: function(medium) {
|
||||||
if (medium == 'msisdn') return 'Phone';
|
if (medium === 'msisdn') return _t('Phone');
|
||||||
|
if (medium === 'email') return _t('Email');
|
||||||
return medium[0].toUpperCase() + medium.slice(1);
|
return medium[0].toUpperCase() + medium.slice(1);
|
||||||
},
|
},
|
||||||
|
|
||||||
presentableTextForThreepid: function(threepid) {
|
presentableTextForThreepid: function(threepid) {
|
||||||
if (threepid.medium == 'msisdn') {
|
if (threepid.medium === 'msisdn') {
|
||||||
return '+' + threepid.address;
|
return '+' + threepid.address;
|
||||||
} else {
|
} else {
|
||||||
return threepid.address;
|
return threepid.address;
|
||||||
|
@ -803,7 +844,7 @@ module.exports = React.createClass({
|
||||||
},
|
},
|
||||||
|
|
||||||
render: function() {
|
render: function() {
|
||||||
var Loader = sdk.getComponent("elements.Spinner");
|
const Loader = sdk.getComponent("elements.Spinner");
|
||||||
switch (this.state.phase) {
|
switch (this.state.phase) {
|
||||||
case "UserSettings.LOADING":
|
case "UserSettings.LOADING":
|
||||||
return (
|
return (
|
||||||
|
@ -815,18 +856,18 @@ module.exports = React.createClass({
|
||||||
throw new Error("Unknown state.phase => " + this.state.phase);
|
throw new Error("Unknown state.phase => " + this.state.phase);
|
||||||
}
|
}
|
||||||
// can only get here if phase is UserSettings.DISPLAY
|
// can only get here if phase is UserSettings.DISPLAY
|
||||||
var SimpleRoomHeader = sdk.getComponent('rooms.SimpleRoomHeader');
|
const SimpleRoomHeader = sdk.getComponent('rooms.SimpleRoomHeader');
|
||||||
var ChangeDisplayName = sdk.getComponent("views.settings.ChangeDisplayName");
|
const ChangeDisplayName = sdk.getComponent("views.settings.ChangeDisplayName");
|
||||||
var ChangePassword = sdk.getComponent("views.settings.ChangePassword");
|
const ChangePassword = sdk.getComponent("views.settings.ChangePassword");
|
||||||
var ChangeAvatar = sdk.getComponent('settings.ChangeAvatar');
|
const ChangeAvatar = sdk.getComponent('settings.ChangeAvatar');
|
||||||
var Notifications = sdk.getComponent("settings.Notifications");
|
const Notifications = sdk.getComponent("settings.Notifications");
|
||||||
var EditableText = sdk.getComponent('elements.EditableText');
|
const EditableText = sdk.getComponent('elements.EditableText');
|
||||||
|
|
||||||
var avatarUrl = (
|
const avatarUrl = (
|
||||||
this.state.avatarUrl ? MatrixClientPeg.get().mxcUrlToHttp(this.state.avatarUrl) : null
|
this.state.avatarUrl ? MatrixClientPeg.get().mxcUrlToHttp(this.state.avatarUrl) : null
|
||||||
);
|
);
|
||||||
|
|
||||||
var threepidsSection = this.state.threepids.map((val, pidIndex) => {
|
const threepidsSection = this.state.threepids.map((val, pidIndex) => {
|
||||||
const id = "3pid-" + val.address;
|
const id = "3pid-" + val.address;
|
||||||
return (
|
return (
|
||||||
<div className="mx_UserSettings_profileTableRow" key={pidIndex}>
|
<div className="mx_UserSettings_profileTableRow" key={pidIndex}>
|
||||||
|
@ -839,7 +880,7 @@ module.exports = React.createClass({
|
||||||
/>
|
/>
|
||||||
</div>
|
</div>
|
||||||
<div className="mx_UserSettings_threepidButton mx_filterFlipColor">
|
<div className="mx_UserSettings_threepidButton mx_filterFlipColor">
|
||||||
<img src="img/cancel-small.svg" width="14" height="14" alt="Remove" onClick={this.onRemoveThreepidClicked.bind(this, val)} />
|
<img src="img/cancel-small.svg" width="14" height="14" alt={ _t("Remove") } onClick={this.onRemoveThreepidClicked.bind(this, val)} />
|
||||||
</div>
|
</div>
|
||||||
</div>
|
</div>
|
||||||
);
|
);
|
||||||
|
@ -851,13 +892,14 @@ module.exports = React.createClass({
|
||||||
addEmailSection = (
|
addEmailSection = (
|
||||||
<div className="mx_UserSettings_profileTableRow" key="_newEmail">
|
<div className="mx_UserSettings_profileTableRow" key="_newEmail">
|
||||||
<div className="mx_UserSettings_profileLabelCell">
|
<div className="mx_UserSettings_profileLabelCell">
|
||||||
|
<label>{_t('Email')}</label>
|
||||||
</div>
|
</div>
|
||||||
<div className="mx_UserSettings_profileInputCell">
|
<div className="mx_UserSettings_profileInputCell">
|
||||||
<EditableText
|
<EditableText
|
||||||
ref="add_email_input"
|
ref="add_email_input"
|
||||||
className="mx_UserSettings_editable"
|
className="mx_UserSettings_editable"
|
||||||
placeholderClassName="mx_UserSettings_threepidPlaceholder"
|
placeholderClassName="mx_UserSettings_threepidPlaceholder"
|
||||||
placeholder={ "Add email address" }
|
placeholder={ _t("Add email address") }
|
||||||
blurToCancel={ false }
|
blurToCancel={ false }
|
||||||
onValueChanged={ this._onAddEmailEditFinished } />
|
onValueChanged={ this._onAddEmailEditFinished } />
|
||||||
</div>
|
</div>
|
||||||
|
@ -874,16 +916,15 @@ module.exports = React.createClass({
|
||||||
threepidsSection.push(addEmailSection);
|
threepidsSection.push(addEmailSection);
|
||||||
threepidsSection.push(addMsisdnSection);
|
threepidsSection.push(addMsisdnSection);
|
||||||
|
|
||||||
var accountJsx;
|
let accountJsx;
|
||||||
|
|
||||||
if (MatrixClientPeg.get().isGuest()) {
|
if (MatrixClientPeg.get().isGuest()) {
|
||||||
accountJsx = (
|
accountJsx = (
|
||||||
<div className="mx_UserSettings_button" onClick={this.onUpgradeClicked}>
|
<div className="mx_UserSettings_button" onClick={this.onUpgradeClicked}>
|
||||||
Create an account
|
{ _t("Create an account") }
|
||||||
</div>
|
</div>
|
||||||
);
|
);
|
||||||
}
|
} else {
|
||||||
else {
|
|
||||||
accountJsx = (
|
accountJsx = (
|
||||||
<ChangePassword
|
<ChangePassword
|
||||||
className="mx_UserSettings_accountTable"
|
className="mx_UserSettings_accountTable"
|
||||||
|
@ -895,10 +936,10 @@ module.exports = React.createClass({
|
||||||
onFinished={this.onPasswordChanged} />
|
onFinished={this.onPasswordChanged} />
|
||||||
);
|
);
|
||||||
}
|
}
|
||||||
var notification_area;
|
let notificationArea;
|
||||||
if (!MatrixClientPeg.get().isGuest() && this.state.threepids !== undefined) {
|
if (!MatrixClientPeg.get().isGuest() && this.state.threepids !== undefined) {
|
||||||
notification_area = (<div>
|
notificationArea = (<div>
|
||||||
<h3>Notifications</h3>
|
<h3>{ _t("Notifications") }</h3>
|
||||||
|
|
||||||
<div className="mx_UserSettings_section">
|
<div className="mx_UserSettings_section">
|
||||||
<Notifications threepids={this.state.threepids} brand={this.props.brand} />
|
<Notifications threepids={this.state.threepids} brand={this.props.brand} />
|
||||||
|
@ -911,13 +952,13 @@ module.exports = React.createClass({
|
||||||
// we are using a version old version of olm. We assume the former.
|
// we are using a version old version of olm. We assume the former.
|
||||||
let olmVersionString = "<not-enabled>";
|
let olmVersionString = "<not-enabled>";
|
||||||
if (olmVersion !== undefined) {
|
if (olmVersion !== undefined) {
|
||||||
olmVersionString = `v${olmVersion[0]}.${olmVersion[1]}.${olmVersion[2]}`;
|
olmVersionString = `${olmVersion[0]}.${olmVersion[1]}.${olmVersion[2]}`;
|
||||||
}
|
}
|
||||||
|
|
||||||
return (
|
return (
|
||||||
<div className="mx_UserSettings">
|
<div className="mx_UserSettings">
|
||||||
<SimpleRoomHeader
|
<SimpleRoomHeader
|
||||||
title="Settings"
|
title={ _t("Settings") }
|
||||||
collapsedRhs={ this.props.collapsedRhs }
|
collapsedRhs={ this.props.collapsedRhs }
|
||||||
onCancelClick={ this.props.onClose }
|
onCancelClick={ this.props.onClose }
|
||||||
/>
|
/>
|
||||||
|
@ -925,13 +966,13 @@ module.exports = React.createClass({
|
||||||
<GeminiScrollbar className="mx_UserSettings_body"
|
<GeminiScrollbar className="mx_UserSettings_body"
|
||||||
autoshow={true}>
|
autoshow={true}>
|
||||||
|
|
||||||
<h3>Profile</h3>
|
<h3>{ _t("Profile") }</h3>
|
||||||
|
|
||||||
<div className="mx_UserSettings_section">
|
<div className="mx_UserSettings_section">
|
||||||
<div className="mx_UserSettings_profileTable">
|
<div className="mx_UserSettings_profileTable">
|
||||||
<div className="mx_UserSettings_profileTableRow">
|
<div className="mx_UserSettings_profileTableRow">
|
||||||
<div className="mx_UserSettings_profileLabelCell">
|
<div className="mx_UserSettings_profileLabelCell">
|
||||||
<label htmlFor="displayName">Display name</label>
|
<label htmlFor="displayName">{ _t('Display name') }</label>
|
||||||
</div>
|
</div>
|
||||||
<div className="mx_UserSettings_profileInputCell">
|
<div className="mx_UserSettings_profileInputCell">
|
||||||
<ChangeDisplayName />
|
<ChangeDisplayName />
|
||||||
|
@ -948,7 +989,7 @@ module.exports = React.createClass({
|
||||||
<div className="mx_UserSettings_avatarPicker_edit">
|
<div className="mx_UserSettings_avatarPicker_edit">
|
||||||
<label htmlFor="avatarInput" ref="file_label">
|
<label htmlFor="avatarInput" ref="file_label">
|
||||||
<img src="img/camera.svg" className="mx_filterFlipColor"
|
<img src="img/camera.svg" className="mx_filterFlipColor"
|
||||||
alt="Upload avatar" title="Upload avatar"
|
alt={ _t("Upload avatar") } title={ _t("Upload avatar") }
|
||||||
width="17" height="15" />
|
width="17" height="15" />
|
||||||
</label>
|
</label>
|
||||||
<input id="avatarInput" type="file" onChange={this.onAvatarSelected}/>
|
<input id="avatarInput" type="file" onChange={this.onAvatarSelected}/>
|
||||||
|
@ -956,12 +997,12 @@ module.exports = React.createClass({
|
||||||
</div>
|
</div>
|
||||||
</div>
|
</div>
|
||||||
|
|
||||||
<h3>Account</h3>
|
<h3>{ _t("Account") }</h3>
|
||||||
|
|
||||||
<div className="mx_UserSettings_section">
|
<div className="mx_UserSettings_section cadcampoHide">
|
||||||
|
|
||||||
<AccessibleButton className="mx_UserSettings_logout mx_UserSettings_button" onClick={this.onLogoutClicked}>
|
<AccessibleButton className="mx_UserSettings_logout mx_UserSettings_button" onClick={this.onLogoutClicked}>
|
||||||
Sign out
|
{ _t("Sign out") }
|
||||||
</AccessibleButton>
|
</AccessibleButton>
|
||||||
|
|
||||||
{accountJsx}
|
{accountJsx}
|
||||||
|
@ -969,7 +1010,7 @@ module.exports = React.createClass({
|
||||||
|
|
||||||
{this._renderReferral()}
|
{this._renderReferral()}
|
||||||
|
|
||||||
{notification_area}
|
{notificationArea}
|
||||||
|
|
||||||
{this._renderUserInterfaceSettings()}
|
{this._renderUserInterfaceSettings()}
|
||||||
{this._renderLabs()}
|
{this._renderLabs()}
|
||||||
|
@ -978,31 +1019,31 @@ module.exports = React.createClass({
|
||||||
{this._renderBulkOptions()}
|
{this._renderBulkOptions()}
|
||||||
{this._renderBugReport()}
|
{this._renderBugReport()}
|
||||||
|
|
||||||
<h3>Advanced</h3>
|
<h3>{ _t("Advanced") }</h3>
|
||||||
|
|
||||||
<div className="mx_UserSettings_section">
|
<div className="mx_UserSettings_section">
|
||||||
<div className="mx_UserSettings_advanced">
|
<div className="mx_UserSettings_advanced">
|
||||||
Logged in as {this._me}
|
{ _t("Logged in as:") } {this._me}
|
||||||
</div>
|
</div>
|
||||||
<div className="mx_UserSettings_advanced">
|
<div className="mx_UserSettings_advanced">
|
||||||
Access Token: <span className="mx_UserSettings_advanced_spoiler" onClick={this._showSpoiler} data-spoiler={ MatrixClientPeg.get().getAccessToken() }><click to reveal></span>
|
{_t('Access Token:')} <span className="mx_UserSettings_advanced_spoiler" onClick={this._showSpoiler} data-spoiler={ MatrixClientPeg.get().getAccessToken() }><{ _t("click to reveal") }></span>
|
||||||
</div>
|
</div>
|
||||||
<div className="mx_UserSettings_advanced">
|
<div className="mx_UserSettings_advanced">
|
||||||
Homeserver is { MatrixClientPeg.get().getHomeserverUrl() }
|
{ _t("Homeserver is") } { MatrixClientPeg.get().getHomeserverUrl() }
|
||||||
</div>
|
</div>
|
||||||
<div className="mx_UserSettings_advanced">
|
<div className="mx_UserSettings_advanced">
|
||||||
Identity Server is { MatrixClientPeg.get().getIdentityServerUrl() }
|
{ _t("Identity Server is") } { MatrixClientPeg.get().getIdentityServerUrl() }
|
||||||
</div>
|
</div>
|
||||||
<div className="mx_UserSettings_advanced">
|
<div className="mx_UserSettings_advanced">
|
||||||
matrix-react-sdk version: {(REACT_SDK_VERSION !== '<local>')
|
{_t('matrix-react-sdk version:')} {(REACT_SDK_VERSION !== '<local>')
|
||||||
? <a href={ GHVersionUrl('matrix-org/matrix-react-sdk', REACT_SDK_VERSION) }>{REACT_SDK_VERSION}</a>
|
? gHVersionLabel('matrix-org/matrix-react-sdk', REACT_SDK_VERSION)
|
||||||
: REACT_SDK_VERSION
|
: REACT_SDK_VERSION
|
||||||
}<br/>
|
}<br/>
|
||||||
riot-web version: {(this.state.vectorVersion !== null)
|
{_t('riot-web version:')} {(this.state.vectorVersion !== undefined)
|
||||||
? <a href={ GHVersionUrl('vector-im/riot-web', this.state.vectorVersion.split('-')[0]) }>{this.state.vectorVersion}</a>
|
? gHVersionLabel('vector-im/riot-web', this.state.vectorVersion)
|
||||||
: 'unknown'
|
: 'unknown'
|
||||||
}<br/>
|
}<br/>
|
||||||
olm version: {olmVersionString}<br/>
|
{ _t("olm version:") } {olmVersionString}<br/>
|
||||||
</div>
|
</div>
|
||||||
</div>
|
</div>
|
||||||
|
|
||||||
|
@ -1013,5 +1054,5 @@ module.exports = React.createClass({
|
||||||
</GeminiScrollbar>
|
</GeminiScrollbar>
|
||||||
</div>
|
</div>
|
||||||
);
|
);
|
||||||
}
|
},
|
||||||
});
|
});
|
||||||
|
|
|
@ -17,6 +17,7 @@ limitations under the License.
|
||||||
'use strict';
|
'use strict';
|
||||||
|
|
||||||
var React = require('react');
|
var React = require('react');
|
||||||
|
import { _t } from '../../../languageHandler';
|
||||||
var sdk = require('../../../index');
|
var sdk = require('../../../index');
|
||||||
var Modal = require("../../../Modal");
|
var Modal = require("../../../Modal");
|
||||||
var MatrixClientPeg = require('../../../MatrixClientPeg');
|
var MatrixClientPeg = require('../../../MatrixClientPeg');
|
||||||
|
@ -54,7 +55,7 @@ module.exports = React.createClass({
|
||||||
progress: "sent_email"
|
progress: "sent_email"
|
||||||
});
|
});
|
||||||
}, (err) => {
|
}, (err) => {
|
||||||
this.showErrorDialog("Failed to send email: " + err.message);
|
this.showErrorDialog(_t('Failed to send email') + ": " + err.message);
|
||||||
this.setState({
|
this.setState({
|
||||||
progress: null
|
progress: null
|
||||||
});
|
});
|
||||||
|
@ -78,30 +79,33 @@ module.exports = React.createClass({
|
||||||
ev.preventDefault();
|
ev.preventDefault();
|
||||||
|
|
||||||
if (!this.state.email) {
|
if (!this.state.email) {
|
||||||
this.showErrorDialog("The email address linked to your account must be entered.");
|
this.showErrorDialog(_t('The email address linked to your account must be entered.'));
|
||||||
}
|
}
|
||||||
else if (!this.state.password || !this.state.password2) {
|
else if (!this.state.password || !this.state.password2) {
|
||||||
this.showErrorDialog("A new password must be entered.");
|
this.showErrorDialog(_t('A new password must be entered.'));
|
||||||
}
|
}
|
||||||
else if (this.state.password !== this.state.password2) {
|
else if (this.state.password !== this.state.password2) {
|
||||||
this.showErrorDialog("New passwords must match each other.");
|
this.showErrorDialog(_t('New passwords must match each other.'));
|
||||||
}
|
}
|
||||||
else {
|
else {
|
||||||
var QuestionDialog = sdk.getComponent("dialogs.QuestionDialog");
|
var QuestionDialog = sdk.getComponent("dialogs.QuestionDialog");
|
||||||
Modal.createDialog(QuestionDialog, {
|
Modal.createDialog(QuestionDialog, {
|
||||||
title: "Warning",
|
title: _t('Warning!'),
|
||||||
description:
|
description:
|
||||||
<div>
|
<div>
|
||||||
Resetting password will currently reset any end-to-end encryption keys on all devices,
|
{ _t(
|
||||||
making encrypted chat history unreadable, unless you first export your room keys
|
'Resetting password will currently reset any ' +
|
||||||
and re-import them afterwards.
|
'end-to-end encryption keys on all devices, ' +
|
||||||
In future this <a href="https://github.com/vector-im/riot-web/issues/2671">will be improved</a>.
|
'making encrypted chat history unreadable, ' +
|
||||||
|
'unless you first export your room keys and re-import ' +
|
||||||
|
'them afterwards. In future this will be improved.'
|
||||||
|
) }
|
||||||
</div>,
|
</div>,
|
||||||
button: "Continue",
|
button: _t('Continue'),
|
||||||
extraButtons: [
|
extraButtons: [
|
||||||
<button className="mx_Dialog_primary"
|
<button className="mx_Dialog_primary"
|
||||||
onClick={this._onExportE2eKeysClicked}>
|
onClick={this._onExportE2eKeysClicked}>
|
||||||
Export E2E room keys
|
{ _t('Export E2E room keys') }
|
||||||
</button>
|
</button>
|
||||||
],
|
],
|
||||||
onFinished: (confirmed) => {
|
onFinished: (confirmed) => {
|
||||||
|
@ -150,7 +154,7 @@ module.exports = React.createClass({
|
||||||
var ErrorDialog = sdk.getComponent("dialogs.ErrorDialog");
|
var ErrorDialog = sdk.getComponent("dialogs.ErrorDialog");
|
||||||
Modal.createDialog(ErrorDialog, {
|
Modal.createDialog(ErrorDialog, {
|
||||||
title: title,
|
title: title,
|
||||||
description: body
|
description: body,
|
||||||
});
|
});
|
||||||
},
|
},
|
||||||
|
|
||||||
|
@ -168,22 +172,20 @@ module.exports = React.createClass({
|
||||||
else if (this.state.progress === "sent_email") {
|
else if (this.state.progress === "sent_email") {
|
||||||
resetPasswordJsx = (
|
resetPasswordJsx = (
|
||||||
<div>
|
<div>
|
||||||
An email has been sent to {this.state.email}. Once you've followed
|
{ _t('An email has been sent to') } {this.state.email}. { _t('Once you've followed the link it contains, click below') }.
|
||||||
the link it contains, click below.
|
|
||||||
<br />
|
<br />
|
||||||
<input className="mx_Login_submit" type="button" onClick={this.onVerify}
|
<input className="mx_Login_submit" type="button" onClick={this.onVerify}
|
||||||
value="I have verified my email address" />
|
value={ _t('I have verified my email address') } />
|
||||||
</div>
|
</div>
|
||||||
);
|
);
|
||||||
}
|
}
|
||||||
else if (this.state.progress === "complete") {
|
else if (this.state.progress === "complete") {
|
||||||
resetPasswordJsx = (
|
resetPasswordJsx = (
|
||||||
<div>
|
<div>
|
||||||
<p>Your password has been reset.</p>
|
<p>{ _t('Your password has been reset') }.</p>
|
||||||
<p>You have been logged out of all devices and will no longer receive push notifications.
|
<p>{ _t('You have been logged out of all devices and will no longer receive push notifications. To re-enable notifications, sign in again on each device') }.</p>
|
||||||
To re-enable notifications, sign in again on each device.</p>
|
|
||||||
<input className="mx_Login_submit" type="button" onClick={this.props.onComplete}
|
<input className="mx_Login_submit" type="button" onClick={this.props.onComplete}
|
||||||
value="Return to login screen" />
|
value={ _t('Return to login screen') } />
|
||||||
</div>
|
</div>
|
||||||
);
|
);
|
||||||
}
|
}
|
||||||
|
@ -191,7 +193,7 @@ module.exports = React.createClass({
|
||||||
resetPasswordJsx = (
|
resetPasswordJsx = (
|
||||||
<div>
|
<div>
|
||||||
<div className="mx_Login_prompt">
|
<div className="mx_Login_prompt">
|
||||||
To reset your password, enter the email address linked to your account:
|
{ _t('To reset your password, enter the email address linked to your account') }:
|
||||||
</div>
|
</div>
|
||||||
<div>
|
<div>
|
||||||
<form onSubmit={this.onSubmitForm}>
|
<form onSubmit={this.onSubmitForm}>
|
||||||
|
@ -199,21 +201,21 @@ module.exports = React.createClass({
|
||||||
name="reset_email" // define a name so browser's password autofill gets less confused
|
name="reset_email" // define a name so browser's password autofill gets less confused
|
||||||
value={this.state.email}
|
value={this.state.email}
|
||||||
onChange={this.onInputChanged.bind(this, "email")}
|
onChange={this.onInputChanged.bind(this, "email")}
|
||||||
placeholder="Email address" autoFocus />
|
placeholder={ _t('Email address') } autoFocus />
|
||||||
<br />
|
<br />
|
||||||
<input className="mx_Login_field" ref="pass" type="password"
|
<input className="mx_Login_field" ref="pass" type="password"
|
||||||
name="reset_password"
|
name="reset_password"
|
||||||
value={this.state.password}
|
value={this.state.password}
|
||||||
onChange={this.onInputChanged.bind(this, "password")}
|
onChange={this.onInputChanged.bind(this, "password")}
|
||||||
placeholder="New password" />
|
placeholder={ _t('New password') } />
|
||||||
<br />
|
<br />
|
||||||
<input className="mx_Login_field" ref="pass" type="password"
|
<input className="mx_Login_field" ref="pass" type="password"
|
||||||
name="reset_password_confirm"
|
name="reset_password_confirm"
|
||||||
value={this.state.password2}
|
value={this.state.password2}
|
||||||
onChange={this.onInputChanged.bind(this, "password2")}
|
onChange={this.onInputChanged.bind(this, "password2")}
|
||||||
placeholder="Confirm your new password" />
|
placeholder={ _t('Confirm your new password') } />
|
||||||
<br />
|
<br />
|
||||||
<input className="mx_Login_submit" type="submit" value="Send Reset Email" />
|
<input className="mx_Login_submit" type="submit" value={ _t('Send Reset Email') } />
|
||||||
</form>
|
</form>
|
||||||
<ServerConfig ref="serverConfig"
|
<ServerConfig ref="serverConfig"
|
||||||
withToggleButton={true}
|
withToggleButton={true}
|
||||||
|
@ -230,7 +232,7 @@ module.exports = React.createClass({
|
||||||
Return to login
|
Return to login
|
||||||
</a>
|
</a>
|
||||||
<a className="mx_Login_create" onClick={this.props.onRegisterClick} href="#">
|
<a className="mx_Login_create" onClick={this.props.onRegisterClick} href="#">
|
||||||
Create a new account
|
{ _t('Create an account') }
|
||||||
</a>
|
</a>
|
||||||
<LoginFooter />
|
<LoginFooter />
|
||||||
</div>
|
</div>
|
||||||
|
|
|
@ -18,11 +18,14 @@ limitations under the License.
|
||||||
'use strict';
|
'use strict';
|
||||||
|
|
||||||
import React from 'react';
|
import React from 'react';
|
||||||
|
import { _t } from '../../../languageHandler';
|
||||||
import ReactDOM from 'react-dom';
|
import ReactDOM from 'react-dom';
|
||||||
import url from 'url';
|
|
||||||
import sdk from '../../../index';
|
import sdk from '../../../index';
|
||||||
import Login from '../../../Login';
|
import Login from '../../../Login';
|
||||||
|
|
||||||
|
// For validating phone numbers without country codes
|
||||||
|
const PHONE_NUMBER_REGEX = /^[0-9\(\)\-\s]*$/;
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* A wire component which glues together login UI components and Login logic
|
* A wire component which glues together login UI components and Login logic
|
||||||
*/
|
*/
|
||||||
|
@ -125,7 +128,16 @@ module.exports = React.createClass({
|
||||||
},
|
},
|
||||||
|
|
||||||
onPhoneNumberChanged: function(phoneNumber) {
|
onPhoneNumberChanged: function(phoneNumber) {
|
||||||
this.setState({ phoneNumber: phoneNumber });
|
// Validate the phone number entered
|
||||||
|
if (!PHONE_NUMBER_REGEX.test(phoneNumber)) {
|
||||||
|
this.setState({ errorText: 'The phone number entered looks invalid' });
|
||||||
|
return;
|
||||||
|
}
|
||||||
|
|
||||||
|
this.setState({
|
||||||
|
phoneNumber: phoneNumber,
|
||||||
|
errorText: null,
|
||||||
|
});
|
||||||
},
|
},
|
||||||
|
|
||||||
onServerConfigChange: function(config) {
|
onServerConfigChange: function(config) {
|
||||||
|
@ -210,15 +222,17 @@ module.exports = React.createClass({
|
||||||
(this.state.enteredHomeserverUrl.startsWith("http:") ||
|
(this.state.enteredHomeserverUrl.startsWith("http:") ||
|
||||||
!this.state.enteredHomeserverUrl.startsWith("http")))
|
!this.state.enteredHomeserverUrl.startsWith("http")))
|
||||||
{
|
{
|
||||||
|
const urlStart = <a href='https://www.google.com/search?&q=enable%20unsafe%20scripts'>;
|
||||||
|
const urlEnd = </a>;
|
||||||
errorText = <span>
|
errorText = <span>
|
||||||
Can't connect to homeserver via HTTP when an HTTPS URL is in your browser bar.
|
{ _t('Can\'t connect to homeserver via HTTP when an HTTPS URL is in your browser bar. Either use HTTPS or %(urlStart)s enable unsafe scripts %(urlEnd)s', {urlStart: urlStart, urlEnd: urlEnd})}
|
||||||
Either use HTTPS or <a href='https://www.google.com/search?&q=enable%20unsafe%20scripts'>enable unsafe scripts</a>
|
|
||||||
</span>;
|
</span>;
|
||||||
}
|
}
|
||||||
else {
|
else {
|
||||||
|
const urlStart = <a href={this.state.enteredHomeserverUrl}>;
|
||||||
|
const urlEnd = </a>;
|
||||||
errorText = <span>
|
errorText = <span>
|
||||||
Can't connect to homeserver - please check your connectivity and ensure
|
{ _t('Can\'t connect to homeserver - please check your connectivity and ensure your %(urlStart)s homeserver\'s SSL certificate %(urlEnd)s is trusted', {urlStart: urlStart, urlEnd: urlEnd})}
|
||||||
your <a href={ this.state.enteredHomeserverUrl }>homeserver's SSL certificate</a> is trusted.
|
|
||||||
</span>;
|
</span>;
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
@ -230,12 +244,6 @@ module.exports = React.createClass({
|
||||||
switch (step) {
|
switch (step) {
|
||||||
case 'm.login.password':
|
case 'm.login.password':
|
||||||
const PasswordLogin = sdk.getComponent('login.PasswordLogin');
|
const PasswordLogin = sdk.getComponent('login.PasswordLogin');
|
||||||
// HSs that are not matrix.org may not be configured to have their
|
|
||||||
// domain name === domain part.
|
|
||||||
let hsDomain = url.parse(this.state.enteredHomeserverUrl).hostname;
|
|
||||||
if (hsDomain !== 'matrix.org') {
|
|
||||||
hsDomain = null;
|
|
||||||
}
|
|
||||||
return (
|
return (
|
||||||
<PasswordLogin
|
<PasswordLogin
|
||||||
onSubmit={this.onPasswordLogin}
|
onSubmit={this.onPasswordLogin}
|
||||||
|
@ -247,7 +255,6 @@ module.exports = React.createClass({
|
||||||
onPhoneNumberChanged={this.onPhoneNumberChanged}
|
onPhoneNumberChanged={this.onPhoneNumberChanged}
|
||||||
onForgotPasswordClick={this.props.onForgotPasswordClick}
|
onForgotPasswordClick={this.props.onForgotPasswordClick}
|
||||||
loginIncorrect={this.state.loginIncorrect}
|
loginIncorrect={this.state.loginIncorrect}
|
||||||
hsDomain={hsDomain}
|
|
||||||
/>
|
/>
|
||||||
);
|
);
|
||||||
case 'm.login.cas':
|
case 'm.login.cas':
|
||||||
|
@ -261,8 +268,7 @@ module.exports = React.createClass({
|
||||||
}
|
}
|
||||||
return (
|
return (
|
||||||
<div>
|
<div>
|
||||||
Sorry, this homeserver is using a login which is not
|
{ _t('Sorry, this homeserver is using a login which is not recognised ')}({step})
|
||||||
recognised ({step})
|
|
||||||
</div>
|
</div>
|
||||||
);
|
);
|
||||||
}
|
}
|
||||||
|
@ -279,7 +285,7 @@ module.exports = React.createClass({
|
||||||
if (this.props.enableGuest) {
|
if (this.props.enableGuest) {
|
||||||
loginAsGuestJsx =
|
loginAsGuestJsx =
|
||||||
<a className="mx_Login_create" onClick={this._onLoginAsGuestClick} href="#">
|
<a className="mx_Login_create" onClick={this._onLoginAsGuestClick} href="#">
|
||||||
Login as guest
|
{ _t('Login as guest')}
|
||||||
</a>;
|
</a>;
|
||||||
}
|
}
|
||||||
|
|
||||||
|
@ -287,7 +293,7 @@ module.exports = React.createClass({
|
||||||
if (this.props.onCancelClick) {
|
if (this.props.onCancelClick) {
|
||||||
returnToAppJsx =
|
returnToAppJsx =
|
||||||
<a className="mx_Login_create" onClick={this.props.onCancelClick} href="#">
|
<a className="mx_Login_create" onClick={this.props.onCancelClick} href="#">
|
||||||
Return to app
|
{ _t('Return to app')}
|
||||||
</a>;
|
</a>;
|
||||||
}
|
}
|
||||||
|
|
||||||
|
@ -296,7 +302,7 @@ module.exports = React.createClass({
|
||||||
<div className="mx_Login_box">
|
<div className="mx_Login_box">
|
||||||
<LoginHeader />
|
<LoginHeader />
|
||||||
<div>
|
<div>
|
||||||
<h2>Sign in
|
<h2>{ _t('Sign in')}
|
||||||
{ loader }
|
{ loader }
|
||||||
</h2>
|
</h2>
|
||||||
{ this.componentForStep(this.state.currentFlow) }
|
{ this.componentForStep(this.state.currentFlow) }
|
||||||
|
@ -312,7 +318,7 @@ module.exports = React.createClass({
|
||||||
{ this.state.errorText }
|
{ this.state.errorText }
|
||||||
</div>
|
</div>
|
||||||
<a className="mx_Login_create" onClick={this.props.onRegisterClick} href="#">
|
<a className="mx_Login_create" onClick={this.props.onRegisterClick} href="#">
|
||||||
Create a new account
|
{ _t('Create an account')}
|
||||||
</a>
|
</a>
|
||||||
{ loginAsGuestJsx }
|
{ loginAsGuestJsx }
|
||||||
{ returnToAppJsx }
|
{ returnToAppJsx }
|
||||||
|
|
|
@ -16,9 +16,10 @@ limitations under the License.
