diff --git a/raylib/external/web/raylib.js b/raylib/external/web/raylib.js new file mode 100644 index 0000000..9d28ea0 --- /dev/null +++ b/raylib/external/web/raylib.js @@ -0,0 +1,105109 @@ +// The Module object: Our interface to the outside world. We import +// and export values on it, and do the work to get that through +// closure compiler if necessary. There are various ways Module can be used: +// 1. Not defined. We create it here +// 2. A function parameter, function(Module) { ..generated code.. } +// 3. pre-run appended it, var Module = {}; ..generated code.. +// 4. External script tag defines var Module. +// We need to do an eval in order to handle the closure compiler +// case, where this code here is minified but Module was defined +// elsewhere (e.g. case 4 above). We also need to check if Module +// already exists (e.g. case 3 above). +// Note that if you want to run closure, and also to use Module +// after the generated code, you will need to define var Module = {}; +// before the code. Then that object will be used in the code, and you +// can continue to use Module afterwards as well. +var Module; +if (!Module) Module = (typeof Module !== 'undefined' ? Module : null) || {}; + +// Sometimes an existing Module object exists with properties +// meant to overwrite the default module functionality. Here +// we collect those properties and reapply _after_ we configure +// the current environment's defaults to avoid having to be so +// defensive during initialization. +var moduleOverrides = {}; +for (var key in Module) { + if (Module.hasOwnProperty(key)) { + moduleOverrides[key] = Module[key]; + } +} + +// The environment setup code below is customized to use Module. +// *** Environment setup code *** +var ENVIRONMENT_IS_WEB = false; +var ENVIRONMENT_IS_WORKER = false; +var ENVIRONMENT_IS_NODE = false; +var ENVIRONMENT_IS_SHELL = false; + +// Three configurations we can be running in: +// 1) We could be the application main() thread running in the main JS UI thread. (ENVIRONMENT_IS_WORKER == false and ENVIRONMENT_IS_PTHREAD == false) +// 2) We could be the application main() thread proxied to worker. (with Emscripten -s PROXY_TO_WORKER=1) (ENVIRONMENT_IS_WORKER == true, ENVIRONMENT_IS_PTHREAD == false) +// 3) We could be an application pthread running in a worker. (ENVIRONMENT_IS_WORKER == true and ENVIRONMENT_IS_PTHREAD == true) + +if (Module['ENVIRONMENT']) { + if (Module['ENVIRONMENT'] === 'WEB') { + ENVIRONMENT_IS_WEB = true; + } else if (Module['ENVIRONMENT'] === 'WORKER') { + ENVIRONMENT_IS_WORKER = true; + } else if (Module['ENVIRONMENT'] === 'NODE') { + ENVIRONMENT_IS_NODE = true; + } else if (Module['ENVIRONMENT'] === 'SHELL') { + ENVIRONMENT_IS_SHELL = true; + } else { + throw new Error('The provided Module[\'ENVIRONMENT\'] value is not valid. It must be one of: WEB|WORKER|NODE|SHELL.'); + } +} else { + ENVIRONMENT_IS_WEB = typeof window === 'object'; + ENVIRONMENT_IS_WORKER = typeof importScripts === 'function'; + ENVIRONMENT_IS_NODE = typeof process === 'object' && typeof require === 'function' && !ENVIRONMENT_IS_WEB && !ENVIRONMENT_IS_WORKER; + ENVIRONMENT_IS_SHELL = !ENVIRONMENT_IS_WEB && !ENVIRONMENT_IS_NODE && !ENVIRONMENT_IS_WORKER; +} + + +if (ENVIRONMENT_IS_NODE) { + // Expose functionality in the same simple way that the shells work + // Note that we pollute the global namespace here, otherwise we break in node + if (!Module['print']) Module['print'] = console.log; + if (!Module['printErr']) Module['printErr'] = console.warn; + + var nodeFS; + var nodePath; + + Module['read'] = function shell_read(filename, binary) { + if (!nodeFS) nodeFS = require('fs'); + if (!nodePath) nodePath = require('path'); + filename = nodePath['normalize'](filename); + var ret = nodeFS['readFileSync'](filename); + return binary ? ret : ret.toString(); + }; + + Module['readBinary'] = function readBinary(filename) { + var ret = Module['read'](filename, true); + if (!ret.buffer) { + ret = new Uint8Array(ret); + } + assert(ret.buffer); + return ret; + }; + + Module['load'] = function load(f) { + globalEval(read(f)); + }; + + if (!Module['thisProgram']) { + if (process['argv'].length > 1) { + Module['thisProgram'] = process['argv'][1].replace(/\\/g, '/'); + } else { + Module['thisProgram'] = 'unknown-program'; + } + } + + Module['arguments'] = process['argv'].slice(2); + + if (typeof module !== 'undefined') { + module['exports'] = Module; + } + + process['on']('uncaughtException', function(ex) { + // suppress ExitStatus exceptions from showing an error + if (!(ex instanceof ExitStatus)) { + throw ex; + } + }); + + Module['inspect'] = function () { return '[Emscripten Module object]'; }; +} +else if (ENVIRONMENT_IS_SHELL) { + if (!Module['print']) Module['print'] = print; + if (typeof printErr != 'undefined') Module['printErr'] = printErr; // not present in v8 or older sm + + if (typeof read != 'undefined') { + Module['read'] = read; + } else { + Module['read'] = function shell_read() { throw 'no read() available' }; + } + + Module['readBinary'] = function readBinary(f) { + if (typeof readbuffer === 'function') { + return new Uint8Array(readbuffer(f)); + } + var data = read(f, 'binary'); + assert(typeof data === 'object'); + return data; + }; + + if (typeof scriptArgs != 'undefined') { + Module['arguments'] = scriptArgs; + } else if (typeof arguments != 'undefined') { + Module['arguments'] = arguments; + } + + if (typeof quit === 'function') { + Module['quit'] = function(status, toThrow) { + quit(status); + } + } + +} +else if (ENVIRONMENT_IS_WEB || ENVIRONMENT_IS_WORKER) { + Module['read'] = function shell_read(url) { + var xhr = new XMLHttpRequest(); + xhr.open('GET', url, false); + xhr.send(null); + return xhr.responseText; + }; + + if (ENVIRONMENT_IS_WORKER) { + Module['readBinary'] = function readBinary(url) { + var xhr = new XMLHttpRequest(); + xhr.open('GET', url, false); + xhr.responseType = 'arraybuffer'; + xhr.send(null); + return new Uint8Array(xhr.response); + }; + } + + Module['readAsync'] = function readAsync(url, onload, onerror) { + var xhr = new XMLHttpRequest(); + xhr.open('GET', url, true); + xhr.responseType = 'arraybuffer'; + xhr.onload = function xhr_onload() { + if (xhr.status == 200 || (xhr.status == 0 && xhr.response)) { // file URLs can return 0 + onload(xhr.response); + } else { + onerror(); + } + }; + xhr.onerror = onerror; + xhr.send(null); + }; + + if (typeof arguments != 'undefined') { + Module['arguments'] = arguments; + } + + if (typeof console !== 'undefined') { + if (!Module['print']) Module['print'] = function shell_print(x) { + console.log(x); + }; + if (!Module['printErr']) Module['printErr'] = function shell_printErr(x) { + console.warn(x); + }; + } else { + // Probably a worker, and without console.log. We can do very little here... + var TRY_USE_DUMP = false; + if (!Module['print']) Module['print'] = (TRY_USE_DUMP && (typeof(dump) !== "undefined") ? (function(x) { + dump(x); + }) : (function(x) { + // self.postMessage(x); // enable this if you want stdout to be sent as messages + })); + } + + if (ENVIRONMENT_IS_WORKER) { + Module['load'] = importScripts; + } + + if (typeof Module['setWindowTitle'] === 'undefined') { + Module['setWindowTitle'] = function(title) { document.title = title }; + } +} +else { + // Unreachable because SHELL is dependant on the others + throw 'Unknown runtime environment. Where are we?'; +} + +function globalEval(x) { + eval.call(null, x); +} +if (!Module['load'] && Module['read']) { + Module['load'] = function load(f) { + globalEval(Module['read'](f)); + }; +} +if (!Module['print']) { + Module['print'] = function(){}; +} +if (!Module['printErr']) { + Module['printErr'] = Module['print']; +} +if (!Module['arguments']) { + Module['arguments'] = []; +} +if (!Module['thisProgram']) { + Module['thisProgram'] = './this.program'; +} +if (!Module['quit']) { + Module['quit'] = function(status, toThrow) { + throw toThrow; + } +} + +// *** Environment setup code *** + +// Closure helpers +Module.print = Module['print']; +Module.printErr = Module['printErr']; + +// Callbacks +Module['preRun'] = []; +Module['postRun'] = []; + +// Merge back in the overrides +for (var key in moduleOverrides) { + if (moduleOverrides.hasOwnProperty(key)) { + Module[key] = moduleOverrides[key]; + } +} +// Free the object hierarchy contained in the overrides, this lets the GC +// reclaim data used e.g. in memoryInitializerRequest, which is a large typed array. +moduleOverrides = undefined; + + + +// {{PREAMBLE_ADDITIONS}} + +// === Preamble library stuff === + +// Documentation for the public APIs defined in this file must be updated in: +// site/source/docs/api_reference/preamble.js.rst +// A prebuilt local version of the documentation is available at: +// site/build/text/docs/api_reference/preamble.js.txt +// You can also build docs locally as HTML or other formats in site/ +// An online HTML version (which may be of a different version of Emscripten) +// is up at http://kripken.github.io/emscripten-site/docs/api_reference/preamble.js.html + +//======================================== +// Runtime code shared with compiler +//======================================== + +var Runtime = { + setTempRet0: function (value) { + tempRet0 = value; + return value; + }, + getTempRet0: function () { + return tempRet0; + }, + stackSave: function () { + return STACKTOP; + }, + stackRestore: function (stackTop) { + STACKTOP = stackTop; + }, + getNativeTypeSize: function (type) { + switch (type) { + case 'i1': case 'i8': return 1; + case 'i16': return 2; + case 'i32': return 4; + case 'i64': return 8; + case 'float': return 4; + case 'double': return 8; + default: { + if (type[type.length-1] === '*') { + return Runtime.QUANTUM_SIZE; // A pointer + } else if (type[0] === 'i') { + var bits = parseInt(type.substr(1)); + assert(bits % 8 === 0); + return bits/8; + } else { + return 0; + } + } + } + }, + getNativeFieldSize: function (type) { + return Math.max(Runtime.getNativeTypeSize(type), Runtime.QUANTUM_SIZE); + }, + STACK_ALIGN: 16, + prepVararg: function (ptr, type) { + if (type === 'double' || type === 'i64') { + // move so the load is aligned + if (ptr & 7) { + assert((ptr & 7) === 4); + ptr += 4; + } + } else { + assert((ptr & 3) === 0); + } + return ptr; + }, + getAlignSize: function (type, size, vararg) { + // we align i64s and doubles on 64-bit boundaries, unlike x86 + if (!vararg && (type == 'i64' || type == 'double')) return 8; + if (!type) return Math.min(size, 8); // align structures internally to 64 bits + return Math.min(size || (type ? Runtime.getNativeFieldSize(type) : 0), Runtime.QUANTUM_SIZE); + }, + dynCall: function (sig, ptr, args) { + if (args && args.length) { + assert(args.length == sig.length-1); + assert(('dynCall_' + sig) in Module, 'bad function pointer type - no table for sig \'' + sig + '\''); + return Module['dynCall_' + sig].apply(null, [ptr].concat(args)); + } else { + assert(sig.length == 1); + assert(('dynCall_' + sig) in Module, 'bad function pointer type - no table for sig \'' + sig + '\''); + return Module['dynCall_' + sig].call(null, ptr); + } + }, + functionPointers: [], + addFunction: function (func) { + for (var i = 0; i < Runtime.functionPointers.length; i++) { + if (!Runtime.functionPointers[i]) { + Runtime.functionPointers[i] = func; + return 2*(1 + i); + } + } + throw 'Finished up all reserved function pointers. Use a higher value for RESERVED_FUNCTION_POINTERS.'; + }, + removeFunction: function (index) { + Runtime.functionPointers[(index-2)/2] = null; + }, + warnOnce: function (text) { + if (!Runtime.warnOnce.shown) Runtime.warnOnce.shown = {}; + if (!Runtime.warnOnce.shown[text]) { + Runtime.warnOnce.shown[text] = 1; + Module.printErr(text); + } + }, + funcWrappers: {}, + getFuncWrapper: function (func, sig) { + if (!func) return; // on null pointer, return undefined + assert(sig); + if (!Runtime.funcWrappers[sig]) { + Runtime.funcWrappers[sig] = {}; + } + var sigCache = Runtime.funcWrappers[sig]; + if (!sigCache[func]) { + // optimize away arguments usage in common cases + if (sig.length === 1) { + sigCache[func] = function dynCall_wrapper() { + return Runtime.dynCall(sig, func); + }; + } else if (sig.length === 2) { + sigCache[func] = function dynCall_wrapper(arg) { + return Runtime.dynCall(sig, func, [arg]); + }; + } else { + // general case + sigCache[func] = function dynCall_wrapper() { + return Runtime.dynCall(sig, func, Array.prototype.slice.call(arguments)); + }; + } + } + return sigCache[func]; + }, + getCompilerSetting: function (name) { + throw 'You must build with -s RETAIN_COMPILER_SETTINGS=1 for Runtime.getCompilerSetting or emscripten_get_compiler_setting to work'; + }, + stackAlloc: function (size) { var ret = STACKTOP;STACKTOP = (STACKTOP + size)|0;STACKTOP = (((STACKTOP)+15)&-16);(assert((((STACKTOP|0) < (STACK_MAX|0))|0))|0); return ret; }, + staticAlloc: function (size) { var ret = STATICTOP;STATICTOP = (STATICTOP + (assert(!staticSealed),size))|0;STATICTOP = (((STATICTOP)+15)&-16); return ret; }, + dynamicAlloc: function (size) { assert(DYNAMICTOP_PTR);var ret = HEAP32[DYNAMICTOP_PTR>>2];var end = (((ret + size + 15)|0) & -16);HEAP32[DYNAMICTOP_PTR>>2] = end;if (end >= TOTAL_MEMORY) {var success = enlargeMemory();if (!success) {HEAP32[DYNAMICTOP_PTR>>2] = ret;return 0;}}return ret;}, + alignMemory: function (size,quantum) { var ret = size = Math.ceil((size)/(quantum ? quantum : 16))*(quantum ? quantum : 16); return ret; }, + makeBigInt: function (low,high,unsigned) { var ret = (unsigned ? ((+((low>>>0)))+((+((high>>>0)))*4294967296.0)) : ((+((low>>>0)))+((+((high|0)))*4294967296.0))); return ret; }, + GLOBAL_BASE: 8, + QUANTUM_SIZE: 4, + __dummy__: 0 +} + + + +Module["Runtime"] = Runtime; + + + +//======================================== +// Runtime essentials +//======================================== + +var ABORT = 0; // whether we are quitting the application. no code should run after this. set in exit() and abort() +var EXITSTATUS = 0; + +/** @type {function(*, string=)} */ +function assert(condition, text) { + if (!condition) { + abort('Assertion failed: ' + text); + } +} + +var globalScope = this; + +// Returns the C function with a specified identifier (for C++, you need to do manual name mangling) +function getCFunc(ident) { + var func = Module['_' + ident]; // closure exported function + if (!func) { + try { func = eval('_' + ident); } catch(e) {} + } + assert(func, 'Cannot call unknown function ' + ident + ' (perhaps LLVM optimizations or closure removed it?)'); + return func; +} + +var cwrap, ccall; +(function(){ + var JSfuncs = { + // Helpers for cwrap -- it can't refer to Runtime directly because it might + // be renamed by closure, instead it calls JSfuncs['stackSave'].body to find + // out what the minified function name is. + 'stackSave': function() { + Runtime.stackSave() + }, + 'stackRestore': function() { + Runtime.stackRestore() + }, + // type conversion from js to c + 'arrayToC' : function(arr) { + var ret = Runtime.stackAlloc(arr.length); + writeArrayToMemory(arr, ret); + return ret; + }, + 'stringToC' : function(str) { + var ret = 0; + if (str !== null && str !== undefined && str !== 0) { // null string + // at most 4 bytes per UTF-8 code point, +1 for the trailing '\0' + var len = (str.length << 2) + 1; + ret = Runtime.stackAlloc(len); + stringToUTF8(str, ret, len); + } + return ret; + } + }; + // For fast lookup of conversion functions + var toC = {'string' : JSfuncs['stringToC'], 'array' : JSfuncs['arrayToC']}; + + // C calling interface. + ccall = function ccallFunc(ident, returnType, argTypes, args, opts) { + var func = getCFunc(ident); + var cArgs = []; + var stack = 0; + assert(returnType !== 'array', 'Return type should not be "array".'); + if (args) { + for (var i = 0; i < args.length; i++) { + var converter = toC[argTypes[i]]; + if (converter) { + if (stack === 0) stack = Runtime.stackSave(); + cArgs[i] = converter(args[i]); + } else { + cArgs[i] = args[i]; + } + } + } + var ret = func.apply(null, cArgs); + if ((!opts || !opts.async) && typeof EmterpreterAsync === 'object') { + assert(!EmterpreterAsync.state, 'cannot start async op with normal JS calling ccall'); + } + if (opts && opts.async) assert(!returnType, 'async ccalls cannot return values'); + if (returnType === 'string') ret = Pointer_stringify(ret); + if (stack !== 0) { + if (opts && opts.async) { + EmterpreterAsync.asyncFinalizers.push(function() { + Runtime.stackRestore(stack); + }); + return; + } + Runtime.stackRestore(stack); + } + return ret; + } + + var sourceRegex = /^function\s*[a-zA-Z$_0-9]*\s*\(([^)]*)\)\s*{\s*([^*]*?)[\s;]*(?:return\s*(.*?)[;\s]*)?}$/; + function parseJSFunc(jsfunc) { + // Match the body and the return value of a javascript function source + var parsed = jsfunc.toString().match(sourceRegex).slice(1); + return {arguments : parsed[0], body : parsed[1], returnValue: parsed[2]} + } + + // sources of useful functions. we create this lazily as it can trigger a source decompression on this entire file + var JSsource = null; + function ensureJSsource() { + if (!JSsource) { + JSsource = {}; + for (var fun in JSfuncs) { + if (JSfuncs.hasOwnProperty(fun)) { + // Elements of toCsource are arrays of three items: + // the code, and the return value + JSsource[fun] = parseJSFunc(JSfuncs[fun]); + } + } + } + } + + cwrap = function cwrap(ident, returnType, argTypes) { + argTypes = argTypes || []; + var cfunc = getCFunc(ident); + // When the function takes numbers and returns a number, we can just return + // the original function + var numericArgs = argTypes.every(function(type){ return type === 'number'}); + var numericRet = (returnType !== 'string'); + if ( numericRet && numericArgs) { + return cfunc; + } + // Creation of the arguments list (["$1","$2",...,"$nargs"]) + var argNames = argTypes.map(function(x,i){return '$'+i}); + var funcstr = "(function(" + argNames.join(',') + ") {"; + var nargs = argTypes.length; + if (!numericArgs) { + // Generate the code needed to convert the arguments from javascript + // values to pointers + ensureJSsource(); + funcstr += 'var stack = ' + JSsource['stackSave'].body + ';'; + for (var i = 0; i < nargs; i++) { + var arg = argNames[i], type = argTypes[i]; + if (type === 'number') continue; + var convertCode = JSsource[type + 'ToC']; // [code, return] + funcstr += 'var ' + convertCode.arguments + ' = ' + arg + ';'; + funcstr += convertCode.body + ';'; + funcstr += arg + '=(' + convertCode.returnValue + ');'; + } + } + + // When the code is compressed, the name of cfunc is not literally 'cfunc' anymore + var cfuncname = parseJSFunc(function(){return cfunc}).returnValue; + // Call the function + funcstr += 'var ret = ' + cfuncname + '(' + argNames.join(',') + ');'; + if (!numericRet) { // Return type can only by 'string' or 'number' + // Convert the result to a string + var strgfy = parseJSFunc(function(){return Pointer_stringify}).returnValue; + funcstr += 'ret = ' + strgfy + '(ret);'; + } + funcstr += "if (typeof EmterpreterAsync === 'object') { assert(!EmterpreterAsync.state, 'cannot start async op with normal JS calling cwrap') }"; + if (!numericArgs) { + // If we had a stack, restore it + ensureJSsource(); + funcstr += JSsource['stackRestore'].body.replace('()', '(stack)') + ';'; + } + funcstr += 'return ret})'; + return eval(funcstr); + }; +})(); +Module["ccall"] = ccall; +Module["cwrap"] = cwrap; + +/** @type {function(number, number, string, boolean=)} */ +function setValue(ptr, value, type, noSafe) { + type = type || 'i8'; + if (type.charAt(type.length-1) === '*') type = 'i32'; // pointers are 32-bit + switch(type) { + case 'i1': HEAP8[((ptr)>>0)]=value; break; + case 'i8': HEAP8[((ptr)>>0)]=value; break; + case 'i16': HEAP16[((ptr)>>1)]=value; break; + case 'i32': HEAP32[((ptr)>>2)]=value; break; + case 'i64': (tempI64 = [value>>>0,(tempDouble=value,(+(Math_abs(tempDouble))) >= 1.0 ? (tempDouble > 0.0 ? ((Math_min((+(Math_floor((tempDouble)/4294967296.0))), 4294967295.0))|0)>>>0 : (~~((+(Math_ceil((tempDouble - +(((~~(tempDouble)))>>>0))/4294967296.0)))))>>>0) : 0)],HEAP32[((ptr)>>2)]=tempI64[0],HEAP32[(((ptr)+(4))>>2)]=tempI64[1]); break; + case 'float': HEAPF32[((ptr)>>2)]=value; break; + case 'double': HEAPF64[((ptr)>>3)]=value; break; + default: abort('invalid type for setValue: ' + type); + } +} +Module["setValue"] = setValue; + +/** @type {function(number, string, boolean=)} */ +function getValue(ptr, type, noSafe) { + type = type || 'i8'; + if (type.charAt(type.length-1) === '*') type = 'i32'; // pointers are 32-bit + switch(type) { + case 'i1': return HEAP8[((ptr)>>0)]; + case 'i8': return HEAP8[((ptr)>>0)]; + case 'i16': return HEAP16[((ptr)>>1)]; + case 'i32': return HEAP32[((ptr)>>2)]; + case 'i64': return HEAP32[((ptr)>>2)]; + case 'float': return HEAPF32[((ptr)>>2)]; + case 'double': return HEAPF64[((ptr)>>3)]; + default: abort('invalid type for setValue: ' + type); + } + return null; +} +Module["getValue"] = getValue; + +var ALLOC_NORMAL = 0; // Tries to use _malloc() +var ALLOC_STACK = 1; // Lives for the duration of the current function call +var ALLOC_STATIC = 2; // Cannot be freed +var ALLOC_DYNAMIC = 3; // Cannot be freed except through sbrk +var ALLOC_NONE = 4; // Do not allocate +Module["ALLOC_NORMAL"] = ALLOC_NORMAL; +Module["ALLOC_STACK"] = ALLOC_STACK; +Module["ALLOC_STATIC"] = ALLOC_STATIC; +Module["ALLOC_DYNAMIC"] = ALLOC_DYNAMIC; +Module["ALLOC_NONE"] = ALLOC_NONE; + +// allocate(): This is for internal use. You can use it yourself as well, but the interface +// is a little tricky (see docs right below). The reason is that it is optimized +// for multiple syntaxes to save space in generated code. So you should +// normally not use allocate(), and instead allocate memory using _malloc(), +// initialize it with setValue(), and so forth. +// @slab: An array of data, or a number. If a number, then the size of the block to allocate, +// in *bytes* (note that this is sometimes confusing: the next parameter does not +// affect this!) +// @types: Either an array of types, one for each byte (or 0 if no type at that position), +// or a single type which is used for the entire block. This only matters if there +// is initial data - if @slab is a number, then this does not matter at all and is +// ignored. +// @allocator: How to allocate memory, see ALLOC_* +/** @type {function((TypedArray|Array|number), string, number, number=)} */ +function allocate(slab, types, allocator, ptr) { + var zeroinit, size; + if (typeof slab === 'number') { + zeroinit = true; + size = slab; + } else { + zeroinit = false; + size = slab.length; + } + + var singleType = typeof types === 'string' ? types : null; + + var ret; + if (allocator == ALLOC_NONE) { + ret = ptr; + } else { + ret = [typeof _malloc === 'function' ? _malloc : Runtime.staticAlloc, Runtime.stackAlloc, Runtime.staticAlloc, Runtime.dynamicAlloc][allocator === undefined ? ALLOC_STATIC : allocator](Math.max(size, singleType ? 1 : types.length)); + } + + if (zeroinit) { + var ptr = ret, stop; + assert((ret & 3) == 0); + stop = ret + (size & ~3); + for (; ptr < stop; ptr += 4) { + HEAP32[((ptr)>>2)]=0; + } + stop = ret + size; + while (ptr < stop) { + HEAP8[((ptr++)>>0)]=0; + } + return ret; + } + + if (singleType === 'i8') { + if (slab.subarray || slab.slice) { + HEAPU8.set(/** @type {!Uint8Array} */ (slab), ret); + } else { + HEAPU8.set(new Uint8Array(slab), ret); + } + return ret; + } + + var i = 0, type, typeSize, previousType; + while (i < size) { + var curr = slab[i]; + + if (typeof curr === 'function') { + curr = Runtime.getFunctionIndex(curr); + } + + type = singleType || types[i]; + if (type === 0) { + i++; + continue; + } + assert(type, 'Must know what type to store in allocate!'); + + if (type == 'i64') type = 'i32'; // special case: we have one i32 here, and one i32 later + + setValue(ret+i, curr, type); + + // no need to look up size unless type changes, so cache it + if (previousType !== type) { + typeSize = Runtime.getNativeTypeSize(type); + previousType = type; + } + i += typeSize; + } + + return ret; +} +Module["allocate"] = allocate; + +// Allocate memory during any stage of startup - static memory early on, dynamic memory later, malloc when ready +function getMemory(size) { + if (!staticSealed) return Runtime.staticAlloc(size); + if (!runtimeInitialized) return Runtime.dynamicAlloc(size); + return _malloc(size); +} +Module["getMemory"] = getMemory; + +/** @type {function(number, number=)} */ +function Pointer_stringify(ptr, length) { + if (length === 0 || !ptr) return ''; + // TODO: use TextDecoder + // Find the length, and check for UTF while doing so + var hasUtf = 0; + var t; + var i = 0; + while (1) { + assert(ptr + i < TOTAL_MEMORY); + t = HEAPU8[(((ptr)+(i))>>0)]; + hasUtf |= t; + if (t == 0 && !length) break; + i++; + if (length && i == length) break; + } + if (!length) length = i; + + var ret = ''; + + if (hasUtf < 128) { + var MAX_CHUNK = 1024; // split up into chunks, because .apply on a huge string can overflow the stack + var curr; + while (length > 0) { + curr = String.fromCharCode.apply(String, HEAPU8.subarray(ptr, ptr + Math.min(length, MAX_CHUNK))); + ret = ret ? ret + curr : curr; + ptr += MAX_CHUNK; + length -= MAX_CHUNK; + } + return ret; + } + return Module['UTF8ToString'](ptr); +} +Module["Pointer_stringify"] = Pointer_stringify; + +// Given a pointer 'ptr' to a null-terminated ASCII-encoded string in the emscripten HEAP, returns +// a copy of that string as a Javascript String object. + +function AsciiToString(ptr) { + var str = ''; + while (1) { + var ch = HEAP8[((ptr++)>>0)]; + if (!ch) return str; + str += String.fromCharCode(ch); + } +} +Module["AsciiToString"] = AsciiToString; + +// Copies the given Javascript String object 'str' to the emscripten HEAP at address 'outPtr', +// null-terminated and encoded in ASCII form. The copy will require at most str.length+1 bytes of space in the HEAP. + +function stringToAscii(str, outPtr) { + return writeAsciiToMemory(str, outPtr, false); +} +Module["stringToAscii"] = stringToAscii; + +// Given a pointer 'ptr' to a null-terminated UTF8-encoded string in the given array that contains uint8 values, returns +// a copy of that string as a Javascript String object. + +var UTF8Decoder = typeof TextDecoder !== 'undefined' ? new TextDecoder('utf8') : undefined; +function UTF8ArrayToString(u8Array, idx) { + var endPtr = idx; + // TextDecoder needs to know the byte length in advance, it doesn't stop on null terminator by itself. + // Also, use the length info to avoid running tiny strings through TextDecoder, since .subarray() allocates garbage. + while (u8Array[endPtr]) ++endPtr; + + if (endPtr - idx > 16 && u8Array.subarray && UTF8Decoder) { + return UTF8Decoder.decode(u8Array.subarray(idx, endPtr)); + } else { + var u0, u1, u2, u3, u4, u5; + + var str = ''; + while (1) { + // For UTF8 byte structure, see http://en.wikipedia.org/wiki/UTF-8#Description and https://www.ietf.org/rfc/rfc2279.txt and https://tools.ietf.org/html/rfc3629 + u0 = u8Array[idx++]; + if (!u0) return str; + if (!(u0 & 0x80)) { str += String.fromCharCode(u0); continue; } + u1 = u8Array[idx++] & 63; + if ((u0 & 0xE0) == 0xC0) { str += String.fromCharCode(((u0 & 31) << 6) | u1); continue; } + u2 = u8Array[idx++] & 63; + if ((u0 & 0xF0) == 0xE0) { + u0 = ((u0 & 15) << 12) | (u1 << 6) | u2; + } else { + u3 = u8Array[idx++] & 63; + if ((u0 & 0xF8) == 0xF0) { + u0 = ((u0 & 7) << 18) | (u1 << 12) | (u2 << 6) | u3; + } else { + u4 = u8Array[idx++] & 63; + if ((u0 & 0xFC) == 0xF8) { + u0 = ((u0 & 3) << 24) | (u1 << 18) | (u2 << 12) | (u3 << 6) | u4; + } else { + u5 = u8Array[idx++] & 63; + u0 = ((u0 & 1) << 30) | (u1 << 24) | (u2 << 18) | (u3 << 12) | (u4 << 6) | u5; + } + } + } + if (u0 < 0x10000) { + str += String.fromCharCode(u0); + } else { + var ch = u0 - 0x10000; + str += String.fromCharCode(0xD800 | (ch >> 10), 0xDC00 | (ch & 0x3FF)); + } + } + } +} +Module["UTF8ArrayToString"] = UTF8ArrayToString; + +// Given a pointer 'ptr' to a null-terminated UTF8-encoded string in the emscripten HEAP, returns +// a copy of that string as a Javascript String object. + +function UTF8ToString(ptr) { + return UTF8ArrayToString(HEAPU8,ptr); +} +Module["UTF8ToString"] = UTF8ToString; + +// Copies the given Javascript String object 'str' to the given byte array at address 'outIdx', +// encoded in UTF8 form and null-terminated. The copy will require at most str.length*4+1 bytes of space in the HEAP. +// Use the function lengthBytesUTF8 to compute the exact number of bytes (excluding null terminator) that this function will write. +// Parameters: +// str: the Javascript string to copy. +// outU8Array: the array to copy to. Each index in this array is assumed to be one 8-byte element. +// outIdx: The starting offset in the array to begin the copying. +// maxBytesToWrite: The maximum number of bytes this function can write to the array. This count should include the null +// terminator, i.e. if maxBytesToWrite=1, only the null terminator will be written and nothing else. +// maxBytesToWrite=0 does not write any bytes to the output, not even the null terminator. +// Returns the number of bytes written, EXCLUDING the null terminator. + +function stringToUTF8Array(str, outU8Array, outIdx, maxBytesToWrite) { + if (!