|
||||||
|
|
||||||
'use strict';
|
'use strict';
|
||||||
|
|
||||||
var React = require('react');
|
import React from 'react';
|
||||||
var sdk = require('../../../index');
|
import sdk from '../../../index';
|
||||||
var MatrixClientPeg = require('../../../MatrixClientPeg');
|
import MatrixClientPeg from '../../../MatrixClientPeg';
|
||||||
|
import { _t } from '../../../languageHandler';
|
||||||
|
|
||||||
module.exports = React.createClass({
|
module.exports = React.createClass({
|
||||||
displayName: 'PostRegistration',
|
displayName: 'PostRegistration',
|
||||||
|
@ -64,12 +65,12 @@ module.exports = React.createClass({
|
||||||
<div className="mx_Login_box">
|
<div className="mx_Login_box">
|
||||||
<LoginHeader />
|
<LoginHeader />
|
||||||
<div className="mx_Login_profile">
|
<div className="mx_Login_profile">
|
||||||
Set a display name:
|
{ _t('Set a display name:') }
|
||||||
<ChangeDisplayName />
|
<ChangeDisplayName />
|
||||||
Upload an avatar:
|
{ _t('Upload an avatar:') }
|
||||||
<ChangeAvatar
|
<ChangeAvatar
|
||||||
initialAvatarUrl={this.state.avatarUrl} />
|
initialAvatarUrl={this.state.avatarUrl} />
|
||||||
<button onClick={this.props.onComplete}>Continue</button>
|
<button onClick={this.props.onComplete}>{ _t('Continue') }</button>
|
||||||
{this.state.errorString}
|
{this.state.errorString}
|
||||||
</div>
|
</div>
|
||||||
</div>
|
</div>
|
||||||
|
|
|
@ -27,6 +27,7 @@ import MatrixClientPeg from '../../../MatrixClientPeg';
|
||||||
import RegistrationForm from '../../views/login/RegistrationForm';
|
import RegistrationForm from '../../views/login/RegistrationForm';
|
||||||
import CaptchaForm from '../../views/login/CaptchaForm';
|
import CaptchaForm from '../../views/login/CaptchaForm';
|
||||||
import RtsClient from '../../../RtsClient';
|
import RtsClient from '../../../RtsClient';
|
||||||
|
import { _t } from '../../../languageHandler';
|
||||||
|
|
||||||
const MIN_PASSWORD_LENGTH = 6;
|
const MIN_PASSWORD_LENGTH = 6;
|
||||||
|
|
||||||
|
@ -123,18 +124,17 @@ module.exports = React.createClass({
|
||||||
}
|
}
|
||||||
},
|
},
|
||||||
|
|
||||||
onHsUrlChanged: function(newHsUrl) {
|
onServerConfigChange: function(config) {
|
||||||
this.setState({
|
let newState = {};
|
||||||
hsUrl: newHsUrl,
|
if (config.hsUrl !== undefined) {
|
||||||
|
newState.hsUrl = config.hsUrl;
|
||||||
|
}
|
||||||
|
if (config.isUrl !== undefined) {
|
||||||
|
newState.isUrl = config.isUrl;
|
||||||
|
}
|
||||||
|
this.setState(newState, function() {
|
||||||
|
this._replaceClient();
|
||||||
});
|
});
|
||||||
this._replaceClient();
|
|
||||||
},
|
|
||||||
|
|
||||||
onIsUrlChanged: function(newIsUrl) {
|
|
||||||
this.setState({
|
|
||||||
isUrl: newIsUrl,
|
|
||||||
});
|
|
||||||
this._replaceClient();
|
|
||||||
},
|
},
|
||||||
|
|
||||||
_replaceClient: function() {
|
_replaceClient: function() {
|
||||||
|
@ -163,7 +163,7 @@ module.exports = React.createClass({
|
||||||
msisdn_available |= flow.stages.indexOf('m.login.msisdn') > -1;
|
msisdn_available |= flow.stages.indexOf('m.login.msisdn') > -1;
|
||||||
}
|
}
|
||||||
if (!msisdn_available) {
|
if (!msisdn_available) {
|
||||||
msg = "This server does not support authentication with a phone number";
|
msg = _t('This server does not support authentication with a phone number.');
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
this.setState({
|
this.setState({
|
||||||
|
@ -261,29 +261,29 @@ module.exports = React.createClass({
|
||||||
var errMsg;
|
var errMsg;
|
||||||
switch (errCode) {
|
switch (errCode) {
|
||||||
case "RegistrationForm.ERR_PASSWORD_MISSING":
|
case "RegistrationForm.ERR_PASSWORD_MISSING":
|
||||||
errMsg = "Missing password.";
|
errMsg = _t('Missing password.');
|
||||||
break;
|
break;
|
||||||
case "RegistrationForm.ERR_PASSWORD_MISMATCH":
|
case "RegistrationForm.ERR_PASSWORD_MISMATCH":
|
||||||
errMsg = "Passwords don't match.";
|
errMsg = _t('Passwords don\'t match.');
|
||||||
break;
|
break;
|
||||||
case "RegistrationForm.ERR_PASSWORD_LENGTH":
|
case "RegistrationForm.ERR_PASSWORD_LENGTH":
|
||||||
errMsg = `Password too short (min ${MIN_PASSWORD_LENGTH}).`;
|
errMsg = _t('Password too short (min %(MIN_PASSWORD_LENGTH)s).', {MIN_PASSWORD_LENGTH: $MIN_PASSWORD_LENGTH})
|
||||||
break;
|
break;
|
||||||
case "RegistrationForm.ERR_EMAIL_INVALID":
|
case "RegistrationForm.ERR_EMAIL_INVALID":
|
||||||
errMsg = "This doesn't look like a valid email address";
|
errMsg = _t('This doesn\'t look like a valid email address.');
|
||||||
break;
|
break;
|
||||||
case "RegistrationForm.ERR_PHONE_NUMBER_INVALID":
|
case "RegistrationForm.ERR_PHONE_NUMBER_INVALID":
|
||||||
errMsg = "This doesn't look like a valid phone number";
|
errMsg = _t('This doesn\'t look like a valid phone number.');
|
||||||
break;
|
break;
|
||||||
case "RegistrationForm.ERR_USERNAME_INVALID":
|
case "RegistrationForm.ERR_USERNAME_INVALID":
|
||||||
errMsg = "User names may only contain letters, numbers, dots, hyphens and underscores.";
|
errMsg = _t('User names may only contain letters, numbers, dots, hyphens and underscores.');
|
||||||
break;
|
break;
|
||||||
case "RegistrationForm.ERR_USERNAME_BLANK":
|
case "RegistrationForm.ERR_USERNAME_BLANK":
|
||||||
errMsg = "You need to enter a user name";
|
errMsg = _t('You need to enter a user name.');
|
||||||
break;
|
break;
|
||||||
default:
|
default:
|
||||||
console.error("Unknown error code: %s", errCode);
|
console.error("Unknown error code: %s", errCode);
|
||||||
errMsg = "An unknown error occurred.";
|
errMsg = _t('An unknown error occurred.');
|
||||||
break;
|
break;
|
||||||
}
|
}
|
||||||
this.setState({
|
this.setState({
|
||||||
|
@ -390,8 +390,7 @@ module.exports = React.createClass({
|
||||||
customIsUrl={this.props.customIsUrl}
|
customIsUrl={this.props.customIsUrl}
|
||||||
defaultHsUrl={this.props.defaultHsUrl}
|
defaultHsUrl={this.props.defaultHsUrl}
|
||||||
defaultIsUrl={this.props.defaultIsUrl}
|
defaultIsUrl={this.props.defaultIsUrl}
|
||||||
onHsUrlChanged={this.onHsUrlChanged}
|
onServerConfigChange={this.onServerConfigChange}
|
||||||
onIsUrlChanged={this.onIsUrlChanged}
|
|
||||||
delayTimeMs={1000}
|
delayTimeMs={1000}
|
||||||
/>
|
/>
|
||||||
</div>
|
</div>
|
||||||
|
@ -402,7 +401,7 @@ module.exports = React.createClass({
|
||||||
if (this.props.onCancelClick) {
|
if (this.props.onCancelClick) {
|
||||||
returnToAppJsx = (
|
returnToAppJsx = (
|
||||||
<a className="mx_Login_create" onClick={this.props.onCancelClick} href="#">
|
<a className="mx_Login_create" onClick={this.props.onCancelClick} href="#">
|
||||||
Return to app
|
{_t('Return to app')}
|
||||||
</a>
|
</a>
|
||||||
);
|
);
|
||||||
}
|
}
|
||||||
|
@ -415,10 +414,10 @@ module.exports = React.createClass({
|
||||||
this.state.teamSelected.domain + "/icon.png" :
|
this.state.teamSelected.domain + "/icon.png" :
|
||||||
null}
|
null}
|
||||||
/>
|
/>
|
||||||
<h2>Create an account</h2>
|
<h2>{_t('Create an account')}</h2>
|
||||||
{registerBody}
|
{registerBody}
|
||||||
<a className="mx_Login_create" onClick={this.props.onLoginClick} href="#">
|
<a className="mx_Login_create" onClick={this.props.onLoginClick} href="#">
|
||||||
I already have an account
|
{_t('I already have an account')}
|
||||||
</a>
|
</a>
|
||||||
{returnToAppJsx}
|
{returnToAppJsx}
|
||||||
<LoginFooter />
|
<LoginFooter />
|
||||||
|
|
|
@ -59,7 +59,9 @@ module.exports = React.createClass({
|
||||||
ContentRepo.getHttpUriForMxc(
|
ContentRepo.getHttpUriForMxc(
|
||||||
MatrixClientPeg.get().getHomeserverUrl(),
|
MatrixClientPeg.get().getHomeserverUrl(),
|
||||||
props.oobData.avatarUrl,
|
props.oobData.avatarUrl,
|
||||||
props.width, props.height, props.resizeMethod
|
Math.floor(props.width * window.devicePixelRatio),
|
||||||
|
Math.floor(props.height * window.devicePixelRatio),
|
||||||
|
props.resizeMethod
|
||||||
), // highest priority
|
), // highest priority
|
||||||
this.getRoomAvatarUrl(props),
|
this.getRoomAvatarUrl(props),
|
||||||
this.getOneToOneAvatar(props),
|
this.getOneToOneAvatar(props),
|
||||||
|
@ -74,7 +76,9 @@ module.exports = React.createClass({
|
||||||
|
|
||||||
return props.room.getAvatarUrl(
|
return props.room.getAvatarUrl(
|
||||||
MatrixClientPeg.get().getHomeserverUrl(),
|
MatrixClientPeg.get().getHomeserverUrl(),
|
||||||
props.width, props.height, props.resizeMethod,
|
Math.floor(props.width * window.devicePixelRatio),
|
||||||
|
Math.floor(props.height * window.devicePixelRatio),
|
||||||
|
props.resizeMethod,
|
||||||
false
|
false
|
||||||
);
|
);
|
||||||
},
|
},
|
||||||
|
@ -103,14 +107,18 @@ module.exports = React.createClass({
|
||||||
}
|
}
|
||||||
return theOtherGuy.getAvatarUrl(
|
return theOtherGuy.getAvatarUrl(
|
||||||
MatrixClientPeg.get().getHomeserverUrl(),
|
MatrixClientPeg.get().getHomeserverUrl(),
|
||||||
props.width, props.height, props.resizeMethod,
|
Math.floor(props.width * window.devicePixelRatio),
|
||||||
|
Math.floor(props.height * window.devicePixelRatio),
|
||||||
|
props.resizeMethod,
|
||||||
false
|
false
|
||||||
);
|
);
|
||||||
} else if (userIds.length == 1) {
|
} else if (userIds.length == 1) {
|
||||||
return mlist[userIds[0]].getAvatarUrl(
|
return mlist[userIds[0]].getAvatarUrl(
|
||||||
MatrixClientPeg.get().getHomeserverUrl(),
|
MatrixClientPeg.get().getHomeserverUrl(),
|
||||||
props.width, props.height, props.resizeMethod,
|
Math.floor(props.width * window.devicePixelRatio),
|
||||||
false
|
Math.floor(props.height * window.devicePixelRatio),
|
||||||
|
props.resizeMethod,
|
||||||
|
false
|
||||||
);
|
);
|
||||||
} else {
|
} else {
|
||||||
return null;
|
return null;
|
||||||
|
|
|
@ -47,16 +47,6 @@ export default React.createClass({
|
||||||
children: React.PropTypes.node,
|
children: React.PropTypes.node,
|
||||||
},
|
},
|
||||||
|
|
||||||
componentWillMount: function() {
|
|
||||||
this.priorActiveElement = document.activeElement;
|
|
||||||
},
|
|
||||||
|
|
||||||
componentWillUnmount: function() {
|
|
||||||
if (this.priorActiveElement !== null) {
|
|
||||||
this.priorActiveElement.focus();
|
|
||||||
}
|
|
||||||
},
|
|
||||||
|
|
||||||
_onKeyDown: function(e) {
|
_onKeyDown: function(e) {
|
||||||
if (e.keyCode === KeyCode.ESCAPE) {
|
if (e.keyCode === KeyCode.ESCAPE) {
|
||||||
e.stopPropagation();
|
e.stopPropagation();
|
||||||
|
@ -77,7 +67,7 @@ export default React.createClass({
|
||||||
|
|
||||||
render: function() {
|
render: function() {
|
||||||
const TintableSvg = sdk.getComponent("elements.TintableSvg");
|
const TintableSvg = sdk.getComponent("elements.TintableSvg");
|
||||||
|
|
||||||
return (
|
return (
|
||||||
<div onKeyDown={this._onKeyDown} className={this.props.className}>
|
<div onKeyDown={this._onKeyDown} className={this.props.className}>
|
||||||
<AccessibleButton onClick={this._onCancelClick}
|
<AccessibleButton onClick={this._onCancelClick}
|
||||||
|
|
|
@ -16,6 +16,7 @@ limitations under the License.
|
||||||
|
|
||||||
import React from 'react';
|
import React from 'react';
|
||||||
import classNames from 'classnames';
|
import classNames from 'classnames';
|
||||||
|
import { _t } from '../../../languageHandler';
|
||||||
import sdk from '../../../index';
|
import sdk from '../../../index';
|
||||||
import { getAddressType, inviteMultipleToRoom } from '../../../Invite';
|
import { getAddressType, inviteMultipleToRoom } from '../../../Invite';
|
||||||
import createRoom from '../../../createRoom';
|
import createRoom from '../../../createRoom';
|
||||||
|
@ -48,11 +49,7 @@ module.exports = React.createClass({
|
||||||
|
|
||||||
getDefaultProps: function() {
|
getDefaultProps: function() {
|
||||||
return {
|
return {
|
||||||
title: "Start a chat",
|
|
||||||
description: "Who would you like to communicate with?",
|
|
||||||
value: "",
|
value: "",
|
||||||
placeholder: "Email, name or matrix ID",
|
|
||||||
button: "Start Chat",
|
|
||||||
focus: true
|
focus: true
|
||||||
};
|
};
|
||||||
},
|
},
|
||||||
|
|
|
@ -16,6 +16,7 @@ limitations under the License.
|
||||||
|
|
||||||
import React from 'react';
|
import React from 'react';
|
||||||
import sdk from '../../../index';
|
import sdk from '../../../index';
|
||||||
|
import { _t } from '../../../languageHandler';
|
||||||
import classnames from 'classnames';
|
import classnames from 'classnames';
|
||||||
|
|
||||||
/*
|
/*
|
||||||
|
@ -69,7 +70,7 @@ export default React.createClass({
|
||||||
const BaseDialog = sdk.getComponent('views.dialogs.BaseDialog');
|
const BaseDialog = sdk.getComponent('views.dialogs.BaseDialog');
|
||||||
const MemberAvatar = sdk.getComponent("views.avatars.MemberAvatar");
|
const MemberAvatar = sdk.getComponent("views.avatars.MemberAvatar");
|
||||||
|
|
||||||
const title = this.props.action + " this person?";
|
const title = _t("%(actionVerb)s this person?", { actionVerb: this.props.action});
|
||||||
const confirmButtonClass = classnames({
|
const confirmButtonClass = classnames({
|
||||||
'mx_Dialog_primary': true,
|
'mx_Dialog_primary': true,
|
||||||
'danger': this.props.danger,
|
'danger': this.props.danger,
|
||||||
|
@ -82,7 +83,7 @@ export default React.createClass({
|
||||||
<form onSubmit={this.onOk}>
|
<form onSubmit={this.onOk}>
|
||||||
<input className="mx_ConfirmUserActionDialog_reasonField"
|
<input className="mx_ConfirmUserActionDialog_reasonField"
|
||||||
ref={this._collectReasonField}
|
ref={this._collectReasonField}
|
||||||
placeholder="Reason"
|
placeholder={ _t("Reason") }
|
||||||
autoFocus={true}
|
autoFocus={true}
|
||||||
/>
|
/>
|
||||||
</form>
|
</form>
|
||||||
|
@ -111,7 +112,7 @@ export default React.createClass({
|
||||||
</button>
|
</button>
|
||||||
|
|
||||||
<button onClick={this.onCancel}>
|
<button onClick={this.onCancel}>
|
||||||
Cancel
|
{ _t("Cancel") }
|
||||||
</button>
|
</button>
|
||||||
</div>
|
</div>
|
||||||
</BaseDialog>
|
</BaseDialog>
|
||||||
|
|
76
src/components/views/dialogs/DeviceVerifyDialog.js
Normal file
76
src/components/views/dialogs/DeviceVerifyDialog.js
Normal file
|
@ -0,0 +1,76 @@
|
||||||
|
/*
|
||||||
|
Copyright 2016 OpenMarket Ltd
|
||||||
|
Copyright 2017 Vector Creations Ltd
|
||||||
|
|
||||||
|
Licensed under the Apache License, Version 2.0 (the "License");
|
||||||
|
you may not use this file except in compliance with the License.
|
||||||
|
You may obtain a copy of the License at
|
||||||
|
|
||||||
|
http://www.apache.org/licenses/LICENSE-2.0
|
||||||
|
|
||||||
|
Unless required by applicable law or agreed to in writing, software
|
||||||
|
distributed under the License is distributed on an "AS IS" BASIS,
|
||||||
|
WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
||||||
|
See the License for the specific language governing permissions and
|
||||||
|
limitations under the License.
|
||||||
|
*/
|
||||||
|
|
||||||
|
import React from 'react';
|
||||||
|
import MatrixClientPeg from '../../../MatrixClientPeg';
|
||||||
|
import sdk from '../../../index';
|
||||||
|
import * as FormattingUtils from '../../../utils/FormattingUtils';
|
||||||
|
|
||||||
|
export default function DeviceVerifyDialog(props) {
|
||||||
|
const QuestionDialog = sdk.getComponent("dialogs.QuestionDialog");
|
||||||
|
|
||||||
|
const key = FormattingUtils.formatCryptoKey(props.device.getFingerprint());
|
||||||
|
const body = (
|
||||||
|
<div>
|
||||||
|
<p>
|
||||||
|
To verify that this device can be trusted, please contact its
|
||||||
|
owner using some other means (e.g. in person or a phone call)
|
||||||
|
and ask them whether the key they see in their User Settings
|
||||||
|
for this device matches the key below:
|
||||||
|
</p>
|
||||||
|
<div className="mx_UserSettings_cryptoSection">
|
||||||
|
<ul>
|
||||||
|
<li><label>Device name:</label> <span>{ props.device.getDisplayName() }</span></li>
|
||||||
|
<li><label>Device ID:</label> <span><code>{ props.device.deviceId}</code></span></li>
|
||||||
|
<li><label>Device key:</label> <span><code><b>{ key }</b></code></span></li>
|
||||||
|
</ul>
|
||||||
|
</div>
|
||||||
|
<p>
|
||||||
|
If it matches, press the verify button below.
|
||||||
|
If it doesnt, then someone else is intercepting this device
|
||||||
|
and you probably want to press the blacklist button instead.
|
||||||
|
</p>
|
||||||
|
<p>
|
||||||
|
In future this verification process will be more sophisticated.
|
||||||
|
</p>
|
||||||
|
</div>
|
||||||
|
);
|
||||||
|
|
||||||
|
function onFinished(confirm) {
|
||||||
|
if (confirm) {
|
||||||
|
MatrixClientPeg.get().setDeviceVerified(
|
||||||
|
props.userId, props.device.deviceId, true,
|
||||||
|
);
|
||||||
|
}
|
||||||
|
props.onFinished(confirm);
|
||||||
|
}
|
||||||
|
|
||||||
|
return (
|
||||||
|
<QuestionDialog
|
||||||
|
title="Verify device"
|
||||||
|
description={body}
|
||||||
|
button="I verify that the keys match"
|
||||||
|
onFinished={onFinished}
|
||||||
|
/>
|
||||||
|
);
|
||||||
|
}
|
||||||
|
|
||||||
|
DeviceVerifyDialog.propTypes = {
|
||||||
|
userId: React.PropTypes.string.isRequired,
|
||||||
|
device: React.PropTypes.object.isRequired,
|
||||||
|
onFinished: React.PropTypes.func.isRequired,
|
||||||
|
};
|
|
@ -27,6 +27,7 @@ limitations under the License.
|
||||||
|
|
||||||
import React from 'react';
|
import React from 'react';
|
||||||
import sdk from '../../../index';
|
import sdk from '../../../index';
|
||||||
|
import { _t } from '../../../languageHandler';
|
||||||
|
|
||||||
export default React.createClass({
|
export default React.createClass({
|
||||||
displayName: 'ErrorDialog',
|
displayName: 'ErrorDialog',
|
||||||
|
@ -43,10 +44,10 @@ export default React.createClass({
|
||||||
|
|
||||||
getDefaultProps: function() {
|
getDefaultProps: function() {
|
||||||
return {
|
return {
|
||||||
title: "Error",
|
|
||||||
description: "An error has occurred.",
|
|
||||||
button: "OK",
|
|
||||||
focus: true,
|
focus: true,
|
||||||
|
title: null,
|
||||||
|
description: null,
|
||||||
|
button: null,
|
||||||
};
|
};
|
||||||
},
|
},
|
||||||
|
|
||||||
|
@ -60,13 +61,13 @@ export default React.createClass({
|
||||||
const BaseDialog = sdk.getComponent('views.dialogs.BaseDialog');
|
const BaseDialog = sdk.getComponent('views.dialogs.BaseDialog');
|
||||||
return (
|
return (
|
||||||
<BaseDialog className="mx_ErrorDialog" onFinished={this.props.onFinished}
|
<BaseDialog className="mx_ErrorDialog" onFinished={this.props.onFinished}
|
||||||
title={this.props.title}>
|
title={this.props.title || _t('Error')}>
|
||||||
<div className="mx_Dialog_content">
|
<div className="mx_Dialog_content">
|
||||||
{this.props.description}
|
{this.props.description || _t('An error has occurred.')}
|
||||||
</div>
|
</div>
|
||||||
<div className="mx_Dialog_buttons">
|
<div className="mx_Dialog_buttons">
|
||||||
<button ref="button" className="mx_Dialog_primary" onClick={this.props.onFinished}>
|
<button ref="button" className="mx_Dialog_primary" onClick={this.props.onFinished}>
|
||||||
{this.props.button}
|
{this.props.button || _t('OK')}
|
||||||
</button>
|
</button>
|
||||||
</div>
|
</div>
|
||||||
</BaseDialog>
|
</BaseDialog>
|
||||||
|
|
|
@ -20,6 +20,7 @@ import Matrix from 'matrix-js-sdk';
|
||||||
import React from 'react';
|
import React from 'react';
|
||||||
|
|
||||||
import sdk from '../../../index';
|
import sdk from '../../../index';
|
||||||
|
import { _t } from '../../../languageHandler';
|
||||||
|
|
||||||
import AccessibleButton from '../elements/AccessibleButton';
|
import AccessibleButton from '../elements/AccessibleButton';
|
||||||
|
|
||||||
|
@ -46,12 +47,6 @@ export default React.createClass({
|
||||||
title: React.PropTypes.string,
|
title: React.PropTypes.string,
|
||||||
},
|
},
|
||||||
|
|
||||||
getDefaultProps: function() {
|
|
||||||
return {
|
|
||||||
title: "Authentication",
|
|
||||||
};
|
|
||||||
},
|
|
||||||
|
|
||||||
getInitialState: function() {
|
getInitialState: function() {
|
||||||
return {
|
return {
|
||||||
authError: null,
|
authError: null,
|
||||||
|
@ -105,7 +100,7 @@ export default React.createClass({
|
||||||
return (
|
return (
|
||||||
<BaseDialog className="mx_InteractiveAuthDialog"
|
<BaseDialog className="mx_InteractiveAuthDialog"
|
||||||
onFinished={this.props.onFinished}
|
onFinished={this.props.onFinished}
|
||||||
title={this.state.authError ? 'Error' : this.props.title}
|
title={this.state.authError ? 'Error' : (this.props.title || _t('Authentication'))}
|
||||||
>
|
>
|
||||||
{content}
|
{content}
|
||||||
</BaseDialog>
|
</BaseDialog>
|
||||||
|
|
|
@ -26,6 +26,7 @@ limitations under the License.
|
||||||
import React from 'react';
|
import React from 'react';
|
||||||
import dis from '../../../dispatcher';
|
import dis from '../../../dispatcher';
|
||||||
import sdk from '../../../index';
|
import sdk from '../../../index';
|
||||||
|
import { _t } from '../../../languageHandler';
|
||||||
|
|
||||||
module.exports = React.createClass({
|
module.exports = React.createClass({
|
||||||
displayName: 'NeedToRegisterDialog',
|
displayName: 'NeedToRegisterDialog',
|
||||||
|
@ -38,13 +39,6 @@ module.exports = React.createClass({
|
||||||
onFinished: React.PropTypes.func.isRequired,
|
onFinished: React.PropTypes.func.isRequired,
|
||||||
},
|
},
|
||||||
|
|
||||||
getDefaultProps: function() {
|
|
||||||
return {
|
|
||||||
title: "Registration required",
|
|
||||||
description: "A registered account is required for this action",
|
|
||||||
};
|
|
||||||
},
|
|
||||||
|
|
||||||
onRegisterClicked: function() {
|
onRegisterClicked: function() {
|
||||||
dis.dispatch({
|
dis.dispatch({
|
||||||
action: "start_upgrade_registration",
|
action: "start_upgrade_registration",
|
||||||
|
@ -59,10 +53,10 @@ module.exports = React.createClass({
|
||||||
return (
|
return (
|
||||||
<BaseDialog className="mx_NeedToRegisterDialog"
|
<BaseDialog className="mx_NeedToRegisterDialog"
|
||||||
onFinished={this.props.onFinished}
|
onFinished={this.props.onFinished}
|
||||||
title={this.props.title}
|
title={this.props.title || _t('Registration required')}
|
||||||
>
|
>
|
||||||
<div className="mx_Dialog_content">
|
<div className="mx_Dialog_content">
|
||||||
{this.props.description}
|
{this.props.description || _t('A registered account is required for this action')}
|
||||||
</div>
|
</div>
|
||||||
<div className="mx_Dialog_buttons">
|
<div className="mx_Dialog_buttons">
|
||||||
<button className="mx_Dialog_primary" onClick={this.props.onFinished} autoFocus={true}>
|
<button className="mx_Dialog_primary" onClick={this.props.onFinished} autoFocus={true}>
|
||||||
|
|
|
@ -16,6 +16,7 @@ limitations under the License.
|
||||||
|
|
||||||
import React from 'react';
|
import React from 'react';
|
||||||
import sdk from '../../../index';
|
import sdk from '../../../index';
|
||||||
|
import { _t } from '../../../languageHandler';
|
||||||
|
|
||||||
export default React.createClass({
|
export default React.createClass({
|
||||||
displayName: 'QuestionDialog',
|
displayName: 'QuestionDialog',
|
||||||
|
@ -33,7 +34,6 @@ export default React.createClass({
|
||||||
title: "",
|
title: "",
|
||||||
description: "",
|
description: "",
|
||||||
extraButtons: null,
|
extraButtons: null,
|
||||||
button: "OK",
|
|
||||||
focus: true,
|
focus: true,
|
||||||
hasCancelButton: true,
|
hasCancelButton: true,
|
||||||
};
|
};
|
||||||
|
@ -47,12 +47,6 @@ export default React.createClass({
|
||||||
this.props.onFinished(false);
|
this.props.onFinished(false);
|
||||||
},
|
},
|
||||||
|
|
||||||
componentDidMount: function() {
|
|
||||||
if (this.props.focus) {
|
|
||||||
this.refs.button.focus();
|
|
||||||
}
|
|
||||||
},
|
|
||||||
|
|
||||||
render: function() {
|
render: function() {
|
||||||
const BaseDialog = sdk.getComponent('views.dialogs.BaseDialog');
|
const BaseDialog = sdk.getComponent('views.dialogs.BaseDialog');
|
||||||
const cancelButton = this.props.hasCancelButton ? (
|
const cancelButton = this.props.hasCancelButton ? (
|
||||||
|
@ -69,8 +63,8 @@ export default React.createClass({
|
||||||
{this.props.description}
|
{this.props.description}
|
||||||
</div>
|
</div>
|
||||||
<div className="mx_Dialog_buttons">
|
<div className="mx_Dialog_buttons">
|
||||||
<button ref="button" className="mx_Dialog_primary" onClick={this.onOk}>
|
<button className="mx_Dialog_primary" onClick={this.onOk} autoFocus={this.props.focus}>
|
||||||
{this.props.button}
|
{this.props.button || _t('OK')}
|
||||||
</button>
|
</button>
|
||||||
{this.props.extraButtons}
|
{this.props.extraButtons}
|
||||||
{cancelButton}
|
{cancelButton}
|
||||||
|
|
|
@ -16,6 +16,7 @@ limitations under the License.
|
||||||
|
|
||||||
import React from 'react';
|
import React from 'react';
|
||||||
import sdk from '../../../index';
|
import sdk from '../../../index';
|
||||||
|
import { _t } from '../../../languageHandler';
|
||||||
|
|
||||||
export default React.createClass({
|
export default React.createClass({
|
||||||
displayName: 'TextInputDialog',
|
displayName: 'TextInputDialog',
|
||||||
|
@ -36,7 +37,6 @@ export default React.createClass({
|
||||||
title: "",
|
title: "",
|
||||||
value: "",
|
value: "",
|
||||||
description: "",
|
description: "",
|
||||||
button: "OK",
|
|
||||||
focus: true,
|
focus: true,
|
||||||
};
|
};
|
||||||
},
|
},
|
||||||
|
@ -73,7 +73,7 @@ export default React.createClass({
|
||||||
</div>
|
</div>
|
||||||
<div className="mx_Dialog_buttons">
|
<div className="mx_Dialog_buttons">
|
||||||
<button onClick={this.onCancel}>
|
<button onClick={this.onCancel}>
|
||||||
Cancel
|
{ _t("Cancel") }
|
||||||
</button>
|
</button>
|
||||||
<button className="mx_Dialog_primary" onClick={this.onOk}>
|
<button className="mx_Dialog_primary" onClick={this.onOk}>
|
||||||
{this.props.button}
|
{this.props.button}
|
||||||
|
|
|
@ -149,7 +149,7 @@ export default React.createClass({
|
||||||
>
|
>
|
||||||
<GeminiScrollbar autoshow={false} className="mx_Dialog_content">
|
<GeminiScrollbar autoshow={false} className="mx_Dialog_content">
|
||||||
<h4>
|
<h4>
|
||||||
This room contains devices that you haven't seen before.
|
"{this.props.room.name}" contains devices that you haven't seen before.
|
||||||
</h4>
|
</h4>
|
||||||
{ warning }
|
{ warning }
|
||||||
Unknown devices:
|
Unknown devices:
|
||||||
|
|
|
@ -1,5 +1,6 @@
|
||||||
/*
|
/*
|
||||||
Copyright 2015, 2016 OpenMarket Ltd
|
Copyright 2015, 2016 OpenMarket Ltd
|
||||||
|
Copyright 2017 Vector Creations Ltd
|
||||||
|
|
||||||
Licensed under the Apache License, Version 2.0 (the "License");
|
Licensed under the Apache License, Version 2.0 (the "License");
|
||||||
you may not use this file except in compliance with the License.
|
you may not use this file except in compliance with the License.
|
||||||
|
@ -138,7 +139,7 @@ export default React.createClass({
|
||||||
onClick={this.onClick.bind(this, i)}
|
onClick={this.onClick.bind(this, i)}
|
||||||
onMouseEnter={this.onMouseEnter.bind(this, i)}
|
onMouseEnter={this.onMouseEnter.bind(this, i)}
|
||||||
onMouseLeave={this.onMouseLeave}
|
onMouseLeave={this.onMouseLeave}
|
||||||
key={this.props.addressList[i].userId}
|
key={this.props.addressList[i].addressType + "/" + this.props.addressList[i].address}
|
||||||
ref={(ref) => { this.addressListElement = ref; }}
|
ref={(ref) => { this.addressListElement = ref; }}
|
||||||
>
|
>
|
||||||
<AddressTile address={this.props.addressList[i]} justified={true} networkName="vector" networkUrl="img/search-icon-vector.svg" />
|
<AddressTile address={this.props.addressList[i]} justified={true} networkName="vector" networkUrl="img/search-icon-vector.svg" />
|
||||||
|
|
|
@ -50,42 +50,10 @@ export default React.createClass({
|
||||||
},
|
},
|
||||||
|
|
||||||
onVerifyClick: function() {
|
onVerifyClick: function() {
|
||||||
var QuestionDialog = sdk.getComponent("dialogs.QuestionDialog");
|
const DeviceVerifyDialog = sdk.getComponent('views.dialogs.DeviceVerifyDialog');
|
||||||
Modal.createDialog(QuestionDialog, {
|
Modal.createDialog(DeviceVerifyDialog, {
|
||||||
title: "Verify device",
|
userId: this.props.userId,
|
||||||
description: (
|
device: this.state.device,
|
||||||
<div>
|
|
||||||
<p>
|
|
||||||
To verify that this device can be trusted, please contact its
|
|
||||||
owner using some other means (e.g. in person or a phone call)
|
|
||||||
and ask them whether the key they see in their User Settings
|
|
||||||
for this device matches the key below:
|
|
||||||
</p>
|
|
||||||
<div className="mx_UserSettings_cryptoSection">
|
|
||||||
<ul>
|
|
||||||
<li><label>Device name:</label> <span>{ this.state.device.getDisplayName() }</span></li>
|
|
||||||
<li><label>Device ID:</label> <span><code>{ this.state.device.deviceId}</code></span></li>
|
|
||||||
<li><label>Device key:</label> <span><code><b>{ this.state.device.getFingerprint() }</b></code></span></li>
|
|
||||||
</ul>
|
|
||||||
</div>
|
|
||||||
<p>
|
|
||||||
If it matches, press the verify button below.
|
|
||||||
If it doesnt, then someone else is intercepting this device
|
|
||||||
and you probably want to press the blacklist button instead.
|
|
||||||
</p>
|
|
||||||
<p>
|
|
||||||
In future this verification process will be more sophisticated.
|
|
||||||
</p>
|
|
||||||
</div>
|
|
||||||
),
|
|
||||||
button: "I verify that the keys match",
|
|
||||||
onFinished: confirm=>{
|
|
||||||
if (confirm) {
|
|
||||||
MatrixClientPeg.get().setDeviceVerified(
|
|
||||||
this.props.userId, this.state.device.deviceId, true
|
|
||||||
);
|
|
||||||
}
|
|
||||||
},
|
|
||||||
});
|
});
|
||||||
},
|
},
|
||||||
|
|
||||||
|
|
|
@ -93,7 +93,7 @@ export default class DirectorySearchBox extends React.Component {
|
||||||
className="mx_DirectorySearchBox_input"
|
className="mx_DirectorySearchBox_input"
|
||||||
ref={this._collectInput}
|
ref={this._collectInput}
|
||||||
onChange={this._onChange} onKeyUp={this._onKeyUp}
|
onChange={this._onChange} onKeyUp={this._onKeyUp}
|
||||||
placeholder={this.props.placeholder}
|
placeholder={this.props.placeholder} autoFocus
|
||||||
/>
|
/>
|
||||||
{join_button}
|
{join_button}
|
||||||
<span className="mx_DirectorySearchBox_clear_wrapper">
|
<span className="mx_DirectorySearchBox_clear_wrapper">
|
||||||
|
|
|
@ -114,8 +114,11 @@ export default class Dropdown extends React.Component {
|
||||||
}
|
}
|
||||||
|
|
||||||
componentWillReceiveProps(nextProps) {
|
componentWillReceiveProps(nextProps) {
|
||||||
|
if (!nextProps.children || nextProps.children.length === 0) {
|
||||||
|
return;
|
||||||
|
}
|
||||||
this._reindexChildren(nextProps.children);
|
this._reindexChildren(nextProps.children);
|
||||||
const firstChild = React.Children.toArray(nextProps.children)[0];
|
const firstChild = nextProps.children[0];
|
||||||
this.setState({
|
this.setState({
|
||||||
highlightedOption: firstChild ? firstChild.key : null,
|
highlightedOption: firstChild ? firstChild.key : null,
|
||||||
});
|
});
|
||||||
|
@ -149,10 +152,12 @@ export default class Dropdown extends React.Component {
|
||||||
}
|
}
|
||||||
|
|
||||||
_onInputClick(ev) {
|
_onInputClick(ev) {
|
||||||
this.setState({
|
if (!this.state.expanded) {
|
||||||
expanded: !this.state.expanded,
|
this.setState({
|
||||||
});
|
expanded: true,
|
||||||
ev.preventDefault();
|
});
|
||||||
|
ev.preventDefault();
|
||||||
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
_onMenuOptionClick(dropdownKey) {
|
_onMenuOptionClick(dropdownKey) {
|
||||||
|
@ -249,7 +254,7 @@ export default class Dropdown extends React.Component {
|
||||||
);
|
);
|
||||||
});
|
});
|
||||||
if (options.length === 0) {
|
if (options.length === 0) {
|
||||||
return [<div className="mx_Dropdown_option">
|
return [<div key="0" className="mx_Dropdown_option">
|
||||||
No results
|
No results
|
||||||
</div>];
|
</div>];
|
||||||
}
|
}
|
||||||
|
|
128
src/components/views/elements/LanguageDropdown.js
Normal file
128
src/components/views/elements/LanguageDropdown.js
Normal file
|
@ -0,0 +1,128 @@
|
||||||
|
/*
|
||||||
|
Copyright 2017 Marcel Radzio (MTRNord)
|
||||||
|
Copyright 2017 Vector Creations Ltd.
|
||||||
|
|
||||||
|
Licensed under the Apache License, Version 2.0 (the "License");
|
||||||
|
you may not use this file except in compliance with the License.
|
||||||
|
You may obtain a copy of the License at
|
||||||
|
|
||||||
|
http://www.apache.org/licenses/LICENSE-2.0
|
||||||
|
|
||||||
|
Unless required by applicable law or agreed to in writing, software
|
||||||
|
distributed under the License is distributed on an "AS IS" BASIS,
|
||||||
|
WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
||||||
|
See the License for the specific language governing permissions and
|
||||||
|
limitations under the License.
|
||||||
|
*/
|
||||||
|
|
||||||
|
import React from 'react';
|
||||||
|
|
||||||
|
import sdk from '../../../index';
|
||||||
|
import UserSettingsStore from '../../../UserSettingsStore';
|
||||||
|
import { _t } from '../../../languageHandler';
|
||||||
|
import * as languageHandler from '../../../languageHandler';
|
||||||
|
|
||||||
|
function languageMatchesSearchQuery(query, language) {
|
||||||
|
if (language.label.toUpperCase().indexOf(query.toUpperCase()) == 0) return true;
|
||||||
|
if (language.value.toUpperCase() == query.toUpperCase()) return true;
|
||||||
|
return false;
|
||||||
|
}
|
||||||
|
|
||||||
|
export default class LanguageDropdown extends React.Component {
|
||||||
|
constructor(props) {
|
||||||
|
super(props);
|
||||||
|
this._onSearchChange = this._onSearchChange.bind(this);
|
||||||
|
|
||||||
|
this.state = {
|
||||||
|
searchQuery: '',
|
||||||
|
langs: null,
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
componentWillMount() {
|
||||||
|
languageHandler.getAllLanguageKeysFromJson().then((langKeys) => {
|
||||||
|
const langs = [];
|
||||||
|
langKeys.forEach((languageKey) => {
|
||||||
|
langs.push({
|
||||||
|
value: languageKey,
|
||||||
|
label: _t(languageKey)
|
||||||
|
});
|
||||||
|
});
|
||||||
|
langs.sort(function(a, b){
|
||||||
|
if(a.label < b.label) return -1;
|
||||||
|
if(a.label > b.label) return 1;
|
||||||
|
return 0;
|
||||||
|
});
|
||||||
|
this.setState({langs});
|
||||||
|
}).catch(() => {
|
||||||
|
this.setState({langs: ['en']});
|
||||||
|
}).done();
|
||||||
|
|
||||||
|
if (!this.props.value) {
|
||||||
|
// If no value is given, we start with the first
|
||||||
|
// country selected, but our parent component
|
||||||
|
// doesn't know this, therefore we do this.
|
||||||
|
const _localSettings = UserSettingsStore.getLocalSettings();
|
||||||
|
if (_localSettings.hasOwnProperty('language')) {
|
||||||
|
this.props.onOptionChange(_localSettings.language);
|
||||||
|
}else {
|
||||||
|
const language = languageHandler.normalizeLanguageKey(languageHandler.getLanguageFromBrowser());
|
||||||
|
this.props.onOptionChange(language);
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
_onSearchChange(search) {
|
||||||
|
this.setState({
|
||||||
|
searchQuery: search,
|
||||||
|
});
|
||||||
|
}
|
||||||
|
|
||||||
|
render() {
|
||||||
|
if (this.state.langs === null) {
|
||||||
|
const Spinner = sdk.getComponent('elements.Spinner');
|
||||||
|
return <Spinner />;
|
||||||
|
}
|
||||||
|
|
||||||
|
const Dropdown = sdk.getComponent('elements.Dropdown');
|
||||||
|
|
||||||
|
let displayedLanguages;
|
||||||
|
if (this.state.searchQuery) {
|
||||||
|
displayedLanguages = this.state.langs.filter((lang) => {
|
||||||
|
return languageMatchesSearchQuery(this.state.searchQuery, lang);
|
||||||
|
});
|
||||||
|
} else {
|
||||||
|
displayedLanguages = this.state.langs;
|
||||||
|
}
|
||||||
|
|
||||||
|
const options = displayedLanguages.map((language) => {
|
||||||
|
return <div key={language.value}>
|
||||||
|
{language.label}
|
||||||
|
</div>;
|
||||||
|
});
|
||||||
|
|
||||||
|
// default value here too, otherwise we need to handle null / undefined
|
||||||
|
// values between mounting and the initial value propgating
|
||||||
|
let value = null;
|
||||||
|
const _localSettings = UserSettingsStore.getLocalSettings();
|
||||||
|
if (_localSettings.hasOwnProperty('language')) {
|
||||||
|
value = this.props.value || _localSettings.language;
|
||||||
|
} else {
|
||||||
|
const language = navigator.language || navigator.userLanguage;
|
||||||
|
value = this.props.value || language;
|
||||||
|
}
|
||||||
|
|
||||||
|
return <Dropdown className={this.props.className}
|
||||||
|
onOptionChange={this.props.onOptionChange} onSearchChange={this._onSearchChange}
|
||||||
|
searchEnabled={true} value={value}
|
||||||
|
>
|
||||||
|
{options}
|
||||||
|
</Dropdown>
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
LanguageDropdown.propTypes = {
|
||||||
|
className: React.PropTypes.string,
|
||||||
|
onOptionChange: React.PropTypes.func.isRequired,
|
||||||
|
value: React.PropTypes.string,
|
||||||
|
};
|
|
@ -15,6 +15,7 @@ limitations under the License.
|
||||||
*/
|
*/
|
||||||
import React from 'react';
|
import React from 'react';
|
||||||
const MemberAvatar = require('../avatars/MemberAvatar.js');
|
const MemberAvatar = require('../avatars/MemberAvatar.js');
|
||||||
|
import { _t } from '../../../languageHandler';
|
||||||
|
|
||||||
module.exports = React.createClass({
|
module.exports = React.createClass({
|
||||||
displayName: 'MemberEventListSummary',
|
displayName: 'MemberEventListSummary',
|
||||||
|
@ -203,28 +204,146 @@ module.exports = React.createClass({
|
||||||
* @param {boolean} plural whether there were multiple users undergoing the same
|
* @param {boolean} plural whether there were multiple users undergoing the same
|
||||||
* transition.