(maxBytesToWrite > 0)) // Parameter maxBytesToWrite is not optional. Negative values, 0, null, undefined and false each don't write out any bytes. + return 0; + + var startIdx = outIdx; + var endIdx = outIdx + maxBytesToWrite - 1; // -1 for string null terminator. + for (var i = 0; i < str.length; ++i) { + // Gotcha: charCodeAt returns a 16-bit word that is a UTF-16 encoded code unit, not a Unicode code point of the character! So decode UTF16->UTF32->UTF8. + // See http://unicode.org/faq/utf_bom.html#utf16-3 + // For UTF8 byte structure, see http://en.wikipedia.org/wiki/UTF-8#Description and https://www.ietf.org/rfc/rfc2279.txt and https://tools.ietf.org/html/rfc3629 + var u = str.charCodeAt(i); // possibly a lead surrogate + if (u >= 0xD800 && u <= 0xDFFF) u = 0x10000 + ((u & 0x3FF) << 10) | (str.charCodeAt(++i) & 0x3FF); + if (u <= 0x7F) { + if (outIdx >= endIdx) break; + outU8Array[outIdx++] = u; + } else if (u <= 0x7FF) { + if (outIdx + 1 >= endIdx) break; + outU8Array[outIdx++] = 0xC0 | (u >> 6); + outU8Array[outIdx++] = 0x80 | (u & 63); + } else if (u <= 0xFFFF) { + if (outIdx + 2 >= endIdx) break; + outU8Array[outIdx++] = 0xE0 | (u >> 12); + outU8Array[outIdx++] = 0x80 | ((u >> 6) & 63); + outU8Array[outIdx++] = 0x80 | (u & 63); + } else if (u <= 0x1FFFFF) { + if (outIdx + 3 >= endIdx) break; + outU8Array[outIdx++] = 0xF0 | (u >> 18); + outU8Array[outIdx++] = 0x80 | ((u >> 12) & 63); + outU8Array[outIdx++] = 0x80 | ((u >> 6) & 63); + outU8Array[outIdx++] = 0x80 | (u & 63); + } else if (u <= 0x3FFFFFF) { + if (outIdx + 4 >= endIdx) break; + outU8Array[outIdx++] = 0xF8 | (u >> 24); + outU8Array[outIdx++] = 0x80 | ((u >> 18) & 63); + outU8Array[outIdx++] = 0x80 | ((u >> 12) & 63); + outU8Array[outIdx++] = 0x80 | ((u >> 6) & 63); + outU8Array[outIdx++] = 0x80 | (u & 63); + } else { + if (outIdx + 5 >= endIdx) break; + outU8Array[outIdx++] = 0xFC | (u >> 30); + outU8Array[outIdx++] = 0x80 | ((u >> 24) & 63); + outU8Array[outIdx++] = 0x80 | ((u >> 18) & 63); + outU8Array[outIdx++] = 0x80 | ((u >> 12) & 63); + outU8Array[outIdx++] = 0x80 | ((u >> 6) & 63); + outU8Array[outIdx++] = 0x80 | (u & 63); + } + } + // Null-terminate the pointer to the buffer. + outU8Array[outIdx] = 0; + return outIdx - startIdx; +} +Module["stringToUTF8Array"] = stringToUTF8Array; + +// Copies the given Javascript String object 'str' to the emscripten HEAP at address 'outPtr', +// null-terminated and encoded in UTF8 form. The copy will require at most str.length*4+1 bytes of space in the HEAP. +// Use the function lengthBytesUTF8 to compute the exact number of bytes (excluding null terminator) that this function will write. +// Returns the number of bytes written, EXCLUDING the null terminator. + +function stringToUTF8(str, outPtr, maxBytesToWrite) { + assert(typeof maxBytesToWrite == 'number', 'stringToUTF8(str, outPtr, maxBytesToWrite) is missing the third parameter that specifies the length of the output buffer!'); + return stringToUTF8Array(str, HEAPU8,outPtr, maxBytesToWrite); +} +Module["stringToUTF8"] = stringToUTF8; + +// Returns the number of bytes the given Javascript string takes if encoded as a UTF8 byte array, EXCLUDING the null terminator byte. + +function lengthBytesUTF8(str) { + var len = 0; + for (var i = 0; i < str.length; ++i) { + // Gotcha: charCodeAt returns a 16-bit word that is a UTF-16 encoded code unit, not a Unicode code point of the character! So decode UTF16->UTF32->UTF8. + // See http://unicode.org/faq/utf_bom.html#utf16-3 + var u = str.charCodeAt(i); // possibly a lead surrogate + if (u >= 0xD800 && u <= 0xDFFF) u = 0x10000 + ((u & 0x3FF) << 10) | (str.charCodeAt(++i) & 0x3FF); + if (u <= 0x7F) { + ++len; + } else if (u <= 0x7FF) { + len += 2; + } else if (u <= 0xFFFF) { + len += 3; + } else if (u <= 0x1FFFFF) { + len += 4; + } else if (u <= 0x3FFFFFF) { + len += 5; + } else { + len += 6; + } + } + return len; +} +Module["lengthBytesUTF8"] = lengthBytesUTF8; + +// Given a pointer 'ptr' to a null-terminated UTF16LE-encoded string in the emscripten HEAP, returns +// a copy of that string as a Javascript String object. + +var UTF16Decoder = typeof TextDecoder !== 'undefined' ? new TextDecoder('utf-16le') : undefined; +function UTF16ToString(ptr) { + assert(ptr % 2 == 0, 'Pointer passed to UTF16ToString must be aligned to two bytes!'); + var endPtr = ptr; + // TextDecoder needs to know the byte length in advance, it doesn't stop on null terminator by itself. + // Also, use the length info to avoid running tiny strings through TextDecoder, since .subarray() allocates garbage. + var idx = endPtr >> 1; + while (HEAP16[idx]) ++idx; + endPtr = idx << 1; + + if (endPtr - ptr > 32 && UTF16Decoder) { + return UTF16Decoder.decode(HEAPU8.subarray(ptr, endPtr)); + } else { + var i = 0; + + var str = ''; + while (1) { + var codeUnit = HEAP16[(((ptr)+(i*2))>>1)]; + if (codeUnit == 0) return str; + ++i; + // fromCharCode constructs a character from a UTF-16 code unit, so we can pass the UTF16 string right through. + str += String.fromCharCode(codeUnit); + } + } +} + + +// Copies the given Javascript String object 'str' to the emscripten HEAP at address 'outPtr', +// null-terminated and encoded in UTF16 form. The copy will require at most str.length*4+2 bytes of space in the HEAP. +// Use the function lengthBytesUTF16() to compute the exact number of bytes (excluding null terminator) that this function will write. +// Parameters: +// str: the Javascript string to copy. +// outPtr: Byte address in Emscripten HEAP where to write the string to. +// maxBytesToWrite: The maximum number of bytes this function can write to the array. This count should include the null +// terminator, i.e. if maxBytesToWrite=2, only the null terminator will be written and nothing else. +// maxBytesToWrite<2 does not write any bytes to the output, not even the null terminator. +// Returns the number of bytes written, EXCLUDING the null terminator. + +function stringToUTF16(str, outPtr, maxBytesToWrite) { + assert(outPtr % 2 == 0, 'Pointer passed to stringToUTF16 must be aligned to two bytes!'); + assert(typeof maxBytesToWrite == 'number', 'stringToUTF16(str, outPtr, maxBytesToWrite) is missing the third parameter that specifies the length of the output buffer!'); + // Backwards compatibility: if max bytes is not specified, assume unsafe unbounded write is allowed. + if (maxBytesToWrite === undefined) { + maxBytesToWrite = 0x7FFFFFFF; + } + if (maxBytesToWrite < 2) return 0; + maxBytesToWrite -= 2; // Null terminator. + var startPtr = outPtr; + var numCharsToWrite = (maxBytesToWrite < str.length*2) ? (maxBytesToWrite / 2) : str.length; + for (var i = 0; i < numCharsToWrite; ++i) { + // charCodeAt returns a UTF-16 encoded code unit, so it can be directly written to the HEAP. + var codeUnit = str.charCodeAt(i); // possibly a lead surrogate + HEAP16[((outPtr)>>1)]=codeUnit; + outPtr += 2; + } + // Null-terminate the pointer to the HEAP. + HEAP16[((outPtr)>>1)]=0; + return outPtr - startPtr; +} + + +// Returns the number of bytes the given Javascript string takes if encoded as a UTF16 byte array, EXCLUDING the null terminator byte. + +function lengthBytesUTF16(str) { + return str.length*2; +} + + +function UTF32ToString(ptr) { + assert(ptr % 4 == 0, 'Pointer passed to UTF32ToString must be aligned to four bytes!'); + var i = 0; + + var str = ''; + while (1) { + var utf32 = HEAP32[(((ptr)+(i*4))>>2)]; + if (utf32 == 0) + return str; + ++i; + // Gotcha: fromCharCode constructs a character from a UTF-16 encoded code (pair), not from a Unicode code point! So encode the code point to UTF-16 for constructing. + // See http://unicode.org/faq/utf_bom.html#utf16-3 + if (utf32 >= 0x10000) { + var ch = utf32 - 0x10000; + str += String.fromCharCode(0xD800 | (ch >> 10), 0xDC00 | (ch & 0x3FF)); + } else { + str += String.fromCharCode(utf32); + } + } +} + + +// Copies the given Javascript String object 'str' to the emscripten HEAP at address 'outPtr', +// null-terminated and encoded in UTF32 form. The copy will require at most str.length*4+4 bytes of space in the HEAP. +// Use the function lengthBytesUTF32() to compute the exact number of bytes (excluding null terminator) that this function will write. +// Parameters: +// str: the Javascript string to copy. +// outPtr: Byte address in Emscripten HEAP where to write the string to. +// maxBytesToWrite: The maximum number of bytes this function can write to the array. This count should include the null +// terminator, i.e. if maxBytesToWrite=4, only the null terminator will be written and nothing else. +// maxBytesToWrite<4 does not write any bytes to the output, not even the null terminator. +// Returns the number of bytes written, EXCLUDING the null terminator. + +function stringToUTF32(str, outPtr, maxBytesToWrite) { + assert(outPtr % 4 == 0, 'Pointer passed to stringToUTF32 must be aligned to four bytes!'); + assert(typeof maxBytesToWrite == 'number', 'stringToUTF32(str, outPtr, maxBytesToWrite) is missing the third parameter that specifies the length of the output buffer!'); + // Backwards compatibility: if max bytes is not specified, assume unsafe unbounded write is allowed. + if (maxBytesToWrite === undefined) { + maxBytesToWrite = 0x7FFFFFFF; + } + if (maxBytesToWrite < 4) return 0; + var startPtr = outPtr; + var endPtr = startPtr + maxBytesToWrite - 4; + for (var i = 0; i < str.length; ++i) { + // Gotcha: charCodeAt returns a 16-bit word that is a UTF-16 encoded code unit, not a Unicode code point of the character! We must decode the string to UTF-32 to the heap. + // See http://unicode.org/faq/utf_bom.html#utf16-3 + var codeUnit = str.charCodeAt(i); // possibly a lead surrogate + if (codeUnit >= 0xD800 && codeUnit <= 0xDFFF) { + var trailSurrogate = str.charCodeAt(++i); + codeUnit = 0x10000 + ((codeUnit & 0x3FF) << 10) | (trailSurrogate & 0x3FF); + } + HEAP32[((outPtr)>>2)]=codeUnit; + outPtr += 4; + if (outPtr + 4 > endPtr) break; + } + // Null-terminate the pointer to the HEAP. + HEAP32[((outPtr)>>2)]=0; + return outPtr - startPtr; +} + + +// Returns the number of bytes the given Javascript string takes if encoded as a UTF16 byte array, EXCLUDING the null terminator byte. + +function lengthBytesUTF32(str) { + var len = 0; + for (var i = 0; i < str.length; ++i) { + // Gotcha: charCodeAt returns a 16-bit word that is a UTF-16 encoded code unit, not a Unicode code point of the character! We must decode the string to UTF-32 to the heap. + // See http://unicode.org/faq/utf_bom.html#utf16-3 + var codeUnit = str.charCodeAt(i); + if (codeUnit >= 0xD800 && codeUnit <= 0xDFFF) ++i; // possibly a lead surrogate, so skip over the tail surrogate. + len += 4; + } + + return len; +} + + +function demangle(func) { + var __cxa_demangle_func = Module['___cxa_demangle'] || Module['__cxa_demangle']; + if (__cxa_demangle_func) { + try { + var s = + func.substr(1); + var len = lengthBytesUTF8(s)+1; + var buf = _malloc(len); + stringToUTF8(s, buf, len); + var status = _malloc(4); + var ret = __cxa_demangle_func(buf, 0, 0, status); + if (getValue(status, 'i32') === 0 && ret) { + return Pointer_stringify(ret); + } + // otherwise, libcxxabi failed + } catch(e) { + // ignore problems here + } finally { + if (buf) _free(buf); + if (status) _free(status); + if (ret) _free(ret); + } + // failure when using libcxxabi, don't demangle + return func; + } + Runtime.warnOnce('warning: build with -s DEMANGLE_SUPPORT=1 to link in libcxxabi demangling'); + return func; +} + +function demangleAll(text) { + var regex = + /__Z[\w\d_]+/g; + return text.replace(regex, + function(x) { + var y = demangle(x); + return x === y ? x : (x + ' [' + y + ']'); + }); +} + +function jsStackTrace() { + var err = new Error(); + if (!err.stack) { + // IE10+ special cases: It does have callstack info, but it is only populated if an Error object is thrown, + // so try that as a special-case. + try { + throw new Error(0); + } catch(e) { + err = e; + } + if (!err.stack) { + return '(no stack trace available)'; + } + } + return err.stack.toString(); +} + +function stackTrace() { + var js = jsStackTrace(); + if (Module['extraStackTrace']) js += '\n' + Module['extraStackTrace'](); + return demangleAll(js); +} +Module["stackTrace"] = stackTrace; + +// Memory management + +var PAGE_SIZE = 16384; +var WASM_PAGE_SIZE = 65536; +var ASMJS_PAGE_SIZE = 16777216; +var MIN_TOTAL_MEMORY = 16777216; + +function alignUp(x, multiple) { + if (x % multiple > 0) { + x += multiple - (x % multiple); + } + return x; +} + +var HEAP, +/** @type {ArrayBuffer} */ + buffer, +/** @type {Int8Array} */ + HEAP8, +/** @type {Uint8Array} */ + HEAPU8, +/** @type {Int16Array} */ + HEAP16, +/** @type {Uint16Array} */ + HEAPU16, +/** @type {Int32Array} */ + HEAP32, +/** @type {Uint32Array} */ + HEAPU32, +/** @type {Float32Array} */ + HEAPF32, +/** @type {Float64Array} */ + HEAPF64; + +function updateGlobalBuffer(buf) { + Module['buffer'] = buffer = buf; +} + +function updateGlobalBufferViews() { + Module['HEAP8'] = HEAP8 = new Int8Array(buffer); + Module['HEAP16'] = HEAP16 = new Int16Array(buffer); + Module['HEAP32'] = HEAP32 = new Int32Array(buffer); + Module['HEAPU8'] = HEAPU8 = new Uint8Array(buffer); + Module['HEAPU16'] = HEAPU16 = new Uint16Array(buffer); + Module['HEAPU32'] = HEAPU32 = new Uint32Array(buffer); + Module['HEAPF32'] = HEAPF32 = new Float32Array(buffer); + Module['HEAPF64'] = HEAPF64 = new Float64Array(buffer); +} + +var STATIC_BASE, STATICTOP, staticSealed; // static area +var STACK_BASE, STACKTOP, STACK_MAX; // stack area +var DYNAMIC_BASE, DYNAMICTOP_PTR; // dynamic area handled by sbrk + + STATIC_BASE = STATICTOP = STACK_BASE = STACKTOP = STACK_MAX = DYNAMIC_BASE = DYNAMICTOP_PTR = 0; + staticSealed = false; + + +// Initializes the stack cookie. Called at the startup of main and at the startup of each thread in pthreads mode. +function writeStackCookie() { + assert((STACK_MAX & 3) == 0); + HEAPU32[(STACK_MAX >> 2)-1] = 0x02135467; + HEAPU32[(STACK_MAX >> 2)-2] = 0x89BACDFE; +} + +function checkStackCookie() { + if (HEAPU32[(STACK_MAX >> 2)-1] != 0x02135467 || HEAPU32[(STACK_MAX >> 2)-2] != 0x89BACDFE) { + abort('Stack overflow! Stack cookie has been overwritten, expected hex dwords 0x89BACDFE and 0x02135467, but received 0x' + HEAPU32[(STACK_MAX >> 2)-2].toString(16) + ' ' + HEAPU32[(STACK_MAX >> 2)-1].toString(16)); + } + // Also test the global address 0 for integrity. This check is not compatible with SAFE_SPLIT_MEMORY though, since that mode already tests all address 0 accesses on its own. + if (HEAP32[0] !== 0x63736d65 /* 'emsc' */) throw 'Runtime error: The application has corrupted its heap memory area (address zero)!'; +} + +function abortStackOverflow(allocSize) { + abort('Stack overflow! Attempted to allocate ' + allocSize + ' bytes on the stack, but stack has only ' + (STACK_MAX - Module['asm'].stackSave() + allocSize) + ' bytes available!'); +} + +function abortOnCannotGrowMemory() { + abort('Cannot enlarge memory arrays. Either (1) compile with -s TOTAL_MEMORY=X with X higher than the current value ' + TOTAL_MEMORY + ', (2) compile with -s ALLOW_MEMORY_GROWTH=1 which allows increasing the size at runtime but prevents some optimizations, (3) set Module.TOTAL_MEMORY to a higher value before the program runs, or (4) if you want malloc to return NULL (0) instead of this abort, compile with -s ABORTING_MALLOC=0 '); +} + + +function enlargeMemory() { + abortOnCannotGrowMemory(); +} + + +var TOTAL_STACK = Module['TOTAL_STACK'] || 5242880; +var TOTAL_MEMORY = Module['TOTAL_MEMORY'] || 16777216; +if (TOTAL_MEMORY < TOTAL_STACK) Module.printErr('TOTAL_MEMORY should be larger than TOTAL_STACK, was ' + TOTAL_MEMORY + '! (TOTAL_STACK=' + TOTAL_STACK + ')'); + +// Initialize the runtime's memory +// check for full engine support (use string 'subarray' to avoid closure compiler confusion) +assert(typeof Int32Array !== 'undefined' && typeof Float64Array !== 'undefined' && Int32Array.prototype.subarray !== undefined && Int32Array.prototype.set !== undefined, + 'JS engine does not provide full typed array support'); + + + +// Use a provided buffer, if there is one, or else allocate a new one +if (Module['buffer']) { + buffer = Module['buffer']; + assert(buffer.byteLength === TOTAL_MEMORY, 'provided buffer should be ' + TOTAL_MEMORY + ' bytes, but it is ' + buffer.byteLength); +} else { + // Use a WebAssembly memory where available + { + buffer = new ArrayBuffer(TOTAL_MEMORY); + } + assert(buffer.byteLength === TOTAL_MEMORY); +} +updateGlobalBufferViews(); + + +function getTotalMemory() { + return TOTAL_MEMORY; +} + +// Endianness check (note: assumes compiler arch was little-endian) + HEAP32[0] = 0x63736d65; /* 'emsc' */ +HEAP16[1] = 0x6373; +if (HEAPU8[2] !== 0x73 || HEAPU8[3] !== 0x63) throw 'Runtime error: expected the system to be little-endian!'; + +Module['HEAP'] = HEAP; +Module['buffer'] = buffer; +Module['HEAP8'] = HEAP8; +Module['HEAP16'] = HEAP16; +Module['HEAP32'] = HEAP32; +Module['HEAPU8'] = HEAPU8; +Module['HEAPU16'] = HEAPU16; +Module['HEAPU32'] = HEAPU32; +Module['HEAPF32'] = HEAPF32; +Module['HEAPF64'] = HEAPF64; + +function callRuntimeCallbacks(callbacks) { + while(callbacks.length > 0) { + var callback = callbacks.shift(); + if (typeof callback == 'function') { + callback(); + continue; + } + var func = callback.func; + if (typeof func === 'number') { + if (callback.arg === undefined) { + func(); + } else { + func(arg); + } + } else { + func(callback.arg === undefined ? null : callback.arg); + } + } +} + +var __ATPRERUN__ = []; // functions called before the runtime is initialized +var __ATINIT__ = []; // functions called during startup +var __ATMAIN__ = []; // functions called when main() is to be run +var __ATEXIT__ = []; // functions called during shutdown +var __ATPOSTRUN__ = []; // functions called after the runtime has exited + +var runtimeInitialized = false; +var runtimeExited = false; + + +function preRun() { + // compatibility - merge in anything from Module['preRun'] at this time + if (Module['preRun']) { + if (typeof Module['preRun'] == 'function') Module['preRun'] = [Module['preRun']]; + while (Module['preRun'].length) { + addOnPreRun(Module['preRun'].shift()); + } + } + callRuntimeCallbacks(__ATPRERUN__); +} + +function ensureInitRuntime() { + checkStackCookie(); + if (runtimeInitialized) return; + runtimeInitialized = true; + callRuntimeCallbacks(__ATINIT__); +} + +function preMain() { + checkStackCookie(); + callRuntimeCallbacks(__ATMAIN__); +} + +function exitRuntime() { + checkStackCookie(); + callRuntimeCallbacks(__ATEXIT__); + runtimeExited = true; +} + +function postRun() { + checkStackCookie(); + // compatibility - merge in anything from Module['postRun'] at this time + if (Module['postRun']) { + if (typeof Module['postRun'] == 'function') Module['postRun'] = [Module['postRun']]; + while (Module['postRun'].length) { + addOnPostRun(Module['postRun'].shift()); + } + } + callRuntimeCallbacks(__ATPOSTRUN__); +} + +function addOnPreRun(cb) { + __ATPRERUN__.unshift(cb); +} +Module["addOnPreRun"] = addOnPreRun; + +function addOnInit(cb) { + __ATINIT__.unshift(cb); +} +Module["addOnInit"] = addOnInit; + +function addOnPreMain(cb) { + __ATMAIN__.unshift(cb); +} +Module["addOnPreMain"] = addOnPreMain; + +function addOnExit(cb) { + __ATEXIT__.unshift(cb); +} +Module["addOnExit"] = addOnExit; + +function addOnPostRun(cb) { + __ATPOSTRUN__.unshift(cb); +} +Module["addOnPostRun"] = addOnPostRun; + +// Tools + +/** @type {function(string, boolean=, number=)} */ +function intArrayFromString(stringy, dontAddNull, length) { + var len = length > 0 ? length : lengthBytesUTF8(stringy)+1; + var u8array = new Array(len); + var numBytesWritten = stringToUTF8Array(stringy, u8array, 0, u8array.length); + if (dontAddNull) u8array.length = numBytesWritten; + return u8array; +} +Module["intArrayFromString"] = intArrayFromString; + +function intArrayToString(array) { + var ret = []; + for (var i = 0; i < array.length; i++) { + var chr = array[i]; + if (chr > 0xFF) { + assert(false, 'Character code ' + chr + ' (' + String.fromCharCode(chr) + ') at offset ' + i + ' not in 0x00-0xFF.'); + chr &= 0xFF; + } + ret.push(String.fromCharCode(chr)); + } + return ret.join(''); +} +Module["intArrayToString"] = intArrayToString; + +// Deprecated: This function should not be called because it is unsafe and does not provide +// a maximum length limit of how many bytes it is allowed to write. Prefer calling the +// function stringToUTF8Array() instead, which takes in a maximum length that can be used +// to be secure from out of bounds writes. +/** @deprecated */ +function writeStringToMemory(string, buffer, dontAddNull) { + Runtime.warnOnce('writeStringToMemory is deprecated and should not be called! Use stringToUTF8() instead!'); + + var /** @type {number} */ lastChar, /** @type {number} */ end; + if (dontAddNull) { + // stringToUTF8Array always appends null. If we don't want to do that, remember the + // character that existed at the location where the null will be placed, and restore + // that after the write (below). + end = buffer + lengthBytesUTF8(string); + lastChar = HEAP8[end]; + } + stringToUTF8(string, buffer, Infinity); + if (dontAddNull) HEAP8[end] = lastChar; // Restore the value under the null character. +} +Module["writeStringToMemory"] = writeStringToMemory; + +function writeArrayToMemory(array, buffer) { + assert(array.length >= 0, 'writeArrayToMemory array must have a length (should be an array or typed array)') + HEAP8.set(array, buffer); +} +Module["writeArrayToMemory"] = writeArrayToMemory; + +function writeAsciiToMemory(str, buffer, dontAddNull) { + for (var i = 0; i < str.length; ++i) { + assert(str.charCodeAt(i) === str.charCodeAt(i)&0xff); + HEAP8[((buffer++)>>0)]=str.charCodeAt(i); + } + // Null-terminate the pointer to the HEAP. + if (!dontAddNull) HEAP8[((buffer)>>0)]=0; +} +Module["writeAsciiToMemory"] = writeAsciiToMemory; + +function unSign(value, bits, ignore) { + if (value >= 0) { + return value; + } + return bits <= 32 ? 2*Math.abs(1 << (bits-1)) + value // Need some trickery, since if bits == 32, we are right at the limit of the bits JS uses in bitshifts + : Math.pow(2, bits) + value; +} +function reSign(value, bits, ignore) { + if (value <= 0) { + return value; + } + var half = bits <= 32 ? Math.abs(1 << (bits-1)) // abs is needed if bits == 32 + : Math.pow(2, bits-1); + if (value >= half && (bits <= 32 || value > half)) { // for huge values, we can hit the precision limit and always get true here. so don't do that + // but, in general there is no perfect solution here. With 64-bit ints, we get rounding and errors + // TODO: In i64 mode 1, resign the two parts separately and safely + value = -2*half + value; // Cannot bitshift half, as it may be at the limit of the bits JS uses in bitshifts + } + return value; +} + +// check for imul support, and also for correctness ( https://bugs.webkit.org/show_bug.cgi?id=126345 ) +if (!Math['imul'] || Math['imul'](0xffffffff, 5) !== -5) Math['imul'] = function imul(a, b) { + var ah = a >>> 16; + var al = a & 0xffff; + var bh = b >>> 16; + var bl = b & 0xffff; + return (al*bl + ((ah*bl + al*bh) << 16))|0; +}; +Math.imul = Math['imul']; + + +if (!Math['clz32']) Math['clz32'] = function(x) { + x = x >>> 0; + for (var i = 0; i < 32; i++) { + if (x & (1 << (31 - i))) return i; + } + return 32; +}; +Math.clz32 = Math['clz32'] + +if (!Math['trunc']) Math['trunc'] = function(x) { + return x < 0 ? Math.ceil(x) : Math.floor(x); +}; +Math.trunc = Math['trunc']; + +var Math_abs = Math.abs; +var Math_cos = Math.cos; +var Math_sin = Math.sin; +var Math_tan = Math.tan; +var Math_acos = Math.acos; +var Math_asin = Math.asin; +var Math_atan = Math.atan; +var Math_atan2 = Math.atan2; +var Math_exp = Math.exp; +var Math_log = Math.log; +var Math_sqrt = Math.sqrt; +var Math_ceil = Math.ceil; +var Math_floor = Math.floor; +var Math_pow = Math.pow; +var Math_imul = Math.imul; +var Math_fround = Math.fround; +var Math_round = Math.round; +var Math_min = Math.min; +var Math_clz32 = Math.clz32; +var Math_trunc = Math.trunc; + +// A counter of dependencies for calling run(). If we need to +// do asynchronous work before running, increment this and +// decrement it. Incrementing must happen in a place like +// PRE_RUN_ADDITIONS (used by emcc to add file preloading). +// Note that you can add dependencies in preRun, even though +// it happens right before run - run will be postponed until +// the dependencies are met. +var runDependencies = 0; +var runDependencyWatcher = null; +var dependenciesFulfilled = null; // overridden to take different actions when all run dependencies are fulfilled +var runDependencyTracking = {}; + +function getUniqueRunDependency(id) { + var orig = id; + while (1) { + if (!runDependencyTracking[id]) return id; + id = orig + Math.random(); + } + return id; +} + +function addRunDependency(id) { + runDependencies++; + if (Module['monitorRunDependencies']) { + Module['monitorRunDependencies'](runDependencies); + } + if (id) { + assert(!runDependencyTracking[id]); + runDependencyTracking[id] = 1; + if (runDependencyWatcher === null && typeof setInterval !== 'undefined') { + // Check for missing dependencies every few seconds + runDependencyWatcher = setInterval(function() { + if (ABORT) { + clearInterval(runDependencyWatcher); + runDependencyWatcher = null; + return; + } + var shown = false; + for (var dep in runDependencyTracking) { + if (!shown) { + shown = true; + Module.printErr('still waiting on run dependencies:'); + } + Module.printErr('dependency: ' + dep); + } + if (shown) { + Module.printErr('(end of list)'); + } + }, 10000); + } + } else { + Module.printErr('warning: run dependency added without ID'); + } +} +Module["addRunDependency"] = addRunDependency; + +function removeRunDependency(id) { + runDependencies--; + if (Module['monitorRunDependencies']) { + Module['monitorRunDependencies'](runDependencies); + } + if (id) { + assert(runDependencyTracking[id]); + delete runDependencyTracking[id]; + } else { + Module.printErr('warning: run dependency removed without ID'); + } + if (runDependencies == 0) { + if (runDependencyWatcher !== null) { + clearInterval(runDependencyWatcher); + runDependencyWatcher = null; + } + if (dependenciesFulfilled) { + var callback = dependenciesFulfilled; + dependenciesFulfilled = null; + callback(); // can add another dependenciesFulfilled + } + } +} +Module["removeRunDependency"] = removeRunDependency; + +Module["preloadedImages"] = {}; // maps url to image data +Module["preloadedAudios"] = {}; // maps url to audio data + + + +var memoryInitializer = null; + + + + + + +// === Body === + +var ASM_CONSTS = [function($0, $1) { Module.printErr('bad name in getProcAddress: ' + [Pointer_stringify($0), Pointer_stringify($1)]) }]; + +function _emscripten_asm_const_iii(code, a0, a1) { + return ASM_CONSTS[code](a0, a1); +} + + + +STATIC_BASE = Runtime.GLOBAL_BASE; + +STATICTOP = STATIC_BASE + 85840; +/* global initializers */ __ATINIT__.push(); + + +/* memory initializer */ allocate([77,33,75,33,0,0,0,0,4,0,0,0,77,46,75,46,0,0,0,0,4,0,0,0,70,76,84,52,0,0,0,0,4,0,0,0,70,76,84,56,0,0,0,0,8,0,0,0,52,67,72,78,0,0,0,0,4,0,0,0,54,67,72,78,0,0,0,0,6,0,0,0,56,67,72,78,0,0,0,0,8,0,0,0,49,48,67,72,0,0,0,0,10,0,0,0,49,50,67,72,0,0,0,0,12,0,0,0,49,52,67,72,0,0,0,0,14,0,0,0,49,54,67,72,0,0,0,0,16,0,0,0,49,56,67,72,0,0,0,0,18,0,0,0,50,48,67,72,0,0,0,0,20,0,0,0,50,50,67,72,0,0,0,0,22,0,0,0,50,52,67,72,0,0,0,0,24,0,0,0,50,54,67,72,0,0,0,0,26,0,0,0,50,56,67,72,0,0,0,0,28,0,0,0,51,48,67,72,0,0,0,0,30,0,0,0,51,50,67,72,0,0,0,0,32,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,128,63,0,0,128,63,0,0,128,63,0,0,128,63,0,0,128,63,0,0,128,63,171,170,42,63,0,0,0,63,0,0,128,63,0,0,128,63,0,0,128,63,0,0,128,63,0,0,128,63,0,0,128,63,0,0,192,63,0,0,0,64,0,0,0,0,0,0,128,191,0,0,0,192,0,0,128,192,0,0,0,193,0,0,128,193,0,0,0,0,0,0,0,0,0,0,0,0,0,0,128,63,0,0,0,64,0,0,128,64,0,0,0,65,0,0,128,65,0,0,0,0,0,0,0,0,172,95,0,0,255,3,0,0,255,255,255,255,205,204,236,63,2,0,0,0,86,1,0,0,85,1,0,0,87,0,0,0,83,0,0,0,68,0,0,0,65,0,0,0,69,0,0,0,81,0,0,0,255,255,255,255,0,1,0,0,255,255,255,255,0,0,0,0,1,0,0,0,2,0,0,0,3,0,0,0,4,0,0,0,4,0,0,0,1,0,0,0,2,0,0,0,3,0,0,0,4,0,0,0,5,0,0,0,6,0,0,0,7,0,0,0,8,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,128,191,0,0,0,0,0,0,0,0,0,0,128,63,0,0,0,0,0,0,128,63,0,0,128,63,0,0,0,0,0,0,128,63,0,0,128,63,0,0,0,0,0,0,128,63,0,0,128,63,0,0,0,0,0,0,128,63,0,0,0,0,0,0,0,0,0,0,0,0,0,0,128,63,0,0,0,0,0,0,0,0,0,0,128,63,0,0,0,0,0,0,128,63,0,0,128,63,0,0,128,63,0,0,128,63,0,0,0,0,0,0,128,63,0,0,0,0,0,0,0,0,0,0,128,63,0,0,0,0,0,0,128,63,0,0,0,0,0,0,128,63,0,0,128,63,0,0,0,0,0,0,128,63,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,128,63,0,0,0,0,0,0,128,63,0,0,128,63,0,0,0,0,0,0,128,63,0,0,0,0,0,0,0,0,0,0,128,63,0,0,0,0,0,0,0,0,0,0,128,63,0,0,0,0,0,0,0,0,0,0,128,63,0,0,0,0,0,0,0,0,0,0,128,63,0,0,0,0,0,0,0,0,0,0,128,191,0,0,0,0,0,0,0,0,0,0,128,191,0,0,0,0,0,0,0,0,0,0,128,191,0,0,0,0,0,0,0,0,0,0,128,191,0,0,0,0,0,0,128,63,0,0,0,0,0,0,0,0,0,0,128,63,0,0,0,0,0,0,0,0,0,0,128,63,0,0,0,0,0,0,0,0,0,0,128,63,0,0,0,0,0,0,0,0,0,0,128,191,0,0,0,0,0,0,0,0,0,0,128,191,0,0,0,0,0,0,0,0,0,0,128,191,0,0,0,0,0,0,0,0,0,0,128,191,0,0,0,0,0,0,128,63,0,0,0,0,0,0,0,0,0,0,128,63,0,0,0,0,0,0,0,0,0,0,128,63,0,0,0,0,0,0,0,0,0,0,128,63,0,0,0,0,0,0,0,0,0,0,128,191,0,0,0,0,0,0,0,0,0,0,128,191,0,0,0,0,0,0,0,0,0,0,128,191,0,0,0,0,0,0,0,0,0,0,128,191,0,0,0,0,0,0,0,0,0,0,0,0,0,0,128,191,0,0,0,0,0,0,0,0,0,0,0,0,0,0,128,191,0,0,0,0,0,0,0,0,0,0,128,63,0,0,128,63,0,0,0,0,0,0,0,0,0,0,128,191,0,0,0,0,0,0,0,0,0,0,128,63,0,0,128,63,0,0,128,63,0,0,0,0,0,0,128,63,0,0,0,0,0,0,128,191,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,32,0,32,0,0,176,1,0,0,0,0,0,0,0,0,0,32,37,249,142,0,10,2,0,0,128,190,125,95,244,125,31,160,242,43,74,30,9,82,8,0,64,34,65,80,20,4,16,32,32,41,46,18,8,34,8,0,32,34,65,80,20,4,16,32,32,249,16,76,8,250,62,60,16,34,125,222,247,125,16,32,32,161,232,50,8,34,8,0,8,34,5,16,4,69,16,0,240,163,164,50,8,82,8,0,4,34,5,16,4,69,16,32,32,249,226,94,8,2,0,129,2,62,125,31,244,125,16,0,0,32,0,0,176,1,128,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,190,15,0,192,15,224,247,251,125,126,191,95,232,190,80,0,162,8,8,68,232,47,20,10,133,2,129,80,72,160,80,0,162,40,228,73,40,40,20,10,132,2,129,64,72,160,72,0,190,15,2,16,175,235,247,9,132,62,159,216,79,160,71,0,34,136,228,9,161,42,20,10,132,2,129,80,72,160,72,0,34,40,8,4,160,47,20,10,133,2,129,80,72,162,80,0,190,143,0,0,33,32,244,251,125,126,129,95,232,156,208,7,0,128,0,0,224,15,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,128,1,12,0,130,66,191,223,239,247,251,11,5,5,133,66,191,4,72,0,198,66,161,80,40,20,64,8,5,37,133,66,160,8,168,0,170,70,161,80,40,20,64,8,5,37,133,66,144,16,8,0,146,74,161,95,232,247,67,8,5,37,121,126,136,32,8,0,130,82,161,64,40,1,66,8,137,36,133,64,132,64,8,0,130,98,161,64,42,2,66,8,81,36,133,64,130,128,8,0,130,66,191,192,47,244,67,248,33,252,133,126,191,0,9,62,0,0,0,0,4,0,0,0,0,0,0,0,128,1,12,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,2,4,0,4,0,32,72,65,0,0,0,0,0,8,0,0,4,4,0,4,60,32,0,65,0,0,0,0,0,8,0,0,240,125,223,247,133,239,75,81,190,239,251,190,239,59,81,4,0,69,65,20,133,40,74,73,170,40,138,162,32,8,81,4,240,69,65,244,157,40,74,71,170,40,138,162,224,11,81,4,16,69,65,20,132,40,74,73,170,40,138,162,0,10,145,2,240,125,223,247,133,47,74,209,170,232,251,190,224,123,31,1,0,0,0,0,4,8,64,0,0,0,8,32,0,0,0,0,0,0,0,0,132,15,96,0,0,0,8,32,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,172,1,15,0,0,0,0,0,0,0,0,0,0,0,0,0,36,1,15,0,0,0,0,0,0,0,0,0,6,0,0,0,36,1,15,0,0,0,0,0,0,0,128,16,9,162,40,250,36,1,15,0,0,0,0,0,0,0,0,62,1,42,37,66,34,82,15,0,0,0,0,0,0,0,128,138,3,42,34,34,36,41,15,0,0,0,0,0,0,0,128,10,1,42,37,18,36,1,15,0,0,0,0,0,0,0,128,10,1,190,232,251,36,1,15,0,0,0,0,0,0,0,128,190,14,0,0,2,172,1,15,0,0,0,0,0,0,0,128,4,0,0,224,3,0,0,15,0,0,0,0,0,0,0,128,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,56,0,0,0,14,184,67,132,3,58,32,0,128,160,190,2,32,0,0,240,138,32,82,196,2,43,32,4,34,145,2,248,59,0,240,7,142,56,75,228,2,58,32,2,28,138,30,8,42,233,17,4,224,11,66,244,2,130,36,1,20,4,20,232,186,4,209,5,128,184,195,231,10,58,137,0,28,14,60,40,2,9,80,4,128,0,64,196,2,128,68,0,34,132,32,232,2,0,80,4,0,0,64,128,2,0,32,5,0,142,62,8,2,0,16,4,224,3,64,128,66,0,0,7,0,132,0,248,3,0,240,7,0,0,64,128,34,0,0,4,0,0,0,0,0,0,0,0,0,0,64,128,2,0,0,4,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,2,7,128,0,194,160,72,24,0,0,1,132,33,9,146,2,66,38,4,1,33,81,0,0,127,63,2,66,2,16,41,0,34,20,192,239,247,251,253,126,9,161,223,239,247,187,187,3,18,15,68,40,20,10,133,66,9,129,64,32,16,16,17,1,8,4,68,40,20,10,133,66,127,129,64,32,16,16,17,1,4,130,199,239,247,251,253,126,9,129,207,231,243,17,17,1,50,169,80,40,20,10,133,66,9,161,64,32,16,16,17,1,64,184,80,40,20,10,133,66,121,191,223,239,247,187,187,3,32,160,31,0,0,0,0,0,0,16,0,0,0,0,0,0,112,32,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,40,2,8,131,34,1,0,2,8,67,2,1,0,1,1,124,20,4,132,68,1,0,32,4,132,4,128,8,63,130,0,132,66,191,223,239,247,3,126,161,80,40,20,10,33,0,0,132,70,161,80,40,20,138,82,161,80,40,20,122,161,239,3,158,74,161,80,40,20,82,82,161,80,40,20,74,31,8,2,132,82,161,80,40,20,34,74,161,80,40,244,75,161,239,3,132,98,161,80,40,20,82,74,161,80,40,4,122,161,40,2,124,66,191,223,239,247,139,126,191,223,239,247,11,189,239,3,0,0,0,0,0,0,0,4,0,0,0,0,8,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,8,5,32,0,0,4,132,0,34,129,69,17,16,66,1,0,148,66,81,0,0,8,66,81,148,42,162,32,8,165,80,0,0,0,32,0,0,0,0,0,0,0,5,0,0,0,0,8,190,239,251,254,251,190,239,251,20,145,235,251,190,239,251,0,32,8,130,32,10,162,40,138,20,145,40,138,162,40,138,62,190,239,251,254,11,190,239,251,20,145,40,138,162,40,138,0,162,40,138,34,8,130,32,8,20,145,40,138,162,40,138,8,190,239,251,254,251,190,239,251,20,145,47,250,190,239,251,0,0,0,0,0,64,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,32,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,1,33,0,4,0,0,0,0,0,0,0,0,0,0,0,0,130,80,20,2,20,0,0,0,0,0,0,0,0,0,0,16,0,0,0,32,0,0,0,0,0,0,0,0,0,0,0,190,40,138,162,40,34,0,0,0,0,0,0,0,0,0,0,170,40,138,162,232,34,0,0,0,0,0,0,0,0,0,0,170,40,138,162,168,34,0,0,0,0,0,0,0,0,0,0,170,40,138,162,232,34,0,0,0,0,0,0,0,0,0,0,190,239,251,190,47,62,0,0,0,0,0,0,0,0,0,0,4,0,0,0,40,32,0,0,0,0,0,0,0,0,0,0,0,0,0,128,15,62,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,3,0,0,0,1,0,0,0,4,0,0,0,6,0,0,0,5,0,0,0,7,0,0,0,6,0,0,0,2,0,0,0,3,0,0,0,3,0,0,0,5,0,0,0,5,0,0,0,2,0,0,0,4,0,0,0,1,0,0,0,7,0,0,0,5,0,0,0,2,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,1,0,0,0,1,0,0,0,3,0,0,0,4,0,0,0,3,0,0,0,6,0,0,0,7,0,0,0,6,0,0,0,6,0,0,0,6,0,0,0,6,0,0,0,6,0,0,0,6,0,0,0,6,0,0,0,6,0,0,0,3,0,0,0,5,0,0,0,6,0,0,0,5,0,0,0,7,0,0,0,6,0,0,0,6,0,0,0,6,0,0,0,6,0,0,0,6,0,0,0,6,0,0,0,7,0,0,0,6,0,0,0,7,0,0,0,7,0,0,0,6,0,0,0,6,0,0,0,6,0,0,0,2,0,0,0,7,0,0,0,2,0,0,0,3,0,0,0,5,0,0,0,2,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,4,0,0,0,5,0,0,0,5,0,0,0,1,0,0,0,2,0,0,0,5,0,0,0,2,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,4,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,3,0,0,0,1,0,0,0,3,0,0,0,4,0,0,0,4,0,0,0,1,0,0,0,1,0,0,0,1,0,0,0,1,0,0,0,1,0,0,0,1,0,0,0,1,0,0,0,1,0,0,0,1,0,0,0,1,0,0,0,1,0,0,0,1,0,0,0,1,0,0,0,1,0,0,0,1,0,0,0,1,0,0,0,1,0,0,0,1,0,0,0,1,0,0,0,1,0,0,0,1,0,0,0,1,0,0,0,1,0,0,0,1,0,0,0,1,0,0,0,1,0,0,0,1,0,0,0,1,0,0,0,1,0,0,0,1,0,0,0,1,0,0,0,1,0,0,0,1,0,0,0,1,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,7,0,0,0,1,0,0,0,5,0,0,0,3,0,0,0,7,0,0,0,3,0,0,0,5,0,0,0,4,0,0,0,1,0,0,0,7,0,0,0,4,0,0,0,3,0,0,0,5,0,0,0,3,0,0,0,3,0,0,0,2,0,0,0,5,0,0,0,6,0,0,0,1,0,0,0,2,0,0,0,2,0,0,0,3,0,0,0,5,0,0,0,6,0,0,0,6,0,0,0,6,0,0,0,6,0,0,0,6,0,0,0,6,0,0,0,6,0,0,0,6,0,0,0,6,0,0,0,6,0,0,0,7,0,0,0,6,0,0,0,6,0,0,0,6,0,0,0,6,0,0,0,6,0,0,0,3,0,0,0,3,0,0,0,3,0,0,0,3,0,0,0,7,0,0,0,6,0,0,0,6,0,0,0,6,0,0,0,6,0,0,0,6,0,0,0,6,0,0,0,5,0,0,0,6,0,0,0,6,0,0,0,6,0,0,0,6,0,0,0,6,0,0,0,6,0,0,0,4,0,0,0,6,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,9,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,2,0,0,0,2,0,0,0,3,0,0,0,3,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,3,0,0,0,5,0,0,0,20,0,0,0,0,0,128,63,0,0,128,63,0,0,0,0,0,0,0,0,0,0,128,191,0,0,128,63,0,0,0,0,0,0,0,0,0,0,128,63,0,0,128,191,0,0,0,0,0,0,0,0,0,0,128,191,0,0,128,191,0,0,0,0,0,0,0,0,0,0,128,63,0,0,0,0,0,0,128,63,0,0,0,0,0,0,128,191,0,0,0,0,0,0,128,63,0,0,0,0,0,0,128,63,0,0,0,0,0,0,128,191,0,0,0,0,0,0,128,191,0,0,0,0,0,0,128,191,0,0,0,0,0,0,0,0,0,0,128,63,0,0,128,63,0,0,0,0,0,0,0,0,0,0,128,191,0,0,128,63,0,0,0,0,0,0,0,0,0,0,128,63,0,0,128,191,0,0,0,0,0,0,0,0,0,0,128,191,0,0,128,191,0,0,0,0,0,0,128,63,46,186,232,62,0,0,0,0,4,0,0,0,0,0,0,0,2,0,0,0,0,0,0,0,1,0,0,0,0,0,0,0,8,0,0,0,8,0,0,0,4,0,0,0,4,0,0,0,2,0,0,0,2,0,0,0,1,0,0,0,0,0,0,0,0,0,0,0,4,0,0,0,0,0,0,0,2,0,0,0,0,0,0,0,1,0,0,0,8,0,0,0,8,0,0,0,8,0,0,0,4,0,0,0,4,0,0,0,2,0,0,0,2,0,0,0,1,0,0,0,2,0,0,0,3,0,0,0,205,204,12,64,0,0,128,63,0,0,0,0,4,0,0,0,5,0,0,0,6,0,0,0,7,0,0,0,8,0,0,0,9,0,0,0,10,0,0,0,11,0,0,0,10,0,0,0,12,0,0,0,10,0,0,0,0,0,0,0,48,98,159,57,21,31,31,58,45,208,110,58,21,31,159,58,161,247,198,58,159,174,238,58,150,67,11,59,21,31,31,59,91,11,51,59,218,230,70,59,88,89,91,59,211,249,112,59,38,228,131,59,97,226,143,59,97,136,156,59,196,205,169,59,38,170,183,59,177,54,198,59,158,98,213,59,80,54,229,59,44,186,245,59,231,114,3,60,204,96,12,60,198,166,21,60,212,68,31,60,41,63,41,60,146,145,51,60,66,64,62,60,56,75,73,60,166,182,84,60,90,126,96,60,135,166,108,60,43,47,121,60,11,10,131,60,213,174,137,60,245,133,144,60,80,141,151,60,0,199,158,60,30,53,166,60,120,211,173,60,64,166,181,60,92,171,189,60,255,230,197,60,248,84,206,60,94,247,214,60,74,208,223,60,165,221,232,60,134,33,242,60,212,153,251,60,97,165,2,61,28,153,7,61,26,168,12,61,91,210,17,61,236,24,23,61,204,123,28,61,253,250,33,61,125,150,39,61,77,78,45,61,121,35,51,61,245,20,57,61,205,35,63,61,1,80,69,61,145,153,75,61,113,255,81,61,199,132,88,61,108,38,95,61,121,230,101,61,240,196,108,61,206,193,115,61,22,221,122,61,99,11,129,61,111,183,132,61,54,115,136,61,50,62,140,61,231,24,144,61,88,3,148,61,130,253,151,61,226,6,156,61,129,32,160,61,98,74,164,61,253,131,168,61,83,205,172,61,233,38,177,61,71,145,181,61,95,11,186,61,184,149,190,61,81,48,195,61,177,219,199,61,217,151,204,61,65,100,209,61,234,64,214,61,224,46,219,61,157,45,224,61,155,60,229,61,230,92,234,61,126,142,239,61,87,208,244,61,3,36,250,61,118,136,255,61,27,127,2,62,95,66,5,62,141,14,8,62,97,227,10,62,30,193,13,62,63,167,16,62,74,150,19,62,63,142,22,62,29,143,25,62,162,152,28,62,17,171,31,62,172,198,34,62,238,234,37,62,93,24,41,62,181,78,44,62,59,142,47,62,170,214,50,62,70,40,54,62,14,131,57,62,4,231,60,62,38,84,64,62,117,202,67,62,241,73,71,62,154,210,74,62,178,100,78,62,59,0,82,62,240,164,85,62,21,83,89,62,170,10,93,62,108,203,96,62,225,149,100,62,198,105,104,62,27,71,108,62,35,46,112,62,155,30,116,62,131,24,120,62,29,28,124,62,182,20,128,62,54,32,130,62,144,48,132,62,195,69,134,62,208,95,136,62,183,126,138,62,119,162,140,62,50,203,142,62,232,248,144,62,119,43,147,62,2,99,149,62,102,159,151,62,231,224,153,62,66,39,156,62,185,114,158,62,43,195,160,62,152,24,163,62,0,115,165,62,133,210,167,62,38,55,170,62,195,160,172,62,90,15,175,62,48,131,177,62,34,252,179,62,16,122,182,62,59,253,184,62,131,133,187,62,232,18,190,62,106,165,192,62,41,61,195,62,39,218,197,62,66,124,200,62,121,35,203,62,15,208,205,62,195,129,208,62,214,56,211,62,6,245,213,62,149,182,216,62,99,125,219,62,111,73,222,62,185,26,225,62,99,241,227,62,108,205,230,62,180,174,233,62,91,149,236,62,98,129,239,62,201,114,242,62,110,105,245,62,149,101,248,62,27,103,251,62,1,110,254,62,52,189,0,63,6,70,2,63,171,209,3,63,254,95,5,63,2,241,6,63,199,132,8,63,92,27,10,63,162,180,11,63,152,80,13,63,95,239,14,63,247,144,16,63,63,53,18,63,89,220,19,63,35,134,21,63,207,50,23,63,59,226,24,63,104,148,26,63,119,73,28,63,71,1,30,63,216,187,31,63,74,121,33,63,143,57,35,63,164,252,36,63,139,194,38,63,68,139,40,63,205,86,42,63,57,37,44,63,136,246,45,63,151,202,47,63,152,161,49,63,108,123,51,63,33,88,53,63,185,55,55,63,34,26,57,63,126,255,58,63,188,231,60,63,204,210,62,63,207,192,64,63,196,177,66,63,139,165,68,63,69,156,70,63,242,149,72,63,129,146,74,63,4,146,76,63,104,148,78,63,208,153,80,63,26,162,82,63,88,173,84,63,136,187,86,63,171,204,88,63,210,224,90,63,219,247,92,63,232,17,95,63,232,46,97,63,236,78,99,63,227,113,101,63,221,151,103,63,219,192,105,63,204,236,107,63,193,27,110,63,186,77,112,63,182,130,114,63,182,186,116,63,169,245,118,63,177,51,121,63,205,116,123,63,220,184,125,63,0,0,128,63,13,0,115,0,13,0,122,0,13,0,128,0,13,0,135,0,13,0,141,0,13,0,148,0,13,0,154,0,13,0,161,0,26,0,167,0,26,0,180,0,26,0,193,0,26,0,206,0,26,0,218,0,26,0,231,0,26,0,244,0,26,0,1,1,51,0,14,1,51,0,40,1,51,0,65,1,51,0,91,1,51,0,117,1,51,0,143,1,51,0,168,1,51,0,194,1,103,0,220,1,103,0,15,2,103,0,67,2,103,0,118,2,103,0,170,2,103,0,221,2,103,0,17,3,103,0,68,3,206,0,120,3,206,0,223,3,206,0,70,4,206,0,173,4,206,0,20,5,197,0,123,5,188,0,221,5,181,0,59,6,88,1,151,6,66,1,66,7,48,1,227,7,32,1,123,8,18,1,11,9,6,1,148,9,252,0,23,10,242,0,149,10,203,1,15,11,174,1,244,11,149,1,203,12,128,1,149,13,110,1,86,14,94,1,13,15,80,1,188,15,67,1,99,16,100,2,7,17,62,2,56,18,29,2,87,19,1,2,102,20,233,1,102,21,211,1,90,22,192,1,68,23,175,1,36,24,49,3,254,24,254,2,150,26,210,2,21,28,173,2,126,29,141,2,212,30,112,2,26,32,86,2,82,33,64,2,125,34,67,4,159,35,254,3,192,37,196,3,191,39,146,3,161,41,103,3,106,43,65,3,29,45,31,3,190,46,0,3,77,48,176,5,209,49,85,5,168,52,7,5,82,55,197,4,213,57,139,4,55,60,88,4,124,62,42,4,168,64,1,4,189,66,152,7,194,68,30,7,142,72,182,6,28,76,93,6,118,79,16,6,165,82,204,5,172,85,143,5,146,88,89,5,89,91,35,10,12,94,128,9,28,99,246,8,219,103,127,8,85,108,24,8,148,112,189,7,160,116,108,7,125,120,35,7,51,124,1,1,0,0,1,0,0,0,4,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,1,0,0,0,1,0,0,0,1,0,0,0,1,0,0,0,2,0,0,0,2,0,0,0,2,0,0,0,2,0,0,0,3,0,0,0,3,0,0,0,3,0,0,0,3,0,0,0,4,0,0,0,4,0,0,0,4,0,0,0,4,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,5,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,3,0,0,0,4,0,0,0,5,0,0,0,6,0,0,0,7,0,0,0,8,0,0,0,9,0,0,0,10,0,0,0,11,0,0,0,13,0,0,0,15,0,0,0,17,0,0,0,19,0,0,0,23,0,0,0,27,0,0,0,31,0,0,0,35,0,0,0,43,0,0,0,51,0,0,0,59,0,0,0,67,0,0,0,83,0,0,0,99,0,0,0,115,0,0,0,131,0,0,0,163,0,0,0,195,0,0,0,227,0,0,0,2,1,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,1,0,0,0,1,0,0,0,2,0,0,0,2,0,0,0,3,0,0,0,3,0,0,0,4,0,0,0,4,0,0,0,5,0,0,0,5,0,0,0,6,0,0,0,6,0,0,0,7,0,0,0,7,0,0,0,8,0,0,0,8,0,0,0,9,0,0,0,9,0,0,0,10,0,0,0,10,0,0,0,11,0,0,0,11,0,0,0,12,0,0,0,12,0,0,0,13,0,0,0,13,0,0,0,0,0,0,0,0,0,0,0,1,0,0,0,2,0,0,0,3,0,0,0,4,0,0,0,5,0,0,0,7,0,0,0,9,0,0,0,13,0,0,0,17,0,0,0,25,0,0,0,33,0,0,0,49,0,0,0,65,0,0,0,97,0,0,0,129,0,0,0,193,0,0,0,1,1,0,0,129,1,0,0,1,2,0,0,1,3,0,0,1,4,0,0,1,6,0,0,1,8,0,0,1,12,0,0,1,16,0,0,1,24,0,0,1,32,0,0,1,48,0,0,1,64,0,0,1,96,0,0,0,0,0,0,0,0,0,0,0,1,0,0,128,0,0,0,86,0,0,0,64,0,0,0,62,180,228,51,9,145,243,51,139,178,1,52,60,32,10,52,35,26,19,52,96,169,28,52,167,215,38,52,75,175,49,52,80,59,61,52,112,135,73,52,35,160,86,52,184,146,100,52,85,109,115,52,136,159,129,52,252,11,138,52,147,4,147,52,105,146,156,52,50,191,166,52,63,149,177,52,147,31,189,52,228,105,201,52,173,128,214,52,54,113,228,52,166,73,243,52,136,140,1,53,192,247,9,53,6,239,18,53,118,123,28,53,192,166,38,53,55,123,49,53,218,3,61,53,94,76,73,53,59,97,86,53,185,79,100,53,252,37,115,53,138,121,129,53,134,227,137,53,124,217,146,53,133,100,156,53,82,142,166,53,51,97,177,53,37,232,188,53,220,46,201,53,206,65,214,53,65,46,228,53,87,2,243,53,143,102,1,54,79,207,9,54,245,195,18,54,152,77,28,54,232,117,38,54,50,71,49,54,116,204,60,54,94,17,73,54,101,34,86,54,206,12,100,54,184,222,114,54,151,83,129,54,28,187,137,54,114,174,146,54,175,54,156,54,129,93,166,54,53,45,177,54,199,176,188,54,228,243,200,54,1,3,214,54,96,235,227,54,30,187,242,54,162,64,1,55,235,166,9,55,241,152,18,55,201,31,28,55,30,69,38,55,61,19,49,55,30,149,60,55,111,214,72,55,162,227,85,55,247,201,99,55,137,151,114,55,175,45,129,55,190,146,137,55,116,131,146,55,230,8,156,55,190,44,166,55,71,249,176,55,121,121,188,55,254,184,200,55,71,196,213,55,146,168,227,55,248,115,242,55,192,26,1,56,147,126,9,56,249,109,18,56,6,242,27,56,98,20,38,56,86,223,48,56,216,93,60,56,146,155,72,56,242,164,85,56,51,135,99,56,110,80,114,56,211,7,129,56,107,106,137,56,130,88,146,56,42,219,155,56,9,252,165,56,104,197,176,56,59,66,188,56,41,126,200,56,160,133,213,56,217,101,227,56,232,44,242,56,233,244,0,57,70,86,9,57,14,67,18,57,81,196,27,57,181,227,37,57,127,171,48,57,162,38,60,57,197,96,72,57,83,102,85,57,131,68,99,57,104,9,114,57,1,226,128,57,36,66,137,57,157,45,146,57,123,173,155,57,99,203,165,57,153,145,176,57,13,11,188,57,102,67,200,57,11,71,213,57,50,35,227,57,237,229,241,57,29,207,0,58,5,46,9,58,48,24,18,58,169,150,27,58,21,179,37,58,183,119,48,58,124,239,59,58,10,38,72,58,199,39,85,58,230,1,99,58,120,194,113,58,59,188,128,58,233,25,137,58,198,2,146,58,219,127,155,58,203,154,165,58,216,93,176,58,239,211,187,58,179,8,200,58,136,8,213,58,159,224,226,58,7,159,241,58,92,169,0,59,208,5,9,59,94,237,17,59,15,105,27,59,132,130,37,59,253,67,48,59,103,184,59,59,97,235,71,59,77,233,84,59,93,191,98,59,156,123,113,59,127,150,128,59,186,241,136,59,249,215,145,59,71,82,155,59,65,106,165,59,39,42,176,59,226,156,187,59,18,206,199,59,23,202,212,59,32,158,226,59,53,88,241,59,166,131,0,60,167,221,8,60,152,194,17,60,130,59,27,60,1,82,37,60,84,16,48,60,97,129,59,60,200,176,71,60,229,170,84,60,232,124,98,60,212,52,113,60,207,112,128,60,150,201,136,60,58,173,145,60,192,36,155,60,197,57,165,60,133,246,175,60,229,101,187,60,130,147,199,60,185,139,212,60,180,91,226,60,121,17,241,60,251,93,0,61,137,181,8,61,223,151,17,61,2,14,27,61,141,33,37,61,185,220,47,61,109,74,59,61,64,118,71,61,145,108,84,61,133,58,98,61,34,238,112,61,42,75,128,61,127,161,136,61,136,130,145,61,72,247,154,61,88,9,165,61,242,194,175,61,248,46,187,61,3,89,199,61,109,77,212,61,92,25,226,61,209,202,240,61,91,56,0,62,119,141,8,62,51,109,17,62,144,224,26,62,39,241,36,62,46,169,47,62,135,19,59,62,202,59,71,62,77,46,84,62,55,248,97,62,132,167,112,62,143,37,128,62,115,121,136,62,226,87,145,62,220,201,154,62,249,216,164,62,109,143,175,62,27,248,186,62,149,30,199,62,51,15,212,62,23,215,225,62,61,132,240,62,198,18,0,63,114,101,8,63,147,66,17,63,43,179,26,63,206,192,36,63,177,117,47,63,178,220,58,63,101,1,71,63,29,240,83,63,251,181,97,63,251,96,112,63,0,0,128,63,79,103,103,83,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,196,69,1,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,232,29,0,0,5,0,0,0,0,0,0,0,0,0,0,0,13,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,14,0,0,0,15,0,0,0,63,75,1,0,0,0,0,0,0,0,0,0,0,0,0,0,2,0,0,0,0,0,0,0,0,0,0,0,0,0,0,255,255,255,255,255,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,104,30,0,0,5,0,0,0,0,0,0,0,0,0,0,0,13,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,16,0,0,0,15,0,0,0,71,75,1,0,0,4,0,0,0,0,0,0,0,0,0,0,1,0,0,0,0,0,0,0,0,0,0,0,0,0,0,10,255,255,255,255,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,104,30,0,0,2,0,0,192,3,0,0,192,4,0,0,192,5,0,0,192,6,0,0,192,7,0,0,192,8,0,0,192,9,0,0,192,10,0,0,192,11,0,0,192,12,0,0,192,13,0,0,192,14,0,0,192,15,0,0,192,16,0,0,192,17,0,0,192,18,0,0,192,19,0,0,192,20,0,0,192,21,0,0,192,22,0,0,192,23,0,0,192,24,0,0,192,25,0,0,192,26,0,0,192,27,0,0,192,28,0,0,192,29,0,0,192,30,0,0,192,31,0,0,192,0,0,0,179,1,0,0,195,2,0,0,195,3,0,0,195,4,0,0,195,5,0,0,195,6,0,0,195,7,0,0,195,8,0,0,195,9,0,0,195,10,0,0,195,11,0,0,195,12,0,0,195,13,0,0,211,14,0,0,195,15,0,0,195,0,0,12,187,1,0,12,195,2,0,12,195,3,0,12,195,4,0,12,211,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,17,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,255,255,255,255,255,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,10,0,0,0,100,0,0,0,232,3,0,0,16,39,0,0,160,134,1,0,64,66,15,0,128,150,152,0,0,225,245,5,95,112,137,0,255,9,47,15,0,107,0,101,64,95,0,90,192,84,0,80,128,75,64,71,64,67,128,63,0,60,160,56,128,53,128,50,160,47,0,45,96,42,0,40,192,37,160,35,158,33,192,31,0,30,80,28,192,26,64,25,208,23,128,22,48,21,0,20,224,18,208,17,208,16,224,15,0,15,40,14,96,13,160,12,232,11,64,11,152,10,0,10,112,9,232,8,104,8,240,7,128,7,20,7,176,6,80,6,244,5,160,5,76,5,0,5,184,4,116,4,52,4,248,3,192,3,138,3,88,3,40,3,250,2,208,2,166,2,128,2,92,2,58,2,26,2,252,1,224,1,197,1,172,1,148,1,125,1,104,1,83,1,64,1,46,1,29,1,13,1,254,0,240,0,226,0,214,0,202,0,190,0,180,0,170,0,160,0,151,0,143,0,135,0,127,0,120,0,113,0,107,0,101,0,95,0,90,0,85,0,80,0,75,0,71,0,67,0,63,0,60,0,56,0,53,0,50,0,47,0,45,0,42,0,40,0,37,0,35,0,33,0,31,0,30,0,28,0,27,0,25,0,24,0,22,0,21,0,20,0,19,0,18,0,17,0,16,0,15,0,14,0,13,0,13,0,12,0,11,0,11,0,10,0,9,0,9,0,8,0,8,0,7,0,7,0,176,6,80,6,245,5,160,5,77,5,1,5,185,4,117,4,53,4,249,3,193,3,139,3,88,3,0,0,24,0,49,0,74,0,97,0,120,0,141,0,161,0,180,0,197,0,212,0,224,0,235,0,244,0,250,0,253,0,255,0,253,0,250,0,244,0,235,0,224,0,212,0,197,0,180,0,161,0,141,0,120,0,97,0,74,0,49,0,24,0,69,120,116,101,110,100,101,100,32,77,111,100,117,108,101,58,32,0,67,111,117,108,100,32,110,111,116,32,111,112,101,110,32,105,110,112,117,116,32,102,105,108,101,0,102,115,101,101,107,40,41,32,102,97,105,108,101,100,0,102,114,101,97,100,40,41,32,102,97,105,108,101,100,0,99,111,117,108,100,32,110,111,116,32,99,114,101,97,116,101,32,99,111,110,116,101,120,116,58,32,109,111,100,117,108,101,32,105,115,32,110,111,116,32,115,97,110,101,10,0,99,111,117,108,100,32,110,111,116,32,99,114,101,97,116,101,32,99,111,110,116,101,120,116,58,32,109,97,108,108,111,99,32,102,97,105,108,101,100,10,0,99,111,117,108,100,32,110,111,116,32,99,114,101,97,116,101,32,99,111,110,116,101,120,116,58,32,117,110,107,110,111,119,110,32,101,114,114,111,114,10,0,70,97,105,108,101,100,32,116,111,32,105,110,105,116,105,97,108,105,122,101,32,97,117,100,105,111,32,99,111,110,116,101,120,116,0,70,97,105,108,101,100,32,116,111,32,105,110,105,116,105,97,108,105,122,101,32,97,117,100,105,111,32,112,108,97,121,98,97,99,107,32,100,101,118,105,99,101,0,70,97,105,108,101,100,32,116,111,32,115,116,97,114,116,32,97,117,100,105,111,32,112,108,97,121,98,97,99,107,32,100,101,118,105,99,101,0,70,97,105,108,101,100,32,116,111,32,99,114,101,97,116,101,32,109,117,116,101,120,32,102,111,114,32,97,117,100,105,111,32,109,105,120,105,110,103,0,65,117,100,105,111,32,100,101,118,105,99,101,32,105,110,105,116,105,97,108,105,122,101,100,32,115,117,99,99,101,115,115,102,117,108,108,121,58,32,37,115,0,65,117,100,105,111,32,98,97,99,107,101,110,100,58,32,109,105,110,105,95,97,108,32,47,32,37,115,0,65,117,100,105,111,32,102,111,114,109,97,116,58,32,37,115,32,45,62,32,37,115,0,65,117,100,105,111,32,99,104,97,110,110,101,108,115,58,32,37,100,32,45,62,32,37,100,0,65,117,100,105,111,32,115,97,109,112,108,101,32,114,97,116,101,58,32,37,100,32,45,62,32,37,100,0,65,117,100,105,111,32,98,117,102,102,101,114,32,115,105,122,101,58,32,37,100,0,67,111,117,108,100,32,110,111,116,32,99,108,111,115,101,32,97,117,100,105,111,32,100,101,118,105,99,101,32,98,101,99,97,117,115,101,32,105,116,32,105,115,32,110,111,116,32,99,117,114,114,101,110,116,108,121,32,105,110,105,116,105,97,108,105,122,101,100,0,65,117,100,105,111,32,100,101,118,105,99,101,32,99,108,111,115,101,100,32,115,117,99,99,101,115,115,102,117,108,108,121,0,67,114,101,97,116,101,65,117,100,105,111,66,117,102,102,101,114,40,41,32,58,32,70,97,105,108,101,100,32,116,111,32,97,108,108,111,99,97,116,101,32,109,101,109,111,114,121,32,102,111,114,32,97,117,100,105,111,32,98,117,102,102,101,114,0,76,111,97,100,83,111,117,110,100,70,114,111,109,87,97,118,101,40,41,32,58,32,70,97,105,108,101,100,32,116,111,32,99,114,101,97,116,101,32,100,97,116,97,32,99,111,110,118,101,114,115,105,111,110,32,112,105,112,101,108,105,110,101,0,80,108,97,121,65,117,100,105,111,66,117,102,102,101,114,40,41,32,58,32,78,111,32,97,117,100,105,111,32,98,117,102,102,101,114,0,46,119,97,118,0,46,111,103,103,0,91,37,115,93,32,82,101,115,111,117,114,99,101,32,102,105,108,101,32,100,111,101,115,32,110,111,116,32,99,111,110,116,97,105,110,32,119,97,118,101,32,100,97,116,97,0,91,37,115,93,32,65,117,100,105,111,32,102,105,108,101,102,111,114,109,97,116,32,110,111,116,32,115,117,112,112,111,114,116,101,100,44,32,105,116,32,99,97,110,39,116,32,98,101,32,108,111,97,100,101,100,0,76,111,97,100,83,111,117,110,100,70,114,111,109,87,97,118,101,40,41,32,58,32,70,97,105,108,101,100,32,116,111,32,103,101,116,32,102,114,97,109,101,32,99,111,117,110,116,32,102,111,114,32,102,111,114,109,97,116,32,99,111,110,118,101,114,115,105,111,110,0,76,111,97,100,83,111,117,110,100,70,114,111,109,87,97,118,101,40,41,32,58,32,70,97,105,108,101,100,32,116,111,32,99,114,101,97,116,101,32,97,117,100,105,111,32,98,117,102,102,101,114,0,76,111,97,100,83,111,117,110,100,70,114,111,109,87,97,118,101,40,41,32,58,32,70,111,114,109,97,116,32,99,111,110,118,101,114,115,105,111,110,32,102,97,105,108,101,100,0,85,110,108,111,97,100,101,100,32,119,97,118,101,32,100,97,116,97,32,102,114,111,109,32,82,65,77,0,91,83,78,68,32,73,68,32,37,105,93,91,66,85,70,82,32,73,68,32,37,105,93,32,85,110,108,111,97,100,101,100,32,115,111,117,110,100,32,100,97,116,97,32,102,114,111,109,32,82,65,77,0,85,112,100,97,116,101,83,111,117,110,100,40,41,32,58,32,73,110,118,97,108,105,100,32,115,111,117,110,100,32,45,32,110,111,32,97,117,100,105,111,32,98,117,102,102,101,114,0,87,97,118,101,70,111,114,109,97,116,40,41,32,58,32,70,97,105,108,101,100,32,116,111,32,103,101,116,32,102,114,97,109,101,32,99,111,117,110,116,32,102,111,114,32,102,111,114,109,97,116,32,99,111,110,118,101,114,115,105,111,110,46,0,87,97,118,101,70,111,114,109,97,116,40,41,32,58,32,70,111,114,109,97,116,32,99,111,110,118,101,114,115,105,111,110,32,102,97,105,108,101,100,46,0,87,97,118,101,32,99,114,111,112,32,114,97,110,103,101,32,111,117,116,32,111,102,32,98,111,117,110,100,115,0,91,37,115,93,32,79,71,71,32,97,117,100,105,111,32,102,105,108,101,32,99,111,117,108,100,32,110,111,116,32,98,101,32,111,112,101,110,101,100,0,91,37,115,93,32,70,76,65,67,32,116,111,116,97,108,32,115,97,109,112,108,101,115,58,32,37,105,0,91,37,115,93,32,79,71,71,32,115,97,109,112,108,101,32,114,97,116,101,58,32,37,105,0,91,37,115,93,32,79,71,71,32,99,104,97,110,110,101,108,115,58,32,37,105,0,91,37,115,93,32,79,71,71,32,109,101,109,111,114,121,32,114,101,113,117,105,114,101,100,58,32,37,105,0,46,120,109,0,91,37,115,93,32,88,77,32,110,117,109,98,101,114,32,111,102,32,115,97,109,112,108,101,115,58,32,37,105,0,91,37,115,93,32,88,77,32,116,114,97,99,107,32,108,101,110,103,116,104,58,32,37,49,49,46,54,102,32,115,101,99,0,91,37,115,93,32,88,77,32,102,105,108,101,32,99,111,117,108,100,32,110,111,116,32,98,101,32,111,112,101,110,101,100,0,46,109,111,100,0,91,37,115], "i8", ALLOC_NONE, Runtime.GLOBAL_BASE); +/* memory initializer */ allocate([93,32,77,79,68,32,110,117,109,98,101,114,32,111,102,32,115,97,109,112,108,101,115,58,32,37,105,0,91,37,115,93,32,77,79,68,32,116,114,97,99,107,32,108,101,110,103,116,104,58,32,37,49,49,46,54,102,32,115,101,99,0,91,37,115,93,32,77,79,68,32,102,105,108,101,32,99,111,117,108,100,32,110,111,116,32,98,101,32,111,112,101,110,101,100,0,80,108,97,121,77,117,115,105,99,83,116,114,101,97,109,40,41,32,58,32,78,111,32,97,117,100,105,111,32,98,117,102,102,101,114,0,73,110,105,116,32,97,117,100,105,111,32,115,116,114,101,97,109,58,32,78,117,109,98,101,114,32,111,102,32,99,104,97,110,110,101,108,115,32,110,111,116,32,115,117,112,112,111,114,116,101,100,58,32,37,105,0,73,110,105,116,65,117,100,105,111,83,116,114,101,97,109,40,41,32,58,32,70,97,105,108,101,100,32,116,111,32,99,114,101,97,116,101,32,97,117,100,105,111,32,98,117,102,102,101,114,0,91,65,85,68,32,73,68,32,37,105,93,32,65,117,100,105,111,32,115,116,114,101,97,109,32,108,111,97,100,101,100,32,115,117,99,99,101,115,115,102,117,108,108,121,32,40,37,105,32,72,122,44,32,37,105,32,98,105,116,44,32,37,115,41,0,77,111,110,111,0,83,116,101,114,101,111,0,91,65,85,68,32,73,68,32,37,105,93,32,85,110,108,111,97,100,101,100,32,97,117,100,105,111,32,115,116,114,101,97,109,32,100,97,116,97,0,85,112,100,97,116,101,65,117,100,105,111,83,116,114,101,97,109,40,41,32,58,32,78,111,32,97,117,100,105,111,32,98,117,102,102,101,114,0,85,112,100,97,116,101,65,117,100,105,111,83,116,114,101,97,109,40,41,32,58,32,65,116,116,101,109,112,116,105,110,103,32,116,111,32,119,114,105,116,101,32,116,111,111,32,109,97,110,121,32,102,114,97,109,101,115,32,116,111,32,98,117,102,102,101,114,0,65,117,100,105,111,32,98,117,102,102,101,114,32,110,111,116,32,97,118,97,105,108,97,98,108,101,32,102,111,114,32,117,112,100,97,116,105,110,103,0,73,115,65,117,100,105,111,66,117,102,102,101,114,80,114,111,99,101,115,115,101,100,40,41,32,58,32,78,111,32,97,117,100,105,111,32,98,117,102,102,101,114,0,77,46,75,46,0,77,105,120,101,100,32,116,111,111,32,109,97,110,121,32,102,114,97,109,101,115,32,102,114,111,109,32,97,117,100,105,111,32,98,117,102,102,101,114,0,70,114,97,109,101,32,99,117,114,115,111,114,32,112,111,115,105,116,105,111,110,32,109,111,118,101,100,32,116,111,111,32,102,97,114,32,102,111,114,119,97,114,100,32,105,110,32,97,117,100,105,111,32,115,116,114,101,97,109,0,91,37,115,93,32,87,65,86,32,102,105,108,101,32,99,111,117,108,100,32,110,111,116,32,98,101,32,111,112,101,110,101,100,0,82,73,70,70,0,87,65,86,69,0,91,37,115,93,32,73,110,118,97,108,105,100,32,82,73,70,70,32,111,114,32,87,65,86,69,32,72,101,97,100,101,114,0,91,37,115,93,32,73,110,118,97,108,105,100,32,87,97,118,101,32,102,111,114,109,97,116,0,91,37,115,93,32,73,110,118,97,108,105,100,32,100,97,116,97,32,104,101,97,100,101,114,0,91,37,115,93,32,87,65,86,32,115,97,109,112,108,101,32,115,105,122,101,32,40,37,105,98,105,116,41,32,110,111,116,32,115,117,112,112,111,114,116,101,100,44,32,99,111,110,118,101,114,116,101,100,32,116,111,32,49,54,98,105,116,0,91,37,115,93,32,87,65,86,32,99,104,97,110,110,101,108,115,32,110,117,109,98,101,114,32,40,37,105,41,32,110,111,116,32,115,117,112,112,111,114,116,101,100,44,32,99,111,110,118,101,114,116,101,100,32,116,111,32,50,32,99,104,97,110,110,101,108,115,0,91,37,115,93,32,87,65,86,32,102,105,108,101,32,108,111,97,100,101,100,32,115,117,99,99,101,115,115,102,117,108,108,121,32,40,37,105,32,72,122,44,32,37,105,32,98,105,116,44,32,37,115,41,0,91,37,115,93,32,79,71,71,32,102,105,108,101,32,99,111,117,108,100,32,110,111,116,32,98,101,32,111,112,101,110,101,100,0,91,37,115,93,32,79,103,103,32,97,117,100,105,111,32,108,101,110,103,116,104,32,105,115,32,108,97,114,103,101,114,32,116,104,97,110,32,49,48,32,115,101,99,111,110,100,115,32,40,37,102,41,44,32,116,104,97,116,39,115,32,97,32,98,105,103,32,102,105,108,101,32,105,110,32,109,101,109,111,114,121,44,32,99,111,110,115,105,100,101,114,32,109,117,115,105,99,32,115,116,114,101,97,109,105,110,103,0,91,37,115,93,32,83,97,109,112,108,101,115,32,111,98,116,97,105,110,101,100,58,32,37,105,0,91,37,115,93,32,79,71,71,32,102,105,108,101,32,108,111,97,100,101,100,32,115,117,99,99,101,115,115,102,117,108,108,121,32,40,37,105,32,72,122,44,32,37,105,32,98,105,116,44,32,37,115,41,0,119,98,0,73,110,105,116,105,97,108,105,122,105,110,103,32,114,97,121,108,105,98,32,40,118,49,46,57,45,100,101,118,41,0,35,99,97,110,118,97,115,0,84,97,114,103,101,116,32,116,105,109,101,32,112,101,114,32,102,114,97,109,101,58,32,37,48,50,46,48,51,102,32,109,105,108,108,105,115,101,99,111,110,100,115,0,69,115,99,97,112,101,0,67,97,110,118,97,115,32,115,99,97,108,101,100,32,116,111,32,102,117,108,108,115,99,114,101,101,110,46,32,69,108,101,109,101,110,116,83,105,122,101,58,32,40,37,105,120,37,105,41,44,32,83,99,114,101,101,110,83,105,122,101,40,37,105,120,37,105,41,0,67,97,110,118,97,115,32,115,99,97,108,101,100,32,116,111,32,119,105,110,100,111,119,101,100,46,32,69,108,101,109,101,110,116,83,105,122,101,58,32,40,37,105,120,37,105,41,44,32,83,99,114,101,101,110,83,105,122,101,40,37,105,120,37,105,41,0,70,97,105,108,101,100,32,116,111,32,105,110,105,116,105,97,108,105,122,101,32,71,76,70,87,0,84,114,121,105,110,103,32,116,111,32,101,110,97,98,108,101,32,77,83,65,65,32,120,52,0,67,108,111,115,101,115,116,32,102,117,108,108,115,99,114,101,101,110,32,118,105,100,101,111,109,111,100,101,58,32,37,105,32,120,32,37,105,0,71,76,70,87,32,70,97,105,108,101,100,32,116,111,32,105,110,105,116,105,97,108,105,122,101,32,87,105,110,100,111,119,0,68,105,115,112,108,97,121,32,100,101,118,105,99,101,32,105,110,105,116,105,97,108,105,122,101,100,32,115,117,99,99,101,115,115,102,117,108,108,121,0,82,101,110,100,101,114,32,115,105,122,101,58,32,37,105,32,120,32,37,105,0,83,99,114,101,101,110,32,115,105,122,101,58,32,37,105,32,120,32,37,105,0,86,105,101,119,112,111,114,116,32,111,102,102,115,101,116,115,58,32,37,105,44,32,37,105,0,84,114,121,105,110,103,32,116,111,32,101,110,97,98,108,101,32,86,83,89,78,67,0,68,79,87,78,83,67,65,76,73,78,71,58,32,82,101,113,117,105,114,101,100,32,115,99,114,101,101,110,32,115,105,122,101,32,40,37,105,120,37,105,41,32,105,115,32,98,105,103,103,101,114,32,116,104,97,110,32,100,105,115,112,108,97,121,32,115,105,122,101,32,40,37,105,120,37,105