|
* transition.
|
||||||
* @param {number} repeats the number of times the transition was repeated in a row.
|
* @param {number} repeats the number of times the transition was repeated in a row.
|
||||||
* @returns {string} the written English equivalent of the transition.
|
* @returns {string} the written Human Readable equivalent of the transition.
|
||||||
*/
|
*/
|
||||||
_getDescriptionForTransition(t, plural, repeats) {
|
_getDescriptionForTransition(t, plural, repeats) {
|
||||||
const beConjugated = plural ? "were" : "was";
|
// The empty interpolations 'severalUsers' and 'oneUser'
|
||||||
const invitation = "their invitation" + (plural || (repeats > 1) ? "s" : "");
|
// are there only to show translators to non-English languages
|
||||||
|
// that the verb is conjugated to plural or singular Subject.
|
||||||
let res = null;
|
let res = null;
|
||||||
const map = {
|
switch(t) {
|
||||||
"joined": "joined",
|
case "joined":
|
||||||
"left": "left",
|
if (repeats > 1) {
|
||||||
"joined_and_left": "joined and left",
|
res = (plural)
|
||||||
"left_and_joined": "left and rejoined",
|
? _t("%(severalUsers)sjoined %(repeats)s times", { severalUsers: "", repeats: repeats })
|
||||||
"invite_reject": "rejected " + invitation,
|
: _t("%(oneUser)sjoined %(repeats)s times", { oneUser: "", repeats: repeats });
|
||||||
"invite_withdrawal": "had " + invitation + " withdrawn",
|
} else {
|
||||||
"invited": beConjugated + " invited",
|
res = (plural)
|
||||||
"banned": beConjugated + " banned",
|
? _t("%(severalUsers)sjoined", { severalUsers: "" })
|
||||||
"unbanned": beConjugated + " unbanned",
|
: _t("%(oneUser)sjoined", { oneUser: "" });
|
||||||
"kicked": beConjugated + " kicked",
|
}
|
||||||
};
|
|
||||||
|
|
||||||
if (Object.keys(map).includes(t)) {
|
break;
|
||||||
res = map[t] + (repeats > 1 ? " " + repeats + " times" : "" );
|
case "left":
|
||||||
|
if (repeats > 1) {
|
||||||
|
res = (plural)
|
||||||
|
? _t("%(severalUsers)sleft %(repeats)s times", { severalUsers: "", repeats: repeats })
|
||||||
|
: _t("%(oneUser)sleft %(repeats)s times", { oneUser: "", repeats: repeats });
|
||||||
|
} else {
|
||||||
|
res = (plural)
|
||||||
|
? _t("%(severalUsers)sleft", { severalUsers: "" })
|
||||||
|
: _t("%(oneUser)sleft", { oneUser: "" });
|
||||||
|
} break;
|
||||||
|
case "joined_and_left":
|
||||||
|
if (repeats > 1) {
|
||||||
|
res = (plural)
|
||||||
|
? _t("%(severalUsers)sjoined and left %(repeats)s times", { severalUsers: "", repeats: repeats })
|
||||||
|
: _t("%(oneUser)sjoined and left %(repeats)s times", { oneUser: "", repeats: repeats });
|
||||||
|
} else {
|
||||||
|
res = (plural)
|
||||||
|
? _t("%(severalUsers)sjoined and left", { severalUsers: "" })
|
||||||
|
: _t("%(oneUser)sjoined and left", { oneUser: "" });
|
||||||
|
}
|
||||||
|
break;
|
||||||
|
case "left_and_joined":
|
||||||
|
if (repeats > 1) {
|
||||||
|
res = (plural)
|
||||||
|
? _t("%(severalUsers)sleft and rejoined %(repeats)s times", { severalUsers: "", repeats: repeats })
|
||||||
|
: _t("%(oneUser)sleft and rejoined %(repeats)s times", { oneUser: "", repeats: repeats });
|
||||||
|
} else {
|
||||||
|
res = (plural)
|
||||||
|
? _t("%(severalUsers)sleft and rejoined", { severalUsers: "" })
|
||||||
|
: _t("%(oneUser)sleft and rejoined", { oneUser: "" });
|
||||||
|
} break;
|
||||||
|
break;
|
||||||
|
case "invite_reject":
|
||||||
|
if (repeats > 1) {
|
||||||
|
res = (plural)
|
||||||
|
? _t("%(severalUsers)srejected their invitations %(repeats)s times", { severalUsers: "", repeats: repeats })
|
||||||
|
: _t("%(oneUser)srejected their invitation %(repeats)s times", { oneUser: "", repeats: repeats });
|
||||||
|
} else {
|
||||||
|
res = (plural)
|
||||||
|
? _t("%(severalUsers)srejected their invitations", { severalUsers: "" })
|
||||||
|
: _t("%(oneUser)srejected their invitation", { oneUser: "" });
|
||||||
|
}
|
||||||
|
break;
|
||||||
|
case "invite_withdrawal":
|
||||||
|
if (repeats > 1) {
|
||||||
|
res = (plural)
|
||||||
|
? _t("%(severalUsers)shad their invitations withdrawn %(repeats)s times", { severalUsers: "", repeats: repeats })
|
||||||
|
: _t("%(oneUser)shad their invitation withdrawn %(repeats)s times", { oneUser: "", repeats: repeats });
|
||||||
|
} else {
|
||||||
|
res = (plural)
|
||||||
|
? _t("%(severalUsers)shad their invitations withdrawn", { severalUsers: "" })
|
||||||
|
: _t("%(oneUser)shad their invitation withdrawn", { oneUser: "" });
|
||||||
|
}
|
||||||
|
break;
|
||||||
|
case "invited":
|
||||||
|
if (repeats > 1) {
|
||||||
|
res = (plural)
|
||||||
|
? _t("were invited %(repeats)s times", { repeats: repeats })
|
||||||
|
: _t("was invited %(repeats)s times", { repeats: repeats });
|
||||||
|
} else {
|
||||||
|
res = (plural)
|
||||||
|
? _t("were invited")
|
||||||
|
: _t("was invited");
|
||||||
|
}
|
||||||
|
break;
|
||||||
|
case "banned":
|
||||||
|
if (repeats > 1) {
|
||||||
|
res = (plural)
|
||||||
|
? _t("were banned %(repeats)s times", { repeats: repeats })
|
||||||
|
: _t("was banned %(repeats)s times", { repeats: repeats });
|
||||||
|
} else {
|
||||||
|
res = (plural)
|
||||||
|
? _t("were banned")
|
||||||
|
: _t("was banned");
|
||||||
|
}
|
||||||
|
break;
|
||||||
|
case "unbanned":
|
||||||
|
if (repeats > 1) {
|
||||||
|
res = (plural)
|
||||||
|
? _t("were unbanned %(repeats)s times", { repeats: repeats })
|
||||||
|
: _t("was unbanned %(repeats)s times", { repeats: repeats });
|
||||||
|
} else {
|
||||||
|
res = (plural)
|
||||||
|
? _t("were unbanned")
|
||||||
|
: _t("was unbanned");
|
||||||
|
}
|
||||||
|
break;
|
||||||
|
case "kicked":
|
||||||
|
if (repeats > 1) {
|
||||||
|
res = (plural)
|
||||||
|
? _t("were kicked %(repeats)s times", { repeats: repeats })
|
||||||
|
: _t("was kicked %(repeats)s times", { repeats: repeats });
|
||||||
|
} else {
|
||||||
|
res = (plural)
|
||||||
|
? _t("were kicked")
|
||||||
|
: _t("was kicked");
|
||||||
|
}
|
||||||
|
break;
|
||||||
|
case "changed_name":
|
||||||
|
if (repeats > 1) {
|
||||||
|
res = (plural)
|
||||||
|
? _t("%(severalUsers)schanged their name %(repeats)s times", { severalUsers: "", repeats: repeats })
|
||||||
|
: _t("%(oneUser)schanged their name %(repeats)s times", { oneUser: "", repeats: repeats });
|
||||||
|
} else {
|
||||||
|
res = (plural)
|
||||||
|
? _t("%(severalUsers)schanged their name", { severalUsers: "" })
|
||||||
|
: _t("%(oneUser)schanged their name", { oneUser: "" });
|
||||||
|
}
|
||||||
|
break;
|
||||||
|
case "changed_avatar":
|
||||||
|
if (repeats > 1) {
|
||||||
|
res = (plural)
|
||||||
|
? _t("%(severalUsers)schanged their avatar %(repeats)s times", { severalUsers: "", repeats: repeats })
|
||||||
|
: _t("%(oneUser)schanged their avatar %(repeats)s times", { oneUser: "", repeats: repeats });
|
||||||
|
} else {
|
||||||
|
res = (plural)
|
||||||
|
? _t("%(severalUsers)schanged their avatar", { severalUsers: "" })
|
||||||
|
: _t("%(oneUser)schanged their avatar", { oneUser: "" });
|
||||||
|
}
|
||||||
|
break;
|
||||||
}
|
}
|
||||||
|
|
||||||
return res;
|
return res;
|
||||||
|
@ -252,11 +371,12 @@ module.exports = React.createClass({
|
||||||
return items[0];
|
return items[0];
|
||||||
} else if (remaining) {
|
} else if (remaining) {
|
||||||
items = items.slice(0, itemLimit);
|
items = items.slice(0, itemLimit);
|
||||||
const other = " other" + (remaining > 1 ? "s" : "");
|
return (remaining > 1)
|
||||||
return items.join(', ') + ' and ' + remaining + other;
|
? _t("%(items)s and %(remaining)s others", { items: items.join(', '), remaining: remaining } )
|
||||||
|
: _t("%(items)s and one other", { items: items.join(', ') });
|
||||||
} else {
|
} else {
|
||||||
const lastItem = items.pop();
|
const lastItem = items.pop();
|
||||||
return items.join(', ') + ' and ' + lastItem;
|
return _t("%(items)s and %(lastItem)s", { items: items.join(', '), lastItem: lastItem });
|
||||||
}
|
}
|
||||||
},
|
},
|
||||||
|
|
||||||
|
@ -267,7 +387,7 @@ module.exports = React.createClass({
|
||||||
);
|
);
|
||||||
});
|
});
|
||||||
return (
|
return (
|
||||||
<span className="mx_MemberEventListSummary_avatars">
|
<span className="mx_MemberEventListSummary_avatars" onClick={ this._toggleSummary }>
|
||||||
{avatars}
|
{avatars}
|
||||||
</span>
|
</span>
|
||||||
);
|
);
|
||||||
|
@ -289,7 +409,24 @@ module.exports = React.createClass({
|
||||||
switch (e.mxEvent.getContent().membership) {
|
switch (e.mxEvent.getContent().membership) {
|
||||||
case 'invite': return 'invited';
|
case 'invite': return 'invited';
|
||||||
case 'ban': return 'banned';
|
case 'ban': return 'banned';
|
||||||
case 'join': return 'joined';
|
case 'join':
|
||||||
|
if (e.mxEvent.getPrevContent().membership === 'join') {
|
||||||
|
if (e.mxEvent.getContent().displayname !==
|
||||||
|
e.mxEvent.getPrevContent().displayname)
|
||||||
|
{
|
||||||
|
return 'changed_name';
|
||||||
|
}
|
||||||
|
else if (e.mxEvent.getContent().avatar_url !==
|
||||||
|
e.mxEvent.getPrevContent().avatar_url)
|
||||||
|
{
|
||||||
|
return 'changed_avatar';
|
||||||
|
}
|
||||||
|
// console.log("MELS ignoring duplicate membership join event");
|
||||||
|
return null;
|
||||||
|
}
|
||||||
|
else {
|
||||||
|
return 'joined';
|
||||||
|
}
|
||||||
case 'leave':
|
case 'leave':
|
||||||
if (e.mxEvent.getSender() === e.mxEvent.getStateKey()) {
|
if (e.mxEvent.getSender() === e.mxEvent.getStateKey()) {
|
||||||
switch (e.mxEvent.getPrevContent().membership) {
|
switch (e.mxEvent.getPrevContent().membership) {
|
||||||
|
@ -350,6 +487,7 @@ module.exports = React.createClass({
|
||||||
|
|
||||||
render: function() {
|
render: function() {
|
||||||
const eventsToRender = this.props.events;
|
const eventsToRender = this.props.events;
|
||||||
|
const eventIds = eventsToRender.map(e => e.getId()).join(',');
|
||||||
const fewEvents = eventsToRender.length < this.props.threshold;
|
const fewEvents = eventsToRender.length < this.props.threshold;
|
||||||
const expanded = this.state.expanded || fewEvents;
|
const expanded = this.state.expanded || fewEvents;
|
||||||
|
|
||||||
|
@ -360,7 +498,7 @@ module.exports = React.createClass({
|
||||||
|
|
||||||
if (fewEvents) {
|
if (fewEvents) {
|
||||||
return (
|
return (
|
||||||
<div className="mx_MemberEventListSummary">
|
<div className="mx_MemberEventListSummary" data-scroll-tokens={eventIds}>
|
||||||
{expandedEvents}
|
{expandedEvents}
|
||||||
</div>
|
</div>
|
||||||
);
|
);
|
||||||
|
@ -418,7 +556,7 @@ module.exports = React.createClass({
|
||||||
);
|
);
|
||||||
|
|
||||||
return (
|
return (
|
||||||
<div className="mx_MemberEventListSummary">
|
<div className="mx_MemberEventListSummary" data-scroll-tokens={eventIds}>
|
||||||
{toggleButton}
|
{toggleButton}
|
||||||
{summaryContainer}
|
{summaryContainer}
|
||||||
{expanded ? <div className="mx_MemberEventListSummary_line"> </div> : null}
|
{expanded ? <div className="mx_MemberEventListSummary_line"> </div> : null}
|
||||||
|
|
|
@ -19,10 +19,8 @@ limitations under the License.
|
||||||
import React from 'react';
|
import React from 'react';
|
||||||
import * as Roles from '../../../Roles';
|
import * as Roles from '../../../Roles';
|
||||||
|
|
||||||
|
var LEVEL_ROLE_MAP = {};
|
||||||
var reverseRoles = {};
|
var reverseRoles = {};
|
||||||
Object.keys(Roles.LEVEL_ROLE_MAP).forEach(function(key) {
|
|
||||||
reverseRoles[Roles.LEVEL_ROLE_MAP[key]] = key;
|
|
||||||
});
|
|
||||||
|
|
||||||
module.exports = React.createClass({
|
module.exports = React.createClass({
|
||||||
displayName: 'PowerSelector',
|
displayName: 'PowerSelector',
|
||||||
|
@ -44,9 +42,16 @@ module.exports = React.createClass({
|
||||||
|
|
||||||
getInitialState: function() {
|
getInitialState: function() {
|
||||||
return {
|
return {
|
||||||
custom: (Roles.LEVEL_ROLE_MAP[this.props.value] === undefined),
|
custom: (LEVEL_ROLE_MAP[this.props.value] === undefined),
|
||||||
};
|
};
|
||||||
},
|
},
|
||||||
|
|
||||||
|
componentWillMount: function() {
|
||||||
|
LEVEL_ROLE_MAP = Roles.levelRoleMap();
|
||||||
|
Object.keys(LEVEL_ROLE_MAP).forEach(function(key) {
|
||||||
|
reverseRoles[LEVEL_ROLE_MAP[key]] = key;
|
||||||
|
});
|
||||||
|
},
|
||||||
|
|
||||||
onSelectChange: function(event) {
|
onSelectChange: function(event) {
|
||||||
this.setState({ custom: event.target.value === "Custom" });
|
this.setState({ custom: event.target.value === "Custom" });
|
||||||
|
@ -94,7 +99,7 @@ module.exports = React.createClass({
|
||||||
selectValue = "Custom";
|
selectValue = "Custom";
|
||||||
}
|
}
|
||||||
else {
|
else {
|
||||||
selectValue = Roles.LEVEL_ROLE_MAP[this.props.value] || "Custom";
|
selectValue = LEVEL_ROLE_MAP[this.props.value] || "Custom";
|
||||||
}
|
}
|
||||||
var select;
|
var select;
|
||||||
if (this.props.disabled) {
|
if (this.props.disabled) {
|
||||||
|
@ -105,7 +110,7 @@ module.exports = React.createClass({
|
||||||
const levels = [0, 50, 100];
|
const levels = [0, 50, 100];
|
||||||
let options = levels.map((level) => {
|
let options = levels.map((level) => {
|
||||||
return {
|
return {
|
||||||
value: Roles.LEVEL_ROLE_MAP[level],
|
value: LEVEL_ROLE_MAP[level],
|
||||||
// Give a userDefault (users_default in the power event) of 0 but
|
// Give a userDefault (users_default in the power event) of 0 but
|
||||||
// because level !== undefined, this should never be used.
|
// because level !== undefined, this should never be used.
|
||||||
text: Roles.textualPowerLevel(level, 0),
|
text: Roles.textualPowerLevel(level, 0),
|
||||||
|
|
|
@ -19,7 +19,6 @@ import React from 'react';
|
||||||
import sdk from '../../../index';
|
import sdk from '../../../index';
|
||||||
|
|
||||||
import { COUNTRIES } from '../../../phonenumber';
|
import { COUNTRIES } from '../../../phonenumber';
|
||||||
import { charactersToImageNode } from '../../../HtmlUtils';
|
|
||||||
|
|
||||||
const COUNTRIES_BY_ISO2 = new Object(null);
|
const COUNTRIES_BY_ISO2 = new Object(null);
|
||||||
for (const c of COUNTRIES) {
|
for (const c of COUNTRIES) {
|
||||||
|
@ -27,9 +26,14 @@ for (const c of COUNTRIES) {
|
||||||
}
|
}
|
||||||
|
|
||||||
function countryMatchesSearchQuery(query, country) {
|
function countryMatchesSearchQuery(query, country) {
|
||||||
|
// Remove '+' if present (when searching for a prefix)
|
||||||
|
if (query[0] === '+') {
|
||||||
|
query = query.slice(1);
|
||||||
|
}
|
||||||
|
|
||||||
if (country.name.toUpperCase().indexOf(query.toUpperCase()) == 0) return true;
|
if (country.name.toUpperCase().indexOf(query.toUpperCase()) == 0) return true;
|
||||||
if (country.iso2 == query.toUpperCase()) return true;
|
if (country.iso2 == query.toUpperCase()) return true;
|
||||||
if (country.prefix == query) return true;
|
if (country.prefix.indexOf(query) !== -1) return true;
|
||||||
return false;
|
return false;
|
||||||
}
|
}
|
||||||
|
|
||||||
|
@ -37,10 +41,12 @@ export default class CountryDropdown extends React.Component {
|
||||||
constructor(props) {
|
constructor(props) {
|
||||||
super(props);
|
super(props);
|
||||||
this._onSearchChange = this._onSearchChange.bind(this);
|
this._onSearchChange = this._onSearchChange.bind(this);
|
||||||
|
this._onOptionChange = this._onOptionChange.bind(this);
|
||||||
|
this._getShortOption = this._getShortOption.bind(this);
|
||||||
|
|
||||||
this.state = {
|
this.state = {
|
||||||
searchQuery: '',
|
searchQuery: '',
|
||||||
}
|
};
|
||||||
}
|
}
|
||||||
|
|
||||||
componentWillMount() {
|
componentWillMount() {
|
||||||
|
@ -48,7 +54,7 @@ export default class CountryDropdown extends React.Component {
|
||||||
// If no value is given, we start with the first
|
// If no value is given, we start with the first
|
||||||
// country selected, but our parent component
|
// country selected, but our parent component
|
||||||
// doesn't know this, therefore we do this.
|
// doesn't know this, therefore we do this.
|
||||||
this.props.onOptionChange(COUNTRIES[0].iso2);
|
this.props.onOptionChange(COUNTRIES[0]);
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
|
@ -58,14 +64,26 @@ export default class CountryDropdown extends React.Component {
|
||||||
});
|
});
|
||||||
}
|
}
|
||||||
|
|
||||||
|
_onOptionChange(iso2) {
|
||||||
|
this.props.onOptionChange(COUNTRIES_BY_ISO2[iso2]);
|
||||||
|
}
|
||||||
|
|
||||||
_flagImgForIso2(iso2) {
|
_flagImgForIso2(iso2) {
|
||||||
// Unicode Regional Indicator Symbol letter 'A'
|
return <img src={`flags/${iso2}.png`}/>;
|
||||||
const RIS_A = 0x1F1E6;
|
}
|
||||||
const ASCII_A = 65;
|
|
||||||
return charactersToImageNode(iso2, true,
|
_getShortOption(iso2) {
|
||||||
RIS_A + (iso2.charCodeAt(0) - ASCII_A),
|
if (!this.props.isSmall) {
|
||||||
RIS_A + (iso2.charCodeAt(1) - ASCII_A),
|
return undefined;
|
||||||
);
|
}
|
||||||
|
let countryPrefix;
|
||||||
|
if (this.props.showPrefix) {
|
||||||
|
countryPrefix = '+' + COUNTRIES_BY_ISO2[iso2].prefix;
|
||||||
|
}
|
||||||
|
return <span>
|
||||||
|
{ this._flagImgForIso2(iso2) }
|
||||||
|
{ countryPrefix }
|
||||||
|
</span>;
|
||||||
}
|
}
|
||||||
|
|
||||||
render() {
|
render() {
|
||||||
|
@ -94,7 +112,7 @@ export default class CountryDropdown extends React.Component {
|
||||||
const options = displayedCountries.map((country) => {
|
const options = displayedCountries.map((country) => {
|
||||||
return <div key={country.iso2}>
|
return <div key={country.iso2}>
|
||||||
{this._flagImgForIso2(country.iso2)}
|
{this._flagImgForIso2(country.iso2)}
|
||||||
{country.name}
|
{country.name} <span>(+{country.prefix})</span>
|
||||||
</div>;
|
</div>;
|
||||||
});
|
});
|
||||||
|
|
||||||
|
@ -102,18 +120,21 @@ export default class CountryDropdown extends React.Component {
|
||||||
// values between mounting and the initial value propgating
|
// values between mounting and the initial value propgating
|
||||||
const value = this.props.value || COUNTRIES[0].iso2;
|
const value = this.props.value || COUNTRIES[0].iso2;
|
||||||
|
|
||||||
return <Dropdown className={this.props.className}
|
return <Dropdown className={this.props.className + " left_aligned"}
|
||||||
onOptionChange={this.props.onOptionChange} onSearchChange={this._onSearchChange}
|
onOptionChange={this._onOptionChange} onSearchChange={this._onSearchChange}
|
||||||
menuWidth={298} getShortOption={this._flagImgForIso2}
|
menuWidth={298} getShortOption={this._getShortOption}
|
||||||
value={value} searchEnabled={true}
|
value={value} searchEnabled={true}
|
||||||
>
|
>
|
||||||
{options}
|
{options}
|
||||||
</Dropdown>
|
</Dropdown>;
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
CountryDropdown.propTypes = {
|
CountryDropdown.propTypes = {
|
||||||
className: React.PropTypes.string,
|
className: React.PropTypes.string,
|
||||||
|
isSmall: React.PropTypes.bool,
|
||||||
|
// if isSmall, show +44 in the selected value
|
||||||
|
showPrefix: React.PropTypes.bool,
|
||||||
onOptionChange: React.PropTypes.func.isRequired,
|
onOptionChange: React.PropTypes.func.isRequired,
|
||||||
value: React.PropTypes.string,
|
value: React.PropTypes.string,
|
||||||
};
|
};
|
||||||
|
|
|
@ -19,6 +19,7 @@ import React from 'react';
|
||||||
import ReactDOM from 'react-dom';
|
import ReactDOM from 'react-dom';
|
||||||
import classNames from 'classnames';
|
import classNames from 'classnames';
|
||||||
import sdk from '../../../index';
|
import sdk from '../../../index';
|
||||||
|
import { _t } from '../../../languageHandler';
|
||||||
import {field_input_incorrect} from '../../../UiEffects';
|
import {field_input_incorrect} from '../../../UiEffects';
|
||||||
|
|
||||||
|
|
||||||
|
@ -90,8 +91,11 @@ class PasswordLogin extends React.Component {
|
||||||
}
|
}
|
||||||
|
|
||||||
onPhoneCountryChanged(country) {
|
onPhoneCountryChanged(country) {
|
||||||
this.setState({phoneCountry: country});
|
this.setState({
|
||||||
this.props.onPhoneCountryChanged(country);
|
phoneCountry: country.iso2,
|
||||||
|
phonePrefix: country.prefix,
|
||||||
|
});
|
||||||
|
this.props.onPhoneCountryChanged(country.iso2);
|
||||||
}
|
}
|
||||||
|
|
||||||
onPhoneNumberChanged(ev) {
|
onPhoneNumberChanged(ev) {
|
||||||
|
@ -118,42 +122,29 @@ class PasswordLogin extends React.Component {
|
||||||
autoFocus
|
autoFocus
|
||||||
/>;
|
/>;
|
||||||
case PasswordLogin.LOGIN_FIELD_MXID:
|
case PasswordLogin.LOGIN_FIELD_MXID:
|
||||||
const mxidInputClasses = classNames({
|
return <input
|
||||||
"mx_Login_field": true,
|
className="mx_Login_field mx_Login_username"
|
||||||
"mx_Login_username": true,
|
key="username_input"
|
||||||
"mx_Login_field_has_suffix": Boolean(this.props.hsDomain),
|
type="text"
|
||||||
});
|
name="username" // make it a little easier for browser's remember-password
|
||||||
let suffix = null;
|
onChange={this.onUsernameChanged}
|
||||||
if (this.props.hsDomain) {
|
placeholder={_t('User name')}
|
||||||
suffix = <div className="mx_Login_username_suffix">
|
value={this.state.username}
|
||||||
:{this.props.hsDomain}
|
autoFocus
|
||||||
</div>;
|
/>;
|
||||||
}
|
|
||||||
return <div className="mx_Login_username_group">
|
|
||||||
<div className="mx_Login_username_prefix">@</div>
|
|
||||||
<input
|
|
||||||
className={mxidInputClasses}
|
|
||||||
key="username_input"
|
|
||||||
type="text"
|
|
||||||
name="username" // make it a little easier for browser's remember-password
|
|
||||||
onChange={this.onUsernameChanged}
|
|
||||||
placeholder="username"
|
|
||||||
value={this.state.username}
|
|
||||||
autoFocus
|
|
||||||
/>
|
|
||||||
{suffix}
|
|
||||||
</div>;
|
|
||||||
case PasswordLogin.LOGIN_FIELD_PHONE:
|
case PasswordLogin.LOGIN_FIELD_PHONE:
|
||||||
const CountryDropdown = sdk.getComponent('views.login.CountryDropdown');
|
const CountryDropdown = sdk.getComponent('views.login.CountryDropdown');
|
||||||
return <div className="mx_Login_phoneSection">
|
return <div className="mx_Login_phoneSection">
|
||||||
<CountryDropdown
|
<CountryDropdown
|
||||||
className="mx_Login_phoneCountry"
|
className="mx_Login_phoneCountry mx_Login_field_prefix"
|
||||||
ref="phone_country"
|
ref="phone_country"
|
||||||
onOptionChange={this.onPhoneCountryChanged}
|
onOptionChange={this.onPhoneCountryChanged}
|
||||||
value={this.state.phoneCountry}
|
value={this.state.phoneCountry}
|
||||||
|
isSmall={true}
|
||||||
|
showPrefix={true}
|
||||||
/>
|
/>
|
||||||
<input
|
<input
|
||||||
className="mx_Login_phoneNumberField mx_Login_field"
|
className="mx_Login_phoneNumberField mx_Login_field mx_Login_field_has_prefix"
|
||||||
ref="phoneNumber"
|
ref="phoneNumber"
|
||||||
key="phone_input"
|
key="phone_input"
|
||||||
type="text"
|
type="text"
|
||||||
|
@ -173,7 +164,7 @@ class PasswordLogin extends React.Component {
|
||||||
if (this.props.onForgotPasswordClick) {
|
if (this.props.onForgotPasswordClick) {
|
||||||
forgotPasswordJsx = (
|
forgotPasswordJsx = (
|
||||||
<a className="mx_Login_forgot" onClick={this.props.onForgotPasswordClick} href="#">
|
<a className="mx_Login_forgot" onClick={this.props.onForgotPasswordClick} href="#">
|
||||||
Forgot your password?
|
{ _t('Forgot your password?') }
|
||||||
</a>
|
</a>
|
||||||
);
|
);
|
||||||
}
|
}
|
||||||
|
@ -191,24 +182,24 @@ class PasswordLogin extends React.Component {
|
||||||
<div>
|
<div>
|
||||||
<form onSubmit={this.onSubmitForm}>
|
<form onSubmit={this.onSubmitForm}>
|
||||||
<div className="mx_Login_type_container">
|
<div className="mx_Login_type_container">
|
||||||
<label className="mx_Login_type_label">I want to sign in with my</label>
|
<label className="mx_Login_type_label">{ _t('I want to sign in with') }</label>
|
||||||
<Dropdown
|
<Dropdown
|
||||||
className="mx_Login_type_dropdown"
|
className="mx_Login_type_dropdown"
|
||||||
value={this.state.loginType}
|
value={this.state.loginType}
|
||||||
onOptionChange={this.onLoginTypeChange}>
|
onOptionChange={this.onLoginTypeChange}>
|
||||||
<span key={PasswordLogin.LOGIN_FIELD_MXID}>Matrix ID</span>
|
<span key={PasswordLogin.LOGIN_FIELD_MXID}>{ _t('my Matrix ID') }</span>
|
||||||
<span key={PasswordLogin.LOGIN_FIELD_EMAIL}>Email Address</span>
|
<span key={PasswordLogin.LOGIN_FIELD_EMAIL}>{ _t('Email address') }</span>
|
||||||
<span key={PasswordLogin.LOGIN_FIELD_PHONE}>Phone</span>
|
<span key={PasswordLogin.LOGIN_FIELD_PHONE}>{ _t('Phone') }</span>
|
||||||
</Dropdown>
|
</Dropdown>
|
||||||
</div>
|
</div>
|
||||||
{loginField}
|
{loginField}
|
||||||
<input className={pwFieldClass} ref={(e) => {this._passwordField = e;}} type="password"
|
<input className={pwFieldClass} ref={(e) => {this._passwordField = e;}} type="password"
|
||||||
name="password"
|
name="password"
|
||||||
value={this.state.password} onChange={this.onPasswordChanged}
|
value={this.state.password} onChange={this.onPasswordChanged}
|
||||||
placeholder="Password" />
|
placeholder={ _t('Password') } />
|
||||||
<br />
|
<br />
|
||||||
{forgotPasswordJsx}
|
{forgotPasswordJsx}
|
||||||
<input className="mx_Login_submit" type="submit" value="Sign in" />
|
<input className="mx_Login_submit" type="submit" value={ _t('Sign in') } />
|
||||||
</form>
|
</form>
|
||||||
</div>
|
</div>
|
||||||
);
|
);
|
||||||
|
@ -231,7 +222,6 @@ PasswordLogin.propTypes = {
|
||||||
onPhoneNumberChanged: React.PropTypes.func,
|
onPhoneNumberChanged: React.PropTypes.func,
|
||||||
onPasswordChanged: React.PropTypes.func,
|
onPasswordChanged: React.PropTypes.func,
|
||||||
loginIncorrect: React.PropTypes.bool,
|
loginIncorrect: React.PropTypes.bool,
|
||||||
hsDomain: React.PropTypes.string,
|
|
||||||
};
|
};
|
||||||
|
|
||||||
module.exports = PasswordLogin;
|
module.exports = PasswordLogin;
|
||||||
|
|
|
@ -100,7 +100,7 @@ module.exports = React.createClass({
|
||||||
if (this.refs.email.value == '') {
|
if (this.refs.email.value == '') {
|
||||||
var QuestionDialog = sdk.getComponent("dialogs.QuestionDialog");
|
var QuestionDialog = sdk.getComponent("dialogs.QuestionDialog");
|
||||||
Modal.createDialog(QuestionDialog, {
|
Modal.createDialog(QuestionDialog, {
|
||||||
title: "Warning",
|
title: "Warning!",
|
||||||
description:
|
description:
|
||||||
<div>
|
<div>
|
||||||
If you don't specify an email address, you won't be able to reset your password.<br/>
|
If you don't specify an email address, you won't be able to reset your password.<br/>
|
||||||
|
@ -270,7 +270,8 @@ module.exports = React.createClass({
|
||||||
|
|
||||||
_onPhoneCountryChange(newVal) {
|
_onPhoneCountryChange(newVal) {
|
||||||
this.setState({
|
this.setState({
|
||||||
phoneCountry: newVal,
|
phoneCountry: newVal.iso2,
|
||||||
|
phonePrefix: newVal.prefix,
|
||||||
});
|
});
|
||||||
},
|
},
|
||||||
|
|
||||||
|
@ -313,14 +314,19 @@ module.exports = React.createClass({
|
||||||
const phoneSection = (
|
const phoneSection = (
|
||||||
<div className="mx_Login_phoneSection">
|
<div className="mx_Login_phoneSection">
|
||||||
<CountryDropdown ref="phone_country" onOptionChange={this._onPhoneCountryChange}
|
<CountryDropdown ref="phone_country" onOptionChange={this._onPhoneCountryChange}
|
||||||
className="mx_Login_phoneCountry"
|
className="mx_Login_phoneCountry mx_Login_field_prefix"
|
||||||
value={this.state.phoneCountry}
|
value={this.state.phoneCountry}
|
||||||
|
isSmall={true}
|
||||||
|
showPrefix={true}
|
||||||
/>
|
/>
|
||||||
<input type="text" ref="phoneNumber"
|
<input type="text" ref="phoneNumber"
|
||||||
placeholder="Mobile phone number (optional)"
|
placeholder="Mobile phone number (optional)"
|
||||||
defaultValue={this.props.defaultPhoneNumber}
|
defaultValue={this.props.defaultPhoneNumber}
|
||||||
className={this._classForField(
|
className={this._classForField(
|
||||||
FIELD_PHONE_NUMBER, 'mx_Login_phoneNumberField', 'mx_Login_field'
|
FIELD_PHONE_NUMBER,
|
||||||
|
'mx_Login_phoneNumberField',
|
||||||
|
'mx_Login_field',
|
||||||
|
'mx_Login_field_has_prefix'
|
||||||
)}
|
)}
|
||||||
onBlur={function() {self.validateField(FIELD_PHONE_NUMBER);}}
|
onBlur={function() {self.validateField(FIELD_PHONE_NUMBER);}}
|
||||||
value={self.state.phoneNumber}
|
value={self.state.phoneNumber}
|
||||||
|
|
|
@ -20,6 +20,7 @@ import React from 'react';
|
||||||
import filesize from 'filesize';
|
import filesize from 'filesize';
|
||||||
import MatrixClientPeg from '../../../MatrixClientPeg';
|
import MatrixClientPeg from '../../../MatrixClientPeg';
|
||||||
import sdk from '../../../index';
|
import sdk from '../../../index';
|
||||||
|
import { _t } from '../../../languageHandler';
|
||||||
import {decryptFile} from '../../../utils/DecryptFile';
|
import {decryptFile} from '../../../utils/DecryptFile';
|
||||||
import Tinter from '../../../Tinter';
|
import Tinter from '../../../Tinter';
|
||||||
import request from 'browser-request';
|
import request from 'browser-request';
|
||||||
|
@ -202,7 +203,7 @@ module.exports = React.createClass({
|
||||||
* @return {string} the human readable link text for the attachment.
|
* @return {string} the human readable link text for the attachment.
|
||||||
*/
|
*/
|
||||||
presentableTextForFile: function(content) {
|
presentableTextForFile: function(content) {
|
||||||
var linkText = 'Attachment';
|
var linkText = _t("Attachment");
|
||||||
if (content.body && content.body.length > 0) {
|
if (content.body && content.body.length > 0) {
|
||||||
// The content body should be the name of the file including a
|
// The content body should be the name of the file including a
|
||||||
// file extension.
|
// file extension.
|
||||||
|
@ -261,7 +262,7 @@ module.exports = React.createClass({
|
||||||
const content = this.props.mxEvent.getContent();
|
const content = this.props.mxEvent.getContent();
|
||||||
const text = this.presentableTextForFile(content);
|
const text = this.presentableTextForFile(content);
|
||||||
const isEncrypted = content.file !== undefined;
|
const isEncrypted = content.file !== undefined;
|
||||||
const fileName = content.body && content.body.length > 0 ? content.body : "Attachment";
|
const fileName = content.body && content.body.length > 0 ? content.body : _t("Attachment");
|
||||||
const contentUrl = this._getContentUrl();
|
const contentUrl = this._getContentUrl();
|
||||||
const ErrorDialog = sdk.getComponent("dialogs.ErrorDialog");
|
const ErrorDialog = sdk.getComponent("dialogs.ErrorDialog");
|
||||||
|
|
||||||
|
@ -283,7 +284,8 @@ module.exports = React.createClass({
|
||||||
}).catch((err) => {
|
}).catch((err) => {
|
||||||
console.warn("Unable to decrypt attachment: ", err);
|
console.warn("Unable to decrypt attachment: ", err);
|
||||||
Modal.createDialog(ErrorDialog, {
|
Modal.createDialog(ErrorDialog, {
|
||||||
description: "Error decrypting attachment"
|
title: _t("Error"),
|
||||||
|
description: _t("Error decrypting attachment"),
|
||||||
});
|
});
|
||||||
}).finally(() => {
|
}).finally(() => {
|
||||||
decrypting = false;
|
decrypting = false;
|
||||||
|
@ -295,7 +297,7 @@ module.exports = React.createClass({
|
||||||
<span className="mx_MFileBody" ref="body">
|
<span className="mx_MFileBody" ref="body">
|
||||||
<div className="mx_MImageBody_download">
|
<div className="mx_MImageBody_download">
|
||||||
<a href="javascript:void(0)" onClick={decrypt}>
|
<a href="javascript:void(0)" onClick={decrypt}>
|
||||||
Decrypt {text}
|
{ _t("Decrypt %(text)s", { text: text }) }
|
||||||
</a>
|
</a>
|
||||||
</div>
|
</div>
|
||||||
</span>
|
</span>
|
||||||
|
@ -314,7 +316,7 @@ module.exports = React.createClass({
|
||||||
// We can't provide a Content-Disposition header like we would for HTTP.
|
// We can't provide a Content-Disposition header like we would for HTTP.
|
||||||
download: fileName,
|
download: fileName,
|
||||||
target: "_blank",
|
target: "_blank",
|
||||||
textContent: "Download " + text,
|
textContent: _t("Download %(text)s", { text: text }),
|
||||||
}, "*");
|
}, "*");
|
||||||
};
|
};
|
||||||
|
|
||||||
|
@ -362,7 +364,7 @@ module.exports = React.createClass({
|
||||||
<div className="mx_MImageBody_download">
|
<div className="mx_MImageBody_download">
|
||||||
<a href={contentUrl} download={fileName} target="_blank" rel="noopener">
|
<a href={contentUrl} download={fileName} target="_blank" rel="noopener">
|
||||||
<img src={tintedDownloadImageURL} width="12" height="14" ref="downloadImage"/>
|
<img src={tintedDownloadImageURL} width="12" height="14" ref="downloadImage"/>
|
||||||
Download {text}
|
{ _t("Download %(text)s", { text: text }) }
|
||||||
</a>
|
</a>
|
||||||
</div>
|
</div>
|
||||||
</span>
|
</span>
|
||||||
|
@ -371,7 +373,7 @@ module.exports = React.createClass({
|
||||||
} else {
|
} else {
|
||||||
var extra = text ? (': ' + text) : '';
|
var extra = text ? (': ' + text) : '';
|
||||||
return <span className="mx_MFileBody">
|
return <span className="mx_MFileBody">
|
||||||
Invalid file{extra}
|
{ _t("Invalid file%(extra)s", { extra: extra }) }
|
||||||
</span>;
|
</span>;
|
||||||
}
|
}
|
||||||
},
|
},
|
||||||
|
|
|
@ -19,6 +19,7 @@ var React = require('react');
|
||||||
var ObjectUtils = require("../../../ObjectUtils");
|
var ObjectUtils = require("../../../ObjectUtils");
|
||||||
var MatrixClientPeg = require('../../../MatrixClientPeg');
|
var MatrixClientPeg = require('../../../MatrixClientPeg');
|
||||||
var sdk = require("../../../index");
|
var sdk = require("../../../index");
|
||||||
|
import { _t } from '../../../languageHandler';
|
||||||
var Modal = require("../../../Modal");
|
var Modal = require("../../../Modal");
|
||||||
|
|
||||||
module.exports = React.createClass({
|
module.exports = React.createClass({
|
||||||
|
@ -154,8 +155,8 @@ module.exports = React.createClass({
|
||||||
else {
|
else {
|
||||||
var ErrorDialog = sdk.getComponent("dialogs.ErrorDialog");
|
var ErrorDialog = sdk.getComponent("dialogs.ErrorDialog");
|
||||||
Modal.createDialog(ErrorDialog, {
|
Modal.createDialog(ErrorDialog, {
|
||||||
title: "Invalid alias format",
|
title: _t('Invalid alias format'),
|
||||||
description: "'" + alias + "' is not a valid format for an alias",
|
description: _t('\'%(alias)s\' is not a valid format for an alias', { alias: alias }),
|
||||||
});
|
});
|
||||||
}
|
}
|
||||||
},
|
},
|
||||||
|
@ -170,8 +171,8 @@ module.exports = React.createClass({
|
||||||
else {
|
else {
|
||||||
var ErrorDialog = sdk.getComponent("dialogs.ErrorDialog");
|
var ErrorDialog = sdk.getComponent("dialogs.ErrorDialog");
|
||||||
Modal.createDialog(ErrorDialog, {
|
Modal.createDialog(ErrorDialog, {
|
||||||
title: "Invalid address format",
|
title: _t('Invalid address format'),
|
||||||
description: "'" + alias + "' is not a valid format for an address",
|
description: _t('\'%(alias)s\' is not a valid format for an address', { alias: alias }),
|
||||||
});
|
});
|
||||||
}
|
}
|
||||||
},
|
},
|
||||||
|
@ -203,7 +204,7 @@ module.exports = React.createClass({
|
||||||
if (this.props.canSetCanonicalAlias) {
|
if (this.props.canSetCanonicalAlias) {
|
||||||
canonical_alias_section = (
|
canonical_alias_section = (
|
||||||
<select onChange={this.onCanonicalAliasChange} defaultValue={ this.state.canonicalAlias }>
|
<select onChange={this.onCanonicalAliasChange} defaultValue={ this.state.canonicalAlias }>
|
||||||
<option value="" key="unset">not specified</option>
|
<option value="" key="unset">{ _t('not specified') }</option>
|
||||||
{
|
{
|
||||||
Object.keys(self.state.domainToAliases).map(function(domain, i) {
|
Object.keys(self.state.domainToAliases).map(function(domain, i) {
|
||||||
return self.state.domainToAliases[domain].map(function(alias, j) {
|
return self.state.domainToAliases[domain].map(function(alias, j) {
|
||||||
|
@ -220,7 +221,7 @@ module.exports = React.createClass({
|
||||||
}
|
}
|
||||||
else {
|
else {
|
||||||
canonical_alias_section = (
|
canonical_alias_section = (
|
||||||
<b>{ this.state.canonicalAlias || "not set" }</b>
|
<b>{ this.state.canonicalAlias || _t('not set') }</b>
|
||||||
);
|
);
|
||||||
}
|
}
|
||||||
|
|
||||||
|
@ -254,13 +255,13 @@ module.exports = React.createClass({
|
||||||
<div>
|
<div>
|
||||||
<h3>Addresses</h3>
|
<h3>Addresses</h3>
|
||||||
<div className="mx_RoomSettings_aliasLabel">
|
<div className="mx_RoomSettings_aliasLabel">
|
||||||
The main address for this room is: { canonical_alias_section }
|
{ _t('The main address for this room is') }: { canonical_alias_section }
|
||||||
</div>
|
</div>
|
||||||
<div className="mx_RoomSettings_aliasLabel">
|
<div className="mx_RoomSettings_aliasLabel">
|
||||||
{ (this.state.domainToAliases[localDomain] &&
|
{ (this.state.domainToAliases[localDomain] &&
|
||||||
this.state.domainToAliases[localDomain].length > 0)
|
this.state.domainToAliases[localDomain].length > 0)
|
||||||
? "Local addresses for this room:"
|
? _t('Local addresses for this room:')
|
||||||
: "This room has no local addresses" }
|
: _t('This room has no local addresses') }
|
||||||
</div>
|
</div>
|
||||||
<div className="mx_RoomSettings_aliasesTable">
|
<div className="mx_RoomSettings_aliasesTable">
|
||||||
{ (this.state.domainToAliases[localDomain] || []).map((alias, i) => {
|
{ (this.state.domainToAliases[localDomain] || []).map((alias, i) => {
|
||||||
|
@ -268,7 +269,7 @@ module.exports = React.createClass({
|
||||||
if (this.props.canSetAliases) {
|
if (this.props.canSetAliases) {
|
||||||
deleteButton = (
|
deleteButton = (
|
||||||
<img src="img/cancel-small.svg" width="14" height="14"
|
<img src="img/cancel-small.svg" width="14" height="14"
|
||||||
alt="Delete" onClick={ self.onAliasDeleted.bind(self, localDomain, i) } />
|
alt={ _t('Delete') } onClick={ self.onAliasDeleted.bind(self, localDomain, i) } />
|
||||||
);
|
);
|
||||||
}
|
}
|
||||||
return (
|
return (
|
||||||
|
@ -276,7 +277,7 @@ module.exports = React.createClass({
|
||||||
<EditableText
|
<EditableText
|
||||||
className="mx_RoomSettings_alias mx_RoomSettings_editable"
|
className="mx_RoomSettings_alias mx_RoomSettings_editable"
|
||||||
placeholderClassName="mx_RoomSettings_aliasPlaceholder"
|
placeholderClassName="mx_RoomSettings_aliasPlaceholder"
|
||||||
placeholder={ "New address (e.g. #foo:" + localDomain + ")" }
|
placeholder={ _t('New address (e.g. #foo:%(localDomain)s)', { localDomain: localDomain}) }
|
||||||
blurToCancel={ false }
|
blurToCancel={ false }
|
||||||
onValueChanged={ self.onAliasChanged.bind(self, localDomain, i) }
|
onValueChanged={ self.onAliasChanged.bind(self, localDomain, i) }
|
||||||
editable={ self.props.canSetAliases }
|
editable={ self.props.canSetAliases }
|
||||||
|
@ -294,7 +295,7 @@ module.exports = React.createClass({
|
||||||
ref="add_alias"
|
ref="add_alias"
|
||||||
className="mx_RoomSettings_alias mx_RoomSettings_editable"
|
className="mx_RoomSettings_alias mx_RoomSettings_editable"
|
||||||
placeholderClassName="mx_RoomSettings_aliasPlaceholder"
|
placeholderClassName="mx_RoomSettings_aliasPlaceholder"
|
||||||
placeholder={ "New address (e.g. #foo:" + localDomain + ")" }
|
placeholder={ _t('New address (e.g. #foo:%(localDomain)s)', { localDomain: localDomain}) }
|
||||||
blurToCancel={ false }
|
blurToCancel={ false }
|
||||||
onValueChanged={ self.onAliasAdded } />
|
onValueChanged={ self.onAliasAdded } />
|
||||||
<div className="mx_RoomSettings_addAlias mx_filterFlipColor">
|
<div className="mx_RoomSettings_addAlias mx_filterFlipColor">
|
||||||
|
|
|
@ -16,8 +16,10 @@ limitations under the License.
|
||||||
|
|
||||||
'use strict';
|
'use strict';
|
||||||
|
|
||||||
|
|
||||||
var React = require('react');
|
var React = require('react');
|
||||||
var classNames = require("classnames");
|
var classNames = require("classnames");
|
||||||
|
import { _t } from '../../../languageHandler';
|
||||||
var Modal = require('../../../Modal');
|
var Modal = require('../../../Modal');
|
||||||
|
|
||||||
var sdk = require('../../../index');
|
var sdk = require('../../../index');
|
||||||
|
@ -129,6 +131,9 @@ module.exports = WithMatrixClient(React.createClass({
|
||||||
* for now.
|
* for now.
|
||||||
*/
|
*/
|
||||||
tileShape: React.PropTypes.string,
|
tileShape: React.PropTypes.string,
|
||||||
|
|
||||||
|
// show twelve hour timestamps
|
||||||
|
isTwelveHour: React.PropTypes.bool,
|
||||||
},
|
},
|
||||||
|
|
||||||
getInitialState: function() {
|
getInitialState: function() {
|
||||||
|
@ -295,16 +300,6 @@ module.exports = WithMatrixClient(React.createClass({
|
||||||
const receiptOffset = 15;
|
const receiptOffset = 15;
|
||||||
let left = 0;
|
let left = 0;
|
||||||
|
|
||||||
// It's possible that the receipt was sent several days AFTER the event.
|
|
||||||
// If it is, we want to display the complete date along with the HH:MM:SS,
|
|
||||||
// rather than just HH:MM:SS.
|
|
||||||
let dayAfterEvent = new Date(this.props.mxEvent.getTs());
|
|
||||||
dayAfterEvent.setDate(dayAfterEvent.getDate() + 1);
|
|
||||||
dayAfterEvent.setHours(0);
|
|
||||||
dayAfterEvent.setMinutes(0);
|
|
||||||
dayAfterEvent.setSeconds(0);
|
|
||||||
let dayAfterEventTime = dayAfterEvent.getTime();
|
|
||||||
|
|
||||||
var receipts = this.props.readReceipts || [];
|
var receipts = this.props.readReceipts || [];
|
||||||
for (var i = 0; i < receipts.length; ++i) {
|
for (var i = 0; i < receipts.length; ++i) {
|
||||||
var receipt = receipts[i];
|
var receipt = receipts[i];
|
||||||
|
@ -340,7 +335,6 @@ module.exports = WithMatrixClient(React.createClass({
|
||||||
suppressAnimation={this._suppressReadReceiptAnimation}
|
suppressAnimation={this._suppressReadReceiptAnimation}
|
||||||
onClick={this.toggleAllReadAvatars}
|
onClick={this.toggleAllReadAvatars}
|
||||||
timestamp={receipt.ts}
|
timestamp={receipt.ts}
|
||||||
showFullTimestamp={receipt.ts >= dayAfterEventTime}
|
|
||||||
/>
|
/>
|
||||||
);
|
);
|
||||||
}
|
}
|
||||||
|
@ -401,8 +395,7 @@ module.exports = WithMatrixClient(React.createClass({
|
||||||
var msgtype = content.msgtype;
|
var msgtype = content.msgtype;
|
||||||
var eventType = this.props.mxEvent.getType();
|
var eventType = this.props.mxEvent.getType();
|
||||||
|
|
||||||
// Info messages are basically information about commands processed on a
|
// Info messages are basically information about commands processed on a room
|
||||||
// room, or emote messages
|
|
||||||
var isInfoMessage = (eventType !== 'm.room.message');
|
var isInfoMessage = (eventType !== 'm.room.message');
|
||||||
|
|
||||||
var EventTileType = sdk.getComponent(eventTileTypes[eventType]);
|
var EventTileType = sdk.getComponent(eventTileTypes[eventType]);
|
||||||
|
@ -416,9 +409,10 @@ module.exports = WithMatrixClient(React.createClass({
|
||||||
var isSending = (['sending', 'queued', 'encrypting'].indexOf(this.props.eventSendStatus) !== -1);
|
var isSending = (['sending', 'queued', 'encrypting'].indexOf(this.props.eventSendStatus) !== -1);
|
||||||
const isRedacted = (eventType === 'm.room.message') && this.props.isRedacted;
|
const isRedacted = (eventType === 'm.room.message') && this.props.isRedacted;
|
||||||
|
|
||||||
var classes = classNames({
|
const classes = classNames({
|
||||||
mx_EventTile: true,
|
mx_EventTile: true,
|
||||||
mx_EventTile_info: isInfoMessage,
|
mx_EventTile_info: isInfoMessage,
|
||||||
|
mx_EventTile_12hr: this.props.isTwelveHour,
|
||||||
mx_EventTile_encrypting: this.props.eventSendStatus == 'encrypting',
|
mx_EventTile_encrypting: this.props.eventSendStatus == 'encrypting',
|
||||||
mx_EventTile_sending: isSending,
|
mx_EventTile_sending: isSending,
|
||||||
mx_EventTile_notSent: this.props.eventSendStatus == 'not_sent',
|
mx_EventTile_notSent: this.props.eventSendStatus == 'not_sent',
|
||||||
|
@ -430,7 +424,8 @@ module.exports = WithMatrixClient(React.createClass({
|
||||||
menu: this.state.menu,
|
menu: this.state.menu,
|
||||||
mx_EventTile_verified: this.state.verified == true,
|
mx_EventTile_verified: this.state.verified == true,
|
||||||
mx_EventTile_unverified: this.state.verified == false,
|
mx_EventTile_unverified: this.state.verified == false,
|
||||||
mx_EventTile_bad: this.props.mxEvent.getContent().msgtype === 'm.bad.encrypted',
|
mx_EventTile_bad: msgtype === 'm.bad.encrypted',
|
||||||
|
mx_EventTile_emote: msgtype === 'm.emote',
|
||||||
mx_EventTile_redacted: isRedacted,
|
mx_EventTile_redacted: isRedacted,
|
||||||
});
|
});
|
||||||
|
|
||||||
|
@ -475,9 +470,9 @@ module.exports = WithMatrixClient(React.createClass({
|
||||||
if (needsSenderProfile) {
|
if (needsSenderProfile) {
|
||||||
let aux = null;
|
let aux = null;
|
||||||
if (!this.props.tileShape) {
|
if (!this.props.tileShape) {
|
||||||
if (msgtype === 'm.image') aux = "sent an image";
|
if (msgtype === 'm.image') aux = _t('sent an image');
|
||||||
else if (msgtype === 'm.video') aux = "sent a video";
|
else if (msgtype === 'm.video') aux = _t('sent a video');
|
||||||
else if (msgtype === 'm.file') aux = "uploaded a file";
|
else if (msgtype === 'm.file') aux = _t('uploaded a file');
|
||||||
sender = <SenderProfile onClick={ this.onSenderProfileClick } mxEvent={this.props.mxEvent} aux={aux} />;
|
sender = <SenderProfile onClick={ this.onSenderProfileClick } mxEvent={this.props.mxEvent} aux={aux} />;
|
||||||
}
|
}
|
||||||
else {
|
else {
|
||||||
|
@ -485,36 +480,34 @@ module.exports = WithMatrixClient(React.createClass({
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
var editButton = (
|
const editButton = (
|
||||||
<span className="mx_EventTile_editButton" title="Options" onClick={this.onEditClicked} />
|
<span className="mx_EventTile_editButton" title="Options" onClick={this.onEditClicked} />
|
||||||
);
|
);
|
||||||
|
let e2e;
|
||||||
var e2e;
|
|
||||||
// cosmetic padlocks:
|
// cosmetic padlocks:
|
||||||
if ((e2eEnabled && this.props.eventSendStatus) || this.props.mxEvent.getType() === 'm.room.encryption') {
|
if ((e2eEnabled && this.props.eventSendStatus) || this.props.mxEvent.getType() === 'm.room.encryption') {
|
||||||
e2e = <img style={{ cursor: 'initial', marginLeft: '-1px' }} className="mx_EventTile_e2eIcon" src="img/e2e-verified.svg" width="10" height="12" />;
|
e2e = <img style={{ cursor: 'initial', marginLeft: '-1px' }} className="mx_EventTile_e2eIcon" alt="Encrypted by verified device" src="img/e2e-verified.svg" width="10" height="12" />;
|
||||||
}
|
}
|
||||||
// real padlocks
|
// real padlocks
|
||||||
else if (this.props.mxEvent.isEncrypted() || (e2eEnabled && this.props.eventSendStatus)) {
|
else if (this.props.mxEvent.isEncrypted() || (e2eEnabled && this.props.eventSendStatus)) {
|
||||||
if (this.props.mxEvent.getContent().msgtype === 'm.bad.encrypted') {
|
if (this.props.mxEvent.getContent().msgtype === 'm.bad.encrypted') {
|
||||||
e2e = <img onClick={ this.onCryptoClicked } className="mx_EventTile_e2eIcon" src="img/e2e-blocked.svg" width="12" height="12" style={{ marginLeft: "-1px" }} />;
|
e2e = <img onClick={ this.onCryptoClicked } className="mx_EventTile_e2eIcon" alt="Undecryptable" src="img/e2e-blocked.svg" width="12" height="12" style={{ marginLeft: "-1px" }} />;
|
||||||
}
|
}
|
||||||
else if (this.state.verified == true || (e2eEnabled && this.props.eventSendStatus)) {
|
else if (this.state.verified == true || (e2eEnabled && this.props.eventSendStatus)) {
|
||||||
e2e = <img onClick={ this.onCryptoClicked } className="mx_EventTile_e2eIcon" src="img/e2e-verified.svg" width="10" height="12"/>;
|
e2e = <img onClick={ this.onCryptoClicked } className="mx_EventTile_e2eIcon" alt="Encrypted by verified device" src="img/e2e-verified.svg" width="10" height="12"/>;
|
||||||
}
|
}
|
||||||
else {
|
else {
|
||||||
e2e = <img onClick={ this.onCryptoClicked } className="mx_EventTile_e2eIcon" src="img/e2e-warning.svg" width="15" height="12" style={{ marginLeft: "-2px" }}/>;
|
e2e = <img onClick={ this.onCryptoClicked } className="mx_EventTile_e2eIcon" alt="Encrypted by unverified device" src="img/e2e-warning.svg" width="15" height="12" style={{ marginLeft: "-2px" }}/>;
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
else if (e2eEnabled) {
|
else if (e2eEnabled) {
|
||||||
e2e = <img onClick={ this.onCryptoClicked } className="mx_EventTile_e2eIcon" src="img/e2e-unencrypted.svg" width="12" height="12"/>;
|
e2e = <img onClick={ this.onCryptoClicked } className="mx_EventTile_e2eIcon" alt="Unencrypted message" src="img/e2e-unencrypted.svg" width="12" height="12"/>;
|
||||||
}
|
}
|
||||||
const timestamp = this.props.mxEvent.getTs() ?
|
const timestamp = this.props.mxEvent.getTs() ?
|
||||||
<MessageTimestamp ts={this.props.mxEvent.getTs()} /> : null;
|
<MessageTimestamp showTwelveHour={this.props.isTwelveHour} ts={this.props.mxEvent.getTs()} /> : null;
|
||||||
|
|
||||||
if (this.props.tileShape === "notif") {
|
if (this.props.tileShape === "notif") {
|
||||||
var room = this.props.matrixClient.getRoom(this.props.mxEvent.getRoomId());
|
const room = this.props.matrixClient.getRoom(this.props.mxEvent.getRoomId());
|
||||||
|
|
||||||
return (
|
return (
|
||||||
<div className={classes}>
|
<div className={classes}>
|
||||||
<div className="mx_EventTile_roomName">
|
<div className="mx_EventTile_roomName">
|
||||||
|
|
96
src/components/views/rooms/ForwardMessage.js
Normal file
96
src/components/views/rooms/ForwardMessage.js
Normal file
|
@ -0,0 +1,96 @@
|
||||||
|
/*
|
||||||
|
Copyright 2017 Vector Creations Ltd
|
||||||
|
Copyright 2017 Michael Telatynski
|
||||||
|
|
||||||
|
Licensed under the Apache License, Version 2.0 (the "License");
|
||||||
|
you may not use this file except in compliance with the License.
|
||||||
|
You may obtain a copy of the License at
|
||||||
|
|
||||||
|
http://www.apache.org/licenses/LICENSE-2.0
|
||||||
|
|
||||||
|
Unless required by applicable law or agreed to in writing, software
|
||||||
|
distributed under the License is distributed on an "AS IS" BASIS,
|
||||||
|
WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
||||||
|
See the License for the specific language governing permissions and
|
||||||
|
limitations under the License.
|
||||||
|
*/
|
||||||
|
|
||||||
|
import React from 'react';
|
||||||
|
import { _t } from '../../../languageHandler';
|
||||||
|
import MatrixClientPeg from '../../../MatrixClientPeg';
|
||||||
|
import dis from '../../../dispatcher';
|
||||||
|
import KeyCode from '../../../KeyCode';
|
||||||
|
|
||||||
|
|
||||||
|
module.exports = React.createClass({
|
||||||
|
displayName: 'ForwardMessage',
|
||||||
|
|
||||||
|
propTypes: {
|
||||||
|
currentRoomId: React.PropTypes.string.isRequired,
|
||||||
|
|
||||||
|
/* the MatrixEvent to be forwarded */
|
||||||
|
mxEvent: React.PropTypes.object.isRequired,
|
||||||
|
|
||||||
|
onCancelClick: React.PropTypes.func.isRequired,
|
||||||
|
},
|
||||||
|
|
||||||
|
componentWillMount: function() {
|
||||||
|
dis.dispatch({
|
||||||
|
action: 'ui_opacity',
|
||||||
|
leftOpacity: 1.0,
|
||||||
|
rightOpacity: 0.3,
|
||||||
|
middleOpacity: 0.5,
|
||||||
|
});
|
||||||
|
},
|
||||||
|
|
||||||
|
componentDidMount: function() {
|
||||||
|
this.dispatcherRef = dis.register(this.onAction);
|
||||||
|
document.addEventListener('keydown', this._onKeyDown);
|
||||||
|
},
|
||||||
|
|
||||||
|
componentWillUnmount: function() {
|
||||||
|
dis.dispatch({
|
||||||
|
action: 'ui_opacity',
|
||||||
|
sideOpacity: 1.0,
|
||||||
|
middleOpacity: 1.0,
|
||||||
|
});
|
||||||
|
dis.unregister(this.dispatcherRef);
|
||||||
|
document.removeEventListener('keydown', this._onKeyDown);
|
||||||
|
},
|
||||||
|
|
||||||
|
onAction: function(payload) {
|
||||||
|
if (payload.action === 'view_room') {
|
||||||
|
const event = this.props.mxEvent;
|
||||||
|
const Client = MatrixClientPeg.get();
|
||||||
|
Client.sendEvent(payload.room_id, event.getType(), event.getContent()).done(() => {
|
||||||
|
dis.dispatch({action: 'message_sent'});
|
||||||
|
}, (err) => {
|
||||||
|
if (err.name === "UnknownDeviceError") {
|
||||||
|
dis.dispatch({
|
||||||
|
action: 'unknown_device_error',
|
||||||
|
err: err,
|
||||||
|
room: Client.getRoom(payload.room_id),
|
||||||
|
});
|
||||||
|
}
|
||||||
|
dis.dispatch({action: 'message_send_failed'});
|
||||||
|
});
|
||||||
|
if (this.props.currentRoomId === payload.room_id) this.props.onCancelClick();
|
||||||
|
}
|
||||||
|
},
|
||||||
|
|
||||||
|
_onKeyDown: function(ev) {
|
||||||
|
switch (ev.keyCode) {
|
||||||
|
case KeyCode.ESCAPE:
|
||||||
|
this.props.onCancelClick();
|
||||||
|
break;
|
||||||
|
}
|
||||||
|
},
|
||||||
|
|
||||||
|
render: function() {
|
||||||
|
return (
|
||||||
|
<div className="mx_ForwardMessage">
|
||||||
|
<h1>{_t('Please select the destination room for this message')}</h1>
|
||||||
|
</div>
|
||||||
|
);
|
||||||
|
},
|
||||||
|
});
|
|
@ -100,7 +100,9 @@ module.exports = React.createClass({
|
||||||
|
|
||||||
render: function() {
|
render: function() {
|
||||||
var p = this.state.preview;
|
var p = this.state.preview;
|
||||||
if (!p) return <div/>;
|
if (!p || Object.keys(p).length === 0) {
|
||||||
|
return <div/>;
|
||||||
|
}
|
||||||
|
|
||||||
// FIXME: do we want to factor out all image displaying between this and MImageBody - especially for lightboxing?
|
// FIXME: do we want to factor out all image displaying between this and MImageBody - especially for lightboxing?
|
||||||
var image = p["og:image"];
|
var image = p["og:image"];
|
||||||
|
|
|
@ -31,6 +31,7 @@ import classNames from 'classnames';
|
||||||
import dis from '../../../dispatcher';
|
import dis from '../../../dispatcher';
|
||||||
import Modal from '../../../Modal';
|
import Modal from '../../../Modal';
|
||||||
import sdk from '../../../index';
|
import sdk from '../../../index';
|
||||||
|
import { _t } from '../../../languageHandler';
|
||||||
import createRoom from '../../../createRoom';
|
import createRoom from '../../../createRoom';
|
||||||
import DMRoomMap from '../../../utils/DMRoomMap';
|
import DMRoomMap from '../../../utils/DMRoomMap';
|
||||||
import Unread from '../../../Unread';
|
import Unread from '../../../Unread';
|
||||||
|
@ -219,7 +220,7 @@ module.exports = WithMatrixClient(React.createClass({
|
||||||
|
|
||||||
onKick: function() {
|
onKick: function() {
|
||||||
const membership = this.props.member.membership;
|
const membership = this.props.member.membership;
|
||||||
const kickLabel = membership === "invite" ? "Disinvite" : "Kick";
|
const kickLabel = membership === "invite" ? _t("Disinvite") : _t("Kick");
|
||||||
const ConfirmUserActionDialog = sdk.getComponent("dialogs.ConfirmUserActionDialog");
|
const ConfirmUserActionDialog = sdk.getComponent("dialogs.ConfirmUserActionDialog");
|
||||||
Modal.createDialog(ConfirmUserActionDialog, {
|
Modal.createDialog(ConfirmUserActionDialog, {
|
||||||
member: this.props.member,
|
member: this.props.member,
|
||||||
|
@ -241,7 +242,7 @@ module.exports = WithMatrixClient(React.createClass({
|
||||||
const ErrorDialog = sdk.getComponent("dialogs.ErrorDialog");
|
const ErrorDialog = sdk.getComponent("dialogs.ErrorDialog");
|
||||||
console.error("Kick error: " + err);
|
console.error("Kick error: " + err);
|
||||||
Modal.createDialog(ErrorDialog, {
|
Modal.createDialog(ErrorDialog, {
|
||||||
title: "Failed to kick",
|
title: _t("Failed to kick"),
|
||||||
description: ((err && err.message) ? err.message : "Operation failed"),
|
description: ((err && err.message) ? err.message : "Operation failed"),
|
||||||
});
|
});
|
||||||
}
|
}
|
||||||
|
@ -256,7 +257,7 @@ module.exports = WithMatrixClient(React.createClass({
|
||||||
const ConfirmUserActionDialog = sdk.getComponent("dialogs.ConfirmUserActionDialog");
|
const ConfirmUserActionDialog = sdk.getComponent("dialogs.ConfirmUserActionDialog");
|
||||||
Modal.createDialog(ConfirmUserActionDialog, {
|
Modal.createDialog(ConfirmUserActionDialog, {
|
||||||
member: this.props.member,
|
member: this.props.member,
|
||||||
action: this.props.member.membership == 'ban' ? 'Unban' : 'Ban',
|
action: this.props.member.membership == 'ban' ? _t("Unban") : _t("Ban"),
|
||||||
askReason: this.props.member.membership != 'ban',
|
askReason: this.props.member.membership != 'ban',
|
||||||
danger: this.props.member.membership != 'ban',
|
danger: this.props.member.membership != 'ban',
|
||||||
onFinished: (proceed, reason) => {
|
onFinished: (proceed, reason) => {
|
||||||
|
@ -283,8 +284,8 @@ module.exports = WithMatrixClient(React.createClass({
|
||||||
const ErrorDialog = sdk.getComponent("dialogs.ErrorDialog");
|
const ErrorDialog = sdk.getComponent("dialogs.ErrorDialog");
|
||||||
console.error("Ban error: " + err);
|
console.error("Ban error: " + err);
|
||||||
Modal.createDialog(ErrorDialog, {
|
Modal.createDialog(ErrorDialog, {
|
||||||
title: "Error",
|
title: _t("Error"),
|
||||||
description: "Failed to ban user",
|
description: _t("Failed to ban user"),
|
||||||
});
|
});
|
||||||
}
|
}
|
||||||
).finally(()=>{
|
).finally(()=>{
|
||||||
|
@ -333,8 +334,8 @@ module.exports = WithMatrixClient(React.createClass({
|
||||||
}, function(err) {
|
}, function(err) {
|
||||||
console.error("Mute error: " + err);
|
console.error("Mute error: " + err);
|
||||||
Modal.createDialog(ErrorDialog, {
|
Modal.createDialog(ErrorDialog, {
|
||||||
title: "Error",
|
title: _t("Error"),
|
||||||
description: "Failed to mute user",
|
description: _t("Failed to mute user"),
|
||||||
});
|
});
|
||||||
}
|
}
|
||||||
).finally(()=>{
|
).finally(()=>{
|
||||||
|
@ -376,14 +377,14 @@ module.exports = WithMatrixClient(React.createClass({
|
||||||
if (err.errcode == 'M_GUEST_ACCESS_FORBIDDEN') {
|
if (err.errcode == 'M_GUEST_ACCESS_FORBIDDEN') {
|
||||||
var NeedToRegisterDialog = sdk.getComponent("dialogs.NeedToRegisterDialog");
|
var NeedToRegisterDialog = sdk.getComponent("dialogs.NeedToRegisterDialog");
|
||||||
Modal.createDialog(NeedToRegisterDialog, {
|
Modal.createDialog(NeedToRegisterDialog, {
|
||||||
title: "Please Register",
|
title: _t("Please Register"),
|
||||||
description: "This action cannot be performed by a guest user. Please register to be able to do this."
|
description: _t("This action cannot be performed by a guest user. Please register to be able to do this") + ".",
|
||||||
});
|
});
|
||||||
} else {
|
} else {
|
||||||
console.error("Toggle moderator error:" + err);
|
console.error("Toggle moderator error:" + err);
|
||||||
Modal.createDialog(ErrorDialog, {
|
Modal.createDialog(ErrorDialog, {
|
||||||
title: "Error",
|
title: _t("Error"),
|
||||||
description: "Failed to toggle moderator status",
|
description: _t("Failed to toggle moderator status"),
|
||||||
});
|
});
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
@ -403,8 +404,8 @@ module.exports = WithMatrixClient(React.createClass({
|
||||||
const ErrorDialog = sdk.getComponent("dialogs.ErrorDialog");
|
const ErrorDialog = sdk.getComponent("dialogs.ErrorDialog");
|
||||||
console.error("Failed to change power level " + err);
|
console.error("Failed to change power level " + err);
|
||||||
Modal.createDialog(ErrorDialog, {
|
Modal.createDialog(ErrorDialog, {
|
||||||
title: "Error",
|
title: _t("Error"),
|
||||||
description: "Failed to change power level",
|
description: _t("Failed to change power level"),
|
||||||
});
|
});
|
||||||
}
|
}
|
||||||
).finally(()=>{
|
).finally(()=>{
|
||||||
|
@ -432,13 +433,13 @@ module.exports = WithMatrixClient(React.createClass({
|
||||||
if (parseInt(myPower) === parseInt(powerLevel)) {
|
if (parseInt(myPower) === parseInt(powerLevel)) {
|
||||||
var QuestionDialog = sdk.getComponent("dialogs.QuestionDialog");
|
var QuestionDialog = sdk.getComponent("dialogs.QuestionDialog");
|
||||||
Modal.createDialog(QuestionDialog, {
|
Modal.createDialog(QuestionDialog, {
|
||||||
title: "Warning",
|
title: _t("Warning!"),
|
||||||
description:
|
description:
|
||||||
<div>
|
<div>
|
||||||
You will not be able to undo this change as you are promoting the user to have the same power level as yourself.<br/>
|
{ _t("You will not be able to undo this change as you are promoting the user to have the same power level as yourself") }.<br/>
|
||||||
Are you sure?
|
{ _t("Are you sure?") }
|
||||||
</div>,
|
</div>,
|
||||||
button: "Continue",
|
button: _t("Continue"),
|
||||||
onFinished: function(confirmed) {
|
onFinished: function(confirmed) {
|
||||||
if (confirmed) {
|
if (confirmed) {
|
||||||
self._applyPowerChange(roomId, target, powerLevel, powerLevelEvent);
|
self._applyPowerChange(roomId, target, powerLevel, powerLevelEvent);
|
||||||
|
@ -581,9 +582,9 @@ module.exports = WithMatrixClient(React.createClass({
|
||||||
// still loading
|
// still loading
|
||||||
devComponents = <Spinner />;
|
devComponents = <Spinner />;
|
||||||
} else if (devices === null) {
|
} else if (devices === null) {
|
||||||
devComponents = "Unable to load device list";
|
devComponents = _t("Unable to load device list");
|
||||||
} else if (devices.length === 0) {
|
} else if (devices.length === 0) {
|
||||||
devComponents = "No devices with registered encryption keys";
|
devComponents = _t("No devices with registered encryption keys");
|
||||||
} else {
|
} else {
|
||||||
devComponents = [];
|
devComponents = [];
|
||||||
for (var i = 0; i < devices.length; i++) {
|
for (var i = 0; i < devices.length; i++) {
|
||||||
|
@ -595,7 +596,7 @@ module.exports = WithMatrixClient(React.createClass({
|
||||||
|
|
||||||
return (
|
return (
|
||||||
<div>
|
<div>
|
||||||
<h3>Devices</h3>
|
<h3>{ _t("Devices") }</h3>
|
||||||
<div className="mx_MemberInfo_devices">
|
<div className="mx_MemberInfo_devices">
|
||||||
{devComponents}
|
{devComponents}
|
||||||
</div>
|
</div>
|
||||||
|
@ -644,11 +645,11 @@ module.exports = WithMatrixClient(React.createClass({
|
||||||
<div className="mx_RoomTile_avatar">
|
<div className="mx_RoomTile_avatar">
|
||||||
<img src="img/create-big.svg" width="26" height="26" />
|
<img src="img/create-big.svg" width="26" height="26" />
|
||||||
</div>
|
</div>
|
||||||
<div className={labelClasses}><i>Start new chat</i></div>
|
<div className={labelClasses}><i>{ _t("Start a chat") }</i></div>
|
||||||
</AccessibleButton>;
|
</AccessibleButton>;
|
||||||
|
|
||||||
startChat = <div>
|
startChat = <div>
|
||||||
<h3>Direct chats</h3>
|
<h3>{ _t("Direct chats") }</h3>
|
||||||
{tiles}
|
{tiles}
|
||||||
{startNewChat}
|
{startNewChat}
|
||||||
</div>;
|
</div>;
|
||||||
|
@ -661,7 +662,7 @@ module.exports = WithMatrixClient(React.createClass({
|
||||||
|
|
||||||
if (this.state.can.kick) {
|
if (this.state.can.kick) {
|
||||||
const membership = this.props.member.membership;
|
const membership = this.props.member.membership;
|
||||||
const kickLabel = membership === "invite" ? "Disinvite" : "Kick";
|
const kickLabel = membership === "invite" ? _t("Disinvite") : _t("Kick");
|
||||||
kickButton = (
|
kickButton = (
|
||||||
<AccessibleButton className="mx_MemberInfo_field"
|
<AccessibleButton className="mx_MemberInfo_field"
|
||||||
onClick={this.onKick}>
|
onClick={this.onKick}>
|
||||||
|
@ -670,9 +671,9 @@ module.exports = WithMatrixClient(React.createClass({
|
||||||
);
|
);
|
||||||
}
|
}
|
||||||
if (this.state.can.ban) {
|
if (this.state.can.ban) {
|
||||||
let label = 'Ban';
|
let label = _t("Ban");
|
||||||
if (this.props.member.membership == 'ban') {
|
if (this.props.member.membership == 'ban') {
|
||||||
label = 'Unban';
|
label = _t("Unban");
|
||||||
}
|
}
|
||||||
banButton = (
|
banButton = (
|
||||||
<AccessibleButton className="mx_MemberInfo_field"
|
<AccessibleButton className="mx_MemberInfo_field"
|
||||||
|
@ -682,7 +683,7 @@ module.exports = WithMatrixClient(React.createClass({
|
||||||
);
|
);
|
||||||
}
|
}
|
||||||
if (this.state.can.mute) {
|
if (this.state.can.mute) {
|
||||||
const muteLabel = this.state.muted ? "Unmute" : "Mute";
|
const muteLabel = this.state.muted ? _t("Unmute") : _t("Mute");
|
||||||
muteButton = (
|
muteButton = (
|
||||||
<AccessibleButton className="mx_MemberInfo_field"
|
<AccessibleButton className="mx_MemberInfo_field"
|
||||||
onClick={this.onMuteToggle}>
|
onClick={this.onMuteToggle}>
|
||||||
|
@ -691,7 +692,7 @@ module.exports = WithMatrixClient(React.createClass({
|
||||||
);
|
);
|
||||||
}
|
}
|
||||||
if (this.state.can.toggleMod) {
|
if (this.state.can.toggleMod) {
|
||||||
var giveOpLabel = this.state.isTargetMod ? "Revoke Moderator" : "Make Moderator";
|
var giveOpLabel = this.state.isTargetMod ? _t("Revoke Moderator") : _t("Make Moderator");
|
||||||
giveModButton = <AccessibleButton className="mx_MemberInfo_field" onClick={this.onModToggle}>
|
giveModButton = <AccessibleButton className="mx_MemberInfo_field" onClick={this.onModToggle}>
|
||||||
{giveOpLabel}
|
{giveOpLabel}
|
||||||
</AccessibleButton>;
|
</AccessibleButton>;
|
||||||
|
@ -717,8 +718,16 @@ module.exports = WithMatrixClient(React.createClass({
|
||||||
|
|
||||||
const memberName = this.props.member.name;
|
const memberName = this.props.member.name;
|
||||||
|
|
||||||
|
if (this.props.member.user) {
|
||||||
|
var presenceState = this.props.member.user.presence;
|
||||||
|
var presenceLastActiveAgo = this.props.member.user.lastActiveAgo;
|
||||||
|
var presenceLastTs = this.props.member.user.lastPresenceTs;
|
||||||
|
var presenceCurrentlyActive = this.props.member.user.currentlyActive;
|
||||||
|
}
|
||||||
|
|
||||||
var MemberAvatar = sdk.getComponent('avatars.MemberAvatar');
|
var MemberAvatar = sdk.getComponent('avatars.MemberAvatar');
|
||||||
var PowerSelector = sdk.getComponent('elements.PowerSelector');
|
var PowerSelector = sdk.getComponent('elements.PowerSelector');
|
||||||
|
var PresenceLabel = sdk.getComponent('rooms.PresenceLabel');
|
||||||
const EmojiText = sdk.getComponent('elements.EmojiText');
|
const EmojiText = sdk.getComponent('elements.EmojiText');
|
||||||
return (
|
return (
|
||||||
<div className="mx_MemberInfo">
|
<div className="mx_MemberInfo">
|
||||||
|
@ -734,7 +743,12 @@ module.exports = WithMatrixClient(React.createClass({
|
||||||
{ this.props.member.userId }
|
{ this.props.member.userId }
|
||||||
</div>
|
</div>
|
||||||
<div className="mx_MemberInfo_profileField">
|
<div className="mx_MemberInfo_profileField">
|
||||||
Level: <b><PowerSelector controlled={true} value={ parseInt(this.props.member.powerLevel) } disabled={ !this.state.can.modifyLevel } onChange={ this.onPowerChange }/></b>
|
{ _t("Level") }: <b><PowerSelector controlled={true} value={ parseInt(this.props.member.powerLevel) } disabled={ !this.state.can.modifyLevel } onChange={ this.onPowerChange }/></b>
|
||||||
|
</div>
|
||||||
|
<div className="mx_MemberInfo_profileField">
|
||||||
|
<PresenceLabel activeAgo={ presenceLastActiveAgo }
|
||||||
|
currentlyActive={ presenceCurrentlyActive }
|
||||||
|
presenceState={ presenceState } />
|
||||||
</div>
|
</div>
|
||||||
</div>
|
</div>
|
||||||
|
|
||||||
|
|
|
@ -14,6 +14,7 @@ See the License for the specific language governing permissions and
|
||||||
limitations under the License.