,41,0,68,111,119,110,115,99,97,108,101,32,109,97,116,114,105,120,32,103,101,110,101,114,97,116,101,100,44,32,99,111,110,116,101,110,116,32,119,105,108,108,32,98,101,32,114,101,110,100,101,114,101,100,32,97,116,58,32,37,105,32,120,32,37,105,0,85,80,83,67,65,76,73,78,71,58,32,82,101,113,117,105,114,101,100,32,115,99,114,101,101,110,32,115,105,122,101,58,32,37,105,32,120,32,37,105,32,45,62,32,68,105,115,112,108,97,121,32,115,105,122,101,58,32,37,105,32,120,32,37,105,0,91,71,76,70,87,51,32,69,114,114,111,114,93,32,67,111,100,101,58,32,37,105,32,68,101,99,114,105,112,116,105,111,110,58,32,37,115,0,87,105,110,100,111,119,32,99,108,111,115,101,100,32,115,117,99,99,101,115,115,102,117,108,108,121,0,68,101,118,105,99,101,32,99,111,111,114,100,105,110,97,116,101,115,58,32,40,37,102,44,32,37,102,44,32,37,102,41,0,115,116,111,114,97,103,101,46,100,97,116,97,0,114,98,43,0,83,116,111,114,97,103,101,32,100,97,116,97,32,102,105,108,101,32,99,111,117,108,100,32,110,111,116,32,98,101,32,99,114,101,97,116,101,100,0,83,116,111,114,97,103,101,32,112,111,115,105,116,105,111,110,32,99,111,117,108,100,32,110,111,116,32,98,101,32,102,111,117,110,100,0,83,116,111,114,97,103,101,32,100,97,116,97,32,102,105,108,101,32,99,111,117,108,100,32,110,111,116,32,98,101,32,102,111,117,110,100,0,82,101,113,117,105,114,101,100,32,116,111,117,99,104,32,112,111,105,110,116,32,111,117,116,32,111,102,32,114,97,110,103,101,32,40,77,97,120,32,116,111,117,99,104,32,112,111,105,110,116,115,58,32,37,105,41,0,112,67,111,110,116,101,120,116,32,33,61,32,40,40,118,111,105,100,42,41,48,41,0,101,120,116,101,114,110,97,108,47,109,105,110,105,95,97,108,46,104,0,109,97,108,95,99,111,110,116,101,120,116,95,105,110,105,116,95,95,115,100,108,0,109,97,108,95,99,111,110,116,101,120,116,95,117,110,105,110,105,116,95,95,115,100,108,0,112,67,111,110,116,101,120,116,45,62,98,97,99,107,101,110,100,32,61,61,32,109,97,108,95,98,97,99,107,101,110,100,95,115,100,108,0,68,101,102,97,117,108,116,32,80,108,97,121,98,97,99,107,32,68,101,118,105,99,101,0,68,101,102,97,117,108,116,32,67,97,112,116,117,114,101,32,68,101,118,105,99,101,0,112,68,101,118,105,99,101,32,33,61,32,40,40,118,111,105,100,42,41,48,41,0,109,97,108,95,100,101,118,105,99,101,95,117,110,105,110,105,116,95,95,115,100,108,0,109,97,108,95,100,101,118,105,99,101,95,105,110,105,116,95,95,115,100,108,0,112,67,111,110,102,105,103,32,33,61,32,40,40,118,111,105,100,42,41,48,41,0,98,117,102,102,101,114,83,105,122,101,32,60,61,32,51,50,55,54,56,0,70,97,105,108,101,100,32,116,111,32,111,112,101,110,32,83,68,76,32,100,101,118,105,99,101,46,0,109,97,108,95,97,117,100,105,111,95,99,97,108,108,98,97,99,107,95,95,115,100,108,0,109,97,108,95,100,101,118,105,99,101,95,95,115,101,110,100,95,102,114,97,109,101,115,95,116,111,95,99,108,105,101,110,116,0,102,114,97,109,101,67,111,117,110,116,32,62,32,48,0,112,83,97,109,112,108,101,115,32,33,61,32,40,40,118,111,105,100,42,41,48,41,0,112,70,114,97,109,101,115,79,117,116,32,33,61,32,40,40,118,111,105,100,42,41,48,41,0,109,97,108,95,100,115,112,95,109,105,120,95,99,104,97,110,110,101,108,115,95,95,100,101,99,0,99,104,97,110,110,101,108,115,79,117,116,32,62,32,48,0,112,70,114,97,109,101,115,73,110,32,33,61,32,40,40,118,111,105,100,42,41,48,41,0,99,104,97,110,110,101,108,115,73,110,32,62,32,48,0,99,104,97,110,110,101,108,115,79,117,116,32,60,32,99,104,97,110,110,101,108,115,73,110,0,109,97,108,95,100,115,112,95,109,105,120,95,99,104,97,110,110,101,108,115,95,95,105,110,99,0,99,104,97,110,110,101,108,115,79,117,116,32,62,32,99,104,97,110,110,101,108,115,73,110,0,112,83,82,67,32,33,61,32,40,40,118,111,105,100,42,41,48,41,0,109,97,108,95,115,114,99,95,114,101,97,100,95,102,114,97,109,101,115,95,108,105,110,101,97,114,0,112,67,97,99,104,101,32,33,61,32,40,40,118,111,105,100,42,41,48,41,0,109,97,108,95,115,114,99,95,99,97,99,104,101,95,114,101,97,100,95,102,114,97,109,101,115,0,112,67,97,99,104,101,45,62,112,83,82,67,32,33,61,32,40,40,118,111,105,100,42,41,48,41,0,112,67,97,99,104,101,45,62,112,83,82,67,45,62,111,110,82,101,97,100,32,33,61,32,40,40,118,111,105,100,42,41,48,41,0,109,97,108,95,115,114,99,95,114,101,97,100,95,102,114,97,109,101,115,95,112,97,115,115,116,104,114,111,117,103,104,0,109,97,108,95,100,101,118,105,99,101,95,95,114,101,97,100,95,102,114,97,109,101,115,95,102,114,111,109,95,99,108,105,101,110,116,0,99,104,97,110,110,101,108,115,32,62,32,48,0,109,97,108,95,95,105,115,95,99,104,97,110,110,101,108,95,109,97,112,95,118,97,108,105,100,0,109,97,108,95,119,111,114,107,101,114,95,116,104,114,101,97,100,0,109,97,108,95,100,101,118,105,99,101,95,95,103,101,116,95,115,116,97,116,101,40,112,68,101,118,105,99,101,41,32,61,61,32,51,0,109,97,108,95,100,101,118,105,99,101,95,95,115,116,97,114,116,95,98,97,99,107,101,110,100,0,109,97,108,95,100,101,118,105,99,101,95,95,115,116,111,112,95,98,97,99,107,101,110,100,0,109,97,108,95,99,111,110,116,101,120,116,95,117,110,105,110,105,116,0,109,97,108,95,101,110,117,109,101,114,97,116,101,95,100,101,118,105,99,101,115,40,41,32,99,97,108,108,101,100,32,119,105,116,104,32,105,110,118,97,108,105,100,32,97,114,103,117,109,101,110,116,115,32,40,112,67,111,117,110,116,32,61,61,32,48,41,46,0,109,97,108,95,101,110,117,109,101,114,97,116,101,95,100,101,118,105,99,101,115,0,109,97,108,95,100,101,118,105,99,101,95,105,110,105,116,40,41,32,99,97,108,108,101,100,32,119,105,116,104,32,105,110,118,97,108,105,100,32,97,114,103,117,109,101,110,116,115,32,40,112,68,101,118,105,99,101,32,61,61,32,78,85,76,76,41,46,0,109,97,108,95,100,101,118,105,99,101,95,105,110,105,116,40,41,32,99,97,108,108,101,100,32,119,105,116,104,32,105,110,118,97,108,105,100,32,97,114,103,117,109,101,110,116,115,32,40,112,67,111,110,102,105,103,32,61,61,32,78,85,76,76,41,46,0,87,65,82,78,73,78,71,58,32,109,97,108,95,100,101,118,105,99,101,95,105,110,105,116,40,41,32,99,97,108,108,101,100,32,102,111,114,32,97,32,100,101,118,105,99,101,32,116,104,97,116,32,105,115,32,110,111,116,32,112,114,111,112,101,114,108,121,32,97,108,105,103,110,101,100,46,32,84,104,114,101,97,100,32,115,97,102,101,116,121,32,105,115,32,110,111,116,32,115,117,112,112,111,114,116,101,100,46,0,109,97,108,95,100,101,118,105,99,101,95,105,110,105,116,40,41,32,99,97,108,108,101,100,32,119,105,116,104,32,105,110,118,97,108,105,100,32,97,114,103,117,109,101,110,116,115,32,40,112,67,111,110,116,101,120,116,32,61,61,32,78,85,76,76,41,46,0,109,97,108,95,100,101,118,105,99,101,95,105,110,105,116,40,41,32,99,97,108,108,101,100,32,119,105,116,104,32,97,110,32,105,110,118,97,108,105,100,32,99,111,110,102,105,103,46,32,67,104,97,110,110,101,108,32,99,111,117,110,116,32,109,117,115,116,32,98,101,32,103,114,101,97,116,101,114,32,116,104,97,110,32,48,46,0,109,97,108,95,100,101,118,105,99,101,95,105,110,105,116,40,41,32,99,97,108,108,101,100,32,119,105,116,104,32,97,110,32,105,110,118,97,108,105,100,32,99,111,110,102,105,103,46,32,67,104,97,110,110,101,108,32,99,111,117,110,116,32,99,97,110,110,111,116,32,101,120,99,101,101,100,32,49,56,46,0,109,97,108,95,100,101,118,105,99,101,95,105,110,105,116,40,41,32,99,97,108,108,101,100,32,119,105,116,104,32,97,110,32,105,110,118,97,108,105,100,32,99,111,110,102,105,103,46,32,83,97,109,112,108,101,32,114,97,116,101,32,109,117,115,116,32,98,101,32,103,114,101,97,116,101,114,32,116,104,97,110,32,48,46,0,109,97,108,95,100,101,118,105,99,101,95,105,110,105,116,40,41,32,99,97,108,108,101,100,32,119,105,116,104,32,105,110,118,97,108,105,100,32,97,114,103,117,109,101,110,116,115,46,32,67,104,97,110,110,101,108,32,109,97,112,32,105,115,32,105,110,118,97,108,105,100,46,0,70,97,105,108,101,100,32,116,111,32,99,114,101,97,116,101,32,109,117,116,101,120,46,0,70,97,105,108,101,100,32,116,111,32,99,114,101,97,116,101,32,119,111,114,107,101,114,32,116,104,114,101,97,100,32,119,97,107,101,117,112,32,101,118,101,110,116,46,0,70,97,105,108,101,100,32,116,111,32,99,114,101,97,116,101,32,119,111,114,107,101,114,32,116,104,114,101,97,100,32,115,116,97,114,116,32,101,118,101,110,116,46,0,70,97,105,108,101,100,32,116,111,32,99,114,101,97,116,101,32,119,111,114,107,101,114,32,116,104,114,101,97,100,32,115,116,111,112,32,101,118,101,110,116,46,0,80,108,97,121,98,97,99,107,32,68,101,118,105,99,101,0,67,97,112,116,117,114,101,32,68,101,118,105,99,101,0,70,97,105,108,101,100,32,116,111,32,99,114,101,97,116,101,32,119,111,114,107,101,114,32,116,104,114,101,97,100,46,0,109,97,108,95,100,101,118,105,99,101,95,95,103,101,116,95,115,116,97,116,101,40,112,68,101,118,105,99,101,41,32,61,61,32,49,0,109,97,108,95,100,101,118,105,99,101,95,105,110,105,116,0,109,97,108,95,100,101,118,105,99,101,95,115,116,111,112,40,41,32,99,97,108,108,101,100,32,119,105,116,104,32,105,110,118,97,108,105,100,32,97,114,103,117,109,101,110,116,115,32,40,112,68,101,118,105,99,101,32,61,61,32,78,85,76,76,41,46,0,109,97,108,95,100,101,118,105,99,101,95,115,116,111,112,40,41,32,99,97,108,108,101,100,32,102,111,114,32,97,110,32,117,110,105,110,105,116,105,97,108,105,122,101,100,32,100,101,118,105,99,101,46,0,109,97,108,95,100,101,118,105,99,101,95,115,116,111,112,40,41,32,99,97,108,108,101,100,32,119,104,105,108,101,32,97,110,111,116,104,101,114,32,116,104,114,101,97,100,32,105,115,32,97,108,114,101,97,100,121,32,115,116,111,112,112,105,110,103,32,105,116,46,0,109,97,108,95,100,101,118,105,99,101,95,115,116,111,112,40,41,32,99,97,108,108,101,100,32,102,111,114,32,97,32,100,101,118,105,99,101,32,116,104,97,116,39,115,32,97,108,114,101,97,100,121,32,115,116,111,112,112,101,100,46,0,109,97,108,95,100,101,118,105,99,101,95,115,116,111,112,40,41,32,99,97,108,108,101,100,32,119,104,105,108,101,32,97,110,111,116,104,101,114,32,116,104,114,101,97,100,32,105,115,32,105,110,32,116,104,101,32,112,114,111,99,101,115,115,32,111,102,32,115,116,97,114,116,105,110,103,32,105,116,46,0,109,97,108,95,100,101,118,105,99,101,95,95,98,114,101,97,107,95,109,97,105,110,95,108,111,111,112,0,109,97,108,95,100,101,118,105,99,101,95,95,115,116,111,112,95,98,97,99,107,101,110,100,95,95,115,100,108,0,109,97,108,95,100,101,118,105,99,101,95,95,111,110,95,114,101,97,100,95,102,114,111,109,95,100,101,118,105,99,101,0,109,97,108,95,115,114,99,95,99,97,99,104,101,95,105,110,105,116,0,112,68,83,80,32,33,61,32,40,40,118,111,105,100,42,41,48,41,0,109,97,108,95,100,115,112,95,95,115,114,99,95,111,110,95,114,101,97,100,0,109,97,108,95,100,101,118,105,99,101,95,95,111,110,95,114,101,97,100,95,102,114,111,109,95,99,108,105,101,110,116,0,109,97,108,95,99,111,110,116,101,120,116,95,95,116,114,121,95,103,101,116,95,100,101,118,105,99,101,95,110,97,109,101,95,98,121,95,105,100,0,112,78,97,109,101,32,33,61,32,40,40,118,111,105,100,42,41,48,41,0,109,97,108,95,100,101,118,105,99,101,95,115,116,97,114,116,40,41,32,99,97,108,108,101,100,32,119,105,116,104,32,105,110,118,97,108,105,100,32,97,114,103,117,109,101,110,116,115,32,40,112,68,101,118,105,99,101,32,61,61,32,78,85,76,76,41,46,0,109,97,108,95,100,101,118,105,99,101,95,115,116,97,114,116,40,41,32,99,97,108,108,101,100,32,102,111,114,32,97,110,32,117,110,105,110,105,116,105,97,108,105,122,101,100,32,100,101,118,105,99,101,46,0,109,97,108,95,100,101,118,105,99,101,95,115,116,97,114,116,40,41,32,99,97,108,108,101,100,32,119,104,105,108,101,32,97,110,111,116,104,101,114,32,116,104,114,101,97,100,32,105,115,32,97,108,114,101,97,100,121,32,115,116,97,114,116,105,110,103,32,105,116,46,0,109,97,108,95,100,101,118,105,99,101,95,115,116,97,114,116,40,41,32,99,97,108,108,101,100,32,102,111,114,32,97,32,100,101,118,105,99,101,32,116,104,97,116,39,115,32,97,108,114,101,97,100,121,32,115,116,97,114,116,101,100,46,0,109,97,108,95,100,101,118,105,99,101,95,115,116,97,114,116,40,41,32,99,97,108,108,101,100,32,119,104,105,108,101,32,97,110,111,116,104,101,114,32,116,104,114,101,97,100,32,105,115,32,105,110,32,116,104,101,32,112,114,111,99,101,115,115,32,111,102,32,115,116,111,112,112,105,110,103,32,105,116,46,0,109,97,108,95,100,101,118,105,99,101,95,95,115,116,97,114,116,95,98,97,99,107,101,110,100,95,95,115,100,108,0,112,68,97,116,97,32,33,61,32,40,40,118,111,105,100,42,41,48,41,0,109,97,108,95,99,111,110,118,101,114,116,95,102,114,97,109,101,115,95,95,111,110,95,114,101,97,100,0,112,68,97,116,97,45,62,116,111,116,97,108,70,114,97,109,101,67,111,117,110,116,32,62,61,32,112,68,97,116,97,45,62,105,78,101,120,116,70,114,97,109,101,0,85,110,107,110,111,119,110,0,83,68,76,0,79,112,101,110,65,76,0,79,112,101,110,83,76,124,69,83,0,79,83,83,0,65,76,83,65,0,87,105,110,77,77,0,68,105,114,101,99,116,83,111,117,110,100,0,87,65,83,65,80,73,0,78,117,108,108,0,73,110,118,97,108,105,100,0,51,50,45,98,105,116,32,73,69,69,69,32,70,108,111,97,116,105,110,103,32,80,111,105,110,116,0,51,50,45,98,105,116,32,83,105,103,110,101,100,32,73,110,116,101,103,101,114,0,50,52,45,98,105,116,32,83,105,103,110,101,100,32,73,110,116,101,103,101,114,32,40,84,105,103,104,116,108,121,32,80,97,99,107,101,100,41,0,49,54,45,98,105,116,32,83,105,103,110,101,100,32,73,110,116,101,103,101,114,0,56,45,98,105,116,32,85,110,115,105,103,110,101,100,32,73,110,116,101,103,101,114,0,69,112,115,105,108,111,110,32,118,97,108,117,101,32,105,115,32,116,111,111,32,108,97,114,103,101,46,0,99,105,32,61,61,32,110,112,111,105,110,116,115,0,46,47,101,120,116,101,114,110,97,108,47,112,97,114,95,115,104,97,112,101,115,46,104,0,112,97,114,95,115,104,97,112,101,115,95,95,119,101,108,100,95,112,111,105,110,116,115,0,114,97,100,105,117,115,32,60,61,32,49,46,48,32,38,38,32,34,85,115,101,32,115,109,97,108,108,101,114,32,114,97,100,105,117,115,32,116,111,32,97,118,111,105,100,32,115,101,108,102,45,105,110,116,101,114,115,101,99,116,105,111,110,46,34,0,112,97,114,95,115,104,97,112,101,115,95,99,114,101,97,116,101,95,116,111,114,117,115,0,114,97,100,105,117,115,32,62,61,32,48,46,49,32,38,38,32,34,85,115,101,32,108,97,114,103,101,114,32,114,97,100,105,117,115,32,116,111,32,97,118,111,105,100,32,115,101,108,102,45,105,110,116,101,114,115,101,99,116,105,111,110,46,34,0,114,97,100,105,117,115,32,60,61,32,51,46,48,32,38,38,32,34,85,115,101,32,115,109,97,108,108,101,114,32,114,97,100,105,117,115,32,116,111,32,97,118,111,105,100,32,115,101,108,102,45,105,110,116,101,114,115,101,99,116,105,111,110,46,34,0,112,97,114,95,115,104,97,112,101,115,95,99,114,101,97,116,101,95,116,114,101,102,111,105,108,95,107,110,111,116,0,114,97,100,105,117,115,32,62,61,32,48,46,53,32,38,38,32,34,85,115,101,32,108,97,114,103,101,114,32,114,97,100,105,117,115,32,116,111,32,97,118,111,105,100,32,115,101,108,102,45,105,110,116,101,114,115,101,99,116,105,111,110,46,34,0,46,111,98,106,0,77,101,115,104,32,99,111,117,108,100,32,110,111,116,32,98,101,32,108,111,97,100,101,100,0,91,37,115,93,32,79,66,74,32,102,105,108,101,32,99,111,117,108,100,32,110,111,116,32,98,101,32,111,112,101,110,101,100,0,37,99,0,91,37,115,93,32,77,111,100,101,108,32,118,101,114,116,105,99,101,115,58,32,37,105,0,91,37,115,93,32,77,111,100,101,108,32,116,101,120,99,111,111,114,100,115,58,32,37,105,0,91,37,115,93,32,77,111,100,101,108,32,110,111,114,109,97,108,115,58,32,37,105,0,91,37,115,93,32,77,111,100,101,108,32,116,114,105,97,110,103,108,101,115,58,32,37,105,0,37,102,32,37,102,37,42,91,94,10,93,115,10,0,37,102,32,37,102,32,37,102,0,91,37,115,93,32,78,111,32,110,111,114,109,97,108,115,32,100,97,116,97,32,111,110,32,79,66,74,44,32,110,111,114,109,97,108,115,32,119,105,108,108,32,98,101,32,103,101,110,101,114,97,116,101,100,32,102,114,111,109,32,102,97,99,101,115,32,100,97,116,97,0,37,105,32,37,105,32,37,105,0,37,105,47,37,105,32,37,105,47,37,105,32,37,105,47,37,105,0,37,105,47,47,37,105,32,37,105,47,47,37,105,32,37,105,47,47,37,105,0,37,105,47,37,105,47,37,105,32,37,105,47,37,105,47,37,105,32,37,105,47,37,105,47,37,105,0,91,37,115,93,32,77,111,100,101,108,32,108,111,97,100,101,100,32,115,117,99,99,101,115,115,102,117,108,108,121,32,105,110,32,82,65,77,32,40,67,80,85,41,0,85,110,108,111,97,100,101,100,32,109,111,100,101,108,32,100,97,116,97,32,40,109,101,115,104,32,97,110,100,32,109,97,116,101,114,105,97,108,41,32,102,114,111,109,32,82,65,77,32,97,110,100,32,86,82,65,77,0,46,109,116,108,0,91,37,115,93,32,77,84,76,32,102,105,108,101,32,99,111,117,108,100,32,110,111,116,32,98,101,32,111,112,101,110,101,100,0,110,101,119,109,116,108,32,37,115,0,91,37,115,93,32,76,111,97,100,105,110,103,32,109,97,116,101,114,105,97,108,46,46,46,0,75,97,32,37,102,32,37,102,32,37,102,0,75,100,32,37,102,32,37,102,32,37,102,0,75,115,32,37,102,32,37,102,32,37,102,0,78,115,32,37,105,0,109,97,112,95,75,100,32,37,115,0,109,97,112,95,75,115,32,37,115,0,109,97,112,95,66,117,109,112,32,37,115,0,109,97,112,95,98,117,109,112,32,37,115,0,100,32,37,102,0,98,117,109,112,32,37,115,0,84,114,32,37,102,0,91,37,115,93,32,77,97,116,101,114,105,97,108,32,108,111,97,100,101,100,32,115,117,99,99,101,115,115,102,117,108,108,121,0,83,116,97,99,107,32,66,117,102,102,101,114,32,79,118,101,114,102,108,111,119,32,40,77,65,88,32,37,105,32,77,97,116,114,105,120,41,0,77,65,88,95,76,73,78,69,83,95,66,65,84,67,72,32,111,118,101,114,102,108,111,119,0,77,65,88,95,84,82,73,65,78,71,76,69,83,95,66,65,84,67,72,32,111,118,101,114,102,108,111,119,0,77,65,88,95,81,85,65,68,83,95,66,65,84,67,72,32,111,118,101,114,102,108,111,119,0,67,108,97,109,112,32,109,105,114,114,111,114,32,119,114,97,112,32,109,111,100,101,32,110,111,116,32,115,117,112,112,111,114,116,101,100,0,91,84,69,88,32,73,68,32,37,105,93,32,77,97,120,105,109,117,109,32,97,110,105,115,111,116,114,111,112,105,99,32,102,105,108,116,101,114,32,108,101,118,101,108,32,115,117,112,112,111,114,116,101,100,32,105,115,32,37,105,88,0,65,110,105,115,111,116,114,111,112,105,99,32,102,105,108,116,101,114,105,110,103,32,110,111,116,32,115,117,112,112,111,114,116,101,100,0,91,70,66,79,32,73,68,32,37,105,93,32,85,110,108,111,97,100,101,100,32,114,101,110,100,101,114,32,116,101,120,116,117,114,101,32,100,97,116,97,32,102,114,111,109,32,86,82,65,77,32,40,71,80,85,41,0,91,86,65,79,32,73,68,32,37,105,93,32,85,110,108,111,97,100,101,100,32,109,111,100,101,108,32,100,97,116,97,32,102,114,111,109,32,86,82,65,77,32,40,71,80,85,41,0,91,86,66,79,32,73,68,32,37,105,93,32,85,110,108,111,97,100,101,100,32,109,111,100,101,108,32,118,101,114,116,101,120,32,100,97,116,97,32,102,114,111,109,32,86,82,65,77,32,40,71,80,85,41,0,71,80,85,58,32,86,101,110,100,111,114,58,32,32,32,37,115,0,71,80,85,58,32,82,101,110,100,101,114,101,114,58,32,37,115,0,71,80,85,58,32,86,101,114,115,105,111,110,58,32,32,37,115,0,71,80,85,58,32,71,76,83,76,58,32,32,32,32,32,37,115,0,32,0,78,117,109,98,101,114,32,111,102,32,115,117,112,112,111,114,116,101,100,32,101,120,116,101,110,115,105,111,110,115,58,32,37,105,0,71,76,95,79,69,83,95,118,101,114,116,101,120,95,97,114,114,97,121,95,111,98,106,101,99,116,0,103,108,71,101,110,86,101,114,116,101,120,65,114,114,97,121,115,79,69,83,0,103,108,66,105,110,100,86,101,114,116,101,120,65,114,114,97,121,79,69,83,0,103,108,68,101,108,101,116,101,86,101,114,116,101,120,65,114,114,97,121,115,79,69,83,0,71,76,95,79,69,83,95,116,101,120,116,117,114,101,95,110,112,111,116,0,79,69,83,95,116,101,120,116,117,114,101,95,102,108,111,97,116,0,71,76,95,69,88,84,95,116,101,120,116,117,114,101,95,99,111,109,112,114,101,115,115,105,111,110,95,115,51,116,99,0,71,76,95,87,69,66,71,76,95,99,111,109,112,114,101,115,115,101,100,95,116,101,120,116,117,114,101,95,115,51,116,99,0,71,76,95,87,69,66,75,73,84,95,87,69,66,71,76,95,99,111,109,112,114,101,115,115,101,100,95,116,101,120,116,117,114,101,95,115,51,116,99,0,71,76,95,79,69,83,95,99,111,109,112,114,101,115,115,101,100,95,69,84,67,49,95,82,71,66,56,95,116,101,120,116,117,114,101,0,71,76,95,87,69,66,71,76,95,99,111,109,112,114,101,115,115,101,100,95,116,101,120,116,117,114,101,95,101,116,99,49,0,71,76,95,65,82,66,95,69,83,51,95,99,111,109,112,97,116,105,98,105,108,105,116,121,0,71,76,95,73,77,71,95,116,101,120,116,117,114,101,95,99,111,109,112,114,101,115,115,105,111,110,95,112,118,114,116,99,0,71,76,95,75,72,82,95,116,101,120,116,117,114,101,95,99,111,109,112,114,101,115,115,105,111,110,95,97,115,116,99,95,104,100,114,0,71,76,95,69,88,84,95,116,101,120,116,117,114,101,95,102,105,108,116,101,114,95,97,110,105,115,111,116,114,111,112,105,99,0,71,76,95,69,88,84,95,116,101,120,116,117,114,101,95,109,105,114,114,111,114,95,99,108,97,109,112,0,91,69,88,84,69,78,83,73,79,78,93,32,86,65,79,32,101,120,116,101,110,115,105,111,110,32,100,101,116,101,99,116,101,100,44,32,86,65,79,32,102,117,110,99,116,105,111,110,115,32,105,110,105,116,105,97,108,105,122,101,100,32,115,117,99,99,101,115,115,102,117,108,108,121,0,91,69,88,84,69,78,83,73,79,78,93,32,86,65,79,32,101,120,116,101,110,115,105,111,110,32,110,111,116,32,102,111,117,110,100,44,32,86,65,79,32,117,115,97,103,101,32,110,111,116,32,115,117,112,112,111,114,116,101,100,0,91,69,88,84,69,78,83,73,79,78,93,32,78,80,79,84,32,116,101,120,116,117,114,101,115,32,101,120,116,101,110,115,105,111,110,32,100,101,116,101,99,116,101,100,44,32,102,117,108,108,32,78,80,79,84,32,116,101,120,116,117,114,101,115,32,115,117,112,112,111,114,116,101,100,0,91,69,88,84,69,78,83,73,79,78,93,32,78,80,79,84,32,116,101,120,116,117,114,101,115,32,101,120,116,101,110,115,105,111,110,32,110,111,116,32,102,111,117,110,100,44,32,108,105,109,105,116,101,100,32,78,80,79,84,32,115,117,112,112,111,114,116,32,40,110,111,45,109,105,112,109,97,112,115,44,32,110,111,45,114,101,112,101,97,116,41,0,91,69,88,84,69,78,83,73,79,78,93,32,68,88,84,32,99,111,109,112,114,101,115,115,101,100,32,116,101,120,116,117,114,101,115,32,115,117,112,112,111,114,116,101,100,0,91,69,88,84,69,78,83,73,79,78,93,32,69,84,67,49,32,99,111,109,112,114,101,115,115,101,100,32,116,101,120,116,117,114,101,115,32,115,117,112,112,111,114,116,101,100,0,91,69,88,84,69,78,83,73,79,78,93,32,69,84,67,50,47,69,65,67,32,99,111,109,112,114,101,115,115,101,100,32,116,101,120,116,117,114,101,115,32,115,117,112,112,111,114,116,101,100,0,91,69,88,84,69,78,83,73,79,78,93,32,80,86,82,84,32,99,111,109,112,114,101,115,115,101,100,32,116,101,120,116,117,114,101,115,32,115,117,112,112,111,114,116,101,100,0,91,69,88,84,69,78,83,73,79,78,93,32,65,83,84,67,32,99,111,109,112,114,101,115,115,101,100,32,116,101,120,116,117,114,101,115,32,115,117,112,112,111,114,116,101,100,0,91,69,88,84,69,78,83,73,79,78,93,32,65,110,105,115,111,116,114,111,112,105,99,32,116,101,120,116,117,114,101,115,32,102,105,108,116,101,114,105,110,103,32,115,117,112,112,111,114,116,101,100,32,40,109,97,120,58,32,37,46,48,102,88,41,0,91,69,88,84,69,78,83,73,79,78,93,32,67,108,97,109,112,32,109,105,114,114,111,114,32,119,114,97,112,32,116,101,120,116,117,114,101,32,109,111,100,101,32,115,117,112,112,111,114,116,101,100,0,91,84,69,88,32,73,68,32,37,105,93,32,66,97,115,101,32,119,104,105,116,101,32,116,101,120,116,117,114,101,32,108,111,97,100,101,100,32,115,117,99,99,101,115,115,102,117,108,108,121,0,66,97,115,101,32,119,104,105,116,101,32,116,101,120,116,117,114,101,32,99,111,117,108,100,32,110,111,116,32,98,101,32,108,111,97,100,101,100,0,79,112,101,110,71,76,32,100,101,102,97,117,108,116,32,115,116,97,116,101,115,32,105,110,105,116,105,97,108,105,122,101,100,32,115,117,99,99,101,115,115,102,117,108,108,121,0,91,67,80,85,93,32,68,101,102,97,117,108,116,32,98,117,102,102,101,114,115,32,105,110,105,116,105,97,108,105,122,101,100,32,115,117,99,99,101,115,115,102,117,108,108,121,32,40,108,105,110,101,115,44,32,116,114,105,97,110,103,108,101,115,44,32,113,117,97,100,115,41,0,91,86,65,79,32,73,68,32,37,105,93,32,68,101,102,97,117,108,116,32,98,117,102,102,101,114,115,32,86,65,79,32,105,110,105,116,105,97,108,105,122,101,100,32,115,117,99,99,101,115,115,102,117,108,108,121,32,40,108,105,110,101,115,41,0,91,86,66,79,32,73,68,32,37,105,93,91,86,66,79,32,73,68,32,37,105,93,32,68,101,102,97,117,108,116,32,98,117,102,102,101,114,115,32,86,66,79,115,32,105,110,105,116,105,97,108,105,122,101,100,32,115,117,99,99,101,115,115,102,117,108,108,121,32,40,108,105,110,101,115,41,0,91,86,65,79,32,73,68,32,37,105,93,32,68,101,102,97,117,108,116,32,98,117,102,102,101,114,115,32,86,65,79,32,105,110,105,116,105,97,108,105,122,101,100,32,115,117,99,99,101,115,115,102,117,108,108,121,32,40,116,114,105,97,110,103,108,101,115,41,0,91,86,66,79,32,73,68,32,37,105,93,91,86,66,79,32,73,68,32,37,105,93,32,68,101,102,97,117,108,116,32,98,117,102,102,101,114,115,32,86,66,79,115,32,105,110,105,116,105,97,108,105,122,101,100,32,115,117,99,99,101,115,115,102,117,108,108,121,32,40,116,114,105,97,110,103,108,101,115,41,0,91,86,65,79,32,73,68,32,37,105,93,32,68,101,102,97,117,108,116,32,98,117,102,102,101,114,115,32,86,65,79,32,105,110,105,116,105,97,108,105,122,101,100,32,115,117,99,99,101,115,115,102,117,108,108,121,32,40,113,117,97,100,115,41,0,91,86,66,79,32,73,68,32,37,105,93,91,86,66,79,32,73,68,32,37,105,93,91,86,66,79,32,73,68,32,37,105,93,91,86,66,79,32,73,68,32,37,105,93,32,68,101,102,97,117,108,116,32,98,117,102,102,101,114,115,32,86,66,79,115,32,105,110,105,116,105,97,108,105,122,101,100,32,115,117,99,99,101,115,115,102,117,108,108,121,32,40,113,117,97,100,115,41,0,35,118,101,114,115,105,111,110,32,49,48,48,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,10,97,116,116,114,105,98,117,116,101,32,118,101,99,51,32,118,101,114,116,101,120,80,111,115,105,116,105,111,110,59,32,32,32,32,32,10,97,116,116,114,105,98,117,116,101,32,118,101,99,50,32,118,101,114,116,101,120,84,101,120,67,111,111,114,100,59,32,32,32,32,32,10,97,116,116,114,105,98,117,116,101,32,118,101,99,52,32,118,101,114,116,101,120,67,111,108,111,114,59,32,32,32,32,32,32,32,32,10,118,97,114,121,105,110,103,32,118,101,99,50,32,102,114,97,103,84,101,120,67,111,111,114,100,59,32,32,32,32,32,32,32,32,32,10,118,97,114,121,105,110,103,32,118,101,99,52,32,102,114,97,103,67,111,108,111,114,59,32,32,32,32,32,32,32,32,32,32,32,32,10,117,110,105,102,111,114,109,32,109,97,116,52,32,109,118,112,59,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,10,118,111,105,100,32,109,97,105,110,40,41,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,10,123,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,10,32,32,32,32,102,114,97,103,84,101,120,67,111,111,114,100,32,61,32,118,101,114,116,101,120,84,101,120,67,111,111,114,100,59,32,10,32,32,32,32,102,114,97,103,67,111,108,111,114,32,61,32,118,101,114,116,101,120,67,111,108,111,114,59,32,32,32,32,32,32,32,10,32,32,32,32,103,108,95,80,111,115,105,116,105,111,110,32,61,32,109,118,112,42,118,101,99,52,40,118,101,114,116,101,120,80,111,115,105,116,105,111,110,44,32,49,46,48,41,59,32,10,125,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,10,0,35,118,101,114,115,105,111,110,32,49,48,48,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,10,112,114,101,99,105,115,105,111,110,32,109,101,100,105,117,109,112,32,102,108,111,97,116,59,32,32,32,32,32,32,32,32,32,32,32,10,118,97,114,121,105,110,103,32,118,101,99,50,32,102,114,97,103,84,101,120,67,111,111,114,100,59,32,32,32,32,32,32,32,32,32,10,118,97,114,121,105,110,103,32,118,101,99,52,32,102,114,97,103,67,111,108,111,114,59,32,32,32,32,32,32,32,32,32,32,32,32,10,117,110,105,102,111,114,109,32,115,97,109,112,108,101,114,50,68,32,116,101,120,116,117,114,101,48,59,32,32,32,32,32,32,32,32,10,117,110,105,102,111,114,109,32,118,101,99,52,32,99,111,108,68,105,102,102,117,115,101,59,32,32,32,32,32,32,32,32,32,32,32,10,118,111,105,100,32,109,97,105,110,40,41,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,10,123,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,10,32,32,32,32,118,101,99,52,32,116,101,120,101,108,67,111,108,111,114,32,61,32,116,101,120,116,117,114,101,50,68,40,116,101,120,116,117,114,101,48,44,32,102,114,97,103,84,101,120,67,111,111,114,100,41,59,32,10,32,32,32,32,103,108,95,70,114,97,103,67,111,108,111,114,32,61,32,116,101,120,101,108,67,111,108,111,114,42,99,111,108,68,105,102,102,117,115,101,42,102,114,97,103,67,111,108,111,114,59,32,32,32,32,32,32,10,125,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,10,0,91,83,72,68,82,32,73,68,32,37,105,93,32,68,101,102,97,117,108,116,32,115,104,97,100,101,114,32,108,111,97,100,101,100,32,115,117,99,99,101,115,115,102,117,108,108,121,0,118,101,114,116,101,120,80,111,115,105,116,105,111,110,0,118,101,114,116,101,120,84,101,120,67,111,111,114,100,0,118,101,114,116,101,120,67,111,108,111,114,0,109,118,112,0,99,111,108,68,105,102,102,117,115,101,0,116,101,120,116,117,114,101,48,0,91,83,72,68,82,32,73,68,32,37,105,93,32,68,101,102,97,117,108,116,32,115,104,97,100,101,114,32,99,111,117,108,100,32,110,111,116,32,98,101,32,108,111,97,100,101,100,0,118,101,114,116,101,120,78,111,114,109,97,108,0,118,101,114,116,101,120,84,97,110,103,101,110,116,0,118,101,114,116,101,120,84,101,120,67,111,111,114,100,50,0,91,83,72,68,82,32,73,68,32,37,105,93,32,70,97,105,108,101,100,32,116,111,32,108,105,110,107,32,115,104,97,100,101,114,32,112,114,111,103,114,97,109,46,46,46,0,37,115,0,91,83,72,68,82,32,73,68,32,37,105,93,32,83,104,97,100,101,114,32,112,114,111,103,114,97,109,32,108,111,97,100,101,100,32,115,117,99,99,101,115,115,102,117,108,108,121,0,91,83,72,68,82,32,73,68,32,37,105,93,32,70,97,105,108,101,100,32,116,111,32,99,111,109,112,105,108,101,32,115,104,97,100,101,114,46,46,46,0,91,83,72,68,82,32,73,68,32,37,105,93,32,83,104,97,100,101,114,32,99,111,109,112,105,108,101,100,32,115,117,99,99,101,115,115,102,117,108,108,121,0,68,88,84,32,99,111,109,112,114,101,115,115,101,100,32,116,101,120,116,117,114,101,32,102,111,114,109,97,116,32,110,111,116,32,115,117,112,112,111,114,116,101,100,0,69,84,67,49,32,99,111,109,112,114,101,115,115,101,100,32,116,101,120,116,117,114,101,32,102,111,114,109,97,116,32,110,111,116,32,115,117,112,112,111,114,116,101,100,0,69,84,67,50,32,99,111,109,112,114,101,115,115,101,100,32,116,101,120,116,117,114,101,32,102,111,114,109,97,116,32,110,111,116,32,115,117,112,112,111,114,116,101,100,0,80,86,82,84,32,99,111,109,112,114,101,115,115,101,100,32,116,101,120,116,117,114,101,32,102,111,114,109,97,116,32,110,111,116,32,115,117,112,112,111,114,116,101,100,0,65,83,84,67,32,99,111,109,112,114,101,115,115,101,100,32,116,101,120], "i8", ALLOC_NONE, Runtime.GLOBAL_BASE+10240); +/* memory initializer */ allocate([116,117,114,101,32,102,111,114,109,97,116,32,110,111,116,32,115,117,112,112,111,114,116,101,100,0,84,101,120,116,117,114,101,32,102,111,114,109,97,116,32,110,111,116,32,115,117,112,112,111,114,116,101,100,0,91,84,69,88,32,73,68,32,37,105,93,32,84,101,120,116,117,114,101,32,99,114,101,97,116,101,100,32,115,117,99,99,101,115,115,102,117,108,108,121,32,40,37,105,120,37,105,41,0,91,84,69,88,32,73,68,32,37,105,93,32,85,110,108,111,97,100,101,100,32,116,101,120,116,117,114,101,32,100,97,116,97,32,40,98,97,115,101,32,119,104,105,116,101,32,116,101,120,116,117,114,101,41,32,102,114,111,109,32,86,82,65,77,0,84,101,120,116,117,114,101,32,102,111,114,109,97,116,32,117,112,100,97,116,105,110,103,32,110,111,116,32,115,117,112,112,111,114,116,101,100,0,70,114,97,109,101,98,117,102,102,101,114,32,111,98,106,101,99,116,32,99,111,117,108,100,32,110,111,116,32,98,101,32,99,114,101,97,116,101,100,46,46,46,0,70,114,97,109,101,98,117,102,102,101,114,32,105,115,32,117,110,115,117,112,112,111,114,116,101,100,0,70,114,97,109,101,98,117,102,102,101,114,32,105,110,99,111,109,112,108,101,116,101,32,97,116,116,97,99,104,109,101,110,116,0,70,114,97,109,101,98,117,102,102,101,114,32,105,110,99,111,109,112,108,101,116,101,32,100,105,109,101,110,115,105,111,110,115,0,70,114,97,109,101,98,117,102,102,101,114,32,105,110,99,111,109,112,108,101,116,101,32,109,105,115,115,105,110,103,32,97,116,116,97,99,104,109,101,110,116,0,91,70,66,79,32,73,68,32,37,105,93,32,70,114,97,109,101,98,117,102,102,101,114,32,111,98,106,101,99,116,32,99,114,101,97,116,101,100,32,115,117,99,99,101,115,115,102,117,108,108,121,0,91,84,69,88,32,73,68,32,37,105,93,32,77,105,112,109,97,112,115,32,103,101,110,101,114,97,116,101,100,32,97,117,116,111,109,97,116,105,99,97,108,108,121,0,91,84,69,88,32,73,68,32,37,105,93,32,77,105,112,109,97,112,115,32,99,97,110,32,110,111,116,32,98,101,32,103,101,110,101,114,97,116,101,100,0,91,86,65,79,32,73,68,32,37,105,93,32,77,101,115,104,32,117,112,108,111,97,100,101,100,32,115,117,99,99,101,115,115,102,117,108,108,121,32,116,111,32,86,82,65,77,32,40,71,80,85,41,0,77,101,115,104,32,99,111,117,108,100,32,110,111,116,32,98,101,32,117,112,108,111,97,100,101,100,32,116,111,32,86,82,65,77,32,40,71,80,85,41,0,91,86,66,79,115,93,32,77,101,115,104,32,117,112,108,111,97,100,101,100,32,115,117,99,99,101,115,115,102,117,108,108,121,32,116,111,32,86,82,65,77,32,40,71,80,85,41,0,91,37,115,93,32,84,101,120,116,32,102,105,108,101,32,99,111,117,108,100,32,110,111,116,32,98,101,32,111,112,101,110,101,100,0,67,117,115,116,111,109,32,115,104,97,100,101,114,32,99,111,117,108,100,32,110,111,116,32,98,101,32,108,111,97,100,101,100,0,91,83,72,68,82,32,73,68,32,37,105,93,32,65,99,116,105,118,101,32,117,110,105,102,111,114,109,32,91,37,115,93,32,115,101,116,32,97,116,32,108,111,99,97,116,105,111,110,58,32,37,105,0,112,114,111,106,101,99,116,105,111,110,0,118,105,101,119,0,116,101,120,116,117,114,101,49,0,116,101,120,116,117,114,101,50,0,91,83,72,68,82,32,73,68,32,37,105,93,32,85,110,108,111,97,100,101,100,32,115,104,97,100,101,114,32,112,114,111,103,114,97,109,32,100,97,116,97,0,91,83,72,68,82,32,73,68,32,37,105,93,32,83,104,97,100,101,114,32,117,110,105,102,111,114,109,32,91,37,115,93,32,67,79,85,76,68,32,78,79,84,32,66,69,32,70,79,85,78,68,0,91,83,72,68,82,32,73,68,32,37,105,93,32,83,104,97,100,101,114,32,117,110,105,102,111,114,109,32,91,37,115,93,32,115,101,116,32,97,116,32,108,111,99,97,116,105,111,110,58,32,37,105,0,83,104,97,100,101,114,32,118,97,108,117,101,32,102,108,111,97,116,32,97,114,114,97,121,32,115,105,122,101,32,110,111,116,32,115,117,112,112,111,114,116,101,100,0,83,104,97,100,101,114,32,118,97,108,117,101,32,105,110,116,32,97,114,114,97,121,32,115,105,122,101,32,110,111,116,32,115,117,112,112,111,114,116,101,100,0,73,110,105,116,105,97,108,105,122,105,110,103,32,86,82,32,83,105,109,117,108,97,116,111,114,32,40,79,99,117,108,117,115,32,82,105,102,116,32,67,86,49,41,0,73,110,105,116,105,97,108,105,122,105,110,103,32,86,82,32,83,105,109,117,108,97,116,111,114,32,40,79,99,117,108,117,115,32,82,105,102,116,32,68,75,50,41,0,35,118,101,114,115,105,111,110,32,49,48,48,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,10,97,116,116,114,105,98,117,116,101,32,118,101,99,51,32,118,101,114,116,101,120,80,111,115,105,116,105,111,110,59,32,32,32,32,32,10,97,116,116,114,105,98,117,116,101,32,118,101,99,50,32,118,101,114,116,101,120,84,101,120,67,111,111,114,100,59,32,32,32,32,32,10,97,116,116,114,105,98,117,116,101,32,118,101,99,52,32,118,101,114,116,101,120,67,111,108,111,114,59,32,32,32,32,32,32,32,32,10,118,97,114,121,105,110,103,32,118,101,99,50,32,102,114,97,103,84,101,120,67,111,111,114,100,59,32,32,32,32,32,32,32,32,32,10,118,97,114,121,105,110,103,32,118,101,99,52,32,102,114,97,103,67,111,108,111,114,59,32,32,32,32,32,32,32,32,32,32,32,32,10,117,110,105,102,111,114,109,32,109,97,116,52,32,109,118,112,59,32,32,32,32,32,32,32,32,32,32,32,32,10,118,111,105,100,32,109,97,105,110,40,41,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,10,123,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,10,32,32,32,32,102,114,97,103,84,101,120,67,111,111,114,100,32,61,32,118,101,114,116,101,120,84,101,120,67,111,111,114,100,59,32,10,32,32,32,32,102,114,97,103,67,111,108,111,114,32,61,32,118,101,114,116,101,120,67,111,108,111,114,59,32,32,32,32,32,32,32,10,32,32,32,32,103,108,95,80,111,115,105,116,105,111,110,32,61,32,109,118,112,42,118,101,99,52,40,118,101,114,116,101,120,80,111,115,105,116,105,111,110,44,32,49,46,48,41,59,32,10,125,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,10,0,35,118,101,114,115,105,111,110,32,49,48,48,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,10,112,114,101,99,105,115,105,111,110,32,109,101,100,105,117,109,112,32,102,108,111,97,116,59,32,32,32,32,32,32,32,32,32,32,32,10,118,97,114,121,105,110,103,32,118,101,99,50,32,102,114,97,103,84,101,120,67,111,111,114,100,59,32,32,32,32,32,32,32,32,32,10,118,97,114,121,105,110,103,32,118,101,99,52,32,102,114,97,103,67,111,108,111,114,59,32,32,32,32,32,32,32,32,32,32,32,32,10,117,110,105,102,111,114,109,32,115,97,109,112,108,101,114,50,68,32,116,101,120,116,117,114,101,48,59,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,10,117,110,105,102,111,114,109,32,118,101,99,50,32,108,101,102,116,76,101,110,115,67,101,110,116,101,114,59,32,32,32,32,32,32,32,10,117,110,105,102,111,114,109,32,118,101,99,50,32,114,105,103,104,116,76,101,110,115,67,101,110,116,101,114,59,32,32,32,32,32,32,10,117,110,105,102,111,114,109,32,118,101,99,50,32,108,101,102,116,83,99,114,101,101,110,67,101,110,116,101,114,59,32,32,32,32,32,10,117,110,105,102,111,114,109,32,118,101,99,50,32,114,105,103,104,116,83,99,114,101,101,110,67,101,110,116,101,114,59,32,32,32,32,10,117,110,105,102,111,114,109,32,118,101,99,50,32,115,99,97,108,101,59,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,32,10,117,110,105,102,111,114,109,32,118,101,99,50,32,115,99,97,108,101,73,110,59,32,32,32,32,32,32,32,32,32,32,32,32,32,32,10,117,110,105,102,111,114,109,32,118,101,99,52,32,104,109,100,87,97,114,112,80,97,114,97,109,59,32,32,32,32,32,32,32,32,32,10,117,110,105,102,111,114,109,32,118,101,99,52,32,99,104,114,111,109,97,65,98,80,97,114,97,109,59,32,32,32,32,32,32,32,32,10,118,111,105,100,32,109,97,105,110,40,41,32,10,123,32,10,32,32,32,118,101,99,50,32,108,101,110,115,67,101,110,116,101,114,32,61,32,102,114,97,103,84,101,120,67,111,111,114,100,46,120,32,60,32,48,46,53,32,63,32,108,101,102,116,76,101,110,115,67,101,110,116,101,114,32,58,32,114,105,103,104,116,76,101,110,115,67,101,110,116,101,114,59,32,10,32,32,32,118,101,99,50,32,115,99,114,101,101,110,67,101,110,116,101,114,32,61,32,102,114,97,103,84,101,120,67,111,111,114,100,46,120,32,60,32,48,46,53,32,63,32,108,101,102,116,83,99,114,101,101,110,67,101,110,116,101,114,32,58,32,114,105,103,104,116,83,99,114,101,101,110,67,101,110,116,101,114,59,32,10,32,32,32,118,101,99,50,32,116,104,101,116,97,32,61,32,40,102,114,97,103,84,101,120,67,111,111,114,100,32,45,32,108,101,110,115,67,101,110,116,101,114,41,42,115,99,97,108,101,73,110,59,32,10,32,32,32,102,108,111,97,116,32,114,83,113,32,61,32,116,104,101,116,97,46,120,42,116,104,101,116,97,46,120,32,43,32,116,104,101,116,97,46,121,42,116,104,101,116,97,46,121,59,32,10,32,32,32,118,101,99,50,32,116,104,101,116,97,49,32,61,32,116,104,101,116,97,42,40,104,109,100,87,97,114,112,80,97,114,97,109,46,120,32,43,32,104,109,100,87,97,114,112,80,97,114,97,109,46,121,42,114,83,113,32,43,32,104,109,100,87,97,114,112,80,97,114,97,109,46,122,42,114,83,113,42,114,83,113,32,43,32,104,109,100,87,97,114,112,80,97,114,97,109,46,119,42,114,83,113,42,114,83,113,42,114,83,113,41,59,32,10,32,32,32,118,101,99,50,32,116,104,101,116,97,66,108,117,101,32,61,32,116,104,101,116,97,49,42,40,99,104,114,111,109,97,65,98,80,97,114,97,109,46,122,32,43,32,99,104,114,111,109,97,65,98,80,97,114,97,109,46,119,42,114,83,113,41,59,32,10,32,32,32,118,101,99,50,32,116,99,66,108,117,101,32,61,32,108,101,110,115,67,101,110,116,101,114,32,43,32,115,99,97,108,101,42,116,104,101,116,97,66,108,117,101,59,32,10,32,32,32,105,102,32,40,97,110,121,40,98,118,101,99,50,40,99,108,97,109,112,40,116,99,66,108,117,101,44,32,115,99,114,101,101,110,67,101,110,116,101,114,32,45,32,118,101,99,50,40,48,46,50,53,44,32,48,46,53,41,44,32,115,99,114,101,101,110,67,101,110,116,101,114,32,43,32,118,101,99,50,40,48,46,50,53,44,32,48,46,53,41,41,32,45,32,116,99,66,108,117,101,41,41,41,32,10,32,32,32,123,32,10,32,32,32,32,32,32,32,103,108,95,70,114,97,103,67,111,108,111,114,32,61,32,118,101,99,52,40,48,46,48,44,32,48,46,48,44,32,48,46,48,44,32,49,46,48,41,59,32,10,32,32,32,125,32,10,32,32,32,101,108,115,101,32,10,32,32,32,123,32,10,32,32,32,32,32,32,32,102,108,111,97,116,32,98,108,117,101,32,61,32,116,101,120,116,117,114,101,50,68,40,116,101,120,116,117,114,101,48,44,32,116,99,66,108,117,101,41,46,98,59,32,10,32,32,32,32,32,32,32,118,101,99,50,32,116,99,71,114,101,101,110,32,61,32,108,101,110,115,67,101,110,116,101,114,32,43,32,115,99,97,108,101,42,116,104,101,116,97,49,59,32,10,32,32,32,32,32,32,32,102,108,111,97,116,32,103,114,101,101,110,32,61,32,116,101,120,116,117,114,101,50,68,40,116,101,120,116,117,114,101,48,44,32,116,99,71,114,101,101,110,41,46,103,59,32,10,32,32,32,32,32,32,32,118,101,99,50,32,116,104,101,116,97,82,101,100,32,61,32,116,104,101,116,97,49,42,40,99,104,114,111,109,97,65,98,80,97,114,97,109,46,120,32,43,32,99,104,114,111,109,97,65,98,80,97,114,97,109,46,121,42,114,83,113,41,59,32,10,32,32,32,32,32,32,32,118,101,99,50,32,116,99,82,101,100,32,61,32,108,101,110,115,67,101,110,116,101,114,32,43,32,115,99,97,108,101,42,116,104,101,116,97,82,101,100,59,32,10,32,32,32,32,32,32,32,102,108,111,97,116,32,114,101,100,32,61,32,116,101,120,116,117,114,101,50,68,40,116,101,120,116,117,114,101,48,44,32,116,99,82,101,100,41,46,114,59,32,10,32,32,32,32,32,32,32,103,108,95,70,114,97,103,67,111,108,111,114,32,61,32,118,101,99,52,40,114,101,100,44,32,103,114,101,101,110,44,32,98,108,117,101,44,32,49,46,48,41,59,32,10,32,32,32,32,125,32,10,125,32,10,0,86,82,58,32,68,105,115,116,111,114,116,105,111,110,32,83,99,97,108,101,58,32,37,102,0,86,82,58,32,68,105,115,116,111,114,116,105,111,110,32,83,104,97,100,101,114,58,32,76,101,102,116,76,101,110,115,67,101,110,116,101,114,32,61,32,123,32,37,102,44,32,37,102,32,125,0,86,82,58,32,68,105,115,116,111,114,116,105,111,110,32,83,104,97,100,101,114,58,32,82,105,103,104,116,76,101,110,115,67,101,110,116,101,114,32,61,32,123,32,37,102,44,32,37,102,32,125,0,86,82,58,32,68,105,115,116,111,114,116,105,111,110,32,83,104,97,100,101,114,58,32,83,99,97,108,101,32,61,32,123,32,37,102,44,32,37,102,32,125,0,86,82,58,32,68,105,115,116,111,114,116,105,111,110,32,83,104,97,100,101,114,58,32,83,99,97,108,101,73,110,32,61,32,123,32,37,102,44,32,37,102,32,125,0,108,101,102,116,76,101,110,115,67,101,110,116,101,114,0,114,105,103,104,116,76,101,110,115,67,101,110,116,101,114,0,108,101,102,116,83,99,114,101,101,110,67,101,110,116,101,114,0,114,105,103,104,116,83,99,114,101,101,110,67,101,110,116,101,114,0,115,99,97,108,101,0,115,99,97,108,101,73,110,0,104,109,100,87,97,114,112,80,97,114,97,109,0,99,104,114,111,109,97,65,98,80,97,114,97,109,0,91,84,69,88,32,73,68,32,37,105,93,32,68,101,102,97,117,108,116,32,102,111,110,116,32,108,111,97,100,101,100,32,115,117,99,99,101,115,115,102,117,108,108,121,0,46,116,116,102,0,46,102,110,116,0,91,37,115,93,32,83,112,114,105,116,101,70,111,110,116,32,99,111,117,108,100,32,110,111,116,32,98,101,32,108,111,97,100,101,100,44,32,117,115,105,110,103,32,100,101,102,97,117,108,116,32,102,111,110,116,0,83,112,114,105,116,101,70,111,110,116,32,100,97,116,97,32,112,97,114,115,101,100,32,99,111,114,114,101,99,116,108,121,32,102,114,111,109,32,105,109,97,103,101,0,73,109,97,103,101,32,102,105,108,101,32,108,111,97,100,101,100,32,99,111,114,114,101,99,116,108,121,32,97,115,32,83,112,114,105,116,101,70,111,110,116,0,114,116,0,91,37,115,93,32,70,78,84,32,102,105,108,101,32,99,111,117,108,100,32,110,111,116,32,98,101,32,111,112,101,110,101,100,0,108,105,110,101,72,101,105,103,104,116,0,108,105,110,101,72,101,105,103,104,116,61,37,105,32,98,97,115,101,61,37,105,32,115,99,97,108,101,87,61,37,105,32,115,99,97,108,101,72,61,37,105,0,91,37,115,93,32,70,111,110,116,32,115,105,122,101,58,32,37,105,0,91,37,115,93,32,70,111,110,116,32,116,101,120,116,117,114,101,32,115,99,97,108,101,58,32,37,105,120,37,105,0,102,105,108,101,0,102,105,108,101,61,34,37,49,50,56,91,94,34,93,34,0,91,37,115,93,32,70,111,110,116,32,116,101,120,116,117,114,101,32,102,105,108,101,110,97,109,101,58,32,37,115,0,99,111,117,110,116,0,99,111,117,110,116,61,37,105,0,91,37,115,93,32,70,111,110,116,32,110,117,109,32,99,104,97,114,115,58,32,37,105,0,91,37,115,93,32,70,111,110,116,32,116,101,120,116,117,114,101,32,108,111,97,100,105,110,103,32,112,97,116,104,58,32,37,115,0,99,104,97,114,32,105,100,61,37,105,32,120,61,37,105,32,121,61,37,105,32,119,105,100,116,104,61,37,105,32,104,101,105,103,104,116,61,37,105,32,120,111,102,102,115,101,116,61,37,105,32,121,111,102,102,115,101,116,61,37,105,32,120,97,100,118,97,110,99,101,61,37,105,0,91,37,115,93,32,83,112,114,105,116,101,70,111,110,116,32,108,111,97,100,101,100,32,115,117,99,99,101,115,115,102,117,108,108,121,0,85,110,108,111,97,100,101,100,32,115,112,114,105,116,101,32,102,111,110,116,32,100,97,116,97,0,91,37,115,93,32,83,112,114,105,116,101,70,111,110,116,32,99,111,117,108,100,32,110,111,116,32,98,101,32,103,101,110,101,114,97,116,101,100,44,32,117,115,105,110,103,32,100,101,102,97,117,108,116,32,102,111,110,116,0,84,84,70,32,115,112,114,105,116,101,102,111,110,116,32,108,111,97,100,105,110,103,58,32,80,114,101,100,105,99,116,101,100,32,116,101,120,116,117,114,101,32,115,105,122,101,58,32,37,105,120,37,105,0,91,37,115,93,32,84,84,70,32,102,105,108,101,32,99,111,117,108,100,32,110,111,116,32,98,101,32,111,112,101,110,101,100,0,84,84,70,32,115,112,114,105,116,101,102,111,110,116,32,108,111,97,100,105,110,103,58,32,102,105,114,115,116,32,99,104,97,114,97,99,116,101,114,32,105,115,32,110,111,116,32,83,80,65,67,69,40,51,50,41,32,99,104,97,114,97,99,116,101,114,0,84,84,70,32,115,112,114,105,116,101,102,111,110,116,32,108,111,97,100,105,110,103,58,32,78,111,116,32,97,108,108,32,116,104,101,32,99,104,97,114,97,99,116,101,114,115,32,102,105,116,32,105,110,32,116,104,101,32,102,111,110,116,0,120,43,103,119,32,60,32,112,119,0,46,47,101,120,116,101,114,110,97,108,47,115,116,98,95,116,114,117,101,116,121,112,101,46,104,0,115,116,98,116,116,95,66,97,107,101,70,111,110,116,66,105,116,109,97,112,95,105,110,116,101,114,110,97,108,0,122,45,62,100,105,114,101,99,116,105,111,110,0,115,116,98,116,116,95,95,114,97,115,116,101,114,105,122,101,95,115,111,114,116,101,100,95,101,100,103,101,115,0,122,45,62,101,121,32,62,61,32,115,99,97,110,95,121,95,116,111,112,0,101,45,62,101,121,32,62,61,32,121,95,116,111,112,0,115,116,98,116,116,95,95,102,105,108,108,95,97,99,116,105,118,101,95,101,100,103,101,115,95,110,101,119,0,101,45,62,115,121,32,60,61,32,121,95,98,111,116,116,111,109,32,38,38,32,101,45,62,101,121,32,62,61,32,121,95,116,111,112,0,120,32,62,61,32,48,32,38,38,32,120,32,60,32,108,101,110,0,102,97,98,115,40,97,114,101,97,41,32,60,61,32,49,46,48,49,102,0,121,48,32,60,32,121,49,0,115,116,98,116,116,95,95,104,97,110,100,108,101,95,99,108,105,112,112,101,100,95,101,100,103,101,0,101,45,62,115,121,32,60,61,32,101,45,62,101,121,0,120,49,32,60,61,32,120,43,49,0,120,49,32,62,61,32,120,0,120,49,32,60,61,32,120,0,120,49,32,62,61,32,120,43,49,0,120,49,32,62,61,32,120,32,38,38,32,120,49,32,60,61,32,120,43,49,0,120,48,32,62,61,32,120,32,38,38,32,120,48,32,60,61,32,120,43,49,32,38,38,32,120,49,32,62,61,32,120,32,38,38,32,120,49,32,60,61,32,120,43,49,0,122,32,33,61,32,40,40,118,111,105,100,42,41,48,41,0,115,116,98,116,116,95,95,110,101,119,95,97,99,116,105,118,101,0,33,105,110,102,111,45,62,99,102,102,46,115,105,122,101,0,115,116,98,116,116,95,95,71,101,116,71,108,121,102,79,102,102,115,101,116,0,115,116,98,116,116,95,95,99,102,102,95,105,110,116,0,110,32,62,61,32,49,32,38,38,32,110,32,60,61,32,52,0,115,116,98,116,116,95,95,98,117,102,95,103,101,116,0,115,105,122,101,32,60,32,48,120,52,48,48,48,48,48,48,48,0,115,116,98,116,116,95,95,110,101,119,95,98,117,102,0,33,40,111,32,62,32,98,45,62,115,105,122,101,32,124,124,32,111,32,60,32,48,41,0,115,116,98,116,116,95,95,98,117,102,95,115,101,101,107,0,111,102,102,115,105,122,101,32,62,61,32,49,32,38,38,32,111,102,102,115,105,122,101,32,60,61,32,52,0,115,116,98,116,116,95,95,99,102,102,95,103,101,116,95,105,110,100,101,120,0,98,48,32,62,61,32,50,56,0,115,116,98,116,116,95,95,99,102,102,95,115,107,105,112,95,111,112,101,114,97,110,100,0,105,32,62,61,32,48,32,38,38,32,105,32,60,32,99,111,117,110,116,0,115,116,98,116,116,95,95,99,102,102,95,105,110,100,101,120,95,103,101,116,0,111,117,116,112,117,116,95,99,116,120,46,110,117,109,95,118,101,114,116,105,99,101,115,32,61,61,32,99,111,117,110,116,95,99,116,120,46,110,117,109,95,118,101,114,116,105,99,101,115,0,115,116,98,116,116,95,95,71,101,116,71,108,121,112,104,83,104,97,112,101,84,50,0,115,116,98,116,116,95,95,71,101,116,71,108,121,112,104,83,104,97,112,101,84,84,0,115,116,98,116,116,95,70,105,110,100,71,108,121,112,104,73,110,100,101,120,0,117,110,105,99,111,100,101,95,99,111,100,101,112,111,105,110,116,32,60,61,32,116,116,85,83,72,79,82,84,40,100,97,116,97,32,43,32,101,110,100,67,111,117,110,116,32,43,32,50,42,105,116,101,109,41,0,99,109,97,112,0,108,111,99,97,0,104,101,97,100,0,103,108,121,102,0,104,104,101,97,0,104,109,116,120,0,107,101,114,110,0,67,70,70,32,0,109,97,120,112,0,37,50,105,32,70,80,83,0,23,125,161,52,103,117,70,37,247,101,203,169,124,126,44,123,152,238,145,45,171,114,253,10,192,136,4,157,249,30,35,72,175,63,77,90,181,16,96,111,133,104,75,162,93,56,66,240,8,50,84,229,49,210,173,239,141,1,87,18,2,198,143,57,225,160,58,217,168,206,245,204,199,6,73,60,20,230,211,233,94,200,88,9,74,155,33,15,219,130,226,202,83,236,42,172,165,218,55,222,46,107,98,154,109,67,196,178,127,158,13,243,65,79,166,248,25,224,115,80,68,51,184,128,232,208,151,122,26,212,105,43,179,213,235,148,146,89,14,195,28,78,112,76,250,47,24,251,140,108,186,190,228,170,183,139,39,188,244,246,132,48,119,144,180,138,134,193,82,182,120,121,86,220,209,3,91,241,149,85,205,150,113,216,31,100,41,164,177,214,153,231,38,71,185,174,97,201,29,95,7,92,54,254,191,118,34,221,131,11,163,99,234,81,227,147,156,176,17,142,69,12,110,62,27,255,0,194,59,116,242,252,19,21,187,53,207,129,64,135,61,40,167,237,102,223,106,159,197,189,215,137,36,32,22,5,23,125,161,52,103,117,70,37,247,101,203,169,124,126,44,123,152,238,145,45,171,114,253,10,192,136,4,157,249,30,35,72,175,63,77,90,181,16,96,111,133,104,75,162,93,56,66,240,8,50,84,229,49,210,173,239,141,1,87,18,2,198,143,57,225,160,58,217,168,206,245,204,199,6,73,60,20,230,211,233,94,200,88,9,74,155,33,15,219,130,226,202,83,236,42,172,165,218,55,222,46,107,98,154,109,67,196,178,127,158,13,243,65,79,166,248,25,224,115,80,68,51,184,128,232,208,151,122,26,212,105,43,179,213,235,148,146,89,14,195,28,78,112,76,250,47,24,251,140,108,186,190,228,170,183,139,39,188,244,246,132,48,119,144,180,138,134,193,82,182,120,121,86,220,209,3,91,241,149,85,205,150,113,216,31,100,41,164,177,214,153,231,38,71,185,174,97,201,29,95,7,92,54,254,191,118,34,221,131,11,163,99,234,81,227,147,156,176,17,142,69,12,110,62,27,255,0,194,59,116,242,252,19,21,187,53,207,129,64,135,61,40,167,237,102,223,106,159,197,189,215,137,36,32,22,5,0,1,2,3,4,5,6,7,8,9,10,11,0,9,1,11,0,1,2,3,4,5,6,7,8,9,10,11,0,1,2,3,4,5,6,7,8,9,10,11,0,1,2,3,4,5,6,7,8,9,10,11,0,1,2,3,4,5,6,7,8,9,10,11,114,105,46,98,105,116,115,95,112,101,114,95,99,104,97,110,110,101,108,32,61,61,32,49,54,0,46,47,101,120,116,101,114,110,97,108,47,115,116,98,95,105,109,97,103,101,46,104,0,115,116,98,105,95,95,108,111,97,100,95,97,110,100,95,112,111,115,116,112,114,111,99,101,115,115,95,56,98,105,116,0,111,117,116,111,102,109,101,109,0,117,110,107,110,111,119,110,32,105,109,97,103,101,32,116,121,112,101,0,35,63,82,65,68,73,65,78,67,69,0,35,63,82,71,66,69,0,110,111,116,32,72,68,82,0,70,79,82,77,65,84,61,51,50,45,98,105,116,95,114,108,101,95,114,103,98,101,0,117,110,115,117,112,112,111,114,116,101,100,32,102,111,114,109,97,116,0,45,89,32,0,117,110,115,117,112,112,111,114,116,101,100,32,100,97,116,97,32,108,97,121,111,117,116,0,43,88,32,0,116,111,111,32,108,97,114,103,101,0,105,110,118,97,108,105,100,32,100,101,99,111,100,101,100,32,115,99,97,110,108,105,110,101,32,108,101,110,103,116,104,0,99,111,114,114,117,112,116,0,35,63,82,65,68,73,65,78,67,69,10,0,35,63,82,71,66,69,10,0,98,97,100,32,114,101,113,95,99,111,109,112,0,114,101,113,95,99,111,109,112,32,62,61,32,49,32,38,38,32,114,101,113,95,99,111,109,112,32,60,61,32,52,0,115,116,98,105,95,95,99,111,110,118,101,114,116,95,102,111,114,109,97,116,49,54,0,115,116,98,105,95,95,99,111,110,118,101,114,116,95,102,111,114,109,97,116,0,109,117,108,116,105,112,108,101,32,73,72,68,82,0,98,97,100,32,73,72,68,82,32,108,101,110,0,49,47,50,47,52,47,56,47,49,54,45,98,105,116,32,111,110,108,121,0,98,97,100,32,99,116,121,112,101,0,98,97,100,32,99,111,109,112,32,109,101,116,104,111,100,0,98,97,100,32,102,105,108,116,101,114,32,109,101,116,104,111,100,0,98,97,100,32,105,110,116,101,114,108,97,99,101,32,109,101,116,104,111,100,0,48,45,112,105,120,101,108,32,105,109,97,103,101,0,102,105,114,115,116,32,110,111,116,32,73,72,68,82,0,105,110,118,97,108,105,100,32,80,76,84,69,0,116,82,78,83,32,97,102,116,101,114,32,73,68,65,84,0,116,82,78,83,32,98,101,102,111,114,101,32,80,76,84,69,0,98,97,100,32,116,82,78,83,32,108,101,110,0,116,82,78,83,32,119,105,116,104,32,97,108,112,104,97,0,0,255,85,0,17,0,0,0,1,110,111,32,80,76,84,69,0,111,117,116,111,102,100,97,116,97,0,110,111,32,73,68,65,84,0,88,88,88,88,32,80,78,71,32,99,104,117,110,107,32,110,111,116,32,107,110,111,119,110,0,115,45,62,105,109,103,95,111,117,116,95,110,32,61,61,32,52,0,115,116,98,105,95,95,100,101,95,105,112,104,111,110,101,0,111,117,116,95,110,32,61,61,32,50,32,124,124,32,111,117,116,95,110,32,61,61,32,52,0,115,116,98,105,95,95,99,111,109,112,117,116,101,95,116,114,97,110,115,112,97,114,101,110,99,121,0,115,116,98,105,95,95,99,111,109,112,117,116,101,95,116,114,97,110,115,112,97,114,101,110,99,121,49,54,0,111,117,116,95,110,32,61,61,32,115,45,62,105,109,103,95,110,32,124,124,32,111,117,116,95,110,32,61,61,32,115,45,62,105,109,103,95,110,43,49,0,115,116,98,105,95,95,99,114,101,97,116,101,95,112,110,103,95,105,109,97,103,101,95,114,97,119,0,110,111,116,32,101,110,111,117,103,104,32,112,105,120,101,108,115,0,105,109,103,95,119,105,100,116,104,95,98,121,116,101,115,32,60,61,32,120,0,0,1,0,5,6,105,109,103,95,110,43,49,32,61,61,32,111,117,116,95,110,0,105,110,118,97,108,105,100,32,102,105,108,116,101,114,0,105,109,103,95,110,32,61,61,32,51,0,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,8,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,9,7,7,7,7,7,7,7,7,7,7,7,7,7,7,7,7,7,7,7,7,7,7,7,7,8,8,8,8,8,8,8,8,5,5,5,5,5,5,5,5,5,5,5,5,5,5,5,5,5,5,5,5,5,5,5,5,5,5,5,5,5,5,5,5,98,97,100,32,104,117,102,102,109,97,110,32,99,111,100,101,0,98,97,100,32,100,105,115,116,0,111,117,116,112,117,116,32,98,117,102,102,101,114,32,108,105,109,105,116,0,122,45,62,115,105,122,101,91,98,93,32,61,61,32,115,0,115,116,98,105,95,95,122,104,117,102,102,109,97,110,95,100,101,99,111,100,101,95,115,108,111,119,112,97,116,104,0,98,105,116,115,32,60,61,32,49,54,0,115,116,98,105,95,95,98,105,116,95,114,101,118,101,114,115,101,0,122,45,62,99,111,100,101,95,98,117,102,102,101,114,32,60,32,40,49,85,32,60,60,32,122,45,62,110,117,109,95,98,105,116,115,41,0,115,116,98,105,95,95,102,105,108,108,95,98,105,116,115,0,98,97,100,32,99,111,100,101,108,101,110,103,116,104,115,0,99,32,61,61,32,49,56,0,115,116,98,105,95,95,99,111,109,112,117,116,101,95,104,117,102,102,109,97,110,95,99,111,100,101,115,0,98,97,100,32,115,105,122,101,115,0,97,45,62,110,117,109,95,98,105,116,115,32,61,61,32,48,0,115,116,98,105,95,95,112,97,114,115,101,95,117,110,99,111,109,112,114,101,115,115,101,100,95,98,108,111,99,107,0,122,108,105,98,32,99,111,114,114,117,112,116,0,114,101,97,100,32,112,97,115,116,32,98,117,102,102,101,114,0,98,97,100,32,122,108,105,98,32,104,101,97,100,101,114,0,110,111,32,112,114,101,115,101,116,32,100,105,99,116,0,98,97,100,32,99,111,109,112,114,101,115,115,105,111,110,0,98,97,100,32,112,110,103,32,115,105,103,0,1,2,4,4,105,110,102,111,45,62,99,104,97,110,110,101,108,115,32,62,61,32,48,0,46,47,101,120,116,101,114,110,97,108,47,115,116,98,95,105,109,97,103,101,95,114,101,115,105,122,101,46,104,0,115,116,98,105,114,95,95,114,101,115,105,122,101,95,97,108,108,111,99,97,116,101,100,0,105,110,102,111,45,62,99,104,97,110,110,101,108,115,32,60,61,32,54,52,0,105,110,102,111,45,62,104,111,114,105,122,111,110,116,97,108,95,102,105,108,116,101,114,32,60,32,40,115,105,122,101,111,102,40,40,115,116,98,105,114,95,95,102,105,108,116,101,114,95,105,110,102,111,95,116,97,98,108,101,41,41,47,115,105,122,101,111,102,40,40,115,116,98,105,114,95,95,102,105,108,116,101,114,95,105,110,102,111,95,116,97,98,108,101,41,91,48,93,41,41,0,105,110,102,111,45,62,118,101,114,116,105,99,97,108,95,102,105,108,116,101,114,32,60,32,40,115,105,122,101,111,102,40,40,115,116,98,105,114,95,95,102,105,108,116,101,114,95,105,110,102,111,95,116,97,98,108,101,41,41,47,115,105,122,101,111,102,40,40,115,116,98,105,114,95,95,102,105,108,116,101,114,95,105,110,102,111,95,116,97,98,108,101,41,91,48,93,41,41,0,97,108,112,104,97,95,99,104,97,110,110,101,108,32,62,61,32,48,32,38,38,32,97,108,112,104,97,95,99,104,97,110,110,101,108,32,60,32,105,110,102,111,45,62,99,104,97,110,110,101,108,115,0,116,101,109,112,109,101,109,0,116,101,109,112,109,101,109,95,115,105,122,101,95,105,110,95,98,121,116,101,115,32,62,61,32,109,101,109,111,114,121,95,114,101,113,117,105,114,101,100,0,40,115,105,122,101,95,116,41,40,117,110,115,105,103,110,101,100,32,99,104,97,114,42,41,40,40,40,117,110,115,105,103,110,101,100,32,99,104,97,114,42,41,105,110,102,111,45,62,101,110,99,111,100,101,95,98,117,102,102,101,114,41,32,43,32,105,110,102,111,45,62,101,110,99,111,100,101,95,98,117,102,102,101,114,95,115,105,122,101,41,32,61,61,32,40,115,105,122,101,95,116,41,116,101,109,112,109,101,109,32,43,32,116,101,109,112,109,101,109,95,115,105,122,101,95,105,110,95,98,121,116,101,115,0,40,115,105,122,101,95,116,41,40,117,110,115,105,103,110,101,100,32,99,104,97,114,42,41,40,40,40,117,110,115,105,103,110,101,100,32,99,104,97,114,42,41,105,110,102,111,45,62,114,105,110,103,95,98,117,102,102,101,114,41,32,43,32,105,110,102,111,45,62,114,105,110,103,95,98,117,102,102,101,114,95,115,105,122,101,41,32,61,61,32,40,115,105,122,101,95,116,41,116,101,109,112,109,101,109,32,43,32,116,101,109,112,109,101,109,95,115,105,122,101,95,105,110,95,98,121,116,101,115,0,33,115,116,98,105,114,95,95,117,115,101,95,104,101,105,103,104,116,95,117,112,115,97,109,112,108,105,110,103,40,115,116,98,105,114,95,105,110,102,111,41,0,115,116,98,105,114,95,95,98,117,102,102,101,114,95,108,111,111,112,95,100,111,119,110,115,97,109,112,108,101,0,111,117,116,95,108,97,115,116,95,115,99,97,110,108,105,110,101,32,45,32,111,117,116,95,102,105,114,115,116,95,115,99,97,110,108,105,110,101,32,43,32,49,32,60,61,32,115,116,98,105,114,95,105,110,102,111,45,62,114,105,110,103,95,98,117,102,102,101,114,95,110,117,109,95,101,110,116,114,105,101,115,0,115,116,98,105,114,95,95,114,101,115,97,109,112,108,101,95,118,101,114,116,105,99,97,108,95,100,111,119,110,115,97,109,112,108,101,0,114,105,110,103,95,98,117,102,102,101,114,95,105,110,100,101,120,32,33,61,32,115,116,98,105,114,95,105,110,102,111,45,62,114,105,110,103,95,98,117,102,102,101,114,95,98,101,103,105,110,95,105,110,100,101,120,0,115,116,98,105,114,95,95,97,100,100,95,101,109,112,116,121,95,114,105,110,103,95,98,117,102,102,101,114,95,101,110,116,114,121,0,33,115,116,98,105,114,95,95,117,115,101,95,119,105,100,116,104,95,117,112,115,97,109,112,108,105,110,103,40,115,116,98,105,114,95,105,110,102,111,41,0,115,116,98,105,114,95,95,114,101,115,97,109,112,108,101,95,104,111,114,105,122,111,110,116,97,108,95,100,111,119,110,115,97,109,112,108,101,0,99,111,101,102,102,105,99,105,101,110,116,32,33,61,32,48,0,110,49,32,62,61,32,110,48,0,115,116,98,105,114,95,95,114,101,115,97,109,112,108,101,95,104,111,114,105,122,111,110,116,97,108,95,117,112,115,97,109,112,108,101,0,110,48,32,62,61,32,45,115,116,98,105,114,95,105,110,102,111,45,62,104,111,114,105,122,111,110,116,97,108,95,102,105,108,116,101,114,95,112,105,120,101,108,95,109,97,114,103,105,110,0,110,49,32,62,61,32,45,115,116,98,105,114,95,105,110,102,111,45,62,104,111,114,105,122,111,110,116,97,108,95,102,105,108,116,101,114,95,112,105,120,101,108,95,109,97,114,103,105,110,0,110,48,32,60,32,115,116,98,105,114,95,105,110,102,111,45,62,105,110,112,117,116,95,119,32,43,32,115,116,98,105,114,95,105,110,102,111,45,62,104,111,114,105,122,111,110,116,97,108,95,102,105,108,116,101,114,95,112,105,120,101,108,95,109,97,114,103,105,110,0,110,49,32,60,32,115,116,98,105,114,95,105,110,102,111,45,62,105,110,112,117,116,95,119,32,43,32,115,116,98,105,114,95,105,110,102,111,45,62,104,111,114,105,122,111,110,116,97,108,95,102,105,108,116,101,114,95,112,105,120,101,108,95,109,97,114,103,105,110,0,33,34,85,110,107,110,111,119,110,32,116,121,112,101,47,99,111,108,111,114,115,112,97,99,101,47,99,104,97,110,110,101,108,115,32,99,111,109,98,105,110,97,116,105,111,110,46,34,0,115,116,98,105,114,95,95,100,101,99,111,100,101,