|
limitations under the License.
|
||||||
*/
|
*/
|
||||||
var React = require('react');
|
var React = require('react');
|
||||||
|
import { _t } from '../../../languageHandler';
|
||||||
var classNames = require('classnames');
|
var classNames = require('classnames');
|
||||||
var Matrix = require("matrix-js-sdk");
|
var Matrix = require("matrix-js-sdk");
|
||||||
var q = require('q');
|
var q = require('q');
|
||||||
|
@ -207,7 +208,9 @@ module.exports = React.createClass({
|
||||||
// For now we'll pretend this is any entity. It should probably be a separate tile.
|
// For now we'll pretend this is any entity. It should probably be a separate tile.
|
||||||
var EntityTile = sdk.getComponent("rooms.EntityTile");
|
var EntityTile = sdk.getComponent("rooms.EntityTile");
|
||||||
var BaseAvatar = sdk.getComponent("avatars.BaseAvatar");
|
var BaseAvatar = sdk.getComponent("avatars.BaseAvatar");
|
||||||
var text = "and " + overflowCount + " other" + (overflowCount > 1 ? "s" : "") + "...";
|
var text = (overflowCount > 1)
|
||||||
|
? _t("and %(overflowCount)s others...", { overflowCount: overflowCount })
|
||||||
|
: _t("and one other...");
|
||||||
return (
|
return (
|
||||||
<EntityTile className="mx_EntityTile_ellipsis" avatarJsx={
|
<EntityTile className="mx_EntityTile_ellipsis" avatarJsx={
|
||||||
<BaseAvatar url="img/ellipsis.svg" name="..." width={36} height={36} />
|
<BaseAvatar url="img/ellipsis.svg" name="..." width={36} height={36} />
|
||||||
|
@ -363,8 +366,8 @@ module.exports = React.createClass({
|
||||||
var inputBox = (
|
var inputBox = (
|
||||||
<form autoComplete="off">
|
<form autoComplete="off">
|
||||||
<input className="mx_MemberList_query" id="mx_MemberList_query" type="text"
|
<input className="mx_MemberList_query" id="mx_MemberList_query" type="text"
|
||||||
onChange={this.onSearchQueryChanged} value={this.state.searchQuery}
|
onChange={this.onSearchQueryChanged} value={this.state.searchQuery}
|
||||||
placeholder="Filter room members" />
|
placeholder={ _t('Filter room members') } />
|
||||||
</form>
|
</form>
|
||||||
);
|
);
|
||||||
|
|
||||||
|
|
|
@ -14,7 +14,7 @@ See the License for the specific language governing permissions and
|
||||||
limitations under the License.
|
limitations under the License.
|
||||||
*/
|
*/
|
||||||
var React = require('react');
|
var React = require('react');
|
||||||
|
import { _t } from '../../../languageHandler';
|
||||||
var CallHandler = require('../../../CallHandler');
|
var CallHandler = require('../../../CallHandler');
|
||||||
var MatrixClientPeg = require('../../../MatrixClientPeg');
|
var MatrixClientPeg = require('../../../MatrixClientPeg');
|
||||||
var Modal = require('../../../Modal');
|
var Modal = require('../../../Modal');
|
||||||
|
@ -33,6 +33,7 @@ export default class MessageComposer extends React.Component {
|
||||||
this.onHangupClick = this.onHangupClick.bind(this);
|
this.onHangupClick = this.onHangupClick.bind(this);
|
||||||
this.onUploadClick = this.onUploadClick.bind(this);
|
this.onUploadClick = this.onUploadClick.bind(this);
|
||||||
this.onUploadFileSelected = this.onUploadFileSelected.bind(this);
|
this.onUploadFileSelected = this.onUploadFileSelected.bind(this);
|
||||||
|
this.uploadFiles = this.uploadFiles.bind(this);
|
||||||
this.onVoiceCallClick = this.onVoiceCallClick.bind(this);
|
this.onVoiceCallClick = this.onVoiceCallClick.bind(this);
|
||||||
this.onInputContentChanged = this.onInputContentChanged.bind(this);
|
this.onInputContentChanged = this.onInputContentChanged.bind(this);
|
||||||
this.onUpArrow = this.onUpArrow.bind(this);
|
this.onUpArrow = this.onUpArrow.bind(this);
|
||||||
|
@ -43,6 +44,7 @@ export default class MessageComposer extends React.Component {
|
||||||
this.onToggleMarkdownClicked = this.onToggleMarkdownClicked.bind(this);
|
this.onToggleMarkdownClicked = this.onToggleMarkdownClicked.bind(this);
|
||||||
this.onInputStateChanged = this.onInputStateChanged.bind(this);
|
this.onInputStateChanged = this.onInputStateChanged.bind(this);
|
||||||
this.onEvent = this.onEvent.bind(this);
|
this.onEvent = this.onEvent.bind(this);
|
||||||
|
this.onPageUnload = this.onPageUnload.bind(this);
|
||||||
|
|
||||||
this.state = {
|
this.state = {
|
||||||
autocompleteQuery: '',
|
autocompleteQuery: '',
|
||||||
|
@ -50,7 +52,7 @@ export default class MessageComposer extends React.Component {
|
||||||
inputState: {
|
inputState: {
|
||||||
style: [],
|
style: [],
|
||||||
blockType: null,
|
blockType: null,
|
||||||
isRichtextEnabled: UserSettingsStore.getSyncedSetting('MessageComposerInput.isRichTextEnabled', true),
|
isRichtextEnabled: UserSettingsStore.getSyncedSetting('MessageComposerInput.isRichTextEnabled', false),
|
||||||
wordCount: 0,
|
wordCount: 0,
|
||||||
},
|
},
|
||||||
showFormatting: UserSettingsStore.getSyncedSetting('MessageComposer.showFormatting', false),
|
showFormatting: UserSettingsStore.getSyncedSetting('MessageComposer.showFormatting', false),
|
||||||
|
@ -64,12 +66,21 @@ export default class MessageComposer extends React.Component {
|
||||||
// marked as encrypted.
|
// marked as encrypted.
|
||||||
// XXX: fragile as all hell - fixme somehow, perhaps with a dedicated Room.encryption event or something.
|
// XXX: fragile as all hell - fixme somehow, perhaps with a dedicated Room.encryption event or something.
|
||||||
MatrixClientPeg.get().on("event", this.onEvent);
|
MatrixClientPeg.get().on("event", this.onEvent);
|
||||||
|
|
||||||
|
window.addEventListener('beforeunload', this.onPageUnload);
|
||||||
}
|
}
|
||||||
|
|
||||||
componentWillUnmount() {
|
componentWillUnmount() {
|
||||||
if (MatrixClientPeg.get()) {
|
if (MatrixClientPeg.get()) {
|
||||||
MatrixClientPeg.get().removeListener("event", this.onEvent);
|
MatrixClientPeg.get().removeListener("event", this.onEvent);
|
||||||
}
|
}
|
||||||
|
window.removeEventListener('beforeunload', this.onPageUnload);
|
||||||
|
}
|
||||||
|
|
||||||
|
onPageUnload(event) {
|
||||||
|
if (this.messageComposerInput) {
|
||||||
|
this.messageComposerInput.sentHistory.saveLastTextEntry();
|
||||||
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
onEvent(event) {
|
onEvent(event) {
|
||||||
|
@ -82,8 +93,8 @@ export default class MessageComposer extends React.Component {
|
||||||
if (MatrixClientPeg.get().isGuest()) {
|
if (MatrixClientPeg.get().isGuest()) {
|
||||||
let NeedToRegisterDialog = sdk.getComponent("dialogs.NeedToRegisterDialog");
|
let NeedToRegisterDialog = sdk.getComponent("dialogs.NeedToRegisterDialog");
|
||||||
Modal.createDialog(NeedToRegisterDialog, {
|
Modal.createDialog(NeedToRegisterDialog, {
|
||||||
title: "Please Register",
|
title: _t('Please Register'),
|
||||||
description: "Guest users can't upload files. Please register to upload.",
|
description: _t('Guest users can\'t upload files. Please register to upload') + '.',
|
||||||
});
|
});
|
||||||
return;
|
return;
|
||||||
}
|
}
|
||||||
|
@ -91,10 +102,11 @@ export default class MessageComposer extends React.Component {
|
||||||
this.refs.uploadInput.click();
|
this.refs.uploadInput.click();
|
||||||
}
|
}
|
||||||
|
|
||||||
onUploadFileSelected(files, isPasted) {
|
onUploadFileSelected(files) {
|
||||||
if (!isPasted)
|
this.uploadFiles(files.target.files);
|
||||||
files = files.target.files;
|
}
|
||||||
|
|
||||||
|
uploadFiles(files) {
|
||||||
let QuestionDialog = sdk.getComponent("dialogs.QuestionDialog");
|
let QuestionDialog = sdk.getComponent("dialogs.QuestionDialog");
|
||||||
let TintableSvg = sdk.getComponent("elements.TintableSvg");
|
let TintableSvg = sdk.getComponent("elements.TintableSvg");
|
||||||
|
|
||||||
|
@ -106,10 +118,10 @@ export default class MessageComposer extends React.Component {
|
||||||
}
|
}
|
||||||
|
|
||||||
Modal.createDialog(QuestionDialog, {
|
Modal.createDialog(QuestionDialog, {
|
||||||
title: "Upload Files",
|
title: _t('Upload Files'),
|
||||||
description: (
|
description: (
|
||||||
<div>
|
<div>
|
||||||
<p>Are you sure you want upload the following files?</p>
|
<p>{ _t('Are you sure you want upload the following files?') }</p>
|
||||||
<ul style={{listStyle: 'none', textAlign: 'left'}}>
|
<ul style={{listStyle: 'none', textAlign: 'left'}}>
|
||||||
{fileList}
|
{fileList}
|
||||||
</ul>
|
</ul>
|
||||||
|
@ -228,11 +240,11 @@ export default class MessageComposer extends React.Component {
|
||||||
if (roomIsEncrypted) {
|
if (roomIsEncrypted) {
|
||||||
// FIXME: show a /!\ if there are untrusted devices in the room...
|
// FIXME: show a /!\ if there are untrusted devices in the room...
|
||||||
e2eImg = 'img/e2e-verified.svg';
|
e2eImg = 'img/e2e-verified.svg';
|
||||||
e2eTitle = 'Encrypted room';
|
e2eTitle = _t('Encrypted room');
|
||||||
e2eClass = 'mx_MessageComposer_e2eIcon';
|
e2eClass = 'mx_MessageComposer_e2eIcon';
|
||||||
} else {
|
} else {
|
||||||
e2eImg = 'img/e2e-unencrypted.svg';
|
e2eImg = 'img/e2e-unencrypted.svg';
|
||||||
e2eTitle = 'Unencrypted room';
|
e2eTitle = _t('Unencrypted room');
|
||||||
e2eClass = 'mx_MessageComposer_e2eIcon mx_filterFlipColor';
|
e2eClass = 'mx_MessageComposer_e2eIcon mx_filterFlipColor';
|
||||||
}
|
}
|
||||||
|
|
||||||
|
@ -245,16 +257,16 @@ export default class MessageComposer extends React.Component {
|
||||||
if (this.props.callState && this.props.callState !== 'ended') {
|
if (this.props.callState && this.props.callState !== 'ended') {
|
||||||
hangupButton =
|
hangupButton =
|
||||||
<div key="controls_hangup" className="mx_MessageComposer_hangup" onClick={this.onHangupClick}>
|
<div key="controls_hangup" className="mx_MessageComposer_hangup" onClick={this.onHangupClick}>
|
||||||
<img src="img/hangup.svg" alt="Hangup" title="Hangup" width="25" height="26"/>
|
<img src="img/hangup.svg" alt={ _t('Hangup') } title={ _t('Hangup') } width="25" height="26"/>
|
||||||
</div>;
|
</div>;
|
||||||
}
|
}
|
||||||
else {
|
else {
|
||||||
callButton =
|
callButton =
|
||||||
<div key="controls_call" className="mx_MessageComposer_voicecall" onClick={this.onVoiceCallClick} title="Voice call">
|
<div key="controls_call" className="mx_MessageComposer_voicecall" onClick={this.onVoiceCallClick} title={ _t('Voice call') }>
|
||||||
<TintableSvg src="img/icon-call.svg" width="35" height="35"/>
|
<TintableSvg src="img/icon-call.svg" width="35" height="35"/>
|
||||||
</div>;
|
</div>;
|
||||||
videoCallButton =
|
videoCallButton =
|
||||||
<div key="controls_videocall" className="mx_MessageComposer_videocall" onClick={this.onCallClick} title="Video call">
|
<div key="controls_videocall" className="mx_MessageComposer_videocall" onClick={this.onCallClick} title={ _t('Video call') }>
|
||||||
<TintableSvg src="img/icons-video.svg" width="35" height="35"/>
|
<TintableSvg src="img/icons-video.svg" width="35" height="35"/>
|
||||||
</div>;
|
</div>;
|
||||||
}
|
}
|
||||||
|
@ -268,7 +280,7 @@ export default class MessageComposer extends React.Component {
|
||||||
// complex because of conference calls.
|
// complex because of conference calls.
|
||||||
var uploadButton = (
|
var uploadButton = (
|
||||||
<div key="controls_upload" className="mx_MessageComposer_upload"
|
<div key="controls_upload" className="mx_MessageComposer_upload"
|
||||||
onClick={this.onUploadClick} title="Upload file">
|
onClick={this.onUploadClick} title={ _t('Upload file') }>
|
||||||
<TintableSvg src="img/icons-upload.svg" width="35" height="35"/>
|
<TintableSvg src="img/icons-upload.svg" width="35" height="35"/>
|
||||||
<input ref="uploadInput" type="file"
|
<input ref="uploadInput" type="file"
|
||||||
style={uploadInputStyle}
|
style={uploadInputStyle}
|
||||||
|
@ -288,7 +300,7 @@ export default class MessageComposer extends React.Component {
|
||||||
);
|
);
|
||||||
|
|
||||||
const placeholderText = roomIsEncrypted ?
|
const placeholderText = roomIsEncrypted ?
|
||||||
"Send an encrypted message…" : "Send a message (unencrypted)…";
|
_t('Send an encrypted message') + '…' : _t('Send a message (unencrypted)') + '…';
|
||||||
|
|
||||||
controls.push(
|
controls.push(
|
||||||
<MessageComposerInput
|
<MessageComposerInput
|
||||||
|
@ -300,7 +312,7 @@ export default class MessageComposer extends React.Component {
|
||||||
tryComplete={this._tryComplete}
|
tryComplete={this._tryComplete}
|
||||||
onUpArrow={this.onUpArrow}
|
onUpArrow={this.onUpArrow}
|
||||||
onDownArrow={this.onDownArrow}
|
onDownArrow={this.onDownArrow}
|
||||||
onUploadFileSelected={this.onUploadFileSelected}
|
onFilesPasted={this.uploadFiles}
|
||||||
tabComplete={this.props.tabComplete} // used for old messagecomposerinput/tabcomplete
|
tabComplete={this.props.tabComplete} // used for old messagecomposerinput/tabcomplete
|
||||||
onContentChanged={this.onInputContentChanged}
|
onContentChanged={this.onInputContentChanged}
|
||||||
onInputStateChanged={this.onInputStateChanged} />,
|
onInputStateChanged={this.onInputStateChanged} />,
|
||||||
|
@ -313,7 +325,7 @@ export default class MessageComposer extends React.Component {
|
||||||
} else {
|
} else {
|
||||||
controls.push(
|
controls.push(
|
||||||
<div key="controls_error" className="mx_MessageComposer_noperm_error">
|
<div key="controls_error" className="mx_MessageComposer_noperm_error">
|
||||||
You do not have permission to post to this room
|
{ _t('You do not have permission to post to this room') }
|
||||||
</div>
|
</div>
|
||||||
);
|
);
|
||||||
}
|
}
|
||||||
|
@ -342,7 +354,7 @@ export default class MessageComposer extends React.Component {
|
||||||
mx_filterFlipColor: true,
|
mx_filterFlipColor: true,
|
||||||
});
|
});
|
||||||
return <img className={className}
|
return <img className={className}
|
||||||
title={name}
|
title={ _t(name) }
|
||||||
onMouseDown={disabled ? null : onFormatButtonClicked}
|
onMouseDown={disabled ? null : onFormatButtonClicked}
|
||||||
key={name}
|
key={name}
|
||||||
src={`img/button-text-${name}${suffix}.svg`}
|
src={`img/button-text-${name}${suffix}.svg`}
|
||||||
|
@ -362,11 +374,11 @@ export default class MessageComposer extends React.Component {
|
||||||
<div className="mx_MessageComposer_formatbar" style={this.state.showFormatting ? {} : {display: 'none'}}>
|
<div className="mx_MessageComposer_formatbar" style={this.state.showFormatting ? {} : {display: 'none'}}>
|
||||||
{formatButtons}
|
{formatButtons}
|
||||||
<div style={{flex: 1}}></div>
|
<div style={{flex: 1}}></div>
|
||||||
<img title={`Turn Markdown ${this.state.inputState.isRichtextEnabled ? 'on' : 'off'}`}
|
<img title={ this.state.inputState.isRichtextEnabled ? _t("Turn Markdown on") : _t("Turn Markdown off") }
|
||||||
onMouseDown={this.onToggleMarkdownClicked}
|
onMouseDown={this.onToggleMarkdownClicked}
|
||||||
className="mx_MessageComposer_formatbar_markdown mx_filterFlipColor"
|
className="mx_MessageComposer_formatbar_markdown mx_filterFlipColor"
|
||||||
src={`img/button-md-${!this.state.inputState.isRichtextEnabled}.png`} />
|
src={`img/button-md-${!this.state.inputState.isRichtextEnabled}.png`} />
|
||||||
<img title="Hide Text Formatting Toolbar"
|
<img title={ _t("Hide Text Formatting Toolbar") }
|
||||||
onClick={this.onToggleFormattingClicked}
|
onClick={this.onToggleFormattingClicked}
|
||||||
className="mx_MessageComposer_formatbar_cancel mx_filterFlipColor"
|
className="mx_MessageComposer_formatbar_cancel mx_filterFlipColor"
|
||||||
src="img/icon-text-cancel.svg" />
|
src="img/icon-text-cancel.svg" />
|
||||||
|
|
|
@ -30,6 +30,7 @@ import type {MatrixClient} from 'matrix-js-sdk/lib/matrix';
|
||||||
import SlashCommands from '../../../SlashCommands';
|
import SlashCommands from '../../../SlashCommands';
|
||||||
import Modal from '../../../Modal';
|
import Modal from '../../../Modal';
|
||||||
import sdk from '../../../index';
|
import sdk from '../../../index';
|
||||||
|
import { _t } from '../../../languageHandler';
|
||||||
|
|
||||||
import dis from '../../../dispatcher';
|
import dis from '../../../dispatcher';
|
||||||
import KeyCode from '../../../KeyCode';
|
import KeyCode from '../../../KeyCode';
|
||||||
|
@ -84,7 +85,6 @@ export default class MessageComposerInput extends React.Component {
|
||||||
this.onAction = this.onAction.bind(this);
|
this.onAction = this.onAction.bind(this);
|
||||||
this.handleReturn = this.handleReturn.bind(this);
|
this.handleReturn = this.handleReturn.bind(this);
|
||||||
this.handleKeyCommand = this.handleKeyCommand.bind(this);
|
this.handleKeyCommand = this.handleKeyCommand.bind(this);
|
||||||
this.handlePastedFiles = this.handlePastedFiles.bind(this);
|
|
||||||
this.onEditorContentChanged = this.onEditorContentChanged.bind(this);
|
this.onEditorContentChanged = this.onEditorContentChanged.bind(this);
|
||||||
this.setEditorState = this.setEditorState.bind(this);
|
this.setEditorState = this.setEditorState.bind(this);
|
||||||
this.onUpArrow = this.onUpArrow.bind(this);
|
this.onUpArrow = this.onUpArrow.bind(this);
|
||||||
|
@ -94,7 +94,7 @@ export default class MessageComposerInput extends React.Component {
|
||||||
this.setDisplayedCompletion = this.setDisplayedCompletion.bind(this);
|
this.setDisplayedCompletion = this.setDisplayedCompletion.bind(this);
|
||||||
this.onMarkdownToggleClicked = this.onMarkdownToggleClicked.bind(this);
|
this.onMarkdownToggleClicked = this.onMarkdownToggleClicked.bind(this);
|
||||||
|
|
||||||
const isRichtextEnabled = UserSettingsStore.getSyncedSetting('MessageComposerInput.isRichTextEnabled', true);
|
const isRichtextEnabled = UserSettingsStore.getSyncedSetting('MessageComposerInput.isRichTextEnabled', false);
|
||||||
|
|
||||||
this.state = {
|
this.state = {
|
||||||
// whether we're in rich text or markdown mode
|
// whether we're in rich text or markdown mode
|
||||||
|
@ -477,10 +477,6 @@ export default class MessageComposerInput extends React.Component {
|
||||||
return false;
|
return false;
|
||||||
}
|
}
|
||||||
|
|
||||||
handlePastedFiles(files) {
|
|
||||||
this.props.onUploadFileSelected(files, true);
|
|
||||||
}
|
|
||||||
|
|
||||||
handleReturn(ev) {
|
handleReturn(ev) {
|
||||||
if (ev.shiftKey) {
|
if (ev.shiftKey) {
|
||||||
this.onEditorContentChanged(RichUtils.insertSoftNewline(this.state.editorState));
|
this.onEditorContentChanged(RichUtils.insertSoftNewline(this.state.editorState));
|
||||||
|
@ -509,8 +505,8 @@ export default class MessageComposerInput extends React.Component {
|
||||||
console.error("Command failure: %s", err);
|
console.error("Command failure: %s", err);
|
||||||
var ErrorDialog = sdk.getComponent("dialogs.ErrorDialog");
|
var ErrorDialog = sdk.getComponent("dialogs.ErrorDialog");
|
||||||
Modal.createDialog(ErrorDialog, {
|
Modal.createDialog(ErrorDialog, {
|
||||||
title: "Server error",
|
title: _t("Server error"),
|
||||||
description: ((err && err.message) ? err.message : "Server unavailable, overloaded, or something else went wrong."),
|
description: ((err && err.message) ? err.message : _t("Server unavailable, overloaded, or something else went wrong") + "."),
|
||||||
});
|
});
|
||||||
});
|
});
|
||||||
}
|
}
|
||||||
|
@ -518,8 +514,8 @@ export default class MessageComposerInput extends React.Component {
|
||||||
console.error(cmd.error);
|
console.error(cmd.error);
|
||||||
var ErrorDialog = sdk.getComponent("dialogs.ErrorDialog");
|
var ErrorDialog = sdk.getComponent("dialogs.ErrorDialog");
|
||||||
Modal.createDialog(ErrorDialog, {
|
Modal.createDialog(ErrorDialog, {
|
||||||
title: "Command error",
|
title: _t("Command error"),
|
||||||
description: cmd.error
|
description: cmd.error,
|
||||||
});
|
});
|
||||||
}
|
}
|
||||||
return true;
|
return true;
|
||||||
|
@ -542,9 +538,9 @@ export default class MessageComposerInput extends React.Component {
|
||||||
let sendTextFn = this.client.sendTextMessage;
|
let sendTextFn = this.client.sendTextMessage;
|
||||||
|
|
||||||
if (contentText.startsWith('/me')) {
|
if (contentText.startsWith('/me')) {
|
||||||
contentText = contentText.replace('/me ', '');
|
contentText = contentText.substring(4);
|
||||||
// bit of a hack, but the alternative would be quite complicated
|
// bit of a hack, but the alternative would be quite complicated
|
||||||
if (contentHTML) contentHTML = contentHTML.replace('/me ', '');
|
if (contentHTML) contentHTML = contentHTML.replace(/\/me ?/, '');
|
||||||
sendHtmlFn = this.client.sendHtmlEmote;
|
sendHtmlFn = this.client.sendHtmlEmote;
|
||||||
sendTextFn = this.client.sendEmoteMessage;
|
sendTextFn = this.client.sendEmoteMessage;
|
||||||
}
|
}
|
||||||
|
@ -724,7 +720,7 @@ export default class MessageComposerInput extends React.Component {
|
||||||
<div className={className}>
|
<div className={className}>
|
||||||
<img className="mx_MessageComposer_input_markdownIndicator mx_filterFlipColor"
|
<img className="mx_MessageComposer_input_markdownIndicator mx_filterFlipColor"
|
||||||
onMouseDown={this.onMarkdownToggleClicked}
|
onMouseDown={this.onMarkdownToggleClicked}
|
||||||
title={`Markdown is ${this.state.isRichtextEnabled ? 'disabled' : 'enabled'}`}
|
title={ this.state.isRichtextEnabled ? _t("Markdown is disabled") : _t("Markdown is enabled")}
|
||||||
src={`img/button-md-${!this.state.isRichtextEnabled}.png`} />
|
src={`img/button-md-${!this.state.isRichtextEnabled}.png`} />
|
||||||
<Editor ref="editor"
|
<Editor ref="editor"
|
||||||
placeholder={this.props.placeholder}
|
placeholder={this.props.placeholder}
|
||||||
|
@ -734,7 +730,7 @@ export default class MessageComposerInput extends React.Component {
|
||||||
keyBindingFn={MessageComposerInput.getKeyBinding}
|
keyBindingFn={MessageComposerInput.getKeyBinding}
|
||||||
handleKeyCommand={this.handleKeyCommand}
|
handleKeyCommand={this.handleKeyCommand}
|
||||||
handleReturn={this.handleReturn}
|
handleReturn={this.handleReturn}
|
||||||
handlePastedFiles={this.handlePastedFiles}
|
handlePastedFiles={this.props.onFilesPasted}
|
||||||
stripPastedStyles={!this.state.isRichtextEnabled}
|
stripPastedStyles={!this.state.isRichtextEnabled}
|
||||||
onTab={this.onTab}
|
onTab={this.onTab}
|
||||||
onUpArrow={this.onUpArrow}
|
onUpArrow={this.onUpArrow}
|
||||||
|
@ -764,7 +760,7 @@ MessageComposerInput.propTypes = {
|
||||||
|
|
||||||
onDownArrow: React.PropTypes.func,
|
onDownArrow: React.PropTypes.func,
|
||||||
|
|
||||||
onUploadFileSelected: React.PropTypes.func,
|
onFilesPasted: React.PropTypes.func,
|
||||||
|
|
||||||
// attempts to confirm currently selected completion, returns whether actually confirmed
|
// attempts to confirm currently selected completion, returns whether actually confirmed
|
||||||
tryComplete: React.PropTypes.func,
|
tryComplete: React.PropTypes.func,
|
||||||
|
|
|
@ -20,6 +20,7 @@ var SlashCommands = require("../../../SlashCommands");
|
||||||
var Modal = require("../../../Modal");
|
var Modal = require("../../../Modal");
|
||||||
var MemberEntry = require("../../../TabCompleteEntries").MemberEntry;
|
var MemberEntry = require("../../../TabCompleteEntries").MemberEntry;
|
||||||
var sdk = require('../../../index');
|
var sdk = require('../../../index');
|
||||||
|
import { _t } from '../../../languageHandler';
|
||||||
import UserSettingsStore from "../../../UserSettingsStore";
|
import UserSettingsStore from "../../../UserSettingsStore";
|
||||||
|
|
||||||
var dis = require("../../../dispatcher");
|
var dis = require("../../../dispatcher");
|
||||||
|
@ -69,6 +70,9 @@ export default React.createClass({
|
||||||
|
|
||||||
// The text to use a placeholder in the input box
|
// The text to use a placeholder in the input box
|
||||||
placeholder: React.PropTypes.string.isRequired,
|
placeholder: React.PropTypes.string.isRequired,
|
||||||
|
|
||||||
|
// callback to handle files pasted into the composer
|
||||||
|
onFilesPasted: React.PropTypes.func,
|
||||||
},
|
},
|
||||||
|
|
||||||
componentWillMount: function() {
|
componentWillMount: function() {
|
||||||
|
@ -291,8 +295,8 @@ export default React.createClass({
|
||||||
else {
|
else {
|
||||||
var ErrorDialog = sdk.getComponent("dialogs.ErrorDialog");
|
var ErrorDialog = sdk.getComponent("dialogs.ErrorDialog");
|
||||||
Modal.createDialog(ErrorDialog, {
|
Modal.createDialog(ErrorDialog, {
|
||||||
title: "Unknown command",
|
title: _t("Unknown command"),
|
||||||
description: "Usage: /markdown on|off"
|
description: _t("Usage") + ": /markdown on|off",
|
||||||
});
|
});
|
||||||
}
|
}
|
||||||
return;
|
return;
|
||||||
|
@ -311,8 +315,8 @@ export default React.createClass({
|
||||||
console.error("Command failure: %s", err);
|
console.error("Command failure: %s", err);
|
||||||
var ErrorDialog = sdk.getComponent("dialogs.ErrorDialog");
|
var ErrorDialog = sdk.getComponent("dialogs.ErrorDialog");
|
||||||
Modal.createDialog(ErrorDialog, {
|
Modal.createDialog(ErrorDialog, {
|
||||||
title: "Server error",
|
title: _t("Server error"),
|
||||||
description: ((err && err.message) ? err.message : "Server unavailable, overloaded, or something else went wrong."),
|
description: ((err && err.message) ? err.message : _t("Server unavailable, overloaded, or something else went wrong") + "."),
|
||||||
});
|
});
|
||||||
});
|
});
|
||||||
}
|
}
|
||||||
|
@ -320,8 +324,8 @@ export default React.createClass({
|
||||||
console.error(cmd.error);
|
console.error(cmd.error);
|
||||||
var ErrorDialog = sdk.getComponent("dialogs.ErrorDialog");
|
var ErrorDialog = sdk.getComponent("dialogs.ErrorDialog");
|
||||||
Modal.createDialog(ErrorDialog, {
|
Modal.createDialog(ErrorDialog, {
|
||||||
title: "Command error",
|
title: _t("Command error"),
|
||||||
description: cmd.error
|
description: cmd.error,
|
||||||
});
|
});
|
||||||
}
|
}
|
||||||
return;
|
return;
|
||||||
|
@ -439,10 +443,27 @@ export default React.createClass({
|
||||||
this.refs.textarea.focus();
|
this.refs.textarea.focus();
|
||||||
},
|
},
|
||||||
|
|
||||||
|
_onPaste: function(ev) {
|
||||||
|
const items = ev.clipboardData.items;
|
||||||
|
const files = [];
|
||||||
|
for (const item of items) {
|
||||||
|
if (item.kind === 'file') {
|
||||||
|
files.push(item.getAsFile());
|
||||||
|
}
|
||||||
|
}
|
||||||
|
if (files.length && this.props.onFilesPasted) {
|
||||||
|
this.props.onFilesPasted(files);
|
||||||
|
return true;
|
||||||
|
}
|
||||||
|
return false;
|
||||||
|
},
|
||||||
|
|
||||||
render: function() {
|
render: function() {
|
||||||
return (
|
return (
|
||||||
<div className="mx_MessageComposer_input" onClick={ this.onInputClick }>
|
<div className="mx_MessageComposer_input" onClick={ this.onInputClick }>
|
||||||
<textarea autoFocus ref="textarea" rows="1" onKeyDown={this.onKeyDown} onKeyUp={this.onKeyUp} placeholder={this.props.placeholder} />
|
<textarea autoFocus ref="textarea" rows="1" onKeyDown={this.onKeyDown} onKeyUp={this.onKeyUp} placeholder={this.props.placeholder}
|
||||||
|
onPaste={this._onPaste}
|
||||||
|
/>
|
||||||
</div>
|
</div>
|
||||||
);
|
);
|
||||||
}
|
}
|
||||||
|
|
|
@ -24,6 +24,8 @@ var sdk = require('../../../index');
|
||||||
var Velociraptor = require('../../../Velociraptor');
|
var Velociraptor = require('../../../Velociraptor');
|
||||||
require('../../../VelocityBounce');
|
require('../../../VelocityBounce');
|
||||||
|
|
||||||
|
import DateUtils from '../../../DateUtils';
|
||||||
|
|
||||||
var bounce = false;
|
var bounce = false;
|
||||||
try {
|
try {
|
||||||
if (global.localStorage) {
|
if (global.localStorage) {
|
||||||
|
@ -63,9 +65,6 @@ module.exports = React.createClass({
|
||||||
|
|
||||||
// Timestamp when the receipt was read
|
// Timestamp when the receipt was read
|
||||||
timestamp: React.PropTypes.number,
|
timestamp: React.PropTypes.number,
|
||||||
|
|
||||||
// True to show the full date/time rather than just the time
|
|
||||||
showFullTimestamp: React.PropTypes.bool,
|
|
||||||
},
|
},
|
||||||
|
|
||||||
getDefaultProps: function() {
|
getDefaultProps: function() {
|
||||||
|
@ -170,16 +169,8 @@ module.exports = React.createClass({
|
||||||
|
|
||||||
let title;
|
let title;
|
||||||
if (this.props.timestamp) {
|
if (this.props.timestamp) {
|
||||||
const prefix = "Seen by " + this.props.member.userId + " at ";
|
title = "Seen by " + this.props.member.userId + " at " +
|
||||||
let ts = new Date(this.props.timestamp);
|
DateUtils.formatDate(new Date(this.props.timestamp));
|
||||||
if (this.props.showFullTimestamp) {
|
|
||||||
// "15/12/2016, 7:05:45 PM (@alice:matrix.org)"
|
|
||||||
title = prefix + ts.toLocaleString();
|
|
||||||
}
|
|
||||||
else {
|
|
||||||
// "7:05:45 PM (@alice:matrix.org)"
|
|
||||||
title = prefix + ts.toLocaleTimeString();
|
|
||||||
}
|
|
||||||
}
|
}
|
||||||
|
|
||||||
return (
|
return (
|
||||||
|
|
|
@ -17,7 +17,9 @@ limitations under the License.
|
||||||
'use strict';
|
'use strict';
|
||||||
|
|
||||||
var React = require('react');
|
var React = require('react');
|
||||||
|
var classNames = require('classnames');
|
||||||
var sdk = require('../../../index');
|
var sdk = require('../../../index');
|
||||||
|
import { _t } from '../../../languageHandler';
|
||||||
var MatrixClientPeg = require('../../../MatrixClientPeg');
|
var MatrixClientPeg = require('../../../MatrixClientPeg');
|
||||||
var Modal = require("../../../Modal");
|
var Modal = require("../../../Modal");
|
||||||
var dis = require("../../../dispatcher");
|
var dis = require("../../../dispatcher");
|
||||||
|
@ -39,6 +41,7 @@ module.exports = React.createClass({
|
||||||
oobData: React.PropTypes.object,
|
oobData: React.PropTypes.object,
|
||||||
editing: React.PropTypes.bool,
|
editing: React.PropTypes.bool,
|
||||||
saving: React.PropTypes.bool,
|
saving: React.PropTypes.bool,
|
||||||
|
inRoom: React.PropTypes.bool,
|
||||||
collapsedRhs: React.PropTypes.bool,
|
collapsedRhs: React.PropTypes.bool,
|
||||||
onSettingsClick: React.PropTypes.func,
|
onSettingsClick: React.PropTypes.func,
|
||||||
onSaveClick: React.PropTypes.func,
|
onSaveClick: React.PropTypes.func,
|
||||||
|
@ -49,7 +52,7 @@ module.exports = React.createClass({
|
||||||
getDefaultProps: function() {
|
getDefaultProps: function() {
|
||||||
return {
|
return {
|
||||||
editing: false,
|
editing: false,
|
||||||
onSettingsClick: function() {},
|
inRoom: false,
|
||||||
onSaveClick: function() {},
|
onSaveClick: function() {},
|
||||||
};
|
};
|
||||||
},
|
},
|
||||||
|
@ -117,8 +120,8 @@ module.exports = React.createClass({
|
||||||
var ErrorDialog = sdk.getComponent("dialogs.ErrorDialog");
|
var ErrorDialog = sdk.getComponent("dialogs.ErrorDialog");
|
||||||
console.error("Failed to set avatar: " + errMsg);
|
console.error("Failed to set avatar: " + errMsg);
|
||||||
Modal.createDialog(ErrorDialog, {
|
Modal.createDialog(ErrorDialog, {
|
||||||
title: "Error",
|
title: _t("Error"),
|
||||||
description: "Failed to set avatar.",
|
description: _t("Failed to set avatar."),
|
||||||
});
|
});
|
||||||
}).done();
|
}).done();
|
||||||
},
|
},
|
||||||
|
@ -186,6 +189,9 @@ module.exports = React.createClass({
|
||||||
);
|
);
|
||||||
|
|
||||||
save_button = <AccessibleButton className="mx_RoomHeader_textButton" onClick={this.props.onSaveClick}>Save</AccessibleButton>;
|
save_button = <AccessibleButton className="mx_RoomHeader_textButton" onClick={this.props.onSaveClick}>Save</AccessibleButton>;
|
||||||
|
}
|
||||||
|
|
||||||
|
if (this.props.onCancelClick) {
|
||||||
cancel_button = <CancelButton onClick={this.props.onCancelClick}/>;
|
cancel_button = <CancelButton onClick={this.props.onCancelClick}/>;
|
||||||
}
|
}
|
||||||
|
|
||||||
|
@ -203,7 +209,7 @@ module.exports = React.createClass({
|
||||||
// don't display the search count until the search completes and
|
// don't display the search count until the search completes and
|
||||||
// gives us a valid (possibly zero) searchCount.