95,115,99,97,110,108,105,110,101,0,33,34,85,110,105,109,112,108,101,109,101,110,116,101,100,32,101,100,103,101,32,116,121,112,101,34,0,115,116,98,105,114,95,95,101,100,103,101,95,119,114,97,112,95,115,108,111,119,0,115,116,98,105,114,95,95,101,110,99,111,100,101,95,115,99,97,110,108,105,110,101,0,115,99,97,108,101,32,60,61,32,49,0,115,116,98,105,114,95,95,115,117,112,112,111,114,116,95,116,114,97,112,101,122,111,105,100,0,115,116,98,105,114,95,95,102,105,108,116,101,114,95,116,114,97,112,101,122,111,105,100,0,115,116,98,105,114,95,95,117,115,101,95,104,101,105,103,104,116,95,117,112,115,97,109,112,108,105,110,103,40,115,116,98,105,114,95,105,110,102,111,41,0,115,116,98,105,114,95,95,98,117,102,102,101,114,95,108,111,111,112,95,117,112,115,97,109,112,108,101,0,105,110,95,108,97,115,116,95,115,99,97,110,108,105,110,101,32,45,32,105,110,95,102,105,114,115,116,95,115,99,97,110,108,105,110,101,32,43,32,49,32,60,61,32,115,116,98,105,114,95,105,110,102,111,45,62,114,105,110,103,95,98,117,102,102,101,114,95,110,117,109,95,101,110,116,114,105,101,115,0,115,116,98,105,114,95,95,114,101,115,97,109,112,108,101,95,118,101,114,116,105,99,97,108,95,117,112,115,97,109,112,108,101,0,116,111,116,97,108,32,62,32,48,46,57,102,0,115,116,98,105,114,95,95,110,111,114,109,97,108,105,122,101,95,100,111,119,110,115,97,109,112,108,101,95,99,111,101,102,102,105,99,105,101,110,116,115,0,116,111,116,97,108,32,60,32,49,46,49,102,0,111,117,116,95,108,97,115,116,95,112,105,120,101,108,32,45,32,111,117,116,95,102,105,114,115,116,95,112,105,120,101,108,32,60,61,32,40,105,110,116,41,99,101,105,108,40,115,116,98,105,114,95,95,102,105,108,116,101,114,95,105,110,102,111,95,116,97,98,108,101,91,102,105,108,116,101,114,93,46,115,117,112,112,111,114,116,40,115,99,97,108,101,95,114,97,116,105,111,41,32,42,32,50,41,0,115,116,98,105,114,95,95,99,97,108,99,117,108,97,116,101,95,99,111,101,102,102,105,99,105,101,110,116,115,95,100,111,119,110,115,97,109,112,108,101,0,99,111,110,116,114,105,98,117,116,111,114,45,62,110,49,32,62,61,32,99,111,110,116,114,105,98,117,116,111,114,45,62,110,48,0,115,116,98,105,114,95,95,102,105,108,116,101,114,95,105,110,102,111,95,116,97,98,108,101,91,102,105,108,116,101,114,93,46,107,101,114,110,101,108,40,40,102,108,111,97,116,41,40,111,117,116,95,108,97,115,116,95,112,105,120,101,108,32,43,32,49,41,32,43,32,48,46,53,102,32,45,32,111,117,116,95,99,101,110,116,101,114,95,111,102,95,105,110,44,32,115,99,97,108,101,95,114,97,116,105,111,41,32,61,61,32,48,0,105,110,95,108,97,115,116,95,112,105,120,101,108,32,45,32,105,110,95,102,105,114,115,116,95,112,105,120,101,108,32,60,61,32,40,105,110,116,41,99,101,105,108,40,115,116,98,105,114,95,95,102,105,108,116,101,114,95,105,110,102,111,95,116,97,98,108,101,91,102,105,108,116,101,114,93,46,115,117,112,112,111,114,116,40,49,47,115,99,97,108,101,41,32,42,32,50,41,0,115,116,98,105,114,95,95,99,97,108,99,117,108,97,116,101,95,99,111,101,102,102,105,99,105,101,110,116,115,95,117,112,115,97,109,112,108,101,0,115,116,98,105,114,95,95,102,105,108,116,101,114,95,105,110,102,111,95,116,97,98,108,101,91,102,105,108,116,101,114,93,46,107,101,114,110,101,108,40,40,102,108,111,97,116,41,40,105,110,95,108,97,115,116,95,112,105,120,101,108,32,43,32,49,41,32,43,32,48,46,53,102,32,45,32,105,110,95,99,101,110,116,101,114,95,111,102,95,111,117,116,44,32,49,47,115,99,97,108,101,41,32,61,61,32,48,0,116,111,116,97,108,95,102,105,108,116,101,114,32,62,32,48,46,57,0,116,111,116,97,108,95,102,105,108,116,101,114,32,60,32,49,46,49,102,0,102,105,108,116,101,114,32,33,61,32,48,0,115,116,98,105,114,95,95,103,101,116,95,102,105,108,116,101,114,95,112,105,120,101,108,95,119,105,100,116,104,0,102,105,108,116,101,114,32,60,32,40,115,105,122,101,111,102,40,40,115,116,98,105,114,95,95,102,105,108,116,101,114,95,105,110,102,111,95,116,97,98,108,101,41,41,47,115,105,122,101,111,102,40,40,115,116,98,105,114,95,95,102,105,108,116,101,114,95,105,110,102,111,95,116,97,98,108,101,41,91,48,93,41,41,0,105,110,102,111,45,62,104,111,114,105,122,111,110,116,97,108,95,102,105,108,116,101,114,32,33,61,32,48,0,115,116,98,105,114,95,95,99,97,108,99,117,108,97,116,101,95,109,101,109,111,114,121,0,105,110,102,111,45,62,118,101,114,116,105,99,97,108,95,102,105,108,116,101,114,32,33,61,32,48,0,46,114,114,101,115,0,91,37,115,93,32,82,101,115,111,117,114,99,101,32,102,105,108,101,32,100,111,101,115,32,110,111,116,32,99,111,110,116,97,105,110,32,105,109,97,103,101,32,100,97,116,97,0,46,112,110,103,0,46,103,105,102,0,46,104,100,114,0,91,37,115,93,32,73,109,97,103,101,32,102,105,108,101,102,111,114,109,97,116,32,110,111,116,32,115,117,112,112,111,114,116,101,100,32,40,111,110,108,121,32,51,32,99,104,97,110,110,101,108,32,51,50,32,98,105,116,32,102,108,111,97,116,115,41,0,46,100,100,115,0,46,107], "i8", ALLOC_NONE, Runtime.GLOBAL_BASE+20480); +/* memory initializer */ allocate([116,120,0,46,97,115,116,99,0,91,37,115,93,32,73,109,97,103,101,32,102,105,108,101,102,111,114,109,97,116,32,110,111,116,32,115,117,112,112,111,114,116,101,100,0,91,37,115,93,32,73,109,97,103,101,32,108,111,97,100,101,100,32,115,117,99,99,101,115,115,102,117,108,108,121,32,40,37,105,120,37,105,41,0,91,37,115,93,32,73,109,97,103,101,32,99,111,117,108,100,32,110,111,116,32,98,101,32,108,111,97,100,101,100,0,91,37,115,93,32,65,83,84,67,32,102,105,108,101,32,99,111,117,108,100,32,110,111,116,32,98,101,32,111,112,101,110,101,100,0,91,37,115,93,32,65,83,84,67,32,102,105,108,101,32,100,111,101,115,32,110,111,116,32,115,101,101,109,32,116,111,32,98,101,32,97,32,118,97,108,105,100,32,105,109,97,103,101,0,65,83,84,67,32,105,109,97,103,101,32,119,105,100,116,104,58,32,37,105,0,65,83,84,67,32,105,109,97,103,101,32,104,101,105,103,104,116,58,32,37,105,0,65,83,84,67,32,105,109,97,103,101,32,98,108,111,99,107,115,58,32,37,105,120,37,105,0,91,37,115,93,32,65,83,84,67,32,98,108,111,99,107,32,115,105,122,101,32,99,111,110,102,105,103,117,114,97,116,105,111,110,32,110,111,116,32,115,117,112,112,111,114,116,101,100,0,91,37,115,93,32,75,84,88,32,105,109,97,103,101,32,102,105,108,101,32,99,111,117,108,100,32,110,111,116,32,98,101,32,111,112,101,110,101,100,0,91,37,115,93,32,75,84,88,32,102,105,108,101,32,100,111,101,115,32,110,111,116,32,115,101,101,109,32,116,111,32,98,101,32,97,32,118,97,108,105,100,32,102,105,108,101,0,75,84,88,32,40,69,84,67,41,32,105,109,97,103,101,32,119,105,100,116,104,58,32,37,105,0,75,84,88,32,40,69,84,67,41,32,105,109,97,103,101,32,104,101,105,103,104,116,58,32,37,105,0,75,84,88,32,40,69,84,67,41,32,105,109,97,103,101,32,102,111,114,109,97,116,58,32,48,120,37,120,0,91,37,115,93,32,68,68,83,32,102,105,108,101,32,99,111,117,108,100,32,110,111,116,32,98,101,32,111,112,101,110,101,100,0,68,68,83,32,0,91,37,115,93,32,68,68,83,32,102,105,108,101,32,100,111,101,115,32,110,111,116,32,115,101,101,109,32,116,111,32,98,101,32,97,32,118,97,108,105,100,32,105,109,97,103,101,0,91,37,115,93,32,68,68,83,32,102,105,108,101,32,104,101,97,100,101,114,32,115,105,122,101,58,32,37,105,0,91,37,115,93,32,68,68,83,32,102,105,108,101,32,112,105,120,101,108,32,102,111,114,109,97,116,32,115,105,122,101,58,32,37,105,0,91,37,115,93,32,68,68,83,32,102,105,108,101,32,112,105,120,101,108,32,102,111,114,109,97,116,32,102,108,97,103,115,58,32,48,120,37,120,0,91,37,115,93,32,68,68,83,32,102,105,108,101,32,102,111,114,109,97,116,58,32,48,120,37,120,0,91,37,115,93,32,68,68,83,32,102,105,108,101,32,98,105,116,32,99,111,117,110,116,58,32,48,120,37,120,0,80,105,116,99,104,32,111,114,32,108,105,110,101,97,114,32,115,105,122,101,58,32,37,105,0,73,109,97,103,101,32,102,111,114,109,97,116,32,110,111,116,32,114,101,99,111,103,110,105,122,101,100,0,91,37,115,93,32,82,65,87,32,105,109,97,103,101,32,102,105,108,101,32,99,111,117,108,100,32,110,111,116,32,98,101,32,111,112,101,110,101,100,0,73,109,97,103,101,32,102,111,114,109,97,116,32,110,111,116,32,115,117,112,111,114,116,101,100,0,91,37,115,93,32,82,65,87,32,105,109,97,103,101,32,100,97,116,97,32,99,97,110,32,110,111,116,32,98,101,32,114,101,97,100,44,32,119,114,111,110,103,32,114,101,113,117,101,115,116,101,100,32,102,111,114,109,97,116,32,111,114,32,115,105,122,101,0,84,101,120,116,117,114,101,32,99,111,117,108,100,32,110,111,116,32,98,101,32,99,114,101,97,116,101,100,0,91,84,69,88,32,73,68,32,37,105,93,32,80,97,114,97,109,101,116,101,114,115,58,32,37,105,120,37,105,44,32,37,105,32,109,105,112,115,44,32,102,111,114,109,97,116,32,37,105,0,91,84,69,88,32,73,68,32,37,105,93,32,85,110,108,111,97,100,101,100,32,116,101,120,116,117,114,101,32,100,97,116,97,32,102,114,111,109,32,86,82,65,77,32,40,71,80,85,41,0,70,111,114,109,97,116,32,110,111,116,32,115,117,112,112,111,114,116,101,100,32,102,111,114,32,112,105,120,101,108,32,100,97,116,97,32,114,101,116,114,105,101,118,97,108,0,84,101,120,116,117,114,101,32,112,105,120,101,108,32,100,97,116,97,32,111,98,116,97,105,110,101,100,32,115,117,99,99,101,115,115,102,117,108,108,121,0,84,101,120,116,117,114,101,32,112,105,120,101,108,32,100,97,116,97,32,99,111,117,108,100,32,110,111,116,32,98,101,32,111,98,116,97,105,110,101,100,0,67,111,109,112,114,101,115,115,101,100,32,116,101,120,116,117,114,101,32,100,97,116,97,32,99,111,117,108,100,32,110,111,116,32,98,101,32,111,98,116,97,105,110,101,100,0,73,109,97,103,101,32,100,97,116,97,32,102,111,114,109,97,116,32,105,115,32,99,111,109,112,114,101,115,115,101,100,44,32,99,97,110,32,110,111,116,32,98,101,32,99,111,110,118,101,114,116,101,100,0,65,108,112,104,97,32,109,97,115,107,32,109,117,115,116,32,98,101,32,115,97,109,101,32,115,105,122,101,32,97,115,32,105,109,97,103,101,0,65,108,112,104,97,32,109,97,115,107,32,99,97,110,32,110,111,116,32,98,101,32,97,112,112,108,105,101,100,32,116,111,32,99,111,109,112,114,101,115,115,101,100,32,100,97,116,97,32,102,111,114,109,97,116,115,0,73,109,97,103,101,32,99,111,110,118,101,114,116,101,100,32,116,111,32,80,79,84,58,32,40,37,105,120,37,105,41,32,45,62,32,40,37,105,120,37,105,41,0,67,114,111,112,32,114,101,99,116,97,110,103,108,101,32,119,105,100,116,104,32,111,117,116,32,111,102,32,98,111,117,110,100,115,44,32,114,101,115,99,97,108,101,100,32,99,114,111,112,32,119,105,100,116,104,58,32,37,105,0,67,114,111,112,32,114,101,99,116,97,110,103,108,101,32,104,101,105,103,104,116,32,111,117,116,32,111,102,32,98,111,117,110,100,115,44,32,114,101,115,99,97,108,101,100,32,99,114,111,112,32,104,101,105,103,104,116,58,32,37,105,0,73,109,97,103,101,32,99,97,110,32,110,111,116,32,98,101,32,99,114,111,112,112,101,100,44,32,99,114,111,112,32,114,101,99,116,97,110,103,108,101,32,111,117,116,32,111,102,32,98,111,117,110,100,115,0,83,111,117,114,99,101,32,114,101,99,116,97,110,103,108,101,32,119,105,100,116,104,32,111,117,116,32,111,102,32,98,111,117,110,100,115,44,32,114,101,115,99,97,108,101,100,32,119,105,100,116,104,58,32,37,105,0,83,111,117,114,99,101,32,114,101,99,116,97,110,103,108,101,32,104,101,105,103,104,116,32,111,117,116,32,111,102,32,98,111,117,110,100,115,44,32,114,101,115,99,97,108,101,100,32,104,101,105,103,104,116,58,32,37,105,0,68,101,115,116,105,110,97,116,105,111,110,32,114,101,99,116,97,110,103,108,101,32,119,105,100,116,104,32,111,117,116,32,111,102,32,98,111,117,110,100,115,44,32,114,101,115,99,97,108,101,100,32,119,105,100,116,104,58,32,37,105,0,68,101,115,116,105,110,97,116,105,111,110,32,114,101,99,116,97,110,103,108,101,32,104,101,105,103,104,116,32,111,117,116,32,111,102,32,98,111,117,110,100,115,44,32,114,101,115,99,97,108,101,100,32,104,101,105,103,104,116,58,32,37,105,0,84,101,120,116,32,73,109,97,103,101,32,115,105,122,101,58,32,37,102,44,32,37,102,0,83,99,97,108,101,102,97,99,116,111,114,58,32,37,102,0,67,111,109,112,114,101,115,115,101,100,32,100,97,116,97,32,102,111,114,109,97,116,115,32,99,97,110,32,110,111,116,32,98,101,32,100,105,116,104,101,114,101,100,0,85,110,115,117,112,112,111,114,116,101,100,32,100,105,116,104,101,114,105,110,103,32,98,112,112,115,32,40,37,105,98,112,112,41,44,32,111,110,108,121,32,49,54,98,112,112,32,111,114,32,108,111,119,101,114,32,109,111,100,101,115,32,115,117,112,112,111,114,116,101,100,0,73,109,97,103,101,32,102,111,114,109,97,116,32,105,115,32,97,108,114,101,97,100,121,32,49,54,98,112,112,32,111,114,32,108,111,119,101,114,44,32,100,105,116,104,101,114,105,110,103,32,99,111,117,108,100,32,104,97,118,101,32,110,111,32,101,102,102,101,99,116,0,85,110,115,117,112,112,111,114,116,101,100,32,100,105,116,104,101,114,101,100,32,79,112,101,110,71,76,32,105,110,116,101,114,110,97,108,32,102,111,114,109,97,116,58,32,37,105,98,112,112,32,40,82,37,105,71,37,105,66,37,105,65,37,105,41,0,73,110,102,0,76,105,109,105,116,101,100,32,78,80,79,84,32,115,117,112,112,111,114,116,44,32,110,111,32,109,105,112,109,97,112,115,32,97,118,97,105,108,97,98,108,101,32,102,111,114,32,78,80,79,84,32,116,101,120,116,117,114,101,115,0,91,84,69,88,32,73,68,32,37,105,93,32,78,111,32,109,105,112,109,97,112,115,32,97,118,97,105,108,97,98,108,101,32,102,111,114,32,84,82,73,76,73,78,69,65,82,32,116,101,120,116,117,114,101,32,102,105,108,116,101,114,105,110,103,0,5,5,4,0,16,17,18,0,8,7,9,6,10,5,11,4,12,3,13,2,14,1,15,2,3,7,0,3,3,11,0,91,37,115,93,32,114,82,69,83,32,114,97,121,108,105,98,32,114,101,115,111,117,114,99,101,32,102,105,108,101,32,99,111,117,108,100,32,110,111,116,32,98,101,32,111,112,101,110,101,100,0,91,37,115,93,32,84,104,105,115,32,105,115,32,110,111,116,32,97,32,118,97,108,105,100,32,114,97,121,108,105,98,32,114,101,115,111,117,114,99,101,32,102,105,108,101,0,91,37,115,93,91,73,68,32,37,105,93,32,82,101,115,111,117,114,99,101,32,100,97,116,97,32,108,111,97,100,101,100,32,115,117,99,99,101,115,115,102,117,108,108,121,0,91,37,115,93,91,73,68,32,37,105,93,32,82,101,113,117,101,115,116,101,100,32,114,101,115,111,117,114,99,101,32,99,111,117,108,100,32,110,111,116,32,98,101,32,102,111,117,110,100,0,79,117,116,32,111,102,32,109,101,109,111,114,121,32,119,104,105,108,101,32,100,101,99,111,109,112,114,101,115,115,105,110,103,32,100,97,116,97,0,68,97,116,97,32,100,101,99,111,109,112,114,101,115,115,105,111,110,32,102,97,105,108,101,100,0,69,120,112,101,99,116,101,100,32,117,110,99,111,109,112,114,101,115,115,101,100,32,115,105,122,101,32,100,111,32,110,111,116,32,109,97,116,99,104,44,32,100,97,116,97,32,109,97,121,32,98,101,32,99,111,114,114,117,112,116,101,100,0,32,45,45,32,69,120,112,101,99,116,101,100,32,117,110,99,111,109,112,114,101,115,115,101,100,32,115,105,122,101,58,32,37,105,0,32,45,45,32,82,101,116,117,114,110,101,100,32,117,110,99,111,109,112,114,101,115,115,101,100,32,115,105,122,101,58,32,37,105,0,68,97,116,97,32,100,101,99,111,109,112,114,101,115,115,101,100,32,115,117,99,99,101,115,115,102,117,108,108,121,32,102,114,111,109,32,37,117,32,98,121,116,101,115,32,116,111,32,37,117,32,98,121,116,101,115,0,73,78,70,79,58,32,0,87,65,82,78,73,78,71,58,32,0,48,0,101,120,116,101,114,110,97,108,47,115,116,98,95,118,111,114,98,105,115,46,99,0,103,101,116,95,119,105,110,100,111,119,0,102,45,62,98,121,116,101,115,95,105,110,95,115,101,103,32,62,32,48,0,103,101,116,56,95,112,97,99,107,101,116,95,114,97,119,0,102,45,62,98,121,116,101,115,95,105,110,95,115,101,103,32,61,61,32,48,0,110,101,120,116,95,115,101,103,109,101,110,116,0,102,45,62,97,108,108,111,99,46,97,108,108,111,99,95,98,117,102,102,101,114,95,108,101,110,103,116,104,95,105,110,95,98,121,116,101,115,32,61,61,32,102,45,62,116,101,109,112,95,111,102,102,115,101,116,0,118,111,114,98,105,115,95,100,101,99,111,100,101,95,112,97,99,107,101,116,95,114,101,115,116,0,40,110,32,38,32,51,41,32,61,61,32,48,0,105,109,100,99,116,95,115,116,101,112,51,95,105,116,101,114,48,95,108,111,111,112,0,122,32,60,32,99,45,62,115,111,114,116,101,100,95,101,110,116,114,105,101,115,0,99,111,100,101,98,111,111,107,95,100,101,99,111,100,101,95,115,116,97,114,116,0,33,99,45,62,115,112,97,114,115,101,32,124,124,32,122,32,60,32,99,45,62,115,111,114,116,101,100,95,101,110,116,114,105,101,115,0,99,111,100,101,98,111,111,107,95,100,101,99,111,100,101,95,100,101,105,110,116,101,114,108,101,97,118,101,95,114,101,112,101,97,116,0,33,99,45,62,115,112,97,114,115,101,0,99,111,100,101,98,111,111,107,95,100,101,99,111,100,101,95,115,99,97,108,97,114,95,114,97,119,0,0,1,2,2,3,3,3,3,4,4,4,4,4,4,4,4,118,111,114,98,105,115,95,100,101,99,111,100,101,95,105,110,105,116,105,97,108,0,102,45,62,116,101,109,112,95,111,102,102,115,101,116,32,61,61,32,102,45,62,97,108,108,111,99,46,97,108,108,111,99,95,98,117,102,102,101,114,95,108,101,110,103,116,104,95,105,110,95,98,121,116,101,115,0,115,116,97,114,116,95,100,101,99,111,100,101,114,0,112,111,119,40,40,102,108,111,97,116,41,32,114,43,49,44,32,100,105,109,41,32,62,32,101,110,116,114,105,101,115,0,108,111,111,107,117,112,49,95,118,97,108,117,101,115,0,40,105,110,116,41,32,102,108,111,111,114,40,112,111,119,40,40,102,108,111,97,116,41,32,114,44,32,100,105,109,41,41,32,60,61,32,101,110,116,114,105,101,115,0,107,32,61,61,32,99,45,62,115,111,114,116,101,100,95,101,110,116,114,105,101,115,0,99,111,109,112,117,116,101,95,115,111,114,116,101,100,95,104,117,102,102,109,97,110,0,99,45,62,115,111,114,116,101,100,95,99,111,100,101,119,111,114,100,115,91,120,93,32,61,61,32,99,111,100,101,0,108,101,110,32,33,61,32,78,79,95,67,79,68,69,0,105,110,99,108,117,100,101,95,105,110,95,115,111,114,116,0,99,45,62,115,111,114,116,101,100,95,101,110,116,114,105,101,115,32,61,61,32,48,0,99,111,109,112,117,116,101,95,99,111,100,101,119,111,114,100,115,0,122,32,62,61,32,48,32,38,38,32,122,32,60,32,51,50,0,108,101,110,91,105,93,32,62,61,32,48,32,38,38,32,108,101,110,91,105,93,32,60,32,51,50,0,97,118,97,105,108,97,98,108,101,91,121,93,32,61,61,32,48,0,118,111,114,98,105,115,114,98,0,0,0,0,0,0,0,7,0,0,0,0,0,3,5,0,0,0,0,3,7,5,0,0,0,3,5,3,5,0,0,3,7,5,3,5,0,3,7,5,3,5,7,98,117,102,95,99,32,61,61,32,50,0,99,111,110,118,101,114,116,95,99,104,97,110,110,101,108,115,95,115,104,111,114,116,95,105,110,116,101,114,108,101,97,118,101,100,0,69,88,84,0,65,82,66,0,79,69,83,0,65,78,71,76,69,0,103,108,67,114,101,97,116,101,80,114,111,103,114,97,109,79,98,106,101,99,116,0,103,108,67,114,101,97,116,101,80,114,111,103,114,97,109,0,103,108,85,115,101,80,114,111,103,114,97,109,79,98,106,101,99,116,0,103,108,85,115,101,80,114,111,103,114,97,109,0,103,108,67,114,101,97,116,101,83,104,97,100,101,114,79,98,106,101,99,116,0,103,108,67,114,101,97,116,101,83,104,97,100,101,114,0,103,108,65,116,116,97,99,104,79,98,106,101,99,116,0,103,108,65,116,116,97,99,104,83,104,97,100,101,114,0,103,108,68,101,116,97,99,104,79,98,106,101,99,116,0,103,108,68,101,116,97,99,104,83,104,97,100,101,114,0,103,108,80,105,120,101,108,83,116,111,114,101,105,0,103,108,71,101,116,83,116,114,105,110,103,0,103,108,71,101,116,73,110,116,101,103,101,114,118,0,103,108,71,101,116,70,108,111,97,116,118,0,103,108,71,101,116,66,111,111,108,101,97,110,118,0,103,108,71,101,110,84,101,120,116,117,114,101,115,0,103,108,68,101,108,101,116,101,84,101,120,116,117,114,101,115,0,103,108,67,111,109,112,114,101,115,115,101,100,84,101,120,73,109,97,103,101,50,68,0,103,108,67,111,109,112,114,101,115,115,101,100,84,101,120,83,117,98,73,109,97,103,101,50,68,0,103,108,84,101,120,73,109,97,103,101,50,68,0,103,108,84,101,120,83,117,98,73,109,97,103,101,50,68,0,103,108,82,101,97,100,80,105,120,101,108,115,0,103,108,66,105,110,100,84,101,120,116,117,114,101,0,103,108,71,101,116,84,101,120,80,97,114,97,109,101,116,101,114,102,118,0,103,108,71,101,116,84,101,120,80,97,114,97,109,101,116,101,114,105,118,0,103,108,84,101,120,80,97,114,97,109,101,116,101,114,102,118,0,103,108,84,101,120,80,97,114,97,109,101,116,101,114,105,118,0,103,108,73,115,84,101,120,116,117,114,101,0,103,108,71,101,110,66,117,102,102,101,114,115,0,103,108,68,101,108,101,116,101,66,117,102,102,101,114,115,0,103,108,71,101,116,66,117,102,102,101,114,80,97,114,97,109,101,116,101,114,105,118,0,103,108,66,117,102,102,101,114,68,97,116,97,0,103,108,66,117,102,102,101,114,83,117,98,68,97,116,97,0,103,108,73,115,66,117,102,102,101,114,0,103,108,71,101,110,82,101,110,100,101,114,98,117,102,102,101,114,115,0,103,108,68,101,108,101,116,101,82,101,110,100,101,114,98,117,102,102,101,114,115,0,103,108,66,105,110,100,82,101,110,100,101,114,98,117,102,102,101,114,0,103,108,71,101,116,82,101,110,100,101,114,98,117,102,102,101,114,80,97,114,97,109,101,116,101,114,105,118,0,103,108,73,115,82,101,110,100,101,114,98,117,102,102,101,114,0,103,108,71,101,116,85,110,105,102,111,114,109,102,118,0,103,108,71,101,116,85,110,105,102,111,114,109,105,118,0,103,108,71,101,116,85,110,105,102,111,114,109,76,111,99,97,116,105,111,110,0,103,108,71,101,116,86,101,114,116,101,120,65,116,116,114,105,98,102,118,0,103,108,71,101,116,86,101,114,116,101,120,65,116,116,114,105,98,105,118,0,103,108,71,101,116,86,101,114,116,101,120,65,116,116,114,105,98,80,111,105,110,116,101,114,118,0,103,108,71,101,116,65,99,116,105,118,101,85,110,105,102,111,114,109,0,103,108,85,110,105,102,111,114,109,49,102,0,103,108,85,110,105,102,111,114,109,50,102,0,103,108,85,110,105,102,111,114,109,51,102,0,103,108,85,110,105,102,111,114,109,52,102,0,103,108,85,110,105,102,111,114,109,49,105,0,103,108,85,110,105,102,111,114,109,50,105,0,103,108,85,110,105,102,111,114,109,51,105,0,103,108,85,110,105,102,111,114,109,52,105,0,103,108,85,110,105,102,111,114,109,49,105,118,0,103,108,85,110,105,102,111,114,109,50,105,118,0,103,108,85,110,105,102,111,114,109,51,105,118,0,103,108,85,110,105,102,111,114,109,52,105,118,0,103,108,85,110,105,102,111,114,109,49,102,118,0,103,108,85,110,105,102,111,114,109,50,102,118,0,103,108,85,110,105,102,111,114,109,51,102,118,0,103,108,85,110,105,102,111,114,109,52,102,118,0,103,108,85,110,105,102,111,114,109,77,97,116,114,105,120,50,102,118,0,103,108,85,110,105,102,111,114,109,77,97,116,114,105,120,51,102,118,0,103,108,85,110,105,102,111,114,109,77,97,116,114,105,120,52,102,118,0,103,108,66,105,110,100,66,117,102,102,101,114,0,103,108,86,101,114,116,101,120,65,116,116,114,105,98,49,102,118,0,103,108,86,101,114,116,101,120,65,116,116,114,105,98,50,102,118,0,103,108,86,101,114,116,101,120,65,116,116,114,105,98,51,102,118,0,103,108,86,101,114,116,101,120,65,116,116,114,105,98,52,102,118,0,103,108,71,101,116,65,116,116,114,105,98,76,111,99,97,116,105,111,110,0,103,108,71,101,116,65,99,116,105,118,101,65,116,116,114,105,98,0,103,108,68,101,108,101,116,101,83,104,97,100,101,114,0,103,108,71,101,116,65,116,116,97,99,104,101,100,83,104,97,100,101,114,115,0,103,108,83,104,97,100,101,114,83,111,117,114,99,101,0,103,108,71,101,116,83,104,97,100,101,114,83,111,117,114,99,101,0,103,108,67,111,109,112,105,108,101,83,104,97,100,101,114,0,103,108,71,101,116,83,104,97,100,101,114,73,110,102,111,76,111,103,0,103,108,71,101,116,83,104,97,100,101,114,105,118,0,103,108,71,101,116,80,114,111,103,114,97,109,105,118,0,103,108,73,115,83,104,97,100,101,114,0,103,108,68,101,108,101,116,101,80,114,111,103,114,97,109,0,103,108,71,101,116,83,104,97,100,101,114,80,114,101,99,105,115,105,111,110,70,111,114,109,97,116,0,103,108,76,105,110,107,80,114,111,103,114,97,109,0,103,108,71,101,116,80,114,111,103,114,97,109,73,110,102,111,76,111,103,0,103,108,86,97,108,105,100,97,116,101,80,114,111,103,114,97,109,0,103,108,73,115,80,114,111,103,114,97,109,0,103,108,66,105,110,100,65,116,116,114,105,98,76,111,99,97,116,105,111,110,0,103,108,66,105,110,100,70,114,97,109,101,98,117,102,102,101,114,0,103,108,71,101,110,70,114,97,109,101,98,117,102,102,101,114,115,0,103,108,68,101,108,101,116,101,70,114,97,109,101,98,117,102,102,101,114,115,0,103,108,70,114,97,109,101,98,117,102,102,101,114,82,101,110,100,101,114,98,117,102,102,101,114,0,103,108,70,114,97,109,101,98,117,102,102,101,114,84,101,120,116,117,114,101,50,68,0,103,108,71,101,116,70,114,97,109,101,98,117,102,102,101,114,65,116,116,97,99,104,109,101,110,116,80,97,114,97,109,101,116,101,114,105,118,0,103,108,73,115,70,114,97,109,101,98,117,102,102,101,114,0,103,108,68,101,108,101,116,101,79,98,106,101,99,116,0,103,108,71,101,116,79,98,106,101,99,116,80,97,114,97,109,101,116,101,114,105,118,0,103,108,71,101,116,73,110,102,111,76,111,103,0,103,108,66,105,110,100,80,114,111,103,114,97,109,0,103,108,71,101,116,80,111,105,110,116,101,114,118,0,103,108,68,114,97,119,82,97,110,103,101,69,108,101,109,101,110,116,115,0,103,108,69,110,97,98,108,101,67,108,105,101,110,116,83,116,97,116,101,0,103,108,86,101,114,116,101,120,80,111,105,110,116,101,114,0,103,108,84,101,120,67,111,111,114,100,80,111,105,110,116,101,114,0,103,108,78,111,114,109,97,108,80,111,105,110,116,101,114,0,103,108,67,111,108,111,114,80,111,105,110,116,101,114,0,103,108,67,108,105,101,110,116,65,99,116,105,118,101,84,101,120,116,117,114,101,0,103,108,73,115,86,101,114,116,101,120,65,114,114,97,121,0,103,108,71,101,110,86,101,114,116,101,120,65,114,114,97,121,115,0,103,108,68,101,108,101,116,101,86,101,114,116,101,120,65,114,114,97,121,115,0,103,108,66,105,110,100,86,101,114,116,101,120,65,114,114,97,121,0,103,108,77,97,116,114,105,120,77,111,100,101,0,103,108,76,111,97,100,73,100,101,110,116,105,116,121,0,103,108,76,111,97,100,77,97,116,114,105,120,102,0,103,108,70,114,117,115,116,117,109,0,103,108,82,111,116,97,116,101,102,0,103,108,86,101,114,116,101,120,65,116,116,114,105,98,80,111,105,110,116,101,114,0,103,108,69,110,97,98,108,101,86,101,114,116,101,120,65,116,116,114,105,98,65,114,114,97,121,0,103,108,68,105,115,97,98,108,101,86,101,114,116,101,120,65,116,116,114,105,98,65,114,114,97,121,0,103,108,68,114,97,119,65,114,114,97,121,115,0,103,108,68,114,97,119,69,108,101,109,101,110,116,115,0,103,108,83,104,97,100,101,114,66,105,110,97,114,121,0,103,108,82,101,108,101,97,115,101,83,104,97,100,101,114,67,111,109,112,105,108,101,114,0,103,108,71,101,116,69,114,114,111,114,0,103,108,86,101,114,116,101,120,65,116,116,114,105,98,68,105,118,105,115,111,114,0,103,108,68,114,97,119,65,114,114,97,121,115,73,110,115,116,97,110,99,101,100,0,103,108,68,114,97,119,69,108,101,109,101,110,116,115,73,110,115,116,97,110,99,101,100,0,103,108,70,105,110,105,115,104,0,103,108,70,108,117,115,104,0,103,108,67,108,101,97,114,68,101,112,116,104,0,103,108,67,108,101,97,114,68,101,112,116,104,102,0,103,108,68,101,112,116,104,70,117,110,99,0,103,108,69,110,97,98,108,101,0,103,108,68,105,115,97,98,108,101,0,103,108,70,114,111,110,116,70,97,99,101,0,103,108,67,117,108,108,70,97,99,101,0,103,108,67,108,101,97,114,0,103,108,76,105,110,101,87,105,100,116,104,0,103,108,67,108,101,97,114,83,116,101,110,99,105,108,0,103,108,68,101,112,116,104,77,97,115,107,0,103,108,83,116,101,110,99,105,108,77,97,115,107,0,103,108,67,104,101,99,107,70,114,97,109,101,98,117,102,102,101,114,83,116,97,116,117,115,0,103,108,71,101,110,101,114,97,116,101,77,105,112,109,97,112,0,103,108,65,99,116,105,118,101,84,101,120,116,117,114,101,0,103,108,66,108,101,110,100,69,113,117,97,116,105,111,110,0,103,108,73,115,69,110,97,98,108,101,100,0,103,108,66,108,101,110,100,70,117,110,99,0,103,108,66,108,101,110,100,69,113,117,97,116,105,111,110,83,101,112,97,114,97,116,101,0,103,108,68,101,112,116,104,82,97,110,103,101,0,103,108,68,101,112,116,104,82,97,110,103,101,102,0,103,108,83,116,101,110,99,105,108,77,97,115,107,83,101,112,97,114,97,116,101,0,103,108,72,105,110,116,0,103,108,80,111,108,121,103,111,110,79,102,102,115,101,116,0,103,108,86,101,114,116,101,120,65,116,116,114,105,98,49,102,0,103,108,83,97,109,112,108,101,67,111,118,101,114,97,103,101,0,103,108,84,101,120,80,97,114,97,109,101,116,101,114,105,0,103,108,84,101,120,80,97,114,97,109,101,116,101,114,102,0,103,108,86,101,114,116,101,120,65,116,116,114,105,98,50,102,0,103,108,83,116,101,110,99,105,108,70,117,110,99,0,103,108,83,116,101,110,99,105,108,79,112,0,103,108,86,105,101,119,112,111,114,116,0,103,108,67,108,101,97,114,67,111,108,111,114,0,103,108,83,99,105,115,115,111,114,0,103,108,86,101,114,116,101,120,65,116,116,114,105,98,51,102,0,103,108,67,111,108,111,114,77,97,115,107,0,103,108,82,101,110,100,101,114,98,117,102,102,101,114,83,116,111,114,97,103,101,0,103,108,66,108,101,110,100,70,117,110,99,83,101,112,97,114,97,116,101,0,103,108,66,108,101,110,100,67,111,108,111,114,0,103,108,83,116,101,110,99,105,108,70,117,110,99,83,101,112,97,114,97,116,101,0,103,108,83,116,101,110,99,105,108,79,112,83,101,112,97,114,97,116,101,0,103,108,86,101,114,116,101,120,65,116,116,114,105,98,52,102,0,103,108,67,111,112,121,84,101,120,73,109,97,103,101,50,68,0,103,108,67,111,112,121,84,101,120,83,117,98,73,109,97,103,101,50,68,0,103,108,68,114,97,119,66,117,102,102,101,114,115,0,77,111,100,117,108,101,46,112,114,105,110,116,69,114,114,40,39,98,97,100,32,110,97,109,101,32,105,110,32,103,101,116,80,114,111,99,65,100,100,114,101,115,115,58,32,39,32,43,32,91,80,111,105,110,116,101,114,95,115,116,114,105,110,103,105,102,121,40,36,48,41,44,32,80,111,105,110,116,101,114,95,115,116,114,105,110,103,105,102,121,40,36,49,41,93,41,0,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,0,1,2,3,4,5,6,7,8,9,255,255,255,255,255,255,255,10,11,12,13,14,15,16,17,18,19,20,21,22,23,24,25,26,27,28,29,30,31,32,33,34,35,255,255,255,255,255,255,10,11,12,13,14,15,16,17,18,19,20,21,22,23,24,25,26,27,28,29,30,31,32,33,34,35,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,255,0,1,2,4,7,3,6,5,0,17,0,10,0,17,17,17,0,0,0,0,5,0,0,0,0,0,0,9,0,0,0,0,11,0,0,0,0,0,0,0,0,17,0,15,10,17,17,17,3,10,7,0,1,19,9,11,11,0,0,9,6,11,0,0,11,0,6,17,0,0,0,17,17,17,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,11,0,0,0,0,0,0,0,0,17,0,10,10,17,17,17,0,10,0,0,2,0,9,11,0,0,0,9,0,11,0,0,11,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,12,0,0,0,0,0,0,0,0,0,0,0,12,0,0,0,0,12,0,0,0,0,9,12,0,0,0,0,0,12,0,0,12,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,14,0,0,0,0,0,0,0,0,0,0,0,13,0,0,0,4,13,0,0,0,0,9,14,0,0,0,0,0,14,0,0,14,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,16,0,0,0,0,0,0,0,0,0,0,0,15,0,0,0,0,15,0,0,0,0,9,16,0,0,0,0,0,16,0,0,16,0,0,18,0,0,0,18,18,18,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,18,0,0,0,18,18,18,0,0,0,0,0,0,9,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,11,0,0,0,0,0,0,0,0,0,0,0,10,0,0,0,0,10,0,0,0,0,9,11,0,0,0,0,0,11,0,0,11,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,12,0,0,0,0,0,0,0,0,0,0,0,12,0,0,0,0,12,0,0,0,0,9,12,0,0,0,0,0,12,0,0,12,0,0,45,43,32,32,32,48,88,48,120,0,40,110,117,108,108,41,0,45,48,88,43,48,88,32,48,88,45,48,120,43,48,120,32,48,120,0,105,110,102,0,73,78,70,0,78,65,78