|
// gives us a valid (possibly zero) searchCount.
|
||||||
if (this.props.searchInfo && this.props.searchInfo.searchCount !== undefined && this.props.searchInfo.searchCount !== null) {
|
if (this.props.searchInfo && this.props.searchInfo.searchCount !== undefined && this.props.searchInfo.searchCount !== null) {
|
||||||
searchStatus = <div className="mx_RoomHeader_searchStatus"> (~{ this.props.searchInfo.searchCount } results)</div>;
|
searchStatus = <div className="mx_RoomHeader_searchStatus"> { _t("(~%(searchCount)s results)", { searchCount: this.props.searchInfo.searchCount }) }</div>;
|
||||||
}
|
}
|
||||||
|
|
||||||
// XXX: this is a bit inefficient - we could just compare room.name for 'Empty room'...
|
// XXX: this is a bit inefficient - we could just compare room.name for 'Empty room'...
|
||||||
|
@ -218,17 +224,17 @@ module.exports = React.createClass({
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
var roomName = 'Join Room';
|
var roomName = _t("Join Room");
|
||||||
if (this.props.oobData && this.props.oobData.name) {
|
if (this.props.oobData && this.props.oobData.name) {
|
||||||
roomName = this.props.oobData.name;
|
roomName = this.props.oobData.name;
|
||||||
} else if (this.props.room) {
|
} else if (this.props.room) {
|
||||||
roomName = this.props.room.name;
|
roomName = this.props.room.name;
|
||||||
}
|
}
|
||||||
|
|
||||||
|
const emojiTextClasses = classNames('mx_RoomHeader_nametext', { mx_RoomHeader_settingsHint: settingsHint });
|
||||||
name =
|
name =
|
||||||
<div className="mx_RoomHeader_name" onClick={this.props.onSettingsClick}>
|
<div className="mx_RoomHeader_name" onClick={this.props.onSettingsClick}>
|
||||||
<EmojiText element="div" className={ "mx_RoomHeader_nametext " + (settingsHint ? "mx_RoomHeader_settingsHint" : "") } title={ roomName }>{roomName}</EmojiText>
|
<EmojiText element="div" className={emojiTextClasses} title={roomName}>{ roomName }</EmojiText>
|
||||||
{ searchStatus }
|
{ searchStatus }
|
||||||
</div>;
|
</div>;
|
||||||
}
|
}
|
||||||
|
@ -259,7 +265,7 @@ module.exports = React.createClass({
|
||||||
<div className="mx_RoomHeader_avatarPicker_edit">
|
<div className="mx_RoomHeader_avatarPicker_edit">
|
||||||
<label htmlFor="avatarInput" ref="file_label">
|
<label htmlFor="avatarInput" ref="file_label">
|
||||||
<img src="img/camera.svg"
|
<img src="img/camera.svg"
|
||||||
alt="Upload avatar" title="Upload avatar"
|
alt={ _t("Upload avatar") } title={ _t("Upload avatar") }
|
||||||
width="17" height="15" />
|
width="17" height="15" />
|
||||||
</label>
|
</label>
|
||||||
<input id="avatarInput" type="file" onChange={ this.onAvatarSelected }/>
|
<input id="avatarInput" type="file" onChange={ this.onAvatarSelected }/>
|
||||||
|
@ -294,15 +300,23 @@ module.exports = React.createClass({
|
||||||
var forget_button;
|
var forget_button;
|
||||||
if (this.props.onForgetClick) {
|
if (this.props.onForgetClick) {
|
||||||
forget_button =
|
forget_button =
|
||||||
<AccessibleButton className="mx_RoomHeader_button" onClick={this.props.onForgetClick} title="Forget room">
|
<AccessibleButton className="mx_RoomHeader_button" onClick={this.props.onForgetClick} title={ _t("Forget room") }>
|
||||||
<TintableSvg src="img/leave.svg" width="26" height="20"/>
|
<TintableSvg src="img/leave.svg" width="26" height="20"/>
|
||||||
</AccessibleButton>;
|
</AccessibleButton>;
|
||||||
}
|
}
|
||||||
|
|
||||||
|
let search_button;
|
||||||
|
if (this.props.onSearchClick && this.props.inRoom) {
|
||||||
|
search_button =
|
||||||
|
<AccessibleButton className="mx_RoomHeader_button" onClick={this.props.onSearchClick} title={ _t("Search") }>
|
||||||
|
<TintableSvg src="img/icons-search.svg" width="35" height="35"/>
|
||||||
|
</AccessibleButton>;
|
||||||
|
}
|
||||||
|
|
||||||
var rightPanel_buttons;
|
var rightPanel_buttons;
|
||||||
if (this.props.collapsedRhs) {
|
if (this.props.collapsedRhs) {
|
||||||
rightPanel_buttons =
|
rightPanel_buttons =
|
||||||
<AccessibleButton className="mx_RoomHeader_button" onClick={this.onShowRhsClick} title="Show panel">
|
<AccessibleButton className="mx_RoomHeader_button" onClick={this.onShowRhsClick} title={ _t('Show panel') }>
|
||||||
<TintableSvg src="img/maximise.svg" width="10" height="16"/>
|
<TintableSvg src="img/maximise.svg" width="10" height="16"/>
|
||||||
</AccessibleButton>;
|
</AccessibleButton>;
|
||||||
}
|
}
|
||||||
|
@ -313,9 +327,7 @@ module.exports = React.createClass({
|
||||||
<div className="mx_RoomHeader_rightRow">
|
<div className="mx_RoomHeader_rightRow">
|
||||||
{ settings_button }
|
{ settings_button }
|
||||||
{ forget_button }
|
{ forget_button }
|
||||||
<AccessibleButton className="mx_RoomHeader_button" onClick={this.props.onSearchClick} title="Search">
|
{ search_button }
|
||||||
<TintableSvg src="img/icons-search.svg" width="35" height="35"/>
|
|
||||||
</AccessibleButton>
|
|
||||||
{ rightPanel_buttons }
|
{ rightPanel_buttons }
|
||||||
</div>;
|
</div>;
|
||||||
}
|
}
|
||||||
|
|
|
@ -17,17 +17,18 @@ limitations under the License.
|
||||||
'use strict';
|
'use strict';
|
||||||
var React = require("react");
|
var React = require("react");
|
||||||
var ReactDOM = require("react-dom");
|
var ReactDOM = require("react-dom");
|
||||||
|
import { _t } from '../../../languageHandler';
|
||||||
var GeminiScrollbar = require('react-gemini-scrollbar');
|
var GeminiScrollbar = require('react-gemini-scrollbar');
|
||||||
var MatrixClientPeg = require("../../../MatrixClientPeg");
|
var MatrixClientPeg = require("../../../MatrixClientPeg");
|
||||||
var CallHandler = require('../../../CallHandler');
|
var CallHandler = require('../../../CallHandler');
|
||||||
var RoomListSorter = require("../../../RoomListSorter");
|
var RoomListSorter = require("../../../RoomListSorter");
|
||||||
|
var Unread = require('../../../Unread');
|
||||||
var dis = require("../../../dispatcher");
|
var dis = require("../../../dispatcher");
|
||||||
var sdk = require('../../../index');
|
var sdk = require('../../../index');
|
||||||
var rate_limited_func = require('../../../ratelimitedfunc');
|
var rate_limited_func = require('../../../ratelimitedfunc');
|
||||||
var Rooms = require('../../../Rooms');
|
var Rooms = require('../../../Rooms');
|
||||||
import DMRoomMap from '../../../utils/DMRoomMap';
|
import DMRoomMap from '../../../utils/DMRoomMap';
|
||||||
var Receipt = require('../../../utils/Receipt');
|
var Receipt = require('../../../utils/Receipt');
|
||||||
var constantTimeDispatcher = require('../../../ConstantTimeDispatcher');
|
|
||||||
|
|
||||||
var HIDE_CONFERENCE_CHANS = true;
|
var HIDE_CONFERENCE_CHANS = true;
|
||||||
|
|
||||||
|
@ -37,19 +38,10 @@ module.exports = React.createClass({
|
||||||
propTypes: {
|
propTypes: {
|
||||||
ConferenceHandler: React.PropTypes.any,
|
ConferenceHandler: React.PropTypes.any,
|
||||||
collapsed: React.PropTypes.bool.isRequired,
|
collapsed: React.PropTypes.bool.isRequired,
|
||||||
selectedRoom: React.PropTypes.string,
|
currentRoom: React.PropTypes.string,
|
||||||
searchFilter: React.PropTypes.string,
|
searchFilter: React.PropTypes.string,
|
||||||
},
|
},
|
||||||
|
|
||||||
shouldComponentUpdate: function(nextProps, nextState) {
|
|
||||||
if (nextProps.collapsed !== this.props.collapsed) return true;
|
|
||||||
if (nextProps.searchFilter !== this.props.searchFilter) return true;
|
|
||||||
if (nextState.lists !== this.state.lists ||
|
|
||||||
nextState.isLoadingLeftRooms !== this.state.isLoadingLeftRooms ||
|
|
||||||
nextState.incomingCall !== this.state.incomingCall) return true;
|
|
||||||
return false;
|
|
||||||
},
|
|
||||||
|
|
||||||
getInitialState: function() {
|
getInitialState: function() {
|
||||||
return {
|
return {
|
||||||
isLoadingLeftRooms: false,
|
isLoadingLeftRooms: false,
|
||||||
|
@ -59,6 +51,8 @@ module.exports = React.createClass({
|
||||||
},
|
},
|
||||||
|
|
||||||
componentWillMount: function() {
|
componentWillMount: function() {
|
||||||
|
this.mounted = false;
|
||||||
|
|
||||||
var cli = MatrixClientPeg.get();
|
var cli = MatrixClientPeg.get();
|
||||||
cli.on("Room", this.onRoom);
|
cli.on("Room", this.onRoom);
|
||||||
cli.on("deleteRoom", this.onDeleteRoom);
|
cli.on("deleteRoom", this.onDeleteRoom);
|
||||||
|
@ -66,46 +60,23 @@ module.exports = React.createClass({
|
||||||
cli.on("Room.name", this.onRoomName);
|
cli.on("Room.name", this.onRoomName);
|
||||||
cli.on("Room.tags", this.onRoomTags);
|
cli.on("Room.tags", this.onRoomTags);
|
||||||
cli.on("Room.receipt", this.onRoomReceipt);
|
cli.on("Room.receipt", this.onRoomReceipt);
|
||||||
cli.on("RoomState.members", this.onRoomStateMember);
|
cli.on("RoomState.events", this.onRoomStateEvents);
|
||||||
cli.on("RoomMember.name", this.onRoomMemberName);
|
cli.on("RoomMember.name", this.onRoomMemberName);
|
||||||
cli.on("accountData", this.onAccountData);
|
cli.on("accountData", this.onAccountData);
|
||||||
|
|
||||||
// lookup for which lists a given roomId is currently in.
|
|
||||||
this.listsForRoomId = {};
|
|
||||||
|
|
||||||
var s = this.getRoomLists();
|
var s = this.getRoomLists();
|
||||||
this.setState(s);
|
this.setState(s);
|
||||||
|
|
||||||
// order of the sublists
|
|
||||||
//this.listOrder = [];
|
|
||||||
|
|
||||||
// loop count to stop a stack overflow if the user keeps waggling the
|
|
||||||
// mouse for >30s in a row, or if running under mocha
|
|
||||||
this._delayedRefreshRoomListLoopCount = 0
|
|
||||||
},
|
},
|
||||||
|
|
||||||
componentDidMount: function() {
|
componentDidMount: function() {
|
||||||
this.dispatcherRef = dis.register(this.onAction);
|
this.dispatcherRef = dis.register(this.onAction);
|
||||||
// Initialise the stickyHeaders when the component is created
|
// Initialise the stickyHeaders when the component is created
|
||||||
this._updateStickyHeaders(true);
|
this._updateStickyHeaders(true);
|
||||||
|
|
||||||
|
this.mounted = true;
|
||||||
},
|
},
|
||||||
|
|
||||||
componentWillReceiveProps: function(nextProps) {
|
componentDidUpdate: function() {
|
||||||
// short-circuit react when the room changes
|
|
||||||
// to avoid rerendering all the sublists everywhere
|
|
||||||
if (nextProps.selectedRoom !== this.props.selectedRoom) {
|
|
||||||
if (this.props.selectedRoom) {
|
|
||||||
constantTimeDispatcher.dispatch(
|
|
||||||
"RoomTile.select", this.props.selectedRoom, {}
|
|
||||||
);
|
|
||||||
}
|
|
||||||
constantTimeDispatcher.dispatch(
|
|
||||||
"RoomTile.select", nextProps.selectedRoom, { selected: true }
|
|
||||||
);
|
|
||||||
}
|
|
||||||
},
|
|
||||||
|
|
||||||
componentDidUpdate: function(prevProps, prevState) {
|
|
||||||
// Reinitialise the stickyHeaders when the component is updated
|
// Reinitialise the stickyHeaders when the component is updated
|
||||||
this._updateStickyHeaders(true);
|
this._updateStickyHeaders(true);
|
||||||
this._repositionIncomingCallBox(undefined, false);
|
this._repositionIncomingCallBox(undefined, false);
|
||||||
|
@ -131,29 +102,17 @@ module.exports = React.createClass({
|
||||||
}
|
}
|
||||||
break;
|
break;
|
||||||
case 'on_room_read':
|
case 'on_room_read':
|
||||||
// poke the right RoomTile to refresh, using the constantTimeDispatcher
|
// Force an update because the notif count state is too deep to cause
|
||||||
// to avoid each and every RoomTile registering to the 'on_room_read' event
|
// an update. This forces the local echo of reading notifs to be
|
||||||
// XXX: if we like the constantTimeDispatcher we might want to dispatch
|
// reflected by the RoomTiles.
|
||||||
// directly from TimelinePanel rather than needlessly bouncing via here.
|
this.forceUpdate();
|
||||||
constantTimeDispatcher.dispatch(
|
|
||||||
"RoomTile.refresh", payload.room.roomId, {}
|
|
||||||
);
|
|
||||||
|
|
||||||
// also have to poke the right list(s)
|
|
||||||
var lists = this.listsForRoomId[payload.room.roomId];
|
|
||||||
if (lists) {
|
|
||||||
lists.forEach(list=>{
|
|
||||||
constantTimeDispatcher.dispatch(
|
|
||||||
"RoomSubList.refreshHeader", list, { room: payload.room }
|
|
||||||
);
|
|
||||||
});
|
|
||||||
}
|
|
||||||
|
|
||||||
break;
|
break;
|
||||||
}
|
}
|
||||||
},
|
},
|
||||||
|
|
||||||
componentWillUnmount: function() {
|
componentWillUnmount: function() {
|
||||||
|
this.mounted = false;
|
||||||
|
|
||||||
dis.unregister(this.dispatcherRef);
|
dis.unregister(this.dispatcherRef);
|
||||||
if (MatrixClientPeg.get()) {
|
if (MatrixClientPeg.get()) {
|
||||||
MatrixClientPeg.get().removeListener("Room", this.onRoom);
|
MatrixClientPeg.get().removeListener("Room", this.onRoom);
|
||||||
|
@ -162,7 +121,7 @@ module.exports = React.createClass({
|
||||||
MatrixClientPeg.get().removeListener("Room.name", this.onRoomName);
|
MatrixClientPeg.get().removeListener("Room.name", this.onRoomName);
|
||||||
MatrixClientPeg.get().removeListener("Room.tags", this.onRoomTags);
|
MatrixClientPeg.get().removeListener("Room.tags", this.onRoomTags);
|
||||||
MatrixClientPeg.get().removeListener("Room.receipt", this.onRoomReceipt);
|
MatrixClientPeg.get().removeListener("Room.receipt", this.onRoomReceipt);
|
||||||
MatrixClientPeg.get().removeListener("RoomState.members", this.onRoomStateMember);
|
MatrixClientPeg.get().removeListener("RoomState.events", this.onRoomStateEvents);
|
||||||
MatrixClientPeg.get().removeListener("RoomMember.name", this.onRoomMemberName);
|
MatrixClientPeg.get().removeListener("RoomMember.name", this.onRoomMemberName);
|
||||||
MatrixClientPeg.get().removeListener("accountData", this.onAccountData);
|
MatrixClientPeg.get().removeListener("accountData", this.onAccountData);
|
||||||
}
|
}
|
||||||
|
@ -171,14 +130,10 @@ module.exports = React.createClass({
|
||||||
},
|
},
|
||||||
|
|
||||||
onRoom: function(room) {
|
onRoom: function(room) {
|
||||||
// XXX: this happens rarely; ideally we should only update the correct
|
|
||||||
// sublists when it does (e.g. via a constantTimeDispatch to the right sublist)
|
|
||||||
this._delayedRefreshRoomList();
|
this._delayedRefreshRoomList();
|
||||||
},
|
},
|
||||||
|
|
||||||
onDeleteRoom: function(roomId) {
|
onDeleteRoom: function(roomId) {
|
||||||
// XXX: this happens rarely; ideally we should only update the correct
|
|
||||||
// sublists when it does (e.g. via a constantTimeDispatch to the right sublist)
|
|
||||||
this._delayedRefreshRoomList();
|
this._delayedRefreshRoomList();
|
||||||
},
|
},
|
||||||
|
|
||||||
|
@ -201,10 +156,6 @@ module.exports = React.createClass({
|
||||||
}
|
}
|
||||||
},
|
},
|
||||||
|
|
||||||
_onMouseOver: function(ev) {
|
|
||||||
this._lastMouseOverTs = Date.now();
|
|
||||||
},
|
|
||||||
|
|
||||||
onSubListHeaderClick: function(isHidden, scrollToPosition) {
|
onSubListHeaderClick: function(isHidden, scrollToPosition) {
|
||||||
// The scroll area has expanded or contracted, so re-calculate sticky headers positions
|
// The scroll area has expanded or contracted, so re-calculate sticky headers positions
|
||||||
this._updateStickyHeaders(true, scrollToPosition);
|
this._updateStickyHeaders(true, scrollToPosition);
|
||||||
|
@ -214,98 +165,41 @@ module.exports = React.createClass({
|
||||||
if (toStartOfTimeline) return;
|
if (toStartOfTimeline) return;
|
||||||
if (!room) return;
|
if (!room) return;
|
||||||
if (data.timeline.getTimelineSet() !== room.getUnfilteredTimelineSet()) return;
|
if (data.timeline.getTimelineSet() !== room.getUnfilteredTimelineSet()) return;
|
||||||
|
this._delayedRefreshRoomList();
|
||||||
// rather than regenerate our full roomlists, which is very heavy, we poke the
|
|
||||||
// correct sublists to just re-sort themselves. This isn't enormously reacty,
|
|
||||||
// but is much faster than the default react reconciler, or having to do voodoo
|
|
||||||
// with shouldComponentUpdate and a pleaseRefresh property or similar.
|
|
||||||
var lists = this.listsForRoomId[room.roomId];
|
|
||||||
if (lists) {
|
|
||||||
lists.forEach(list=>{
|
|
||||||
constantTimeDispatcher.dispatch("RoomSubList.sort", list, { room: room });
|
|
||||||
});
|
|
||||||
}
|
|
||||||
|
|
||||||
// we have to explicitly hit the roomtile which just changed
|
|
||||||
constantTimeDispatcher.dispatch(
|
|
||||||
"RoomTile.refresh", room.roomId, {}
|
|
||||||
);
|
|
||||||
},
|
},
|
||||||
|
|
||||||
onRoomReceipt: function(receiptEvent, room) {
|
onRoomReceipt: function(receiptEvent, room) {
|
||||||
// because if we read a notification, it will affect notification count
|
// because if we read a notification, it will affect notification count
|
||||||
// only bother updating if there's a receipt from us
|
// only bother updating if there's a receipt from us
|
||||||
if (Receipt.findReadReceiptFromUserId(receiptEvent, MatrixClientPeg.get().credentials.userId)) {
|
if (Receipt.findReadReceiptFromUserId(receiptEvent, MatrixClientPeg.get().credentials.userId)) {
|
||||||
var lists = this.listsForRoomId[room.roomId];
|
this._delayedRefreshRoomList();
|
||||||
if (lists) {
|
|
||||||
lists.forEach(list=>{
|
|
||||||
constantTimeDispatcher.dispatch(
|
|
||||||
"RoomSubList.refreshHeader", list, { room: room }
|
|
||||||
);
|
|
||||||
});
|
|
||||||
}
|
|
||||||
|
|
||||||
// we have to explicitly hit the roomtile which just changed
|
|
||||||
constantTimeDispatcher.dispatch(
|
|
||||||
"RoomTile.refresh", room.roomId, {}
|
|
||||||
);
|
|
||||||
}
|
}
|
||||||
},
|
},
|
||||||
|
|
||||||
onRoomName: function(room) {
|
onRoomName: function(room) {
|
||||||
constantTimeDispatcher.dispatch(
|
|
||||||
"RoomTile.refresh", room.roomId, {}
|
|
||||||
);
|
|
||||||
},
|
|
||||||
|
|
||||||
onRoomTags: function(event, room) {
|
|
||||||
// XXX: this happens rarely; ideally we should only update the correct
|
|
||||||
// sublists when it does (e.g. via a constantTimeDispatch to the right sublist)
|
|
||||||
this._delayedRefreshRoomList();
|
this._delayedRefreshRoomList();
|
||||||
},
|
},
|
||||||
|
|
||||||
onRoomStateMember: function(ev, state, member) {
|
onRoomTags: function(event, room) {
|
||||||
if (ev.getStateKey() === MatrixClientPeg.get().credentials.userId &&
|
this._delayedRefreshRoomList();
|
||||||
ev.getPrevContent() && ev.getPrevContent().membership === "invite")
|
},
|
||||||
{
|
|
||||||
this._delayedRefreshRoomList();
|
onRoomStateEvents: function(ev, state) {
|
||||||
}
|
this._delayedRefreshRoomList();
|
||||||
else {
|
|
||||||
constantTimeDispatcher.dispatch(
|
|
||||||
"RoomTile.refresh", member.roomId, {}
|
|
||||||
);
|
|
||||||
}
|
|
||||||
},
|
},
|
||||||
|
|
||||||
onRoomMemberName: function(ev, member) {
|
onRoomMemberName: function(ev, member) {
|
||||||
constantTimeDispatcher.dispatch(
|
this._delayedRefreshRoomList();
|
||||||
"RoomTile.refresh", member.roomId, {}
|
|
||||||
);
|
|
||||||
},
|
},
|
||||||
|
|
||||||
onAccountData: function(ev) {
|
onAccountData: function(ev) {
|
||||||
if (ev.getType() == 'm.direct') {
|
if (ev.getType() == 'm.direct') {
|
||||||
// XXX: this happens rarely; ideally we should only update the correct
|
|
||||||
// sublists when it does (e.g. via a constantTimeDispatch to the right sublist)
|
|
||||||
this._delayedRefreshRoomList();
|
this._delayedRefreshRoomList();
|
||||||
}
|
}
|
||||||
else if (ev.getType() == 'm.push_rules') {
|
|
||||||
this._delayedRefreshRoomList();
|
|
||||||
}
|
|
||||||
},
|
},
|
||||||
|
|
||||||
_delayedRefreshRoomList: new rate_limited_func(function() {
|
_delayedRefreshRoomList: new rate_limited_func(function() {
|
||||||
// if the mouse has been moving over the RoomList in the last 500ms
|
this.refreshRoomList();
|
||||||
// then delay the refresh further to avoid bouncing around under the
|
|
||||||
// cursor
|
|
||||||
if (Date.now() - this._lastMouseOverTs > 500 || this._delayedRefreshRoomListLoopCount > 60) {
|
|
||||||
this.refreshRoomList();
|
|
||||||
this._delayedRefreshRoomListLoopCount = 0;
|
|
||||||
}
|
|
||||||
else {
|
|
||||||
this._delayedRefreshRoomListLoopCount++;
|
|
||||||
this._delayedRefreshRoomList();
|
|
||||||
}
|
|
||||||
}, 500),
|
}, 500),
|
||||||
|
|
||||||
refreshRoomList: function() {
|
refreshRoomList: function() {
|
||||||
|
@ -313,12 +207,14 @@ module.exports = React.createClass({
|
||||||
// (!this._lastRefreshRoomListTs ? "-" : (Date.now() - this._lastRefreshRoomListTs))
|
// (!this._lastRefreshRoomListTs ? "-" : (Date.now() - this._lastRefreshRoomListTs))
|
||||||
// );
|
// );
|
||||||
|
|
||||||
// TODO: ideally we'd calculate this once at start, and then maintain
|
// TODO: rather than bluntly regenerating and re-sorting everything
|
||||||
// any changes to it incrementally, updating the appropriate sublists
|
// every time we see any kind of room change from the JS SDK
|
||||||
// as needed.
|
// we could do incremental updates on our copy of the state
|
||||||
// Alternatively we'd do something magical with Immutable.js or similar.
|
// based on the room which has actually changed. This would stop
|
||||||
|
// us re-rendering all the sublists every time anything changes anywhere
|
||||||
|
// in the state of the client.
|
||||||
this.setState(this.getRoomLists());
|
this.setState(this.getRoomLists());
|
||||||
|
|
||||||
// this._lastRefreshRoomListTs = Date.now();
|
// this._lastRefreshRoomListTs = Date.now();
|
||||||
},
|
},
|
||||||
|
|
||||||
|
@ -333,26 +229,18 @@ module.exports = React.createClass({
|
||||||
s.lists["m.lowpriority"] = [];
|
s.lists["m.lowpriority"] = [];
|
||||||
s.lists["im.vector.fake.archived"] = [];
|
s.lists["im.vector.fake.archived"] = [];
|
||||||
|
|
||||||
this.listsForRoomId = {};
|
|
||||||
var otherTagNames = {};
|
|
||||||
|
|
||||||
const dmRoomMap = new DMRoomMap(MatrixClientPeg.get());
|
const dmRoomMap = new DMRoomMap(MatrixClientPeg.get());
|
||||||
|
|
||||||
MatrixClientPeg.get().getRooms().forEach(function(room) {
|
MatrixClientPeg.get().getRooms().forEach(function(room) {
|
||||||
const me = room.getMember(MatrixClientPeg.get().credentials.userId);
|
const me = room.getMember(MatrixClientPeg.get().credentials.userId);
|
||||||
if (!me) return;
|
if (!me) return;
|
||||||
|
|
||||||
// console.log("room = " + room.name + ", me.membership = " + me.membership +
|
// console.log("room = " + room.name + ", me.membership = " + me.membership +
|
||||||
// ", sender = " + me.events.member.getSender() +
|
// ", sender = " + me.events.member.getSender() +
|
||||||
// ", target = " + me.events.member.getStateKey() +
|
// ", target = " + me.events.member.getStateKey() +
|
||||||
// ", prevMembership = " + me.events.member.getPrevContent().membership);
|
// ", prevMembership = " + me.events.member.getPrevContent().membership);
|
||||||
|
|
||||||
if (!self.listsForRoomId[room.roomId]) {
|
|
||||||
self.listsForRoomId[room.roomId] = [];
|
|
||||||
}
|
|
||||||
|
|
||||||
if (me.membership == "invite") {
|
if (me.membership == "invite") {
|
||||||
self.listsForRoomId[room.roomId].push("im.vector.fake.invite");
|
|
||||||
s.lists["im.vector.fake.invite"].push(room);
|
s.lists["im.vector.fake.invite"].push(room);
|
||||||
}
|
}
|
||||||
else if (HIDE_CONFERENCE_CHANS && Rooms.isConfCallRoom(room, me, self.props.ConferenceHandler)) {
|
else if (HIDE_CONFERENCE_CHANS && Rooms.isConfCallRoom(room, me, self.props.ConferenceHandler)) {
|
||||||
|
@ -363,27 +251,23 @@ module.exports = React.createClass({
|
||||||
{
|
{
|
||||||
// Used to split rooms via tags
|
// Used to split rooms via tags
|
||||||
var tagNames = Object.keys(room.tags);
|
var tagNames = Object.keys(room.tags);
|
||||||
|
|
||||||
if (tagNames.length) {
|
if (tagNames.length) {
|
||||||
for (var i = 0; i < tagNames.length; i++) {
|
for (var i = 0; i < tagNames.length; i++) {
|
||||||
var tagName = tagNames[i];
|
var tagName = tagNames[i];
|
||||||
s.lists[tagName] = s.lists[tagName] || [];
|
s.lists[tagName] = s.lists[tagName] || [];
|
||||||
s.lists[tagName].push(room);
|
s.lists[tagNames[i]].push(room);
|
||||||
self.listsForRoomId[room.roomId].push(tagName);
|
|
||||||
otherTagNames[tagName] = 1;
|
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
else if (dmRoomMap.getUserIdForRoomId(room.roomId)) {
|
else if (dmRoomMap.getUserIdForRoomId(room.roomId)) {
|
||||||
// "Direct Message" rooms (that we're still in and that aren't otherwise tagged)
|
// "Direct Message" rooms (that we're still in and that aren't otherwise tagged)
|
||||||
self.listsForRoomId[room.roomId].push("im.vector.fake.direct");
|
|
||||||
s.lists["im.vector.fake.direct"].push(room);
|
s.lists["im.vector.fake.direct"].push(room);
|
||||||
}
|
}
|
||||||
else {
|
else {
|
||||||
self.listsForRoomId[room.roomId].push("im.vector.fake.recent");
|
|
||||||
s.lists["im.vector.fake.recent"].push(room);
|
s.lists["im.vector.fake.recent"].push(room);
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
else if (me.membership === "leave") {
|
else if (me.membership === "leave") {
|
||||||
self.listsForRoomId[room.roomId].push("im.vector.fake.archived");
|
|
||||||
s.lists["im.vector.fake.archived"].push(room);
|
s.lists["im.vector.fake.archived"].push(room);
|
||||||
}
|
}
|
||||||
else {
|
else {
|
||||||
|
@ -404,10 +288,8 @@ module.exports = React.createClass({
|
||||||
const me = room.getMember(MatrixClientPeg.get().credentials.userId);
|
const me = room.getMember(MatrixClientPeg.get().credentials.userId);
|
||||||
|
|
||||||
if (me && Rooms.looksLikeDirectMessageRoom(room, me)) {
|
if (me && Rooms.looksLikeDirectMessageRoom(room, me)) {
|
||||||
self.listsForRoomId[room.roomId].push("im.vector.fake.direct");
|
|
||||||
s.lists["im.vector.fake.direct"].push(room);
|
s.lists["im.vector.fake.direct"].push(room);
|
||||||
} else {
|
} else {
|
||||||
self.listsForRoomId[room.roomId].push("im.vector.fake.recent");
|
|
||||||
s.lists["im.vector.fake.recent"].push(room);
|
s.lists["im.vector.fake.recent"].push(room);
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
@ -424,8 +306,6 @@ module.exports = React.createClass({
|
||||||
newMDirectEvent[otherPerson.userId] = roomList;
|
newMDirectEvent[otherPerson.userId] = roomList;
|
||||||
}
|
}
|
||||||
|
|
||||||
console.warn("Resetting room DM state to be " + JSON.stringify(newMDirectEvent));
|
|
||||||
|
|
||||||
// if this fails, fine, we'll just do the same thing next time we get the room lists
|
// if this fails, fine, we'll just do the same thing next time we get the room lists
|
||||||
MatrixClientPeg.get().setAccountData('m.direct', newMDirectEvent).done();
|
MatrixClientPeg.get().setAccountData('m.direct', newMDirectEvent).done();
|
||||||
}
|
}
|
||||||
|
@ -434,32 +314,19 @@ module.exports = React.createClass({
|
||||||
|
|
||||||
// we actually apply the sorting to this when receiving the prop in RoomSubLists.
|
// we actually apply the sorting to this when receiving the prop in RoomSubLists.
|
||||||
|
|
||||||
// we'll need this when we get to iterating through lists programatically - e.g. ctrl-shift-up/down
|
|
||||||
/*
|
|
||||||
this.listOrder = [
|
|
||||||
"im.vector.fake.invite",
|
|
||||||
"m.favourite",
|
|
||||||
"im.vector.fake.recent",
|
|
||||||
"im.vector.fake.direct",
|
|
||||||
Object.keys(otherTagNames).filter(tagName=>{
|
|
||||||
return (!tagName.match(/^m\.(favourite|lowpriority)$/));
|
|
||||||
}).sort(),
|
|
||||||
"m.lowpriority",
|
|
||||||
"im.vector.fake.archived"
|
|
||||||
];
|
|
||||||
*/
|
|
||||||
|
|
||||||
return s;
|
return s;
|
||||||
},
|
},
|
||||||
|
|
||||||
_getScrollNode: function() {
|
_getScrollNode: function() {
|
||||||
|
if (!this.mounted) return null;
|
||||||
var panel = ReactDOM.findDOMNode(this);
|
var panel = ReactDOM.findDOMNode(this);
|
||||||
if (!panel) return null;
|
if (!panel) return null;
|
||||||
|
|
||||||
// empirically, if we have gm-prevented for some reason, the scroll node
|
if (panel.classList.contains('gm-prevented')) {
|
||||||
// is still the 3rd child (i.e. the view child). This looks to be due
|
return panel;
|
||||||
// to vdh's improved resize updater logic...?
|
} else {
|
||||||
return panel.children[2]; // XXX: Fragile!
|
return panel.children[2]; // XXX: Fragile!