,0,48,49,50,51,52,53,54,55,56,57,65,66,67,68,69,70,46,0,84,33,34,25,13,1,2,3,17,75,28,12,16,4,11,29,18,30,39,104,110,111,112,113,98,32,5,6,15,19,20,21,26,8,22,7,40,36,23,24,9,10,14,27,31,37,35,131,130,125,38,42,43,60,61,62,63,67,71,74,77,88,89,90,91,92,93,94,95,96,97,99,100,101,102,103,105,106,107,108,114,115,116,121,122,123,124,0,73,108,108,101,103,97,108,32,98,121,116,101,32,115,101,113,117,101,110,99,101,0,68,111,109,97,105,110,32,101,114,114,111,114,0,82,101,115,117,108,116,32,110,111,116,32,114,101,112,114,101,115,101,110,116,97,98,108,101,0,78,111,116,32,97,32,116,116,121,0,80,101,114,109,105,115,115,105,111,110,32,100,101,110,105,101,100,0,79,112,101,114,97,116,105,111,110,32,110,111,116,32,112,101,114,109,105,116,116,101,100,0,78,111,32,115,117,99,104,32,102,105,108,101,32,111,114,32,100,105,114,101,99,116,111,114,121,0,78,111,32,115,117,99,104,32,112,114,111,99,101,115,115,0,70,105,108,101,32,101,120,105,115,116,115,0,86,97,108,117,101,32,116,111,111,32,108,97,114,103,101,32,102,111,114,32,100,97,116,97,32,116,121,112,101,0,78,111,32,115,112,97,99,101,32,108,101,102,116,32,111,110,32,100,101,118,105,99,101,0,79,117,116,32,111,102,32,109,101,109,111,114,121,0,82,101,115,111,117,114,99,101,32,98,117,115,121,0,73,110,116,101,114,114,117,112,116,101,100,32,115,121,115,116,101,109,32,99,97,108,108,0,82,101,115,111,117,114,99,101,32,116,101,109,112,111,114,97,114,105,108,121,32,117,110,97,118,97,105,108,97,98,108,101,0,73,110,118,97,108,105,100,32,115,101,101,107,0,67,114,111,115,115,45,100,101,118,105,99,101,32,108,105,110,107,0,82,101,97,100,45,111,110,108,121,32,102,105,108,101,32,115,121,115,116,101,109,0,68,105,114,101,99,116,111,114,121,32,110,111,116,32,101,109,112,116,121,0,67,111,110,110,101,99,116,105,111,110,32,114,101,115,101,116,32,98,121,32,112,101,101,114,0,79,112,101,114,97,116,105,111,110,32,116,105,109,101,100,32,111,117,116,0,67,111,110,110,101,99,116,105,111,110,32,114,101,102,117,115,101,100,0,72,111,115,116,32,105,115,32,100,111,119,110,0,72,111,115,116,32,105,115,32,117,110,114,101,97,99,104,97,98,108,101,0,65,100,100,114,101,115,115,32,105,110,32,117,115,101,0,66,114,111,107,101,110,32,112,105,112,101,0,73,47,79,32,101,114,114,111,114,0,78,111,32,115,117,99,104,32,100,101,118,105,99,101,32,111,114,32,97,100,100,114,101,115,115,0,66,108,111,99,107,32,100,101,118,105,99,101,32,114,101,113,117,105,114,101,100,0,78,111,32,115,117,99,104,32,100,101,118,105,99,101,0,78,111,116,32,97,32,100,105,114,101,99,116,111,114,121,0,73,115,32,97,32,100,105,114,101,99,116,111,114,121,0,84,101,120,116,32,102,105,108,101,32,98,117,115,121,0,69,120,101,99,32,102,111,114,109,97,116,32,101,114,114,111,114,0,73,110,118,97,108,105,100,32,97,114,103,117,109,101,110,116,0,65,114,103,117,109,101,110,116,32,108,105,115,116,32,116,111,111,32,108,111,110,103,0,83,121,109,98,111,108,105,99,32,108,105,110,107,32,108,111,111,112,0,70,105,108,101,110,97,109,101,32,116,111,111,32,108,111,110,103,0,84,111,111,32,109,97,110,121,32,111,112,101,110,32,102,105,108,101,115,32,105,110,32,115,121,115,116,101,109,0,78,111,32,102,105,108,101,32,100,101,115,99,114,105,112,116,111,114,115,32,97,118,97,105,108,97,98,108,101,0,66,97,100,32,102,105,108,101,32,100,101,115,99,114,105,112,116,111,114,0,78,111,32,99,104,105,108,100,32,112,114,111,99,101,115,115,0,66,97,100,32,97,100,100,114,101,115,115,0,70,105,108,101,32,116,111,111,32,108,97,114,103,101,0,84,111,111,32,109,97,110,121,32,108,105,110,107,115,0,78,111,32,108,111,99,107,115,32,97,118,97,105,108,97,98,108,101,0,82,101,115,111,117,114,99,101,32,100,101,97,100,108,111,99,107,32,119,111,117,108,100,32,111,99,99,117,114,0,83,116,97,116,101,32,110,111,116,32,114,101,99,111,118,101,114,97,98,108,101,0,80,114,101,118,105,111,117,115,32,111,119,110,101,114,32,100,105,101,100,0,79,112,101,114,97,116,105,111,110,32,99,97,110,99,101,108,101,100,0,70,117,110,99,116,105,111,110,32,110,111,116,32,105,109,112,108,101,109,101,110,116,101,100,0,78,111,32,109,101,115,115,97,103,101,32,111,102,32,100,101,115,105,114,101,100,32,116,121,112,101,0,73,100,101,110,116,105,102,105,101,114,32,114,101,109,111,118,101,100,0,68,101,118,105,99,101,32,110,111,116,32,97,32,115,116,114,101,97,109,0,78,111,32,100,97,116,97,32,97,118,97,105,108,97,98,108,101,0,68,101,118,105,99,101,32,116,105,109,101,111,117,116,0,79,117,116,32,111,102,32,115,116,114,101,97,109,115,32,114,101,115,111,117,114,99,101,115,0,76,105,110,107,32,104,97,115,32,98,101,101,110,32,115,101,118,101,114,101,100,0,80,114,111,116,111,99,111,108,32,101,114,114,111,114,0,66,97,100,32,109,101,115,115,97,103,101,0,70,105,108,101,32,100,101,115,99,114,105,112,116,111,114,32,105,110,32,98,97,100,32,115,116,97,116,101,0,78,111,116,32,97,32,115,111,99,107,101,116,0,68,101,115,116,105,110,97,116,105,111,110,32,97,100,100,114,101,115,115,32,114,101,113,117,105,114,101,100,0,77,101,115,115,97,103,101,32,116,111,111,32,108,97,114,103,101,0,80,114,111,116,111,99,111,108,32,119,114,111,110,103,32,116,121,112,101,32,102,111,114,32,115,111,99,107,101,116,0,80,114,111,116,111,99,111,108,32,110,111,116,32,97,118,97,105,108,97,98,108,101,0,80,114,111,116,111,99,111,108,32,110,111,116,32,115,117,112,112,111,114,116,101,100,0,83,111,99,107,101,116,32,116,121,112,101,32,110,111,116,32,115,117,112,112,111,114,116,101,100,0,78,111,116,32,115,117,112,112,111,114,116,101,100,0,80,114,111,116,111,99,111,108,32,102,97,109,105,108,121,32,110,111,116,32,115,117,112,112,111,114,116,101,100,0,65,100,100,114,101,115,115,32,102,97,109,105,108,121,32,110,111,116,32,115,117,112,112,111,114,116,101,100,32,98,121,32,112,114,111,116,111,99,111,108,0,65,100,100,114,101,115,115,32,110,111,116,32,97,118,97,105,108,97,98,108,101,0,78,101,116,119,111,114,107,32,105,115,32,100,111,119,110,0,78,101,116,119,111,114,107,32,117,110,114,101,97,99,104,97,98,108,101,0,67,111,110,110,101,99,116,105,111,110,32,114,101,115,101,116,32,98,121,32,110,101,116,119,111,114,107,0,67,111,110,110,101,99,116,105,111,110,32,97,98,111,114,116,101,100,0,78,111,32,98,117,102,102,101,114,32,115,112,97,99,101,32,97,118,97,105,108,97,98,108,101,0,83,111,99,107,101,116,32,105,115,32,99,111,110,110,101,99,116,101,100,0,83,111,99,107,101,116,32,110,111,116,32,99,111,110,110,101,99,116,101,100,0,67,97,110,110,111,116,32,115,101,110,100,32,97,102,116,101,114,32,115,111,99,107,101,116,32,115,104,117,116,100,111,119,110,0,79,112,101,114,97,116,105,111,110,32,97,108,114,101,97,100,121,32,105,110,32,112,114,111,103,114,101,115,115,0,79,112,101,114,97,116,105,111,110,32,105,110,32,112,114,111,103,114,101,115,115,0,83,116,97,108,101,32,102,105,108,101,32,104,97,110,100,108,101,0,82,101,109,111,116,101,32,73,47,79,32,101,114,114,111,114,0,81,117,111,116,97,32,101,120,99,101,101,100,101,100,0,78,111,32,109,101,100,105,117,109,32,102,111,117,110,100,0,87,114,111,110,103,32,109,101,100,105,117,109,32,116,121,112,101,0,78,111,32,101,114,114,111,114,32,105,110,102,111,114,109,97,116,105,111,110,0,0,105,110,102,105,110,105,116,121,0,110,97,110,0,114,119,97,0], "i8", ALLOC_NONE, Runtime.GLOBAL_BASE+30720); + + + + + +/* no memory initializer */ +var tempDoublePtr = STATICTOP; STATICTOP += 16; + +assert(tempDoublePtr % 8 == 0); + +function copyTempFloat(ptr) { // functions, because inlining this code increases code size too much + + HEAP8[tempDoublePtr] = HEAP8[ptr]; + + HEAP8[tempDoublePtr+1] = HEAP8[ptr+1]; + + HEAP8[tempDoublePtr+2] = HEAP8[ptr+2]; + + HEAP8[tempDoublePtr+3] = HEAP8[ptr+3]; + +} + +function copyTempDouble(ptr) { + + HEAP8[tempDoublePtr] = HEAP8[ptr]; + + HEAP8[tempDoublePtr+1] = HEAP8[ptr+1]; + + HEAP8[tempDoublePtr+2] = HEAP8[ptr+2]; + + HEAP8[tempDoublePtr+3] = HEAP8[ptr+3]; + + HEAP8[tempDoublePtr+4] = HEAP8[ptr+4]; + + HEAP8[tempDoublePtr+5] = HEAP8[ptr+5]; + + HEAP8[tempDoublePtr+6] = HEAP8[ptr+6]; + + HEAP8[tempDoublePtr+7] = HEAP8[ptr+7]; + +} + +// {{PRE_LIBRARY}} + + + + var GL={counter:1,lastError:0,buffers:[],mappedBuffers:{},programs:[],framebuffers:[],renderbuffers:[],textures:[],uniforms:[],shaders:[],vaos:[],contexts:[],currentContext:null,offscreenCanvases:{},timerQueriesEXT:[],byteSizeByTypeRoot:5120,byteSizeByType:[1,1,2,2,4,4,4,2,3,4,8],programInfos:{},stringCache:{},tempFixedLengthArray:[],packAlignment:4,unpackAlignment:4,init:function () { + GL.miniTempBuffer = new Float32Array(GL.MINI_TEMP_BUFFER_SIZE); + for (var i = 0; i < GL.MINI_TEMP_BUFFER_SIZE; i++) { + GL.miniTempBufferViews[i] = GL.miniTempBuffer.subarray(0, i+1); + } + + // For functions such as glDrawBuffers, glInvalidateFramebuffer and glInvalidateSubFramebuffer that need to pass a short array to the WebGL API, + // create a set of short fixed-length arrays to avoid having to generate any garbage when calling those functions. + for (var i = 0; i < 32; i++) { + GL.tempFixedLengthArray.push(new Array(i)); + } + },recordError:function recordError(errorCode) { + if (!GL.lastError) { + GL.lastError = errorCode; + } + },getNewId:function (table) { + var ret = GL.counter++; + for (var i = table.length; i < ret; i++) { + table[i] = null; + } + return ret; + },MINI_TEMP_BUFFER_SIZE:256,miniTempBuffer:null,miniTempBufferViews:[0],getSource:function (shader, count, string, length) { + var source = ''; + for (var i = 0; i < count; ++i) { + var frag; + if (length) { + var len = HEAP32[(((length)+(i*4))>>2)]; + if (len < 0) { + frag = Pointer_stringify(HEAP32[(((string)+(i*4))>>2)]); + } else { + frag = Pointer_stringify(HEAP32[(((string)+(i*4))>>2)], len); + } + } else { + frag = Pointer_stringify(HEAP32[(((string)+(i*4))>>2)]); + } + source += frag; + } + return source; + },createContext:function (canvas, webGLContextAttributes) { + if (typeof webGLContextAttributes['majorVersion'] === 'undefined' && typeof webGLContextAttributes['minorVersion'] === 'undefined') { + webGLContextAttributes['majorVersion'] = 1; + webGLContextAttributes['minorVersion'] = 0; + } + + + var ctx; + var errorInfo = '?'; + function onContextCreationError(event) { + errorInfo = event.statusMessage || errorInfo; + } + try { + canvas.addEventListener('webglcontextcreationerror', onContextCreationError, false); + try { + if (webGLContextAttributes['majorVersion'] == 1 && webGLContextAttributes['minorVersion'] == 0) { + ctx = canvas.getContext("webgl", webGLContextAttributes) || canvas.getContext("experimental-webgl", webGLContextAttributes); + } else if (webGLContextAttributes['majorVersion'] == 2 && webGLContextAttributes['minorVersion'] == 0) { + ctx = canvas.getContext("webgl2", webGLContextAttributes); + } else { + throw 'Unsupported WebGL context version ' + majorVersion + '.' + minorVersion + '!' + } + } finally { + canvas.removeEventListener('webglcontextcreationerror', onContextCreationError, false); + } + if (!ctx) throw ':('; + } catch (e) { + Module.print('Could not create canvas: ' + [errorInfo, e, JSON.stringify(webGLContextAttributes)]); + return 0; + } + + if (!ctx) return 0; + var context = GL.registerContext(ctx, webGLContextAttributes); + return context; + },registerContext:function (ctx, webGLContextAttributes) { + var handle = GL.getNewId(GL.contexts); + var context = { + handle: handle, + attributes: webGLContextAttributes, + version: webGLContextAttributes['majorVersion'], + GLctx: ctx + }; + + + // Store the created context object so that we can access the context given a canvas without having to pass the parameters again. + if (ctx.canvas) ctx.canvas.GLctxObject = context; + GL.contexts[handle] = context; + if (typeof webGLContextAttributes['enableExtensionsByDefault'] === 'undefined' || webGLContextAttributes['enableExtensionsByDefault']) { + GL.initExtensions(context); + } + return handle; + },makeContextCurrent:function (contextHandle) { + var context = GL.contexts[contextHandle]; + if (!context) return false; + GLctx = Module.ctx = context.GLctx; // Active WebGL context object. + GL.currentContext = context; // Active Emscripten GL layer context object. + return true; + },getContext:function (contextHandle) { + return GL.contexts[contextHandle]; + },deleteContext:function (contextHandle) { + if (GL.currentContext === GL.contexts[contextHandle]) GL.currentContext = null; + if (typeof JSEvents === 'object') JSEvents.removeAllHandlersOnTarget(GL.contexts[contextHandle].GLctx.canvas); // Release all JS event handlers on the DOM element that the GL context is associated with since the context is now deleted. + if (GL.contexts[contextHandle] && GL.contexts[contextHandle].GLctx.canvas) GL.contexts[contextHandle].GLctx.canvas.GLctxObject = undefined; // Make sure the canvas object no longer refers to the context object so there are no GC surprises. + GL.contexts[contextHandle] = null; + },initExtensions:function (context) { + // If this function is called without a specific context object, init the extensions of the currently active context. + if (!context) context = GL.currentContext; + + if (context.initExtensionsDone) return; + context.initExtensionsDone = true; + + var GLctx = context.GLctx; + + context.maxVertexAttribs = GLctx.getParameter(GLctx.MAX_VERTEX_ATTRIBS); + + // Detect the presence of a few extensions manually, this GL interop layer itself will need to know if they exist. + + if (context.version < 2) { + // Extension available from Firefox 26 and Google Chrome 30 + var instancedArraysExt = GLctx.getExtension('ANGLE_instanced_arrays'); + if (instancedArraysExt) { + GLctx['vertexAttribDivisor'] = function(index, divisor) { instancedArraysExt['vertexAttribDivisorANGLE'](index, divisor); }; + GLctx['drawArraysInstanced'] = function(mode, first, count, primcount) { instancedArraysExt['drawArraysInstancedANGLE'](mode, first, count, primcount); }; + GLctx['drawElementsInstanced'] = function(mode, count, type, indices, primcount) { instancedArraysExt['drawElementsInstancedANGLE'](mode, count, type, indices, primcount); }; + } + + // Extension available from Firefox 25 and WebKit + var vaoExt = GLctx.getExtension('OES_vertex_array_object'); + if (vaoExt) { + GLctx['createVertexArray'] = function() { return vaoExt['createVertexArrayOES'](); }; + GLctx['deleteVertexArray'] = function(vao) { vaoExt['deleteVertexArrayOES'](vao); }; + GLctx['bindVertexArray'] = function(vao) { vaoExt['bindVertexArrayOES'](vao); }; + GLctx['isVertexArray'] = function(vao) { return vaoExt['isVertexArrayOES'](vao); }; + } + + var drawBuffersExt = GLctx.getExtension('WEBGL_draw_buffers'); + if (drawBuffersExt) { + GLctx['drawBuffers'] = function(n, bufs) { drawBuffersExt['drawBuffersWEBGL'](n, bufs); }; + } + } + + GLctx.disjointTimerQueryExt = GLctx.getExtension("EXT_disjoint_timer_query"); + + // These are the 'safe' feature-enabling extensions that don't add any performance impact related to e.g. debugging, and + // should be enabled by default so that client GLES2/GL code will not need to go through extra hoops to get its stuff working. + // As new extensions are ratified at http://www.khronos.org/registry/webgl/extensions/ , feel free to add your new extensions + // here, as long as they don't produce a performance impact for users that might not be using those extensions. + // E.g. debugging-related extensions should probably be off by default. + var automaticallyEnabledExtensions = [ "OES_texture_float", "OES_texture_half_float", "OES_standard_derivatives", + "OES_vertex_array_object", "WEBGL_compressed_texture_s3tc", "WEBGL_depth_texture", + "OES_element_index_uint", "EXT_texture_filter_anisotropic", "ANGLE_instanced_arrays", + "OES_texture_float_linear", "OES_texture_half_float_linear", "WEBGL_compressed_texture_atc", + "WEBGL_compressed_texture_pvrtc", "EXT_color_buffer_half_float", "WEBGL_color_buffer_float", + "EXT_frag_depth", "EXT_sRGB", "WEBGL_draw_buffers", "WEBGL_shared_resources", + "EXT_shader_texture_lod", "EXT_color_buffer_float"]; + + function shouldEnableAutomatically(extension) { + var ret = false; + automaticallyEnabledExtensions.forEach(function(include) { + if (ext.indexOf(include) != -1) { + ret = true; + } + }); + return ret; + } + + var exts = GLctx.getSupportedExtensions(); + if (exts && exts.length > 0) { + GLctx.getSupportedExtensions().forEach(function(ext) { + if (automaticallyEnabledExtensions.indexOf(ext) != -1) { + GLctx.getExtension(ext); // Calling .getExtension enables that extension permanently, no need to store the return value to be enabled. + } + }); + } + },populateUniformTable:function (program) { + var p = GL.programs[program]; + GL.programInfos[program] = { + uniforms: {}, + maxUniformLength: 0, // This is eagerly computed below, since we already enumerate all uniforms anyway. + maxAttributeLength: -1, // This is lazily computed and cached, computed when/if first asked, "-1" meaning not computed yet. + maxUniformBlockNameLength: -1 // Lazily computed as well + }; + + var ptable = GL.programInfos[program]; + var utable = ptable.uniforms; + // A program's uniform table maps the string name of an uniform to an integer location of that uniform. + // The global GL.uniforms map maps integer locations to WebGLUniformLocations. + var numUniforms = GLctx.getProgramParameter(p, GLctx.ACTIVE_UNIFORMS); + for (var i = 0; i < numUniforms; ++i) { + var u = GLctx.getActiveUniform(p, i); + + var name = u.name; + ptable.maxUniformLength = Math.max(ptable.maxUniformLength, name.length+1); + + // Strip off any trailing array specifier we might have got, e.g. "[0]". + if (name.indexOf(']', name.length-1) !== -1) { + var ls = name.lastIndexOf('['); + name = name.slice(0, ls); + } + + // Optimize memory usage slightly: If we have an array of uniforms, e.g. 'vec3 colors[3];', then + // only store the string 'colors' in utable, and 'colors[0]', 'colors[1]' and 'colors[2]' will be parsed as 'colors'+i. + // Note that for the GL.uniforms table, we still need to fetch the all WebGLUniformLocations for all the indices. + var loc = GLctx.getUniformLocation(p, name); + if (loc != null) + { + var id = GL.getNewId(GL.uniforms); + utable[name] = [u.size, id]; + GL.uniforms[id] = loc; + + for (var j = 1; j < u.size; ++j) { + var n = name + '['+j+']'; + loc = GLctx.getUniformLocation(p, n); + id = GL.getNewId(GL.uniforms); + + GL.uniforms[id] = loc; + } + } + } + }};function _emscripten_glIsRenderbuffer(renderbuffer) { + var rb = GL.renderbuffers[renderbuffer]; + if (!rb) return 0; + return GLctx.isRenderbuffer(rb); + } + + function _emscripten_glStencilMaskSeparate(x0, x1) { GLctx['stencilMaskSeparate'](x0, x1) } + + + + + + function _emscripten_get_now() { abort() } + + + + function _emscripten_set_main_loop_timing(mode, value) { + Browser.mainLoop.timingMode = mode; + Browser.mainLoop.timingValue = value; + + if (!Browser.mainLoop.func) { + console.error('emscripten_set_main_loop_timing: Cannot set timing mode for main loop since a main loop does not exist! Call emscripten_set_main_loop first to set one up.'); + return 1; // Return non-zero on failure, can't set timing mode when there is no main loop. + } + + if (mode == 0 /*EM_TIMING_SETTIMEOUT*/) { + Browser.mainLoop.scheduler = function Browser_mainLoop_scheduler_setTimeout() { + var timeUntilNextTick = Math.max(0, Browser.mainLoop.tickStartTime + value - _emscripten_get_now())|0; + setTimeout(Browser.mainLoop.runner, timeUntilNextTick); // doing this each time means that on exception, we stop + }; + Browser.mainLoop.method = 'timeout'; + } else if (mode == 1 /*EM_TIMING_RAF*/) { + Browser.mainLoop.scheduler = function Browser_mainLoop_scheduler_rAF() { + Browser.requestAnimationFrame(Browser.mainLoop.runner); + }; + Browser.mainLoop.method = 'rAF'; + } else if (mode == 2 /*EM_TIMING_SETIMMEDIATE*/) { + if (!window['setImmediate']) { + // Emulate setImmediate. (note: not a complete polyfill, we don't emulate clearImmediate() to keep code size to minimum, since not needed) + var setImmediates = []; + var emscriptenMainLoopMessageId = 'setimmediate'; + function Browser_setImmediate_messageHandler(event) { + if (event.source === window && event.data === emscriptenMainLoopMessageId) { + event.stopPropagation(); + setImmediates.shift()(); + } + } + window.addEventListener("message", Browser_setImmediate_messageHandler, true); + window['setImmediate'] = function Browser_emulated_setImmediate(func) { + setImmediates.push(func); + if (ENVIRONMENT_IS_WORKER) { + if (Module['setImmediates'] === undefined) Module['setImmediates'] = []; + Module['setImmediates'].push(func); + window.postMessage({target: emscriptenMainLoopMessageId}); // In --proxy-to-worker, route the message via proxyClient.js + } else window.postMessage(emscriptenMainLoopMessageId, "*"); // On the main thread, can just send the message to itself. + } + } + Browser.mainLoop.scheduler = function Browser_mainLoop_scheduler_setImmediate() { + window['setImmediate'](Browser.mainLoop.runner); + }; + Browser.mainLoop.method = 'immediate'; + } + return 0; + }function _emscripten_set_main_loop(func, fps, simulateInfiniteLoop, arg, noSetTiming) { + Module['noExitRuntime'] = true; + + assert(!Browser.mainLoop.func, 'emscripten_set_main_loop: there can only be one main loop function at once: call emscripten_cancel_main_loop to cancel the previous one before setting a new one with different parameters.'); + + Browser.mainLoop.func = func; + Browser.mainLoop.arg = arg; + + var browserIterationFunc; + if (typeof arg !== 'undefined') { + browserIterationFunc = function() { + func(arg); + }; + } else { + browserIterationFunc = function() { + func(); + }; + } + + var thisMainLoopId = Browser.mainLoop.currentlyRunningMainloop; + + Browser.mainLoop.runner = function Browser_mainLoop_runner() { + if (ABORT) return; + if (Browser.mainLoop.queue.length > 0) { + var start = Date.now(); + var blocker = Browser.mainLoop.queue.shift(); + blocker.func(blocker.arg); + if (Browser.mainLoop.remainingBlockers) { + var remaining = Browser.mainLoop.remainingBlockers; + var next = remaining%1 == 0 ? remaining-1 : Math.floor(remaining); + if (blocker.counted) { + Browser.mainLoop.remainingBlockers = next; + } else { + // not counted, but move the progress along a tiny bit + next = next + 0.5; // do not steal all the next one's progress + Browser.mainLoop.remainingBlockers = (8*remaining + next)/9; + } + } + console.log('main loop blocker "' + blocker.name + '" took ' + (Date.now() - start) + ' ms'); //, left: ' + Browser.mainLoop.remainingBlockers); + Browser.mainLoop.updateStatus(); + + // catches pause/resume main loop from blocker execution + if (thisMainLoopId < Browser.mainLoop.currentlyRunningMainloop) return; + + setTimeout(Browser.mainLoop.runner, 0); + return; + } + + // catch pauses from non-main loop sources + if (thisMainLoopId < Browser.mainLoop.currentlyRunningMainloop) return; + + // Implement very basic swap interval control + Browser.mainLoop.currentFrameNumber = Browser.mainLoop.currentFrameNumber + 1 | 0; + if (Browser.mainLoop.timingMode == 1/*EM_TIMING_RAF*/ && Browser.mainLoop.timingValue > 1 && Browser.mainLoop.currentFrameNumber % Browser.mainLoop.timingValue != 0) { + // Not the scheduled time to render this frame - skip. + Browser.mainLoop.scheduler(); + return; + } else if (Browser.mainLoop.timingMode == 0/*EM_TIMING_SETTIMEOUT*/) { + Browser.mainLoop.tickStartTime = _emscripten_get_now(); + } + + // Signal GL rendering layer that processing of a new frame is about to start. This helps it optimize + // VBO double-buffering and reduce GPU stalls. + + + if (Browser.mainLoop.method === 'timeout' && Module.ctx) { + Module.printErr('Looks like you are rendering without using requestAnimationFrame for the main loop. You should use 0 for the frame rate in emscripten_set_main_loop in order to use requestAnimationFrame, as that can greatly improve your frame rates!'); + Browser.mainLoop.method = ''; // just warn once per call to set main loop + } + + Browser.mainLoop.runIter(browserIterationFunc); + + checkStackCookie(); + + // catch pauses from the main loop itself + if (thisMainLoopId < Browser.mainLoop.currentlyRunningMainloop) return; + + // Queue new audio data. This is important to be right after the main loop invocation, so that we will immediately be able + // to queue the newest produced audio samples. + // TODO: Consider adding pre- and post- rAF callbacks so that GL.newRenderingFrameStarted() and SDL.audio.queueNewAudioData() + // do not need to be hardcoded into this function, but can be more generic. + if (typeof SDL === 'object' && SDL.audio && SDL.audio.queueNewAudioData) SDL.audio.queueNewAudioData(); + + Browser.mainLoop.scheduler(); + } + + if (!noSetTiming) { + if (fps && fps > 0) _emscripten_set_main_loop_timing(0/*EM_TIMING_SETTIMEOUT*/, 1000.0 / fps); + else _emscripten_set_main_loop_timing(1/*EM_TIMING_RAF*/, 1); // Do rAF by rendering each frame (no decimating) + + Browser.mainLoop.scheduler(); + } + + if (simulateInfiniteLoop) { + throw 'SimulateInfiniteLoop'; + } + } + Module["_emscripten_set_main_loop"] = _emscripten_set_main_loop;var Browser={mainLoop:{scheduler:null,method:"",currentlyRunningMainloop:0,func:null,arg:0,timingMode:0,timingValue:0,currentFrameNumber:0,queue:[],pause:function () { + Browser.mainLoop.scheduler = null; + Browser.mainLoop.currentlyRunningMainloop++; // Incrementing this signals the previous main loop that it's now become old, and it must return. + },resume:function () { + Browser.mainLoop.currentlyRunningMainloop++; + var timingMode = Browser.mainLoop.timingMode; + var timingValue = Browser.mainLoop.timingValue; + var func = Browser.mainLoop.func; + Browser.mainLoop.func = null; + _emscripten_set_main_loop(func, 0, false, Browser.mainLoop.arg, true /* do not set timing and call scheduler, we will do it on the next lines */); + _emscripten_set_main_loop_timing(timingMode, timingValue); + Browser.mainLoop.scheduler(); + },updateStatus:function () { + if (Module['setStatus']) { + var message = Module['statusMessage'] || 'Please wait...'; + var remaining = Browser.mainLoop.remainingBlockers; + var expected = Browser.mainLoop.expectedBlockers; + if (remaining) { + if (remaining < expected) { + Module['setStatus'](message + ' (' + (expected - remaining) + '/' + expected + ')'); + } else { + Module['setStatus'](message); + } + } else { + Module['setStatus'](''); + } + } + },runIter:function (func) { + if (ABORT) return; + if (Module['preMainLoop']) { + var preRet = Module['preMainLoop'](); + if (preRet === false) { + return; // |return false| skips a frame + } + } + try { + func(); + } catch (e) { + if (e instanceof ExitStatus) { + return; + } else { + if (e && typeof e === 'object' && e.stack) Module.printErr('exception thrown: ' + [e, e.stack]); + throw e; + } + } + if (Module['postMainLoop']) Module['postMainLoop'](); + }},isFullscreen:false,pointerLock:false,moduleContextCreatedCallbacks:[],workers:[],init:function () { + if (!Module["preloadPlugins"]) Module["preloadPlugins"] = []; // needs to exist even in workers + + if (Browser.initted) return; + Browser.initted = true; + + try { + new Blob(); + Browser.hasBlobConstructor = true; + } catch(e) { + Browser.hasBlobConstructor = false; + console.log("warning: no blob constructor, cannot create blobs with mimetypes"); + } + Browser.BlobBuilder = typeof MozBlobBuilder != "undefined" ? MozBlobBuilder : (typeof WebKitBlobBuilder != "undefined" ? WebKitBlobBuilder : (!Browser.hasBlobConstructor ? console.log("warning: no BlobBuilder") : null)); + Browser.URLObject = typeof window != "undefined" ? (window.URL ? window.URL : window.webkitURL) : undefined; + if (!Module.noImageDecoding && typeof Browser.URLObject === 'undefined') { + console.log("warning: Browser does not support creating object URLs. Built-in browser image decoding will not be available."); + Module.noImageDecoding = true; + } + + // Support for plugins that can process preloaded files. You can add more of these to + // your app by creating and appending to Module.preloadPlugins. + // + // Each plugin is asked if it can handle a file based on the file's name. If it can, + // it is given the file's raw data. When it is done, it calls a callback with the file's + // (possibly modified) data. For example, a plugin might decompress a file, or it + // might create some side data structure for use later (like an Image element, etc.). + + var imagePlugin = {}; + imagePlugin['canHandle'] = function imagePlugin_canHandle(name) { + return !Module.noImageDecoding && /\.(jpg|jpeg|png|bmp)$/i.test(name); + }; + imagePlugin['handle'] = function imagePlugin_handle(byteArray, name, onload, onerror) { + var b = null; + if (Browser.hasBlobConstructor) { + try { + b = new Blob([byteArray], { type: Browser.getMimetype(name) }); + if (b.size !