|
||||||
|
}
|
||||||
},
|
},
|
||||||
|
|
||||||
_whenScrolling: function(e) {
|
_whenScrolling: function(e) {
|
||||||
|
@ -479,6 +346,7 @@ module.exports = React.createClass({
|
||||||
var incomingCallBox = document.getElementById("incomingCallBox");
|
var incomingCallBox = document.getElementById("incomingCallBox");
|
||||||
if (incomingCallBox && incomingCallBox.parentElement) {
|
if (incomingCallBox && incomingCallBox.parentElement) {
|
||||||
var scrollArea = this._getScrollNode();
|
var scrollArea = this._getScrollNode();
|
||||||
|
if (!scrollArea) return;
|
||||||
// Use the offset of the top of the scroll area from the window
|
// Use the offset of the top of the scroll area from the window
|
||||||
// as this is used to calculate the CSS fixed top position for the stickies
|
// as this is used to calculate the CSS fixed top position for the stickies
|
||||||
var scrollAreaOffset = scrollArea.getBoundingClientRect().top + window.pageYOffset;
|
var scrollAreaOffset = scrollArea.getBoundingClientRect().top + window.pageYOffset;
|
||||||
|
@ -502,10 +370,11 @@ module.exports = React.createClass({
|
||||||
// properly through React
|
// properly through React
|
||||||
_initAndPositionStickyHeaders: function(initialise, scrollToPosition) {
|
_initAndPositionStickyHeaders: function(initialise, scrollToPosition) {
|
||||||
var scrollArea = this._getScrollNode();
|
var scrollArea = this._getScrollNode();
|
||||||
|
if (!scrollArea) return;
|
||||||
// Use the offset of the top of the scroll area from the window
|
// Use the offset of the top of the scroll area from the window
|
||||||
// as this is used to calculate the CSS fixed top position for the stickies
|
// as this is used to calculate the CSS fixed top position for the stickies
|
||||||
var scrollAreaOffset = scrollArea.getBoundingClientRect().top + window.pageYOffset;
|
var scrollAreaOffset = scrollArea.getBoundingClientRect().top + window.pageYOffset;
|
||||||
// Use the offset of the top of the component from the window
|
// Use the offset of the top of the componet from the window
|
||||||
// as this is used to calculate the CSS fixed top position for the stickies
|
// as this is used to calculate the CSS fixed top position for the stickies
|
||||||
var scrollAreaHeight = ReactDOM.findDOMNode(this).getBoundingClientRect().height;
|
var scrollAreaHeight = ReactDOM.findDOMNode(this).getBoundingClientRect().height;
|
||||||
|
|
||||||
|
@ -602,75 +471,72 @@ module.exports = React.createClass({
|
||||||
render: function() {
|
render: function() {
|
||||||
var RoomSubList = sdk.getComponent('structures.RoomSubList');
|
var RoomSubList = sdk.getComponent('structures.RoomSubList');
|
||||||
var self = this;
|
var self = this;
|
||||||
|
|
||||||
return (
|
return (
|
||||||
<GeminiScrollbar className="mx_RoomList_scrollbar"
|
<GeminiScrollbar className="mx_RoomList_scrollbar"
|
||||||
autoshow={true} onScroll={ self._whenScrolling } onResize={ self._whenScrolling } ref="gemscroll">
|
autoshow={true} onScroll={ self._whenScrolling } ref="gemscroll">
|
||||||
<div className="mx_RoomList" onMouseOver={ this._onMouseOver }>
|
<div className="mx_RoomList">
|
||||||
<RoomSubList list={ self.state.lists['im.vector.fake.invite'] }
|
<RoomSubList list={ self.state.lists['im.vector.fake.invite'] }
|
||||||
label="Invites"
|
label={ _t('Invites') }
|
||||||
tagName="im.vector.fake.invite"
|
|
||||||
editable={ false }
|
editable={ false }
|
||||||
order="recent"
|
order="recent"
|
||||||
|
selectedRoom={ self.props.selectedRoom }
|
||||||
incomingCall={ self.state.incomingCall }
|
incomingCall={ self.state.incomingCall }
|
||||||
collapsed={ self.props.collapsed }
|
collapsed={ self.props.collapsed }
|
||||||
selectedRoom={ self.props.selectedRoom }
|
|
||||||
searchFilter={ self.props.searchFilter }
|
searchFilter={ self.props.searchFilter }
|
||||||
onHeaderClick={ self.onSubListHeaderClick }
|
onHeaderClick={ self.onSubListHeaderClick }
|
||||||
onShowMoreRooms={ self.onShowMoreRooms } />
|
onShowMoreRooms={ self.onShowMoreRooms } />
|
||||||
|
|
||||||
<RoomSubList list={ self.state.lists['m.favourite'] }
|
<RoomSubList list={ self.state.lists['m.favourite'] }
|
||||||
label="Favourites"
|
label={ _t('Favourites') }
|
||||||
tagName="m.favourite"
|
tagName="m.favourite"
|
||||||
verb="favourite"
|
verb={ _t('to favourite') }
|
||||||
editable={ true }
|
editable={ true }
|
||||||
order="manual"
|
order="manual"
|
||||||
|
selectedRoom={ self.props.selectedRoom }
|
||||||
incomingCall={ self.state.incomingCall }
|
incomingCall={ self.state.incomingCall }
|
||||||
collapsed={ self.props.collapsed }
|
collapsed={ self.props.collapsed }
|
||||||
selectedRoom={ self.props.selectedRoom }
|
|
||||||
searchFilter={ self.props.searchFilter }
|
searchFilter={ self.props.searchFilter }
|
||||||
onHeaderClick={ self.onSubListHeaderClick }
|
onHeaderClick={ self.onSubListHeaderClick }
|
||||||
onShowMoreRooms={ self.onShowMoreRooms } />
|
onShowMoreRooms={ self.onShowMoreRooms } />
|
||||||
|
|
||||||
<RoomSubList list={ self.state.lists['im.vector.fake.direct'] }
|
<RoomSubList list={ self.state.lists['im.vector.fake.direct'] }
|
||||||
label="People"
|
label={ _t('People') }
|
||||||
tagName="im.vector.fake.direct"
|
tagName="im.vector.fake.direct"
|
||||||
verb="tag direct chat"
|
verb={ _t('to tag direct chat') }
|
||||||
editable={ true }
|
editable={ true }
|
||||||
order="recent"
|
order="recent"
|
||||||
|
selectedRoom={ self.props.selectedRoom }
|
||||||
incomingCall={ self.state.incomingCall }
|
incomingCall={ self.state.incomingCall }
|
||||||
collapsed={ self.props.collapsed }
|
collapsed={ self.props.collapsed }
|
||||||
selectedRoom={ self.props.selectedRoom }
|
|
||||||
alwaysShowHeader={ true }
|
alwaysShowHeader={ true }
|
||||||
searchFilter={ self.props.searchFilter }
|
searchFilter={ self.props.searchFilter }
|
||||||
onHeaderClick={ self.onSubListHeaderClick }
|
onHeaderClick={ self.onSubListHeaderClick }
|
||||||
onShowMoreRooms={ self.onShowMoreRooms } />
|
onShowMoreRooms={ self.onShowMoreRooms } />
|
||||||
|
|
||||||
<RoomSubList list={ self.state.lists['im.vector.fake.recent'] }
|
<RoomSubList list={ self.state.lists['im.vector.fake.recent'] }
|
||||||
label="Rooms"
|
label={ _t('Rooms') }
|
||||||
tagName="im.vector.fake.recent"
|
|
||||||
editable={ true }
|
editable={ true }
|
||||||
verb="restore"
|
verb={ _t('to restore') }
|
||||||
order="recent"
|
order="recent"
|
||||||
|
selectedRoom={ self.props.selectedRoom }
|
||||||
incomingCall={ self.state.incomingCall }
|
incomingCall={ self.state.incomingCall }
|
||||||
collapsed={ self.props.collapsed }
|
collapsed={ self.props.collapsed }
|
||||||
selectedRoom={ self.props.selectedRoom }
|
|
||||||
searchFilter={ self.props.searchFilter }
|
searchFilter={ self.props.searchFilter }
|
||||||
onHeaderClick={ self.onSubListHeaderClick }
|
onHeaderClick={ self.onSubListHeaderClick }
|
||||||
onShowMoreRooms={ self.onShowMoreRooms } />
|
onShowMoreRooms={ self.onShowMoreRooms } />
|
||||||
|
|
||||||
{ Object.keys(self.state.lists).sort().map(function(tagName) {
|
{ Object.keys(self.state.lists).map(function(tagName) {
|
||||||
if (!tagName.match(/^(m\.(favourite|lowpriority)|im\.vector\.fake\.(invite|recent|direct|archived))$/)) {
|
if (!tagName.match(/^(m\.(favourite|lowpriority)|im\.vector\.fake\.(invite|recent|direct|archived))$/)) {
|
||||||
return <RoomSubList list={ self.state.lists[tagName] }
|
return <RoomSubList list={ self.state.lists[tagName] }
|
||||||
key={ tagName }
|
key={ tagName }
|
||||||
label={ tagName }
|
label={ tagName }
|
||||||
tagName={ tagName }
|
tagName={ tagName }
|
||||||
verb={ "tag as " + tagName }
|
verb={ _t('to tag as %(tagName)s', {tagName: tagName}) }
|
||||||
editable={ true }
|
editable={ true }
|
||||||
order="manual"
|
order="manual"
|
||||||
|
selectedRoom={ self.props.selectedRoom }
|
||||||
incomingCall={ self.state.incomingCall }
|
incomingCall={ self.state.incomingCall }
|
||||||
collapsed={ self.props.collapsed }
|
collapsed={ self.props.collapsed }
|
||||||
selectedRoom={ self.props.selectedRoom }
|
|
||||||
searchFilter={ self.props.searchFilter }
|
searchFilter={ self.props.searchFilter }
|
||||||
onHeaderClick={ self.onSubListHeaderClick }
|
onHeaderClick={ self.onSubListHeaderClick }
|
||||||
onShowMoreRooms={ self.onShowMoreRooms } />;
|
onShowMoreRooms={ self.onShowMoreRooms } />;
|
||||||
|
@ -679,25 +545,24 @@ module.exports = React.createClass({
|
||||||
}) }
|
}) }
|
||||||
|
|
||||||
<RoomSubList list={ self.state.lists['m.lowpriority'] }
|
<RoomSubList list={ self.state.lists['m.lowpriority'] }
|
||||||
label="Low priority"
|
label={ _t('Low priority') }
|
||||||
tagName="m.lowpriority"
|
tagName="m.lowpriority"
|
||||||
verb="demote"
|
verb={ _t('to demote') }
|
||||||
editable={ true }
|
editable={ true }
|
||||||
order="recent"
|
order="recent"
|
||||||
|
selectedRoom={ self.props.selectedRoom }
|
||||||
incomingCall={ self.state.incomingCall }
|
incomingCall={ self.state.incomingCall }
|
||||||
collapsed={ self.props.collapsed }
|
collapsed={ self.props.collapsed }
|
||||||
selectedRoom={ self.props.selectedRoom }
|
|
||||||
searchFilter={ self.props.searchFilter }
|
searchFilter={ self.props.searchFilter }
|
||||||
onHeaderClick={ self.onSubListHeaderClick }
|
onHeaderClick={ self.onSubListHeaderClick }
|
||||||
onShowMoreRooms={ self.onShowMoreRooms } />
|
onShowMoreRooms={ self.onShowMoreRooms } />
|
||||||
|
|
||||||
<RoomSubList list={ self.state.lists['im.vector.fake.archived'] }
|
<RoomSubList list={ self.state.lists['im.vector.fake.archived'] }
|
||||||
label="Historical"
|
label={ _t('Historical') }
|
||||||
tagName="im.vector.fake.archived"
|
|
||||||
editable={ false }
|
editable={ false }
|
||||||
order="recent"
|
order="recent"
|
||||||
collapsed={ self.props.collapsed }
|
|
||||||
selectedRoom={ self.props.selectedRoom }
|
selectedRoom={ self.props.selectedRoom }
|
||||||
|
collapsed={ self.props.collapsed }
|
||||||
alwaysShowHeader={ true }
|
alwaysShowHeader={ true }
|
||||||
startAsHidden={ true }
|
startAsHidden={ true }
|
||||||
showSpinner={ self.state.isLoadingLeftRooms }
|
showSpinner={ self.state.isLoadingLeftRooms }
|
||||||
|
|
|
@ -21,6 +21,8 @@ var React = require('react');
|
||||||
var sdk = require('../../../index');
|
var sdk = require('../../../index');
|
||||||
var MatrixClientPeg = require('../../../MatrixClientPeg');
|
var MatrixClientPeg = require('../../../MatrixClientPeg');
|
||||||
|
|
||||||
|
import { _t } from '../../../languageHandler';
|
||||||
|
|
||||||
module.exports = React.createClass({
|
module.exports = React.createClass({
|
||||||
displayName: 'RoomPreviewBar',
|
displayName: 'RoomPreviewBar',
|
||||||
|
|
||||||
|
@ -47,7 +49,7 @@ module.exports = React.createClass({
|
||||||
// The alias that was used to access this room, if appropriate
|
// The alias that was used to access this room, if appropriate
|
||||||
// If given, this will be how the room is referred to (eg.
|
// If given, this will be how the room is referred to (eg.
|
||||||
// in error messages).
|
// in error messages).
|
||||||
roomAlias: React.PropTypes.object,
|
roomAlias: React.PropTypes.string,
|
||||||
},
|
},
|
||||||
|
|
||||||
getDefaultProps: function() {
|
getDefaultProps: function() {
|
||||||
|
@ -84,7 +86,7 @@ module.exports = React.createClass({
|
||||||
_roomNameElement: function(fallback) {
|
_roomNameElement: function(fallback) {
|
||||||
fallback = fallback || 'a room';
|
fallback = fallback || 'a room';
|
||||||
const name = this.props.room ? this.props.room.name : (this.props.room_alias || "");
|
const name = this.props.room ? this.props.room.name : (this.props.room_alias || "");
|
||||||
return name ? <b>{ name }</b> : fallback;
|
return name ? name : fallback;
|
||||||
},
|
},
|
||||||
|
|
||||||
render: function() {
|
render: function() {
|
||||||
|
@ -128,13 +130,14 @@ module.exports = React.createClass({
|
||||||
</div>;
|
</div>;
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
// TODO: find a way to respect HTML in counterpart!
|
||||||
joinBlock = (
|
joinBlock = (
|
||||||
<div>
|
<div>
|
||||||
<div className="mx_RoomPreviewBar_invite_text">
|
<div className="mx_RoomPreviewBar_invite_text">
|
||||||
You have been invited to join this room by <b>{ this.props.inviterName }</b>
|
{ _t('You have been invited to join this room by %(inviterName)s', {inviterName: this.props.inviterName}) }
|
||||||
</div>
|
</div>
|
||||||
<div className="mx_RoomPreviewBar_join_text">
|
<div className="mx_RoomPreviewBar_join_text">
|
||||||
Would you like to <a onClick={ this.props.onJoinClick }>accept</a> or <a onClick={ this.props.onRejectClick }>decline</a> this invitation?
|
{ _t('Would you like to') } <a onClick={ this.props.onJoinClick }>{ _t('accept') }</a> { _t('or') } <a onClick={ this.props.onRejectClick }>{ _t('decline') }</a> { _t('this invitation?') }
|
||||||
</div>
|
</div>
|
||||||
{emailMatchBlock}
|
{emailMatchBlock}
|
||||||
</div>
|
</div>
|
||||||
|
@ -186,8 +189,8 @@ module.exports = React.createClass({
|
||||||
joinBlock = (
|
joinBlock = (
|
||||||
<div>
|
<div>
|
||||||
<div className="mx_RoomPreviewBar_join_text">
|
<div className="mx_RoomPreviewBar_join_text">
|
||||||
You are trying to access { name }.<br/>
|
{ _t('You are trying to access %(roomName)s', {roomName: name}) }.<br/>
|
||||||
<a onClick={ this.props.onJoinClick }><b>Click here</b></a> to join the discussion!
|
<a onClick={ this.props.onJoinClick }><b>{ _t('Click here') }</b></a> { _t('to join the discussion') }!
|
||||||
</div>
|
</div>
|
||||||
</div>
|
</div>
|
||||||
);
|
);
|
||||||
|
@ -196,7 +199,7 @@ module.exports = React.createClass({
|
||||||
if (this.props.canPreview) {
|
if (this.props.canPreview) {
|
||||||
previewBlock = (
|
previewBlock = (
|
||||||
<div className="mx_RoomPreviewBar_preview_text">
|
<div className="mx_RoomPreviewBar_preview_text">
|
||||||
This is a preview of this room. Room interactions have been disabled.
|
{ _t('This is a preview of this room. Room interactions have been disabled') }.
|
||||||
</div>
|
</div>
|
||||||
);
|
);
|
||||||
}
|
}
|
||||||
|
|
|
@ -17,6 +17,7 @@ limitations under the License.
|
||||||
|
|
||||||
import q from 'q';
|
import q from 'q';
|
||||||
import React from 'react';
|
import React from 'react';
|
||||||
|
import { _t } from '../../../languageHandler';
|
||||||
import MatrixClientPeg from '../../../MatrixClientPeg';
|
import MatrixClientPeg from '../../../MatrixClientPeg';
|
||||||
import SdkConfig from '../../../SdkConfig';
|
import SdkConfig from '../../../SdkConfig';
|
||||||
import sdk from '../../../index';
|
import sdk from '../../../index';
|
||||||
|
@ -56,8 +57,8 @@ const BannedUser = React.createClass({
|
||||||
const ErrorDialog = sdk.getComponent("dialogs.ErrorDialog");
|
const ErrorDialog = sdk.getComponent("dialogs.ErrorDialog");
|
||||||
console.error("Failed to unban: " + err);
|
console.error("Failed to unban: " + err);
|
||||||
Modal.createDialog(ErrorDialog, {
|
Modal.createDialog(ErrorDialog, {
|
||||||
title: "Error",
|
title: _t('Error'),
|
||||||
description: "Failed to unban",
|
description: _t('Failed to unban'),
|
||||||
});
|
});
|
||||||
}).done();
|
}).done();
|
||||||
},
|
},
|
||||||
|
@ -70,7 +71,7 @@ const BannedUser = React.createClass({
|
||||||
<AccessibleButton className="mx_RoomSettings_unbanButton"
|
<AccessibleButton className="mx_RoomSettings_unbanButton"
|
||||||
onClick={this._onUnbanClick}
|
onClick={this._onUnbanClick}
|
||||||
>
|
>
|
||||||
Unban
|
{ _t('Unban') }
|
||||||
</AccessibleButton>
|
</AccessibleButton>
|
||||||
{this.props.member.userId}
|
{this.props.member.userId}
|
||||||
</li>
|
</li>
|
||||||
|
@ -400,13 +401,13 @@ module.exports = React.createClass({
|
||||||
var value = ev.target.value;
|
var value = ev.target.value;
|
||||||
|
|
||||||
Modal.createDialog(QuestionDialog, {
|
Modal.createDialog(QuestionDialog, {
|
||||||
title: "Privacy warning",
|
title: _t('Privacy warning'),
|
||||||
description:
|
description:
|
||||||
<div>
|
<div>
|
||||||
Changes to who can read history will only apply to future messages in this room.<br/>
|
{ _t('Changes to who can read history will only apply to future messages in this room') }.<br/>
|
||||||
The visibility of existing history will be unchanged.
|
{ _t('The visibility of existing history will be unchanged') }.
|
||||||
</div>,
|
</div>,
|
||||||
button: "Continue",
|
button: _t('Continue'),
|
||||||
onFinished: function(confirmed) {
|
onFinished: function(confirmed) {
|
||||||
if (confirmed) {
|
if (confirmed) {
|
||||||
self.setState({
|
self.setState({
|
||||||
|
@ -523,11 +524,11 @@ module.exports = React.createClass({
|
||||||
MatrixClientPeg.get().forget(this.props.room.roomId).done(function() {
|
MatrixClientPeg.get().forget(this.props.room.roomId).done(function() {
|
||||||
dis.dispatch({ action: 'view_next_room' });
|
dis.dispatch({ action: 'view_next_room' });
|
||||||
}, function(err) {
|
}, function(err) {
|
||||||
var errCode = err.errcode || "unknown error code";
|
var errCode = err.errcode || _t('unknown error code');
|
||||||
var ErrorDialog = sdk.getComponent("dialogs.ErrorDialog");
|
var ErrorDialog = sdk.getComponent("dialogs.ErrorDialog");
|
||||||
Modal.createDialog(ErrorDialog, {
|
Modal.createDialog(ErrorDialog, {
|
||||||
title: "Error",
|
title: _t('Error'),
|
||||||
description: `Failed to forget room (${errCode})`
|
description: _t("Failed to forget room %(errCode)s", { errCode: errCode }),
|
||||||
});
|
});
|
||||||
});
|
});
|
||||||
},
|
},
|
||||||
|
@ -537,14 +538,14 @@ module.exports = React.createClass({
|
||||||
|
|
||||||
var QuestionDialog = sdk.getComponent("dialogs.QuestionDialog");
|
var QuestionDialog = sdk.getComponent("dialogs.QuestionDialog");
|
||||||
Modal.createDialog(QuestionDialog, {
|
Modal.createDialog(QuestionDialog, {
|
||||||
title: "Warning!",
|
title: _t('Warning!'),
|
||||||
description: (
|
description: (
|
||||||
<div>
|
<div>
|
||||||
<p>End-to-end encryption is in beta and may not be reliable.</p>
|
<p>{ _t('End-to-end encryption is in beta and may not be reliable') }.</p>
|
||||||
<p>You should <b>not</b> yet trust it to secure data.</p>
|
<p>{ _t('You should not yet trust it to secure data') }.</p>
|
||||||
<p>Devices will <b>not</b> yet be able to decrypt history from before they joined the room.</p>
|
<p>{ _t('Devices will not yet be able to decrypt history from before they joined the room') }.</p>
|
||||||
<p>Once encryption is enabled for a room it <b>cannot</b> be turned off again (for now).</p>
|
<p>{ _t('Once encryption is enabled for a room it cannot be turned off again (for now)') }.</p>
|
||||||
<p>Encrypted messages will not be visible on clients that do not yet implement encryption.</p>
|
<p>{ _t('Encrypted messages will not be visible on clients that do not yet implement encryption') }.</p>
|
||||||
</div>
|
</div>
|
||||||
),
|
),
|
||||||
onFinished: confirm=>{
|
onFinished: confirm=>{
|
||||||
|
@ -572,7 +573,7 @@ module.exports = React.createClass({
|
||||||
<input type="checkbox" ref="blacklistUnverified"
|
<input type="checkbox" ref="blacklistUnverified"
|
||||||
defaultChecked={ isGlobalBlacklistUnverified || isRoomBlacklistUnverified }
|
defaultChecked={ isGlobalBlacklistUnverified || isRoomBlacklistUnverified }
|
||||||
disabled={ isGlobalBlacklistUnverified || (this.refs.encrypt && !this.refs.encrypt.checked) }/>
|
disabled={ isGlobalBlacklistUnverified || (this.refs.encrypt && !this.refs.encrypt.checked) }/>
|
||||||
Never send encrypted messages to unverified devices in this room from this device.
|
{ _t('Never send encrypted messages to unverified devices in this room from this device') }.
|
||||||
</label>;
|
</label>;
|
||||||
|
|
||||||
if (!isEncrypted &&
|
if (!isEncrypted &&
|
||||||
|
@ -582,7 +583,7 @@ module.exports = React.createClass({
|
||||||
<label>
|
<label>
|
||||||
<input type="checkbox" ref="encrypt" onClick={ this.onEnableEncryptionClick }/>
|
<input type="checkbox" ref="encrypt" onClick={ this.onEnableEncryptionClick }/>
|
||||||
<img className="mx_RoomSettings_e2eIcon" src="img/e2e-unencrypted.svg" width="12" height="12" />
|
<img className="mx_RoomSettings_e2eIcon" src="img/e2e-unencrypted.svg" width="12" height="12" />
|
||||||
Enable encryption (warning: cannot be disabled again!)
|
{ _t('Enable encryption') } { _t('(warning: cannot be disabled again!)') }
|
||||||
</label>
|
</label>
|
||||||
{ settings }
|
{ settings }
|
||||||
</div>
|
</div>
|
||||||
|
@ -596,7 +597,7 @@ module.exports = React.createClass({
|
||||||
? <img className="mx_RoomSettings_e2eIcon" src="img/e2e-verified.svg" width="10" height="12" />
|
? <img className="mx_RoomSettings_e2eIcon" src="img/e2e-verified.svg" width="10" height="12" />
|
||||||
: <img className="mx_RoomSettings_e2eIcon" src="img/e2e-unencrypted.svg" width="12" height="12" />
|
: <img className="mx_RoomSettings_e2eIcon" src="img/e2e-unencrypted.svg" width="12" height="12" />
|
||||||
}
|
}
|
||||||
Encryption is { isEncrypted ? "" : "not " } enabled in this room.
|
{ isEncrypted ? "Encryption is enabled in this room" : "Encryption is not enabled in this room" }.
|
||||||
</label>
|
</label>
|
||||||
{ settings }
|
{ settings }
|
||||||
</div>
|
</div>
|
||||||
|
@ -647,12 +648,12 @@ module.exports = React.createClass({
|
||||||
if (Object.keys(user_levels).length) {
|
if (Object.keys(user_levels).length) {
|
||||||
userLevelsSection =
|
userLevelsSection =
|
||||||
<div>
|
<div>
|
||||||
<h3>Privileged Users</h3>
|
<h3>{ _t('Privileged Users') }</h3>
|
||||||
<ul className="mx_RoomSettings_userLevels">
|
<ul className="mx_RoomSettings_userLevels">
|
||||||
{Object.keys(user_levels).map(function(user, i) {
|
{Object.keys(user_levels).map(function(user, i) {
|
||||||
return (
|
return (
|
||||||
<li className="mx_RoomSettings_userLevel" key={user}>
|
<li className="mx_RoomSettings_userLevel" key={user}>
|
||||||
{ user } is a <PowerSelector value={ user_levels[user] } disabled={true}/>
|
{ user } { _t('is a') } <PowerSelector value={ user_levels[user] } disabled={true}/>
|
||||||
</li>
|
</li>
|
||||||
);
|
);
|
||||||
})}
|
})}
|
||||||
|
@ -660,7 +661,7 @@ module.exports = React.createClass({
|
||||||
</div>;
|
</div>;
|
||||||
}
|
}
|
||||||
else {
|
else {
|
||||||
userLevelsSection = <div>No users have specific privileges in this room.</div>;
|
userLevelsSection = <div>{ _t('No users have specific privileges in this room') }.</div>;
|
||||||
}
|
}
|
||||||
|
|
||||||
var banned = this.props.room.getMembersWithMembership("ban");
|
var banned = this.props.room.getMembersWithMembership("ban");
|
||||||
|
@ -668,7 +669,7 @@ module.exports = React.createClass({
|
||||||
if (banned.length) {
|
if (banned.length) {
|
||||||
bannedUsersSection =
|
bannedUsersSection =
|
||||||
<div>
|
<div>
|
||||||
<h3>Banned users</h3>
|
<h3>{ _t('Banned users') }</h3>
|
||||||
<ul className="mx_RoomSettings_banned">
|
<ul className="mx_RoomSettings_banned">
|
||||||
{banned.map(function(member) {
|
{banned.map(function(member) {
|
||||||
return (
|
return (
|
||||||
|
@ -683,7 +684,7 @@ module.exports = React.createClass({
|
||||||
if (this._yankValueFromEvent("m.room.create", "m.federate") === false) {
|
if (this._yankValueFromEvent("m.room.create", "m.federate") === false) {
|
||||||
unfederatableSection = (
|
unfederatableSection = (
|
||||||
<div className="mx_RoomSettings_powerLevel">
|
<div className="mx_RoomSettings_powerLevel">
|
||||||
Ths room is not accessible by remote Matrix servers.
|
{ _t('This room is not accessible by remote Matrix servers') }.
|
||||||
</div>
|
</div>
|
||||||
);
|
);
|
||||||
}
|
}
|
||||||
|
@ -694,14 +695,14 @@ module.exports = React.createClass({
|
||||||
if (myMember.membership === "join") {
|
if (myMember.membership === "join") {
|
||||||
leaveButton = (
|
leaveButton = (
|
||||||
<AccessibleButton className="mx_RoomSettings_leaveButton" onClick={ this.onLeaveClick }>
|
<AccessibleButton className="mx_RoomSettings_leaveButton" onClick={ this.onLeaveClick }>
|
||||||
Leave room
|
{ _t('Leave room') }
|
||||||
</AccessibleButton>
|
</AccessibleButton>
|
||||||
);
|
);
|
||||||
}
|
}
|
||||||
else if (myMember.membership === "leave") {
|
else if (myMember.membership === "leave") {
|
||||||
leaveButton = (
|
leaveButton = (
|
||||||
<AccessibleButton className="mx_RoomSettings_leaveButton" onClick={ this.onForgetClick }>
|
<AccessibleButton className="mx_RoomSettings_leaveButton" onClick={ this.onForgetClick }>
|
||||||
Forget room
|
{ _t('Forget room') }
|
||||||
</AccessibleButton>
|
</AccessibleButton>
|
||||||
);
|
);
|
||||||
}
|
}
|
||||||
|
@ -711,8 +712,8 @@ module.exports = React.createClass({
|
||||||
// TODO: support editing custom user_levels
|
// TODO: support editing custom user_levels
|
||||||
|
|
||||||
var tags = [
|
var tags = [
|
||||||
{ name: "m.favourite", label: "Favourite", ref: "tag_favourite" },
|
{ name: "m.favourite", label: _t('Favourite'), ref: "tag_favourite" },
|
||||||
{ name: "m.lowpriority", label: "Low priority", ref: "tag_lowpriority" },
|
{ name: "m.lowpriority", label: _t('Low priority'), ref: "tag_lowpriority" },
|
||||||
];
|
];
|
||||||
|
|
||||||
Object.keys(this.state.tags).sort().forEach(function(tagName) {
|
Object.keys(this.state.tags).sort().forEach(function(tagName) {
|
||||||
|
@ -753,7 +754,7 @@ module.exports = React.createClass({
|
||||||
if (this.state.join_rule === "public" && aliasCount == 0) {
|
if (this.state.join_rule === "public" && aliasCount == 0) {
|
||||||
addressWarning =
|
addressWarning =
|
||||||
<div className="mx_RoomSettings_warning">
|
<div className="mx_RoomSettings_warning">
|
||||||
To link to a room it must have <a href="#addresses">an address</a>.
|
{ _t('To link to a room it must have') } <a href="#addresses"> { _t('an address') }</a>.
|
||||||
</div>;
|
</div>;
|
||||||
}
|
}
|
||||||
|
|
||||||
|
@ -761,10 +762,10 @@ module.exports = React.createClass({
|
||||||
if (this.state.join_rule !== "public" && this.state.guest_access === "forbidden") {
|
if (this.state.join_rule !== "public" && this.state.guest_access === "forbidden") {
|
||||||
inviteGuestWarning =
|
inviteGuestWarning =
|
||||||
<div className="mx_RoomSettings_warning">
|
<div className="mx_RoomSettings_warning">
|
||||||
Guests cannot join this room even if explicitly invited. <a href="#" onClick={ (e) => {
|
{ _t('Guests cannot join this room even if explicitly invited.') } <a href="#" onClick={ (e) => {
|
||||||
this.setState({ join_rule: "invite", guest_access: "can_join" });
|
this.setState({ join_rule: "invite", guest_access: "can_join" });
|
||||||
e.preventDefault();
|
e.preventDefault();
|
||||||
}}>Click here to fix</a>.
|
}}>{ _t('Click here to fix') }</a>.
|
||||||
</div>;
|
</div>;
|
||||||
}
|
}
|
||||||
|
|
||||||
|
@ -776,7 +777,7 @@ module.exports = React.createClass({
|
||||||
console.error(this.state.scalar_error);
|
console.error(this.state.scalar_error);
|
||||||
integrationsError = (
|
integrationsError = (
|
||||||
<span className="mx_RoomSettings_integrationsButton_errorPopup">
|
<span className="mx_RoomSettings_integrationsButton_errorPopup">
|
||||||
Could not connect to the integration server
|
{ _t('Could not connect to the integration server') }
|
||||||
</span>
|
</span>
|
||||||
);
|
);
|
||||||
}
|
}
|
||||||
|
@ -784,7 +785,7 @@ module.exports = React.createClass({
|
||||||
if (this.scalarClient.hasCredentials()) {
|
if (this.scalarClient.hasCredentials()) {
|
||||||
integrationsButton = (
|
integrationsButton = (
|
||||||
<div className="mx_RoomSettings_integrationsButton" onClick={ this.onManageIntegrations }>
|
<div className="mx_RoomSettings_integrationsButton" onClick={ this.onManageIntegrations }>
|
||||||
Manage Integrations
|
{ _t('Manage Integrations') }
|
||||||
</div>
|
</div>
|
||||||
);
|
);
|
||||||
} else if (this.state.scalar_error) {
|
} else if (this.state.scalar_error) {
|
||||||
|
@ -797,7 +798,7 @@ module.exports = React.createClass({
|
||||||
} else {
|
} else {
|
||||||
integrationsButton = (
|
integrationsButton = (
|
||||||
<div className="mx_RoomSettings_integrationsButton" style={{opacity: 0.5}}>
|
<div className="mx_RoomSettings_integrationsButton" style={{opacity: 0.5}}>
|
||||||
Manage Integrations
|
{ _t('Manage Integrations') }
|
||||||
</div>
|
</div>
|
||||||
);
|
);
|
||||||
}
|
}
|
||||||
|
@ -813,28 +814,28 @@ module.exports = React.createClass({
|
||||||
|
|
||||||
<div className="mx_RoomSettings_toggles">
|
<div className="mx_RoomSettings_toggles">
|
||||||
<div className="mx_RoomSettings_settings">
|
<div className="mx_RoomSettings_settings">
|
||||||
<h3>Who can access this room?</h3>
|
<h3>{ _t('Who can access this room?') }</h3>
|
||||||
{ inviteGuestWarning }
|
{ inviteGuestWarning }
|
||||||
<label>
|
<label>
|
||||||
<input type="radio" name="roomVis" value="invite_only"
|
<input type="radio" name="roomVis" value="invite_only"
|
||||||
disabled={ !this.mayChangeRoomAccess() }
|
disabled={ !this.mayChangeRoomAccess() }
|
||||||
onChange={this._onRoomAccessRadioToggle}
|
onChange={this._onRoomAccessRadioToggle}
|
||||||
checked={this.state.join_rule !== "public"}/>
|
checked={this.state.join_rule !== "public"}/>
|
||||||
Only people who have been invited
|
{ _t('Only people who have been invited') }
|
||||||
</label>
|
</label>
|
||||||
<label>
|
<label>
|
||||||
<input type="radio" name="roomVis" value="public_no_guests"
|
<input type="radio" name="roomVis" value="public_no_guests"
|
||||||
disabled={ !this.mayChangeRoomAccess() }
|
disabled={ !this.mayChangeRoomAccess() }
|
||||||
onChange={this._onRoomAccessRadioToggle}
|
onChange={this._onRoomAccessRadioToggle}
|
||||||
checked={this.state.join_rule === "public" && this.state.guest_access !== "can_join"}/>
|
checked={this.state.join_rule === "public" && this.state.guest_access !== "can_join"}/>
|
||||||
Anyone who knows the room's link, apart from guests
|
{ _t('Anyone who knows the room\'s link, apart from guests') }
|
||||||
</label>
|
</label>
|
||||||
<label>
|
<label>
|
||||||
<input type="radio" name="roomVis" value="public_with_guests"
|
<input type="radio" name="roomVis" value="public_with_guests"
|
||||||
disabled={ !this.mayChangeRoomAccess() }
|
disabled={ !this.mayChangeRoomAccess() }
|
||||||
onChange={this._onRoomAccessRadioToggle}
|
onChange={this._onRoomAccessRadioToggle}
|
||||||
checked={this.state.join_rule === "public" && this.state.guest_access === "can_join"}/>
|
checked={this.state.join_rule === "public" && this.state.guest_access === "can_join"}/>
|
||||||
Anyone who knows the room's link, including guests
|
{ _t('Anyone who knows the room\'s link, including guests') }
|
||||||
</label>
|
</label>
|
||||||
{ addressWarning }
|
{ addressWarning }
|
||||||
<br/>
|
<br/>
|
||||||
|
@ -847,7 +848,7 @@ module.exports = React.createClass({
|
||||||
</label>
|
</label>
|
||||||
</div>
|
</div>
|
||||||
<div className="mx_RoomSettings_settings">
|
<div className="mx_RoomSettings_settings">
|
||||||
<h3>Who can read history?</h3>
|
<h3>{ _t('Who can read history?') }</h3>
|
||||||
<label>
|
<label>
|
||||||
<input type="radio" name="historyVis" value="world_readable"
|
<input type="radio" name="historyVis" value="world_readable"
|
||||||
disabled={ !roomState.mayClientSendStateEvent("m.room.history_visibility", cli) }
|
disabled={ !roomState.mayClientSendStateEvent("m.room.history_visibility", cli) }
|
||||||
|
@ -860,28 +861,28 @@ module.exports = React.createClass({
|
||||||
disabled={ !roomState.mayClientSendStateEvent("m.room.history_visibility", cli) }
|
disabled={ !roomState.mayClientSendStateEvent("m.room.history_visibility", cli) }
|
||||||
checked={historyVisibility === "shared"}
|
checked={historyVisibility === "shared"}
|
||||||
onChange={this._onHistoryRadioToggle} />
|
onChange={this._onHistoryRadioToggle} />
|
||||||
Members only (since the point in time of selecting this option)
|
{ _t('Members only') } ({ _t('since the point in time of selecting this option') })
|
||||||
</label>
|
</label>
|
||||||
<label>
|
<label>
|
||||||
<input type="radio" name="historyVis" value="invited"
|
<input type="radio" name="historyVis" value="invited"
|
||||||
disabled={ !roomState.mayClientSendStateEvent("m.room.history_visibility", cli) }
|
disabled={ !roomState.mayClientSendStateEvent("m.room.history_visibility", cli) }
|
||||||
checked={historyVisibility === "invited"}
|
checked={historyVisibility === "invited"}
|
||||||
onChange={this._onHistoryRadioToggle} />
|
onChange={this._onHistoryRadioToggle} />
|
||||||
Members only (since they were invited)
|
{ _t('Members only') } ({ _t('since they were invited') })
|
||||||
</label>
|
</label>
|
||||||
<label >
|
<label >
|
||||||
<input type="radio" name="historyVis" value="joined"
|
<input type="radio" name="historyVis" value="joined"
|
||||||
disabled={ !roomState.mayClientSendStateEvent("m.room.history_visibility", cli) }
|
disabled={ !roomState.mayClientSendStateEvent("m.room.history_visibility", cli) }
|
||||||
checked={historyVisibility === "joined"}
|
checked={historyVisibility === "joined"}
|
||||||
onChange={this._onHistoryRadioToggle} />
|
onChange={this._onHistoryRadioToggle} />
|
||||||
Members only (since they joined)
|
{ _t('Members only') } ({ _t('since they joined') })
|
||||||
</label>
|
</label>
|
||||||
</div>
|
</div>
|
||||||
</div>
|
</div>
|
||||||
|
|
||||||
|
|
||||||
<div>
|
<div>
|
||||||
<h3>Room Colour</h3>
|
<h3>{ _t('Room Colour') }</h3>
|
||||||
<ColorSettings ref="color_settings" room={this.props.room} />
|
<ColorSettings ref="color_settings" room={this.props.room} />
|
||||||
</div>
|
</div>
|
||||||
|
|
||||||
|
@ -899,41 +900,41 @@ module.exports = React.createClass({
|
||||||
|
|
||||||
<UrlPreviewSettings ref="url_preview_settings" room={this.props.room} />
|
<UrlPreviewSettings ref="url_preview_settings" room={this.props.room} />
|
||||||
|
|
||||||
<h3>Permissions</h3>
|
<h3>{ _t('Permissions') }</h3>
|
||||||
<div className="mx_RoomSettings_powerLevels mx_RoomSettings_settings">
|
<div className="mx_RoomSettings_powerLevels mx_RoomSettings_settings">
|
||||||
<div className="mx_RoomSettings_powerLevel">
|
<div className="mx_RoomSettings_powerLevel">
|
||||||
<span className="mx_RoomSettings_powerLevelKey">The default role for new room members is </span>
|
<span className="mx_RoomSettings_powerLevelKey">{ _t('The default role for new room members is') } </span>
|
||||||
<PowerSelector ref="users_default" value={default_user_level} controlled={false} disabled={!can_change_levels || current_user_level < default_user_level} onChange={this.onPowerLevelsChanged}/>
|
<PowerSelector ref="users_default" value={default_user_level} controlled={false} disabled={!can_change_levels || current_user_level < default_user_level} onChange={this.onPowerLevelsChanged}/>
|
||||||
</div>
|
</div>
|
||||||
<div className="mx_RoomSettings_powerLevel">
|
<div className="mx_RoomSettings_powerLevel">
|
||||||
<span className="mx_RoomSettings_powerLevelKey">To send messages, you must be a </span>
|
<span className="mx_RoomSettings_powerLevelKey">{ _t('To send messages') }, { _t('you must be a') } </span>
|
||||||
<PowerSelector ref="events_default" value={send_level} controlled={false} disabled={!can_change_levels || current_user_level < send_level} onChange={this.onPowerLevelsChanged}/>
|
<PowerSelector ref="events_default" value={send_level} controlled={false} disabled={!can_change_levels || current_user_level < send_level} onChange={this.onPowerLevelsChanged}/>
|
||||||
</div>
|
</div>
|
||||||
<div className="mx_RoomSettings_powerLevel">
|
<div className="mx_RoomSettings_powerLevel">
|
||||||
<span className="mx_RoomSettings_powerLevelKey">To invite users into the room, you must be a </span>
|
<span className="mx_RoomSettings_powerLevelKey">{ _t('To invite users into the room') }, { _t('you must be a') } </span>
|
||||||
<PowerSelector ref="invite" value={invite_level} controlled={false} disabled={!can_change_levels || current_user_level < invite_level} onChange={this.onPowerLevelsChanged}/>
|
<PowerSelector ref="invite" value={invite_level} controlled={false} disabled={!can_change_levels || current_user_level < invite_level} onChange={this.onPowerLevelsChanged}/>
|
||||||
</div>
|
</div>
|
||||||
<div className="mx_RoomSettings_powerLevel">
|
<div className="mx_RoomSettings_powerLevel">
|
||||||
<span className="mx_RoomSettings_powerLevelKey">To configure the room, you must be a </span>
|
<span className="mx_RoomSettings_powerLevelKey">{ _t('To configure the room') }, { _t('you must be a') } </span>
|
||||||
<PowerSelector ref="state_default" value={state_level} controlled={false} disabled={!can_change_levels || current_user_level < state_level} onChange={this.onPowerLevelsChanged}/>
|
<PowerSelector ref="state_default" value={state_level} controlled={false} disabled={!can_change_levels || current_user_level < state_level} onChange={this.onPowerLevelsChanged}/>
|
||||||
</div>
|
</div>
|
||||||
<div className="mx_RoomSettings_powerLevel">
|
<div className="mx_RoomSettings_powerLevel">
|
||||||
<span className="mx_RoomSettings_powerLevelKey">To kick users, you must be a </span>
|
<span className="mx_RoomSettings_powerLevelKey">{ _t('To kick users') }, { _t('you must be a') } </span>
|
||||||
<PowerSelector ref="kick" value={kick_level} controlled={false} disabled={!can_change_levels || current_user_level < kick_level} onChange={this.onPowerLevelsChanged}/>
|
<PowerSelector ref="kick" value={kick_level} controlled={false} disabled={!can_change_levels || current_user_level < kick_level} onChange={this.onPowerLevelsChanged}/>
|
||||||
</div>
|
</div>
|
||||||
<div className="mx_RoomSettings_powerLevel">
|
<div className="mx_RoomSettings_powerLevel">
|
||||||
<span className="mx_RoomSettings_powerLevelKey">To ban users, you must be a </span>
|
<span className="mx_RoomSettings_powerLevelKey">{ _t('To ban users') }, { _t('you must be a') } </span>
|
||||||
<PowerSelector ref="ban" value={ban_level} controlled={false} disabled={!can_change_levels || current_user_level < ban_level} onChange={this.onPowerLevelsChanged}/>
|
<PowerSelector ref="ban" value={ban_level} controlled={false} disabled={!can_change_levels || current_user_level < ban_level} onChange={this.onPowerLevelsChanged}/>
|
||||||
</div>
|
</div>
|
||||||
<div className="mx_RoomSettings_powerLevel">
|
<div className="mx_RoomSettings_powerLevel">
|
||||||
<span className="mx_RoomSettings_powerLevelKey">To remove messages, you must be a </span>
|
<span className="mx_RoomSettings_powerLevelKey">{ _t('To remove other users\' messages') }, { _t('you must be a') } </span>
|
||||||
<PowerSelector ref="redact" value={redact_level} controlled={false} disabled={!can_change_levels || current_user_level < redact_level} onChange={this.onPowerLevelsChanged}/>
|
<PowerSelector ref="redact" value={redact_level} controlled={false} disabled={!can_change_levels || current_user_level < redact_level} onChange={this.onPowerLevelsChanged}/>
|
||||||
</div>
|
</div>
|
||||||
|
|
||||||
{Object.keys(events_levels).map(function(event_type, i) {
|
{Object.keys(events_levels).map(function(event_type, i) {
|
||||||
return (
|
return (
|
||||||
<div className="mx_RoomSettings_powerLevel" key={event_type}>
|
<div className="mx_RoomSettings_powerLevel" key={event_type}>
|
||||||
<span className="mx_RoomSettings_powerLevelKey">To send events of type <code>{ event_type }</code>, you must be a </span>
|
<span className="mx_RoomSettings_powerLevelKey">{ _t('To send events of type') } <code>{ event_type }</code>, { _t('you must be a') } </span>
|
||||||
<PowerSelector value={ events_levels[event_type] } controlled={false} disabled={true} onChange={self.onPowerLevelsChanged}/>
|
<PowerSelector value={ events_levels[event_type] } controlled={false} disabled={true} onChange={self.onPowerLevelsChanged}/>
|
||||||
</div>
|
</div>
|
||||||
);
|
);
|
||||||
|
@ -946,9 +947,9 @@ module.exports = React.createClass({
|
||||||
|
|
||||||
{ bannedUsersSection }
|
{ bannedUsersSection }
|
||||||
|
|
||||||
<h3>Advanced</h3>
|
<h3>{ _t('Advanced') }</h3>
|
||||||
<div className="mx_RoomSettings_settings">
|
<div className="mx_RoomSettings_settings">
|
||||||
This room's internal ID is <code>{ this.props.room.roomId }</code>
|
{ _t('This room\'s internal ID is') } <code>{ this.props.room.roomId }</code>
|
||||||
</div>
|
</div>
|
||||||
</div>
|
</div>
|
||||||
);
|
);
|
||||||
|
|
|
@ -27,8 +27,6 @@ var RoomNotifs = require('../../../RoomNotifs');
|
||||||
var FormattingUtils = require('../../../utils/FormattingUtils');
|
var FormattingUtils = require('../../../utils/FormattingUtils');
|
||||||
import AccessibleButton from '../elements/AccessibleButton';
|
import AccessibleButton from '../elements/AccessibleButton';
|
||||||
var UserSettingsStore = require('../../../UserSettingsStore');
|
var UserSettingsStore = require('../../../UserSettingsStore');
|
||||||
var constantTimeDispatcher = require('../../../ConstantTimeDispatcher');
|
|
||||||
var Unread = require('../../../Unread');
|
|
||||||
|
|
||||||
module.exports = React.createClass({
|
module.exports = React.createClass({
|
||||||
displayName: 'RoomTile',
|
displayName: 'RoomTile',
|
||||||
|
@ -38,10 +36,12 @@ module.exports = React.createClass({
|
||||||
connectDropTarget: React.PropTypes.func,
|
connectDropTarget: React.PropTypes.func,
|
||||||
onClick: React.PropTypes.func,
|
onClick: React.PropTypes.func,
|
||||||
isDragging: React.PropTypes.bool,
|
isDragging: React.PropTypes.bool,
|
||||||
selectedRoom: React.PropTypes.string,
|
|
||||||
|
|
||||||
room: React.PropTypes.object.isRequired,
|
room: React.PropTypes.object.isRequired,
|
||||||
collapsed: React.PropTypes.bool.isRequired,
|
collapsed: React.PropTypes.bool.isRequired,
|
||||||
|
selected: React.PropTypes.bool.isRequired,
|
||||||
|
unread: React.PropTypes.bool.isRequired,
|
||||||
|
highlight: React.PropTypes.bool.isRequired,
|
||||||
isInvite: React.PropTypes.bool.isRequired,
|
isInvite: React.PropTypes.bool.isRequired,
|
||||||
incomingCall: React.PropTypes.object,
|
incomingCall: React.PropTypes.object,
|
||||||
},
|
},
|
||||||
|
@ -54,11 +54,10 @@ module.exports = React.createClass({
|
||||||
|
|
||||||
getInitialState: function() {
|
getInitialState: function() {
|
||||||
return({
|
return({
|
||||||
hover: false,
|
hover : false,
|
||||||
badgeHover: false,
|
badgeHover : false,
|
||||||
menuDisplayed: false,
|
menuDisplayed: false,
|
||||||
notifState: RoomNotifs.getRoomNotifsState(this.props.room.roomId),
|
notifState: RoomNotifs.getRoomNotifsState(this.props.room.roomId),
|
||||||
selected: this.props.room ? (this.props.selectedRoom === this.props.room.roomId) : false,
|
|
||||||
});
|
});
|
||||||
},
|
},
|
||||||
|
|
||||||
|
@ -80,32 +79,23 @@ module.exports = React.createClass({
|
||||||
}
|
}
|
||||||
},
|
},
|
||||||
|
|
||||||
|
onAccountData: function(accountDataEvent) {
|
||||||
|
if (accountDataEvent.getType() == 'm.push_rules') {
|
||||||
|
this.setState({
|
||||||
|
notifState: RoomNotifs.getRoomNotifsState(this.props.room.roomId),
|
||||||
|
});
|
||||||
|
}
|
||||||
|
},
|
||||||
|
|
||||||
componentWillMount: function() {
|
componentWillMount: function() {
|
||||||
constantTimeDispatcher.register("RoomTile.refresh", this.props.room.roomId, this.onRefresh);
|
MatrixClientPeg.get().on("accountData", this.onAccountData);
|
||||||
constantTimeDispatcher.register("RoomTile.select", this.props.room.roomId, this.onSelect);
|
|
||||||
this.onRefresh();
|
|
||||||
},
|
},
|
||||||
|
|
||||||
componentWillUnmount: function() {
|
componentWillUnmount: function() {
|
||||||
constantTimeDispatcher.unregister("RoomTile.refresh", this.props.room.roomId, this.onRefresh);
|
var cli = MatrixClientPeg.get();
|
||||||
constantTimeDispatcher.unregister("RoomTile.select", this.props.room.roomId, this.onSelect);
|
if (cli) {
|
||||||
},
|
MatrixClientPeg.get().removeListener("accountData", this.onAccountData);
|
||||||
|
}
|
||||||
componentWillReceiveProps: function(nextProps) {
|
|
||||||
this.onRefresh();
|
|
||||||
},
|
|
||||||
|
|
||||||
onRefresh: function(params) {
|
|
||||||
this.setState({
|
|
||||||
unread: Unread.doesRoomHaveUnreadMessages(this.props.room),
|
|
||||||
highlight: this.props.room.getUnreadNotificationCount('highlight') > 0 || this.props.isInvite,
|
|
||||||
});
|
|
||||||
},
|
|
||||||
|
|
||||||
onSelect: function(params) {
|
|
||||||
this.setState({
|
|
||||||
selected: params.selected,
|
|
||||||
});
|
|
||||||
},
|
},
|
||||||
|
|
||||||
onClick: function(ev) {
|
onClick: function(ev) {
|
||||||
|
@ -179,13 +169,13 @@ module.exports = React.createClass({
|
||||||
// var highlightCount = this.props.room.getUnreadNotificationCount("highlight");
|
// var highlightCount = this.props.room.getUnreadNotificationCount("highlight");
|
||||||
|
|
||||||
const notifBadges = notificationCount > 0 && this._shouldShowNotifBadge();
|
const notifBadges = notificationCount > 0 && this._shouldShowNotifBadge();
|
||||||
const mentionBadges = this.state.highlight && this._shouldShowMentionBadge();
|
const mentionBadges = this.props.highlight && this._shouldShowMentionBadge();
|
||||||
const badges = notifBadges || mentionBadges;
|
const badges = notifBadges || mentionBadges;
|
||||||
|
|
||||||
var classes = classNames({
|
var classes = classNames({
|
||||||
'mx_RoomTile': true,
|
'mx_RoomTile': true,
|
||||||
'mx_RoomTile_selected': this.state.selected,
|
'mx_RoomTile_selected': this.props.selected,
|
||||||
'mx_RoomTile_unread': this.state.unread,
|
'mx_RoomTile_unread': this.props.unread,
|
||||||
'mx_RoomTile_unreadNotify': notifBadges,
|
'mx_RoomTile_unreadNotify': notifBadges,
|
||||||
'mx_RoomTile_highlight': mentionBadges,
|
'mx_RoomTile_highlight': mentionBadges,
|
||||||
'mx_RoomTile_invited': (me && me.membership == 'invite'),
|
'mx_RoomTile_invited': (me && me.membership == 'invite'),
|
||||||
|
@ -231,7 +221,7 @@ module.exports = React.createClass({
|
||||||
'mx_RoomTile_badgeShown': badges || this.state.badgeHover || this.state.menuDisplayed,
|
'mx_RoomTile_badgeShown': badges || this.state.badgeHover || this.state.menuDisplayed,
|
||||||
});
|
});
|
||||||
|
|
||||||
if (this.state.selected) {
|
if (this.props.selected) {
|
||||||
let nameSelected = <EmojiText>{name}</EmojiText>;
|
let nameSelected = <EmojiText>{name}</EmojiText>;
|
||||||
|
|
||||||
label = <div title={ name } className={ nameClasses }>{ nameSelected }</div>;
|
label = <div title={ name } className={ nameClasses }>{ nameSelected }</div>;
|
||||||
|
@ -265,8 +255,7 @@ module.exports = React.createClass({
|
||||||
|
|
||||||
let ret = (
|
let ret = (
|
||||||
<div> { /* Only native elements can be wrapped in a DnD object. */}
|
<div> { /* Only native elements can be wrapped in a DnD object. */}
|
||||||
<AccessibleButton className={classes} tabIndex="0" onClick={this.onClick}
|
<AccessibleButton className={classes} tabIndex="0" onClick={this.onClick} onMouseEnter={this.onMouseEnter} onMouseLeave={this.onMouseLeave}>
|
||||||
onMouseEnter={this.onMouseEnter} onMouseLeave={this.onMouseLeave}>
|
|
||||||
<div className={avatarClasses}>
|
<div className={avatarClasses}>
|
||||||
<div className="mx_RoomTile_avatar_container">
|
<div className="mx_RoomTile_avatar_container">
|
||||||
<RoomAvatar room={this.props.room} width={24} height={24} />
|
<RoomAvatar room={this.props.room} width={24} height={24} />
|
||||||
|
|
|
@ -60,7 +60,7 @@ module.exports = React.createClass({
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
return (
|
return (
|
||||||
<li data-scroll-token={eventId+"+"+j}>
|
<li data-scroll-tokens={eventId+"+"+j}>
|
||||||
{ret}
|
{ret}
|
||||||
</li>);
|
</li>);
|
||||||
},
|
},
|
||||||
|
|
|
@ -17,6 +17,7 @@ var React = require('react');
|
||||||
var MatrixClientPeg = require("../../../MatrixClientPeg");
|
var MatrixClientPeg = require("../../../MatrixClientPeg");
|
||||||
var Modal = require("../../../Modal");
|
var Modal = require("../../../Modal");
|
||||||
var sdk = require("../../../index");
|
var sdk = require("../../../index");
|
||||||
|
import { _t } from '../../../languageHandler';
|
||||||
var GeminiScrollbar = require('react-gemini-scrollbar');
|
var GeminiScrollbar = require('react-gemini-scrollbar');
|
||||||
|
|
||||||
// A list capable of displaying entities which conform to the SearchableEntity
|
// A list capable of displaying entities which conform to the SearchableEntity
|
||||||
|
@ -25,7 +26,6 @@ var SearchableEntityList = React.createClass({
|
||||||
displayName: 'SearchableEntityList',
|
displayName: 'SearchableEntityList',
|
||||||
|
|
||||||
propTypes: {
|
propTypes: {
|
||||||
searchPlaceholderText: React.PropTypes.string,
|
|
||||||
emptyQueryShowsAll: React.PropTypes.bool,
|
emptyQueryShowsAll: React.PropTypes.bool,
|
||||||
showInputBox: React.PropTypes.bool,
|
showInputBox: React.PropTypes.bool,
|
||||||
onQueryChanged: React.PropTypes.func, // fn(inputText)
|
onQueryChanged: React.PropTypes.func, // fn(inputText)
|
||||||
|
@ -37,7 +37,6 @@ var SearchableEntityList = React.createClass({
|
||||||
getDefaultProps: function() {
|
getDefaultProps: function() {
|
||||||
return {
|
return {
|
||||||
showInputBox: true,
|
showInputBox: true,
|
||||||
searchPlaceholderText: "Search",
|
|
||||||
entities: [],
|
entities: [],
|
||||||
emptyQueryShowsAll: false,
|
emptyQueryShowsAll: false,
|
||||||
onSubmit: function() {},
|
onSubmit: function() {},
|
||||||
|
@ -118,7 +117,9 @@ var SearchableEntityList = React.createClass({
|
||||||
_createOverflowEntity: function(overflowCount, totalCount) {
|
_createOverflowEntity: function(overflowCount, totalCount) {
|
||||||
var EntityTile = sdk.getComponent("rooms.EntityTile");
|
var EntityTile = sdk.getComponent("rooms.EntityTile");
|
||||||
var BaseAvatar = sdk.getComponent("avatars.BaseAvatar");
|
var BaseAvatar = sdk.getComponent("avatars.BaseAvatar");
|
||||||
var text = "and " + overflowCount + " other" + (overflowCount > 1 ? "s" : "") + "...";
|
var text = (overflowCount > 1)
|
||||||
|
? _t("and %(overflowCount)s others...", { overflowCount: overflowCount })
|
||||||
|
: _t("and one other...");
|
||||||
return (
|
return (
|
||||||
<EntityTile className="mx_EntityTile_ellipsis" avatarJsx={
|
<EntityTile className="mx_EntityTile_ellipsis" avatarJsx={
|
||||||
<BaseAvatar url="img/ellipsis.svg" name="..." width={36} height={36} />
|
<BaseAvatar url="img/ellipsis.svg" name="..." width={36} height={36} />
|
||||||
|
@ -137,7 +138,7 @@ var SearchableEntityList = React.createClass({
|
||||||
onChange={this.onQueryChanged} value={this.state.query}
|
onChange={this.onQueryChanged} value={this.state.query}
|
||||||
onFocus= {() => { this.setState({ focused: true }); }}
|
onFocus= {() => { this.setState({ focused: true }); }}
|
||||||
onBlur= {() => { this.setState({ focused: false }); }}
|
onBlur= {() => { this.setState({ focused: false }); }}
|
||||||
placeholder={this.props.searchPlaceholderText} />
|
placeholder={ _t("Search") } />
|
||||||
</form>
|
</form>
|
||||||
);
|
);
|
||||||
}
|
}
|
||||||
|
|
|
@ -19,6 +19,7 @@ limitations under the License.
|
||||||
import React from 'react';
|
import React from 'react';
|
||||||
import dis from '../../../dispatcher';
|
import dis from '../../../dispatcher';
|
||||||
import AccessibleButton from '../elements/AccessibleButton';
|
import AccessibleButton from '../elements/AccessibleButton';
|
||||||
|
import sdk from '../../../index';
|
||||||
|
|
||||||
// cancel button which is shared between room header and simple room header
|
// cancel button which is shared between room header and simple room header
|
||||||
export function CancelButton(props) {
|
export function CancelButton(props) {
|
||||||
|
@ -45,6 +46,9 @@ export default React.createClass({
|
||||||
|
|
||||||
// is the RightPanel collapsed?
|
// is the RightPanel collapsed?
|
||||||
collapsedRhs: React.PropTypes.bool,
|
collapsedRhs: React.PropTypes.bool,
|
||||||
|
|
||||||
|
// `src` to a TintableSvg. Optional.
|
||||||
|
icon: React.PropTypes.string,
|
||||||
},
|
},
|
||||||
|
|
||||||
onShowRhsClick: function(ev) {
|
onShowRhsClick: function(ev) {
|
||||||
|
@ -53,9 +57,17 @@ export default React.createClass({
|
||||||
|
|
||||||
render: function() {
|
render: function() {
|
||||||
let cancelButton;
|
let cancelButton;
|
||||||
|
let icon;
|
||||||
if (this.props.onCancelClick) {
|
if (this.props.onCancelClick) {
|
||||||
cancelButton = <CancelButton onClick={this.props.onCancelClick} />;
|
cancelButton = <CancelButton onClick={this.props.onCancelClick} />;
|
||||||
}
|
}
|
||||||
|
if (this.props.icon) {
|
||||||
|
const TintableSvg = sdk.getComponent('elements.TintableSvg');
|
||||||
|
icon = <TintableSvg
|
||||||
|
className="mx_RoomHeader_icon" src={this.props.icon}
|
||||||
|
width="25" height="25"
|
||||||
|
/>;
|
||||||
|
}
|
||||||
|
|
||||||
let showRhsButton;
|
let showRhsButton;
|
||||||
/* // don't bother cluttering things up with this for now.
|
/* // don't bother cluttering things up with this for now.
|
||||||
|
@ -73,6 +85,7 @@ export default React.createClass({
|
||||||
<div className="mx_RoomHeader" >
|
<div className="mx_RoomHeader" >
|
||||||
<div className="mx_RoomHeader_wrapper">
|
<div className="mx_RoomHeader_wrapper">
|
||||||
<div className="mx_RoomHeader_simpleHeader">
|
<div className="mx_RoomHeader_simpleHeader">
|
||||||
|
{ icon }
|
||||||
{ this.props.title }
|
{ this.props.title }
|
||||||
{ showRhsButton }
|
{ showRhsButton }
|
||||||
{ cancelButton }
|
{ cancelButton }
|
||||||
|
|
|
@ -18,6 +18,7 @@ limitations under the License.
|
||||||
'use strict';
|
'use strict';
|
||||||
|
|
||||||
var React = require('react');
|
var React = require('react');
|
||||||
|
import { _t } from '../../../languageHandler';
|
||||||
var sdk = require('../../../index');
|
var sdk = require('../../../index');
|
||||||
|
|
||||||
module.exports = React.createClass({
|
module.exports = React.createClass({
|
||||||
|
@ -34,11 +35,11 @@ module.exports = React.createClass({
|
||||||
<div className="mx_TopUnreadMessagesBar_scrollUp"
|
<div className="mx_TopUnreadMessagesBar_scrollUp"
|
||||||
onClick={this.props.onScrollUpClick}>
|
onClick={this.props.onScrollUpClick}>
|
||||||
<img src="img/scrollto.svg" width="24" height="24"
|
<img src="img/scrollto.svg" width="24" height="24"
|
||||||
alt="Scroll to unread messages"
|
alt={ _t('Scroll to unread messages') }
|
||||||
title="Scroll to unread messages"/>
|
title={ _t('Scroll to unread messages') }/>
|
||||||
Jump to first unread message.
|
Jump to first unread message.
|
||||||
</div>
|
</div>
|
||||||
<img className="mx_TopUnreadMessagesBar_close"
|
<img className="mx_TopUnreadMessagesBar_close mx_filterFlipColor"
|
||||||
src="img/cancel.svg" width="18" height="18"
|
src="img/cancel.svg" width="18" height="18"
|
||||||
alt="Close" title="Close"
|
alt="Close" title="Close"
|
||||||
onClick={this.props.onCloseClick} />
|
onClick={this.props.onCloseClick} />
|
||||||
|
@ -46,4 +47,3 @@ module.exports = React.createClass({
|
||||||
);
|
);
|
||||||
},
|
},
|
||||||
});
|
});
|
||||||
|
|
||||||
|
|
|
@ -15,13 +15,13 @@ limitations under the License.
|
||||||
*/
|
*/
|
||||||
|
|
||||||
import React from 'react';
|
import React from 'react';
|
||||||
|
import { _t } from '../../../languageHandler';
|
||||||
|
|
||||||
import sdk from '../../../index';
|
import sdk from '../../../index';
|
||||||
import AddThreepid from '../../../AddThreepid';
|
import AddThreepid from '../../../AddThreepid';
|
||||||
import WithMatrixClient from '../../../wrappers/WithMatrixClient';
|
import WithMatrixClient from '../../../wrappers/WithMatrixClient';
|
||||||
import Modal from '../../../Modal';
|
import Modal from '../../../Modal';
|
||||||
|
|
||||||
|
|
||||||
export default WithMatrixClient(React.createClass({
|
export default WithMatrixClient(React.createClass({
|
||||||
displayName: 'AddPhoneNumber',
|
displayName: 'AddPhoneNumber',
|
||||||
|
|
||||||
|
@ -50,7 +50,7 @@ export default WithMatrixClient(React.createClass({
|
||||||
},
|
},
|
||||||
|
|
||||||
_onPhoneCountryChange: function(phoneCountry) {
|
_onPhoneCountryChange: function(phoneCountry) {
|
||||||
this.setState({ phoneCountry: phoneCountry });
|
this.setState({ phoneCountry: phoneCountry.iso2 });
|
||||||
},
|
},
|
||||||
|
|
||||||
_onPhoneNumberChange: function(ev) {
|
_onPhoneNumberChange: function(ev) {
|
||||||
|
@ -83,7 +83,7 @@ export default WithMatrixClient(React.createClass({
|
||||||
console.error("Unable to add phone number: " + err);
|
console.error("Unable to add phone number: " + err);
|
||||||
let msg = err.message;
|
let msg = err.message;
|
||||||
Modal.createDialog(ErrorDialog, {
|
Modal.createDialog(ErrorDialog, {
|
||||||
title: "Error",
|
title: _t("Error"),
|
||||||
description: msg,
|
description: msg,
|
||||||
});
|
});
|
||||||
}).finally(() => {
|
}).finally(() => {
|
||||||
|
@ -98,20 +98,19 @@ export default WithMatrixClient(React.createClass({
|
||||||
if (this._unmounted) return;
|
if (this._unmounted) return;
|
||||||
const TextInputDialog = sdk.getComponent("dialogs.TextInputDialog");
|
const TextInputDialog = sdk.getComponent("dialogs.TextInputDialog");
|
||||||
let msgElements = [
|
let msgElements = [
|
||||||
<div key="_static" >A text message has been sent to +{msisdn}.
|
<div key="_static" >{ _t("A text message has been sent to +%(msisdn)s. Please enter the verification code it contains", { msisdn: msisdn} ) }</div>
|
||||||
Please enter the verification code it contains</div>
|
|
||||||
];
|
];
|
||||||
if (err) {
|
if (err) {
|
||||||
let msg = err.error;
|
let msg = err.error;
|
||||||
if (err.errcode == 'M_THREEPID_AUTH_FAILED') {
|
if (err.errcode == 'M_THREEPID_AUTH_FAILED') {
|
||||||
msg = "Incorrect verification code";
|
msg = _t("Incorrect verification code");
|
||||||
}
|
}
|
||||||
msgElements.push(<div key="_error" className="error">{msg}</div>);
|
msgElements.push(<div key="_error" className="error">{msg}</div>);
|
||||||
}
|
}
|
||||||
Modal.createDialog(TextInputDialog, {
|
Modal.createDialog(TextInputDialog, {
|
||||||
title: "Enter Code",
|
title: _t("Enter Code"),
|
||||||
description: <div>{msgElements}</div>,
|
description: <div>{msgElements}</div>,
|
||||||
button: "Submit",
|
button: _t("Submit"),
|
||||||
onFinished: (should_verify, token) => {
|
onFinished: (should_verify, token) => {
|
||||||
if (!should_verify) {
|
if (!should_verify) {
|
||||||
this._addThreepid = null;
|
this._addThreepid = null;
|
||||||
|
@ -147,17 +146,19 @@ export default WithMatrixClient(React.createClass({
|
||||||
return (
|
return (
|
||||||
<form className="mx_UserSettings_profileTableRow" onSubmit={this._onAddMsisdnSubmit}>
|
<form className="mx_UserSettings_profileTableRow" onSubmit={this._onAddMsisdnSubmit}>
|
||||||
<div className="mx_UserSettings_profileLabelCell">
|
<div className="mx_UserSettings_profileLabelCell">
|
||||||
|
<label>{_t('Phone')}</label>
|
||||||
</div>
|
</div>
|
||||||
<div className="mx_UserSettings_profileInputCell">
|
<div className="mx_UserSettings_profileInputCell">
|
||||||
<div className="mx_Login_phoneSection">
|
<div className="mx_UserSettings_phoneSection">
|
||||||
<CountryDropdown onOptionChange={this._onPhoneCountryChange}
|
<CountryDropdown onOptionChange={this._onPhoneCountryChange}
|
||||||
className="mx_Login_phoneCountry"
|
className="mx_UserSettings_phoneCountry"
|
||||||
value={this.state.phoneCountry}
|
value={this.state.phoneCountry}
|
||||||
|
isSmall={true}
|
||||||
/>
|
/>
|
||||||
<input type="text"
|
<input type="text"
|
||||||
ref={this._collectAddMsisdnInput}
|
ref={this._collectAddMsisdnInput}
|
||||||
className="mx_UserSettings_phoneNumberField"
|
className="mx_UserSettings_phoneNumberField"
|
||||||
placeholder="Add phone number"
|
placeholder={ _t('Add phone number') }
|
||||||
value={this.state.phoneNumber}
|
value={this.state.phoneNumber}
|
||||||
onChange={this._onPhoneNumberChange}
|
onChange={this._onPhoneNumberChange}
|
||||||
/>
|
/>
|
||||||
|
|
|
@ -21,6 +21,7 @@ var MatrixClientPeg = require("../../../MatrixClientPeg");
|
||||||
var Modal = require("../../../Modal");
|
var Modal = require("../../../Modal");
|
||||||
var sdk = require("../../../index");
|
var sdk = require("../../../index");
|
||||||
import AccessibleButton from '../elements/AccessibleButton';
|
import AccessibleButton from '../elements/AccessibleButton';
|
||||||
|
import { _t } from '../../../languageHandler';
|
||||||
|
|
||||||
module.exports = React.createClass({
|
module.exports = React.createClass({
|
||||||
displayName: 'ChangePassword',
|
displayName: 'ChangePassword',
|
||||||
|
@ -47,11 +48,11 @@ module.exports = React.createClass({
|
||||||
onCheckPassword: function(oldPass, newPass, confirmPass) {
|
onCheckPassword: function(oldPass, newPass, confirmPass) {
|
||||||
if (newPass !== confirmPass) {
|
if (newPass !== confirmPass) {
|
||||||
return {
|
return {
|
||||||
error: "New passwords don't match."
|
error: _t("New passwords don't match") + "."
|
||||||
};
|
};
|
||||||
} else if (!newPass || newPass.length === 0) {
|
} else if (!newPass || newPass.length === 0) {
|
||||||
return {
|
return {
|
||||||
error: "Passwords can't be empty"
|
error: _t("Passwords can't be empty")
|
||||||
};
|
};
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
@ -69,19 +70,21 @@ module.exports = React.createClass({
|
||||||
|
|
||||||
var QuestionDialog = sdk.getComponent("dialogs.QuestionDialog");
|
var QuestionDialog = sdk.getComponent("dialogs.QuestionDialog");
|
||||||
Modal.createDialog(QuestionDialog, {
|
Modal.createDialog(QuestionDialog, {
|
||||||
title: "Warning",
|
title: _t("Warning!"),
|
||||||
description:
|
description:
|
||||||
<div>
|
<div>
|
||||||
Changing password will currently reset any end-to-end encryption keys on all devices,
|
{ _t(
|
||||||
making encrypted chat history unreadable, unless you first export your room keys
|
'Changing password will currently reset any end-to-end encryption keys on all devices, ' +
|
||||||
and re-import them afterwards.
|
'making encrypted chat history unreadable, unless you first export your room keys ' +
|
||||||
In future this <a href="https://github.com/vector-im/riot-web/issues/2671">will be improved</a>.
|
'and re-import them afterwards. ' +
|
||||||
|
'In future this will be improved.'
|
||||||
|
) } (<a href="https://github.com/vector-im/riot-web/issues/2671">https://github.com/vector-im/riot-web/issues/2671</a>)
|
||||||
</div>,
|
</div>,
|
||||||
button: "Continue",
|
button: _t("Continue"),
|
||||||
extraButtons: [
|
extraButtons: [
|
||||||
<button className="mx_Dialog_primary"
|
<button className="mx_Dialog_primary"
|
||||||
onClick={this._onExportE2eKeysClicked}>
|
onClick={this._onExportE2eKeysClicked}>
|
||||||
Export E2E room keys
|
{ _t('Export E2E room keys') }
|
||||||
</button>
|
</button>
|
||||||
],
|
],
|
||||||
onFinished: (confirmed) => {
|
onFinished: (confirmed) => {
|
||||||
|
@ -150,7 +153,7 @@ module.exports = React.createClass({
|
||||||
<div className={this.props.className}>
|
<div className={this.props.className}>
|
||||||
<div className={rowClassName}>
|
<div className={rowClassName}>
|
||||||
<div className={rowLabelClassName}>
|
<div className={rowLabelClassName}>
|
||||||
<label htmlFor="passwordold">Current password</label>
|
<label htmlFor="passwordold">{ _t('Current password') }</label>
|
||||||
</div>
|
</div>
|
||||||
<div className={rowInputClassName}>
|
<div className={rowInputClassName}>
|
||||||
<input id="passwordold" type="password" ref="old_input" />
|
<input id="passwordold" type="password" ref="old_input" />
|
||||||
|
@ -158,7 +161,7 @@ module.exports = React.createClass({
|
||||||
</div>
|
</div>
|
||||||
<div className={rowClassName}>
|
<div className={rowClassName}>
|
||||||
<div className={rowLabelClassName}>
|
<div className={rowLabelClassName}>
|
||||||
<label htmlFor="password1">New password</label>
|
<label htmlFor="password1">{ _t('New password') }</label>
|
||||||
</div>
|
</div>
|
||||||
<div className={rowInputClassName}>
|
<div className={rowInputClassName}>
|
||||||
<input id="password1" type="password" ref="new_input" />
|
<input id="password1" type="password" ref="new_input" />
|
||||||
|
@ -166,7 +169,7 @@ module.exports = React.createClass({
|
||||||
</div>
|
</div>
|
||||||
<div className={rowClassName}>
|
<div className={rowClassName}>
|
||||||
<div className={rowLabelClassName}>
|
<div className={rowLabelClassName}>
|
||||||
<label htmlFor="password2">Confirm password</label>
|
<label htmlFor="password2">{ _t('Confirm password') }</label>
|
||||||
</div>
|
</div>
|
||||||
<div className={rowInputClassName}>
|
<div className={rowInputClassName}>
|
||||||
<input id="password2" type="password" ref="confirm_input" />
|
<input id="password2" type="password" ref="confirm_input" />
|
||||||
|
@ -174,7 +177,7 @@ module.exports = React.createClass({
|
||||||
</div>
|
</div>
|
||||||
<AccessibleButton className={buttonClassName}
|
<AccessibleButton className={buttonClassName}
|
||||||
onClick={this.onClickChange}>
|
onClick={this.onClickChange}>
|
||||||
Change Password
|
{ _t('Change Password') }
|
||||||
</AccessibleButton>
|
</AccessibleButton>
|
||||||
</div>
|
</div>
|
||||||
);
|
);
|
||||||
|
|
|
@ -17,6 +17,7 @@ limitations under the License.
|
||||||
import React from 'react';
|
import React from 'react';
|
||||||
|
|
||||||
import sdk from '../../../index';
|
import sdk from '../../../index';
|
||||||
|
import { _t } from '../../../languageHandler';
|
||||||
import MatrixClientPeg from '../../../MatrixClientPeg';
|
import MatrixClientPeg from '../../../MatrixClientPeg';
|
||||||
import Modal from '../../../Modal';
|
import Modal from '../../../Modal';
|
||||||
import DateUtils from '../../../DateUtils';
|
import DateUtils from '../../../DateUtils';
|
||||||
|
@ -48,7 +49,7 @@ export default class DevicesPanelEntry extends React.Component {
|
||||||
display_name: value,
|
display_name: value,
|
||||||
}).catch((e) => {
|
}).catch((e) => {
|
||||||
console.error("Error setting device display name", e);
|
console.error("Error setting device display name", e);
|
||||||
throw new Error("Failed to set display name");
|
throw new Error(_t("Failed to set display name"));
|
||||||
});
|
});
|
||||||
}
|
}
|
||||||
|
|
||||||
|
@ -71,6 +72,7 @@ export default class DevicesPanelEntry extends React.Component {
|
||||||
var InteractiveAuthDialog = sdk.getComponent("dialogs.InteractiveAuthDialog");
|
var InteractiveAuthDialog = sdk.getComponent("dialogs.InteractiveAuthDialog");
|
||||||
|
|
||||||
Modal.createDialog(InteractiveAuthDialog, {
|
Modal.createDialog(InteractiveAuthDialog, {
|
||||||
|
title: _t("Authentication"),
|
||||||
matrixClient: MatrixClientPeg.get(),
|
matrixClient: MatrixClientPeg.get(),
|
||||||
authData: error.data,
|
authData: error.data,
|
||||||
makeRequest: this._makeDeleteRequest,
|
makeRequest: this._makeDeleteRequest,
|
||||||
|
@ -84,7 +86,7 @@ export default class DevicesPanelEntry extends React.Component {
|
||||||
if (this._unmounted) { return; }
|
if (this._unmounted) { return; }
|
||||||
this.setState({
|
this.setState({
|
||||||
deleting: false,
|
deleting: false,
|
||||||
deleteError: "Failed to delete device",
|
deleteError: _t("Failed to delete device"),
|
||||||
});
|
});
|
||||||
}).done();
|
}).done();
|
||||||
}
|
}
|
||||||
|
@ -132,7 +134,7 @@ export default class DevicesPanelEntry extends React.Component {
|
||||||
deleteButton = (
|
deleteButton = (
|
||||||
<div className="mx_textButton"
|
<div className="mx_textButton"
|
||||||
onClick={this._onDeleteClick}>
|
onClick={this._onDeleteClick}>
|
||||||
Delete
|
{ _t("Delete") }
|
||||||
</div>
|
</div>
|
||||||
);
|
);
|
||||||
}
|
}
|
||||||
|
|
|
@ -17,6 +17,7 @@ limitations under the License.
|
||||||
var MatrixClientPeg = require('./MatrixClientPeg');
|
var MatrixClientPeg = require('./MatrixClientPeg');
|
||||||
var Modal = require('./Modal');
|
var Modal = require('./Modal');
|
||||||
var sdk = require('./index');
|
var sdk = require('./index');
|
||||||
|
import { _t } from './languageHandler';
|
||||||
var dis = require("./dispatcher");
|
var dis = require("./dispatcher");
|
||||||
var Rooms = require("./Rooms");
|
var Rooms = require("./Rooms");
|
||||||
|
|
||||||
|
@ -43,8 +44,8 @@ function createRoom(opts) {
|
||||||
if (client.isGuest()) {
|
if (client.isGuest()) {
|
||||||
setTimeout(()=>{
|
setTimeout(()=>{
|
||||||
Modal.createDialog(NeedToRegisterDialog, {
|
Modal.createDialog(NeedToRegisterDialog, {
|
||||||
title: "Please Register",
|
title: _t('Please Register'),
|
||||||
description: "Guest users can't create new rooms. Please register to create room and start a chat."
|
description: _t('Guest users can\'t create new rooms. Please register to create room and start a chat') + '.'
|
||||||
});
|
});
|
||||||
}, 0);
|
}, 0);
|
||||||
return q(null);
|
return q(null);
|
||||||
|
@ -104,8 +105,8 @@ function createRoom(opts) {
|
||||||
}, function(err) {
|
}, function(err) {
|
||||||
console.error("Failed to create room " + roomId + " " + err);
|
console.error("Failed to create room " + roomId + " " + err);
|
||||||
Modal.createDialog(ErrorDialog, {
|
Modal.createDialog(ErrorDialog, {
|
||||||
title: "Failure to create room",
|
title: _t("Failure to create room"),
|
||||||
description: "Server may be unavailable, overloaded, or you hit a bug.",
|
description: _t("Server may be unavailable, overloaded, or you hit a bug") + ".",
|
||||||
});
|
});
|
||||||
return null;
|
return null;
|
||||||
});
|
});
|
||||||
|
|
|
@ -16,13 +16,13 @@ limitations under the License.
|
||||||
|
|
||||||
'use strict';
|
'use strict';
|
||||||
|
|
||||||
var flux = require("flux");
|
const flux = require("flux");
|
||||||
|
|
||||||
class MatrixDispatcher extends flux.Dispatcher {
|
class MatrixDispatcher extends flux.Dispatcher {
|
||||||
/**
|
/**
|
||||||
* @param {Object} payload Required. The payload to dispatch.
|
* @param {Object} payload Required. The payload to dispatch.
|
||||||
* Must contain at least an 'action' key.
|
* Must contain at least an 'action' key.
|
||||||
* @param {boolean} sync Optional. Pass true to dispatch
|
* @param {boolean=} sync Optional. Pass true to dispatch
|
||||||
* synchronously. This is useful for anything triggering
|
* synchronously. This is useful for anything triggering
|
||||||
* an operation that the browser requires user interaction
|
* an operation that the browser requires user interaction
|
||||||
* for.
|
* for.
|
||||||
|
|
Some files were not shown because too many files have changed in this diff Show more
Loading…
Add table
Add a link
Reference in a new issue