== byteArray.length) { // Safari bug #118630 + // Safari's Blob can only take an ArrayBuffer + b = new Blob([(new Uint8Array(byteArray)).buffer], { type: Browser.getMimetype(name) }); + } + } catch(e) { + Runtime.warnOnce('Blob constructor present but fails: ' + e + '; falling back to blob builder'); + } + } + if (!b) { + var bb = new Browser.BlobBuilder(); + bb.append((new Uint8Array(byteArray)).buffer); // we need to pass a buffer, and must copy the array to get the right data range + b = bb.getBlob(); + } + var url = Browser.URLObject.createObjectURL(b); + assert(typeof url == 'string', 'createObjectURL must return a url as a string'); + var img = new Image(); + img.onload = function img_onload() { + assert(img.complete, 'Image ' + name + ' could not be decoded'); + var canvas = document.createElement('canvas'); + canvas.width = img.width; + canvas.height = img.height; + var ctx = canvas.getContext('2d'); + ctx.drawImage(img, 0, 0); + Module["preloadedImages"][name] = canvas; + Browser.URLObject.revokeObjectURL(url); + if (onload) onload(byteArray); + }; + img.onerror = function img_onerror(event) { + console.log('Image ' + url + ' could not be decoded'); + if (onerror) onerror(); + }; + img.src = url; + }; + Module['preloadPlugins'].push(imagePlugin); + + var audioPlugin = {}; + audioPlugin['canHandle'] = function audioPlugin_canHandle(name) { + return !Module.noAudioDecoding && name.substr(-4) in { '.ogg': 1, '.wav': 1, '.mp3': 1 }; + }; + audioPlugin['handle'] = function audioPlugin_handle(byteArray, name, onload, onerror) { + var done = false; + function finish(audio) { + if (done) return; + done = true; + Module["preloadedAudios"][name] = audio; + if (onload) onload(byteArray); + } + function fail() { + if (done) return; + done = true; + Module["preloadedAudios"][name] = new Audio(); // empty shim + if (onerror) onerror(); + } + if (Browser.hasBlobConstructor) { + try { + var b = new Blob([byteArray], { type: Browser.getMimetype(name) }); + } catch(e) { + return fail(); + } + var url = Browser.URLObject.createObjectURL(b); // XXX we never revoke this! + assert(typeof url == 'string', 'createObjectURL must return a url as a string'); + var audio = new Audio(); + audio.addEventListener('canplaythrough', function() { finish(audio) }, false); // use addEventListener due to chromium bug 124926 + audio.onerror = function audio_onerror(event) { + if (done) return; + console.log('warning: browser could not fully decode audio ' + name + ', trying slower base64 approach'); + function encode64(data) { + var BASE = 'ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz0123456789+/'; + var PAD = '='; + var ret = ''; + var leftchar = 0; + var leftbits = 0; + for (var i = 0; i < data.length; i++) { + leftchar = (leftchar << 8) | data[i]; + leftbits += 8; + while (leftbits >= 6) { + var curr = (leftchar >> (leftbits-6)) & 0x3f; + leftbits -= 6; + ret += BASE[curr]; + } + } + if (leftbits == 2) { + ret += BASE[(leftchar&3) << 4]; + ret += PAD + PAD; + } else if (leftbits == 4) { + ret += BASE[(leftchar&0xf) << 2]; + ret += PAD; + } + return ret; + } + audio.src = 'data:audio/x-' + name.substr(-3) + ';base64,' + encode64(byteArray); + finish(audio); // we don't wait for confirmation this worked - but it's worth trying + }; + audio.src = url; + // workaround for chrome bug 124926 - we do not always get oncanplaythrough or onerror + Browser.safeSetTimeout(function() { + finish(audio); // try to use it even though it is not necessarily ready to play + }, 10000); + } else { + return fail(); + } + }; + Module['preloadPlugins'].push(audioPlugin); + + // Canvas event setup + + function pointerLockChange() { + Browser.pointerLock = document['pointerLockElement'] === Module['canvas'] || + document['mozPointerLockElement'] === Module['canvas'] || + document['webkitPointerLockElement'] === Module['canvas'] || + document['msPointerLockElement'] === Module['canvas']; + } + var canvas = Module['canvas']; + if (canvas) { + // forced aspect ratio can be enabled by defining 'forcedAspectRatio' on Module + // Module['forcedAspectRatio'] = 4 / 3; + + canvas.requestPointerLock = canvas['requestPointerLock'] || + canvas['mozRequestPointerLock'] || + canvas['webkitRequestPointerLock'] || + canvas['msRequestPointerLock'] || + function(){}; + canvas.exitPointerLock = document['exitPointerLock'] || + document['mozExitPointerLock'] || + document['webkitExitPointerLock'] || + document['msExitPointerLock'] || + function(){}; // no-op if function does not exist + canvas.exitPointerLock = canvas.exitPointerLock.bind(document); + + document.addEventListener('pointerlockchange', pointerLockChange, false); + document.addEventListener('mozpointerlockchange', pointerLockChange, false); + document.addEventListener('webkitpointerlockchange', pointerLockChange, false); + document.addEventListener('mspointerlockchange', pointerLockChange, false); + + if (Module['elementPointerLock']) { + canvas.addEventListener("click", function(ev) { + if (!Browser.pointerLock && Module['canvas'].requestPointerLock) { + Module['canvas'].requestPointerLock(); + ev.preventDefault(); + } + }, false); + } + } + },createContext:function (canvas, useWebGL, setInModule, webGLContextAttributes) { + if (useWebGL && Module.ctx && canvas == Module.canvas) return Module.ctx; // no need to recreate GL context if it's already been created for this canvas. + + var ctx; + var contextHandle; + if (useWebGL) { + // For GLES2/desktop GL compatibility, adjust a few defaults to be different to WebGL defaults, so that they align better with the desktop defaults. + var contextAttributes = { + antialias: false, + alpha: false + }; + + if (webGLContextAttributes) { + for (var attribute in webGLContextAttributes) { + contextAttributes[attribute] = webGLContextAttributes[attribute]; + } + } + + contextHandle = GL.createContext(canvas, contextAttributes); + if (contextHandle) { + ctx = GL.getContext(contextHandle).GLctx; + } + } else { + ctx = canvas.getContext('2d'); + } + + if (!ctx) return null; + + if (setInModule) { + if (!useWebGL) assert(typeof GLctx === 'undefined', 'cannot set in module if GLctx is used, but we are a non-GL context that would replace it'); + + Module.ctx = ctx; + if (useWebGL) GL.makeContextCurrent(contextHandle); + Module.useWebGL = useWebGL; + Browser.moduleContextCreatedCallbacks.forEach(function(callback) { callback() }); + Browser.init(); + } + return ctx; + },destroyContext:function (canvas, useWebGL, setInModule) {},fullscreenHandlersInstalled:false,lockPointer:undefined,resizeCanvas:undefined,requestFullscreen:function (lockPointer, resizeCanvas, vrDevice) { + Browser.lockPointer = lockPointer; + Browser.resizeCanvas = resizeCanvas; + Browser.vrDevice = vrDevice; + if (typeof Browser.lockPointer === 'undefined') Browser.lockPointer = true; + if (typeof Browser.resizeCanvas === 'undefined') Browser.resizeCanvas = false; + if (typeof Browser.vrDevice === 'undefined') Browser.vrDevice = null; + + var canvas = Module['canvas']; + function fullscreenChange() { + Browser.isFullscreen = false; + var canvasContainer = canvas.parentNode; + if ((document['fullscreenElement'] || document['mozFullScreenElement'] || + document['msFullscreenElement'] || document['webkitFullscreenElement'] || + document['webkitCurrentFullScreenElement']) === canvasContainer) { + canvas.exitFullscreen = document['exitFullscreen'] || + document['cancelFullScreen'] || + document['mozCancelFullScreen'] || + document['msExitFullscreen'] || + document['webkitCancelFullScreen'] || + function() {}; + canvas.exitFullscreen = canvas.exitFullscreen.bind(document); + if (Browser.lockPointer) canvas.requestPointerLock(); + Browser.isFullscreen = true; + if (Browser.resizeCanvas) Browser.setFullscreenCanvasSize(); + } else { + + // remove the full screen specific parent of the canvas again to restore the HTML structure from before going full screen + canvasContainer.parentNode.insertBefore(canvas, canvasContainer); + canvasContainer.parentNode.removeChild(canvasContainer); + + if (Browser.resizeCanvas) Browser.setWindowedCanvasSize(); + } + if (Module['onFullScreen']) Module['onFullScreen'](Browser.isFullscreen); + if (Module['onFullscreen']) Module['onFullscreen'](Browser.isFullscreen); + Browser.updateCanvasDimensions(canvas); + } + + if (!Browser.fullscreenHandlersInstalled) { + Browser.fullscreenHandlersInstalled = true; + document.addEventListener('fullscreenchange', fullscreenChange, false); + document.addEventListener('mozfullscreenchange', fullscreenChange, false); + document.addEventListener('webkitfullscreenchange', fullscreenChange, false); + document.addEventListener('MSFullscreenChange', fullscreenChange, false); + } + + // create a new parent to ensure the canvas has no siblings. this allows browsers to optimize full screen performance when its parent is the full screen root + var canvasContainer = document.createElement("div"); + canvas.parentNode.insertBefore(canvasContainer, canvas); + canvasContainer.appendChild(canvas); + + // use parent of canvas as full screen root to allow aspect ratio correction (Firefox stretches the root to screen size) + canvasContainer.requestFullscreen = canvasContainer['requestFullscreen'] || + canvasContainer['mozRequestFullScreen'] || + canvasContainer['msRequestFullscreen'] || + (canvasContainer['webkitRequestFullscreen'] ? function() { canvasContainer['webkitRequestFullscreen'](Element['ALLOW_KEYBOARD_INPUT']) } : null) || + (canvasContainer['webkitRequestFullScreen'] ? function() { canvasContainer['webkitRequestFullScreen'](Element['ALLOW_KEYBOARD_INPUT']) } : null); + + if (vrDevice) { + canvasContainer.requestFullscreen({ vrDisplay: vrDevice }); + } else { + canvasContainer.requestFullscreen(); + } + },requestFullScreen:function (lockPointer, resizeCanvas, vrDevice) { + Module.printErr('Browser.requestFullScreen() is deprecated. Please call Browser.requestFullscreen instead.'); + Browser.requestFullScreen = function(lockPointer, resizeCanvas, vrDevice) { + return Browser.requestFullscreen(lockPointer, resizeCanvas, vrDevice); + } + return Browser.requestFullscreen(lockPointer, resizeCanvas, vrDevice); + },nextRAF:0,fakeRequestAnimationFrame:function (func) { + // try to keep 60fps between calls to here + var now = Date.now(); + if (Browser.nextRAF === 0) { + Browser.nextRAF = now + 1000/60; + } else { + while (now + 2 >= Browser.nextRAF) { // fudge a little, to avoid timer jitter causing us to do lots of delay:0 + Browser.nextRAF += 1000/60; + } + } + var delay = Math.max(Browser.nextRAF - now, 0); + setTimeout(func, delay); + },requestAnimationFrame:function requestAnimationFrame(func) { + if (typeof window === 'undefined') { // Provide fallback to setTimeout if window is undefined (e.g. in Node.js) + Browser.fakeRequestAnimationFrame(func); + } else { + if (!window.requestAnimationFrame) { + window.requestAnimationFrame = window['requestAnimationFrame'] || + window['mozRequestAnimationFrame'] || + window['webkitRequestAnimationFrame'] || + window['msRequestAnimationFrame'] || + window['oRequestAnimationFrame'] || + Browser.fakeRequestAnimationFrame; + } + window.requestAnimationFrame(func); + } + },safeCallback:function (func) { + return function() { + if (!ABORT) return func.apply(null, arguments); + }; + },allowAsyncCallbacks:true,queuedAsyncCallbacks:[],pauseAsyncCallbacks:function () { + Browser.allowAsyncCallbacks = false; + },resumeAsyncCallbacks:function () { // marks future callbacks as ok to execute, and synchronously runs any remaining ones right now + Browser.allowAsyncCallbacks = true; + if (Browser.queuedAsyncCallbacks.length > 0) { + var callbacks = Browser.queuedAsyncCallbacks; + Browser.queuedAsyncCallbacks = []; + callbacks.forEach(function(func) { + func(); + }); + } + },safeRequestAnimationFrame:function (func) { + return Browser.requestAnimationFrame(function() { + if (ABORT) return; + if (Browser.allowAsyncCallbacks) { + func(); + } else { + Browser.queuedAsyncCallbacks.push(func); + } + }); + },safeSetTimeout:function (func, timeout) { + Module['noExitRuntime'] = true; + return setTimeout(function() { + if (ABORT) return; + if (Browser.allowAsyncCallbacks) { + func(); + } else { + Browser.queuedAsyncCallbacks.push(func); + } + }, timeout); + },safeSetInterval:function (func, timeout) { + Module['noExitRuntime'] = true; + return setInterval(function() { + if (ABORT) return; + if (Browser.allowAsyncCallbacks) { + func(); + } // drop it on the floor otherwise, next interval will kick in + }, timeout); + },getMimetype:function (name) { + return { + 'jpg': 'image/jpeg', + 'jpeg': 'image/jpeg', + 'png': 'image/png', + 'bmp': 'image/bmp', + 'ogg': 'audio/ogg', + 'wav': 'audio/wav', + 'mp3': 'audio/mpeg' + }[name.substr(name.lastIndexOf('.')+1)]; + },getUserMedia:function (func) { + if(!window.getUserMedia) { + window.getUserMedia = navigator['getUserMedia'] || + navigator['mozGetUserMedia']; + } + window.getUserMedia(func); + },getMovementX:function (event) { + return event['movementX'] || + event['mozMovementX'] || + event['webkitMovementX'] || + 0; + },getMovementY:function (event) { + return event['movementY'] || + event['mozMovementY'] || + event['webkitMovementY'] || + 0; + },getMouseWheelDelta:function (event) { + var delta = 0; + switch (event.type) { + case 'DOMMouseScroll': + delta = event.detail; + break; + case 'mousewheel': + delta = event.wheelDelta; + break; + case 'wheel': + delta = event['deltaY']; + break; + default: + throw 'unrecognized mouse wheel event: ' + event.type; + } + return delta; + },mouseX:0,mouseY:0,mouseMovementX:0,mouseMovementY:0,touches:{},lastTouches:{},calculateMouseEvent:function (event) { // event should be mousemove, mousedown or mouseup + if (Browser.pointerLock) { + // When the pointer is locked, calculate the coordinates + // based on the movement of the mouse. + // Workaround for Firefox bug 764498 + if (event.type != 'mousemove' && + ('mozMovementX' in event)) { + Browser.mouseMovementX = Browser.mouseMovementY = 0; + } else { + Browser.mouseMovementX = Browser.getMovementX(event); + Browser.mouseMovementY = Browser.getMovementY(event); + } + + // check if SDL is available + if (typeof SDL != "undefined") { + Browser.mouseX = SDL.mouseX + Browser.mouseMovementX; + Browser.mouseY = SDL.mouseY + Browser.mouseMovementY; + } else { + // just add the mouse delta to the current absolut mouse position + // FIXME: ideally this should be clamped against the canvas size and zero + Browser.mouseX += Browser.mouseMovementX; + Browser.mouseY += Browser.mouseMovementY; + } + } else { + // Otherwise, calculate the movement based on the changes + // in the coordinates. + var rect = Module["canvas"].getBoundingClientRect(); + var cw = Module["canvas"].width; + var ch = Module["canvas"].height; + + // Neither .scrollX or .pageXOffset are defined in a spec, but + // we prefer .scrollX because it is currently in a spec draft. + // (see: http://www.w3.org/TR/2013/WD-cssom-view-20131217/) + var scrollX = ((typeof window.scrollX !== 'undefined') ? window.scrollX : window.pageXOffset); + var scrollY = ((typeof window.scrollY !== 'undefined') ? window.scrollY : window.pageYOffset); + // If this assert lands, it's likely because the browser doesn't support scrollX or pageXOffset + // and we have no viable fallback. + assert((typeof scrollX !== 'undefined') && (typeof scrollY !== 'undefined'), 'Unable to retrieve scroll position, mouse positions likely broken.'); + + if (event.type === 'touchstart' || event.type === 'touchend' || event.type === 'touchmove') { + var touch = event.touch; + if (touch === undefined) { + return; // the "touch" property is only defined in SDL + + } + var adjustedX = touch.pageX - (scrollX + rect.left); + var adjustedY = touch.pageY - (scrollY + rect.top); + + adjustedX = adjustedX * (cw / rect.width); + adjustedY = adjustedY * (ch / rect.height); + + var coords = { x: adjustedX, y: adjustedY }; + + if (event.type === 'touchstart') { + Browser.lastTouches[touch.identifier] = coords; + Browser.touches[touch.identifier] = coords; + } else if (event.type === 'touchend' || event.type === 'touchmove') { + var last = Browser.touches[touch.identifier]; + if (!last) last = coords; + Browser.lastTouches[touch.identifier] = last; + Browser.touches[touch.identifier] = coords; + } + return; + } + + var x = event.pageX - (scrollX + rect.left); + var y = event.pageY - (scrollY + rect.top); + + // the canvas might be CSS-scaled compared to its backbuffer; + // SDL-using content will want mouse coordinates in terms + // of backbuffer units. + x = x * (cw / rect.width); + y = y * (ch / rect.height); + + Browser.mouseMovementX = x - Browser.mouseX; + Browser.mouseMovementY = y - Browser.mouseY; + Browser.mouseX = x; + Browser.mouseY = y; + } + },asyncLoad:function (url, onload, onerror, noRunDep) { + var dep = !noRunDep ? getUniqueRunDependency('al ' + url) : ''; + Module['readAsync'](url, function(arrayBuffer) { + assert(arrayBuffer, 'Loading data file "' + url + '" failed (no arrayBuffer).'); + onload(new Uint8Array(arrayBuffer)); + if (dep) removeRunDependency(dep); + }, function(event) { + if (onerror) { + onerror(); + } else { + throw 'Loading data file "' + url + '" failed.'; + } + }); + if (dep) addRunDependency(dep); + },resizeListeners:[],updateResizeListeners:function () { + var canvas = Module['canvas']; + Browser.resizeListeners.forEach(function(listener) { + listener(canvas.width, canvas.height); + }); + },setCanvasSize:function (width, height, noUpdates) { + var canvas = Module['canvas']; + Browser.updateCanvasDimensions(canvas, width, height); + if (!noUpdates) Browser.updateResizeListeners(); + },windowedWidth:0,windowedHeight:0,setFullscreenCanvasSize:function () { + // check if SDL is available + if (typeof SDL != "undefined") { + var flags = HEAPU32[((SDL.screen+Runtime.QUANTUM_SIZE*0)>>2)]; + flags = flags | 0x00800000; // set SDL_FULLSCREEN flag + HEAP32[((SDL.screen+Runtime.QUANTUM_SIZE*0)>>2)]=flags + } + Browser.updateResizeListeners(); + },setWindowedCanvasSize:function () { + // check if SDL is available + if (typeof SDL != "undefined") { + var flags = HEAPU32[((SDL.screen+Runtime.QUANTUM_SIZE*0)>>2)]; + flags = flags & ~0x00800000; // clear SDL_FULLSCREEN flag + HEAP32[((SDL.screen+Runtime.QUANTUM_SIZE*0)>>2)]=flags + } + Browser.updateResizeListeners(); + },updateCanvasDimensions:function (canvas, wNative, hNative) { + if (wNative && hNative) { + canvas.widthNative = wNative; + canvas.heightNative = hNative; + } else { + wNative = canvas.widthNative; + hNative = canvas.heightNative; + } + var w = wNative; + var h = hNative; + if (Module['forcedAspectRatio'] && Module['forcedAspectRatio'] > 0) { + if (w/h < Module['forcedAspectRatio']) { + w = Math.round(h * Module['forcedAspectRatio']); + } else { + h = Math.round(w / Module['forcedAspectRatio']); + } + } + if (((document['fullscreenElement'] || document['mozFullScreenElement'] || + document['msFullscreenElement'] || document['webkitFullscreenElement'] || + document['webkitCurrentFullScreenElement']) === canvas.parentNode) && (typeof screen != 'undefined')) { + var factor = Math.min(screen.width / w, screen.height / h); + w = Math.round(w * factor); + h = Math.round(h * factor); + } + if (Browser.resizeCanvas) { + if (canvas.width != w) canvas.width = w; + if (canvas.height != h) canvas.height = h; + if (typeof canvas.style != 'undefined') { + canvas.style.removeProperty( "width"); + canvas.style.removeProperty("height"); + } + } else { + if (canvas.width != wNative) canvas.width = wNative; + if (canvas.height != hNative) canvas.height = hNative; + if (typeof canvas.style != 'undefined') { + if (w != wNative || h != hNative) { + canvas.style.setProperty( "width", w + "px", "important"); + canvas.style.setProperty("height", h + "px", "important"); + } else { + canvas.style.removeProperty( "width"); + canvas.style.removeProperty("height"); + } + } + } + },wgetRequests:{},nextWgetRequestHandle:0,getNextWgetRequestHandle:function () { + var handle = Browser.nextWgetRequestHandle; + Browser.nextWgetRequestHandle++; + return handle; + }};var GLFW={Window:function (id, width, height, title, monitor, share) { + this.id = id; + this.x = 0; + this.y = 0; + this.fullscreen = false; // Used to determine if app in fullscreen mode + this.storedX = 0; // Used to store X before fullscreen + this.storedY = 0; // Used to store Y before fullscreen + this.width = width; + this.height = height; + this.storedWidth = width; // Used to store width before fullscreen + this.storedHeight = height; // Used to store height before fullscreen + this.title = title; + this.monitor = monitor; + this.share = share; + this.attributes = GLFW.hints; + this.inputModes = { + 0x00033001:0x00034001, // GLFW_CURSOR (GLFW_CURSOR_NORMAL) + 0x00033002:0, // GLFW_STICKY_KEYS + 0x00033003:0, // GLFW_STICKY_MOUSE_BUTTONS + }; + this.buttons = 0; + this.keys = new Array(); + this.domKeys = new Array(); + this.shouldClose = 0; + this.title = null; + this.windowPosFunc = null; // GLFWwindowposfun + this.windowSizeFunc = null; // GLFWwindowsizefun + this.windowCloseFunc = null; // GLFWwindowclosefun + this.windowRefreshFunc = null; // GLFWwindowrefreshfun + this.windowFocusFunc = null; // GLFWwindowfocusfun + this.windowIconifyFunc = null; // GLFWwindowiconifyfun + this.framebufferSizeFunc = null; // GLFWframebuffersizefun + this.mouseButtonFunc = null; // GLFWmousebuttonfun + this.cursorPosFunc = null; // GLFWcursorposfun + this.cursorEnterFunc = null; // GLFWcursorenterfun + this.scrollFunc = null; // GLFWscrollfun + this.dropFunc = null; // GLFWdropfun + this.keyFunc = null; // GLFWkeyfun + this.charFunc = null; // GLFWcharfun + this.userptr = null; + },WindowFromId:function (id) { + if (id <= 0 || !GLFW.windows) return null; + return GLFW.windows[id - 1]; + },joystickFunc:null,errorFunc:null,monitorFunc:null,active:null,windows:null,monitors:null,monitorString:null,versionString:null,initialTime:null,extensions:null,hints:null,defaultHints:{131073:0,131074:0,131075:1,131076:1,131077:1,135169:8,135170:8,135171:8,135172:8,135173:24,135174:8,135175:0,135176:0,135177:0,135178:0,135179:0,135180:0,135181:0,135182:0,135183:0,139265:196609,139266:1,139267:0,139268:0,139269:0,139270:0,139271:0,139272:0},DOMToGLFWKeyCode:function (keycode) { + switch (keycode) { + // these keycodes are only defined for GLFW3, assume they are the same for GLFW2 + case 0x20:return 32; // DOM_VK_SPACE -> GLFW_KEY_SPACE + case 0xDE:return 39; // DOM_VK_QUOTE -> GLFW_KEY_APOSTROPHE + case 0xBC:return 44; // DOM_VK_COMMA -> GLFW_KEY_COMMA + case 0xAD:return 45; // DOM_VK_HYPHEN_MINUS -> GLFW_KEY_MINUS + case 0xBD:return 45; // DOM_VK_MINUS -> GLFW_KEY_MINUS + case 0xBE:return 46; // DOM_VK_PERIOD -> GLFW_KEY_PERIOD + case 0xBF:return 47; // DOM_VK_SLASH -> GLFW_KEY_SLASH + case 0x30:return 48; // DOM_VK_0 -> GLFW_KEY_0 + case 0x31:return 49; // DOM_VK_1 -> GLFW_KEY_1 + case 0x32:return 50; // DOM_VK_2 -> GLFW_KEY_2 + case 0x33:return 51; // DOM_VK_3 -> GLFW_KEY_3 + case 0x34:return 52; // DOM_VK_4 -> GLFW_KEY_4 + case 0x35:return 53; // DOM_VK_5 -> GLFW_KEY_5 + case 0x36:return 54; // DOM_VK_6 -> GLFW_KEY_6 + case 0x37:return 55; // DOM_VK_7 -> GLFW_KEY_7 + case 0x38:return 56; // DOM_VK_8 -> GLFW_KEY_8 + case 0x39:return 57; // DOM_VK_9 -> GLFW_KEY_9 + case 0x3B:return 59; // DOM_VK_SEMICOLON -> GLFW_KEY_SEMICOLON + case 0x3D:return 61; // DOM_VK_EQUALS -> GLFW_KEY_EQUAL + case 0xBB:return 61; // DOM_VK_EQUALS -> GLFW_KEY_EQUAL + case 0x41:return 65; // DOM_VK_A -> GLFW_KEY_A + case 0x42:return 66; // DOM_VK_B -> GLFW_KEY_B + case 0x43:return 67; // DOM_VK_C -> GLFW_KEY_C + case 0x44:return 68; // DOM_VK_D -> GLFW_KEY_D + case 0x45:return 69; // DOM_VK_E -> GLFW_KEY_E + case 0x46:return 70; // DOM_VK_F -> GLFW_KEY_F + case 0x47:return 71; // DOM_VK_G -> GLFW_KEY_G + case 0x48:return 72; // DOM_VK_H -> GLFW_KEY_H + case 0x49:return 73; // DOM_VK_I -> GLFW_KEY_I + case 0x4A:return 74; // DOM_VK_J -> GLFW_KEY_J + case 0x4B:return 75; // DOM_VK_K -> GLFW_KEY_K + case 0x4C:return 76; // DOM_VK_L -> GLFW_KEY_L + case 0x4D:return 77; // DOM_VK_M -> GLFW_KEY_M + case 0x4E:return 78; // DOM_VK_N -> GLFW_KEY_N + case 0x4F:return 79; // DOM_VK_O -> GLFW_KEY_O + case 0x50:return 80; // DOM_VK_P -> GLFW_KEY_P + case 0x51:return 81; // DOM_VK_Q -> GLFW_KEY_Q + case 0x52:return 82; // DOM_VK_R -> GLFW_KEY_R + case 0x53:return 83; // DOM_VK_S -> GLFW_KEY_S + case 0x54:return 84; // DOM_VK_T -> GLFW_KEY_T + case 0x55:return 85; // DOM_VK_U -> GLFW_KEY_U + case 0x56:return 86; // DOM_VK_V -> GLFW_KEY_V + case 0x57:return 87; // DOM_VK_W -> GLFW_KEY_W + case 0x58:return 88; // DOM_VK_X -> GLFW_KEY_X + case 0x59:return 89; // DOM_VK_Y -> GLFW_KEY_Y + case 0x5a:return 90; // DOM_VK_Z -> GLFW_KEY_Z + case 0xDB:return 91; // DOM_VK_OPEN_BRACKET -> GLFW_KEY_LEFT_BRACKET + case 0xDC:return 92; // DOM_VK_BACKSLASH -> GLFW_KEY_BACKSLASH + case 0xDD:return 93; // DOM_VK_CLOSE_BRACKET -> GLFW_KEY_RIGHT_BRACKET + case 0xC0:return 94; // DOM_VK_BACK_QUOTE -> GLFW_KEY_GRAVE_ACCENT + + + case 0x1B:return 256; // DOM_VK_ESCAPE -> GLFW_KEY_ESCAPE + case 0x0D:return 257; // DOM_VK_RETURN -> GLFW_KEY_ENTER + case 0x09:return 258; // DOM_VK_TAB -> GLFW_KEY_TAB + case 0x08:return 259; // DOM_VK_BACK -> GLFW_KEY_BACKSPACE + case 0x2D:return 260; // DOM_VK_INSERT -> GLFW_KEY_INSERT + case 0x2E:return 261; // DOM_VK_DELETE -> GLFW_KEY_DELETE + case 0x27:return 262; // DOM_VK_RIGHT -> GLFW_KEY_RIGHT + case 0x25:return 263; // DOM_VK_LEFT -> GLFW_KEY_LEFT + case 0x28:return 264; // DOM_VK_DOWN -> GLFW_KEY_DOWN + case 0x26:return 265; // DOM_VK_UP -> GLFW_KEY_UP + case 0x21:return 266; // DOM_VK_PAGE_UP -> GLFW_KEY_PAGE_UP + case 0x22:return 267; // DOM_VK_PAGE_DOWN -> GLFW_KEY_PAGE_DOWN + case 0x24:return 268; // DOM_VK_HOME -> GLFW_KEY_HOME + case 0x23:return 269; // DOM_VK_END -> GLFW_KEY_END + case 0x14:return 280; // DOM_VK_CAPS_LOCK -> GLFW_KEY_CAPS_LOCK + case 0x91:return 281; // DOM_VK_SCROLL_LOCK -> GLFW_KEY_SCROLL_LOCK + case 0x90:return 282; // DOM_VK_NUM_LOCK -> GLFW_KEY_NUM_LOCK + case 0x2C:return 283; // DOM_VK_SNAPSHOT -> GLFW_KEY_PRINT_SCREEN + case 0x13:return 284; // DOM_VK_PAUSE -> GLFW_KEY_PAUSE + case 0x70:return 290; // DOM_VK_F1 -> GLFW_KEY_F1 + case 0x71:return 291; // DOM_VK_F2 -> GLFW_KEY_F2 + case 0x72:return 292; // DOM_VK_F3 -> GLFW_KEY_F3 + case 0x73:return 293; // DOM_VK_F4 -> GLFW_KEY_F4 + case 0x74:return 294; // DOM_VK_F5 -> GLFW_KEY_F5 + case 0x75:return 295; // DOM_VK_F6 -> GLFW_KEY_F6 + case 0x76:return 296; // DOM_VK_F7 -> GLFW_KEY_F7 + case 0x77:return 297; // DOM_VK_F8 -> GLFW_KEY_F8 + case 0x78:return 298; // DOM_VK_F9 -> GLFW_KEY_F9 + case 0x79:return 299; // DOM_VK_F10 -> GLFW_KEY_F10 + case 0x7A:return 300; // DOM_VK_F11 -> GLFW_KEY_F11 + case 0x7B:return 301; // DOM_VK_F12 -> GLFW_KEY_F12 + case 0x7C:return 302; // DOM_VK_F13 -> GLFW_KEY_F13 + case 0x7D:return 303; // DOM_VK_F14 -> GLFW_KEY_F14 + case 0x7E:return 304; // DOM_VK_F15 -> GLFW_KEY_F15 + case 0x7F:return 305; // DOM_VK_F16 -> GLFW_KEY_F16 + case 0x80:return 306; // DOM_VK_F17 -> GLFW_KEY_F17 + case 0x81:return 307; // DOM_VK_F18 -> GLFW_KEY_F18 + case 0x82:return 308; // DOM_VK_F19 -> GLFW_KEY_F19 + case 0x83:return 309; // DOM_VK_F20 -> GLFW_KEY_F20 + case 0x84:return 310; // DOM_VK_F21 -> GLFW_KEY_F21 + case 0x85:return 311; // DOM_VK_F22 -> GLFW_KEY_F22 + case 0x86:return 312; // DOM_VK_F23 -> GLFW_KEY_F23 + case 0x87:return 313; // DOM_VK_F24 -> GLFW_KEY_F24 + case 0x88:return 314; // 0x88 (not used?) -> GLFW_KEY_F25 + case 0x60:return 320; // DOM_VK_NUMPAD0 -> GLFW_KEY_KP_0 + case 0x61:return 321; // DOM_VK_NUMPAD1 -> GLFW_KEY_KP_1 + case 0x62:return 322; // DOM_VK_NUMPAD2 -> GLFW_KEY_KP_2 + case 0x63:return 323; // DOM_VK_NUMPAD3 -> GLFW_KEY_KP_3 + case 0x64:return 324; // DOM_VK_NUMPAD4 -> GLFW_KEY_KP_4 + case 0x65:return 325; // DOM_VK_NUMPAD5 -> GLFW_KEY_KP_5 + case 0x66:return 326; // DOM_VK_NUMPAD6 -> GLFW_KEY_KP_6 + case 0x67:return 327; // DOM_VK_NUMPAD7 -> GLFW_KEY_KP_7 + case 0x68:return 328; // DOM_VK_NUMPAD8 -> GLFW_KEY_KP_8 + case 0x69:return 329; // DOM_VK_NUMPAD9 -> GLFW_KEY_KP_9 + case 0x6E:return 330; // DOM_VK_DECIMAL -> GLFW_KEY_KP_DECIMAL + case 0x6F:return 331; // DOM_VK_DIVIDE -> GLFW_KEY_KP_DIVIDE + case 0x6A:return 332; // DOM_VK_MULTIPLY -> GLFW_KEY_KP_MULTIPLY + case 0x6D:return 333; // DOM_VK_SUBTRACT -> GLFW_KEY_KP_SUBTRACT + case 0x6B:return 334; // DOM_VK_ADD -> GLFW_KEY_KP_ADD + // case 0x0D:return 335; // DOM_VK_RETURN -> GLFW_KEY_KP_ENTER (DOM_KEY_LOCATION_RIGHT) + // case 0x61:return 336; // DOM_VK_EQUALS -> GLFW_KEY_KP_EQUAL (DOM_KEY_LOCATION_RIGHT) + case 0x10:return 340; // DOM_VK_SHIFT -> GLFW_KEY_LEFT_SHIFT + case 0x11:return 341; // DOM_VK_CONTROL -> GLFW_KEY_LEFT_CONTROL + case 0x12:return 342; // DOM_VK_ALT -> GLFW_KEY_LEFT_ALT + case 0x5B:return 343; // DOM_VK_WIN -> GLFW_KEY_LEFT_SUPER + // case 0x10:return 344; // DOM_VK_SHIFT -> GLFW_KEY_RIGHT_SHIFT (DOM_KEY_LOCATION_RIGHT) + // case 0x11:return 345; // DOM_VK_CONTROL -> GLFW_KEY_RIGHT_CONTROL (DOM_KEY_LOCATION_RIGHT) + // case 0x12:return 346; // DOM_VK_ALT -> GLFW_KEY_RIGHT_ALT (DOM_KEY_LOCATION_RIGHT) + // case 0x5B:return 347; // DOM_VK_WIN -> GLFW_KEY_RIGHT_SUPER (DOM_KEY_LOCATION_RIGHT) + case 0x5D:return 348; // DOM_VK_CONTEXT_MENU -> GLFW_KEY_MENU + // XXX: GLFW_KEY_WORLD_1, GLFW_KEY_WORLD_2 what are these? + default:return -1; // GLFW_KEY_UNKNOWN + }; + },getModBits:function (win) { + var mod = 0; + if (win.keys[340]) mod |= 0x0001; // GLFW_MOD_SHIFT + if (win.keys[341]) mod |= 0x0002; // GLFW_MOD_CONTROL + if (win.keys[342]) mod |= 0x0004; // GLFW_MOD_ALT + if (win.keys[343]) mod |= 0x0008; // GLFW_MOD_SUPER + return mod; + },onKeyPress:function (event) { + if (!GLFW.active || !GLFW.active.charFunc) return; + if (event.ctrlKey || event.metaKey) return; + + // correct unicode charCode is only available with onKeyPress event + var charCode = event.charCode; + if (charCode == 0 || (charCode >= 0x00 && charCode <= 0x1F)) return; + + + Module['dynCall_vii'](GLFW.active.charFunc, GLFW.active.id, charCode); + },onKeyChanged:function (keyCode, status) { + if (!GLFW.active) return; + + var key = GLFW.DOMToGLFWKeyCode(keyCode); + if (key == -1) return; + + var repeat = status && GLFW.active.keys[key]; + GLFW.active.keys[key] = status; + GLFW.active.domKeys[keyCode] = status; + if (!GLFW.active.keyFunc) return; + + + if (repeat) status = 2; // GLFW_REPEAT + Module['dynCall_viiiii'](GLFW.active.keyFunc, GLFW.active.id, key, keyCode, status, GLFW.getModBits(GLFW.active)); + },onGamepadConnected:function (event) { + GLFW.refreshJoysticks(); + },onGamepadDisconnected:function (event) { + GLFW.refreshJoysticks(); + },onKeydown:function (event) { + GLFW.onKeyChanged(event.keyCode, 1); // GLFW_PRESS or GLFW_REPEAT + + // This logic comes directly from the sdl implementation. We cannot + // call preventDefault on all keydown events otherwise onKeyPress will + // not get called + if (event.keyCode === 8 /* backspace */ || event.keyCode === 9 /* tab */) { + event.preventDefault(); + } + },onKeyup:function (event) { + GLFW.onKeyChanged(event.keyCode, 0); // GLFW_RELEASE + },onBlur:function (event) { + if (!GLFW.active) return; + + for (var i = 0; i < GLFW.active.domKeys.length; ++i) { + if (GLFW.active.domKeys[i]) { + GLFW.onKeyChanged(i, 0); // GLFW_RELEASE + } + } + },onMousemove:function (event) { + if (!GLFW.active) return; + + Browser.calculateMouseEvent(event); + + if (event.target != Module["canvas"] || !GLFW.active.cursorPosFunc) return; + + + Module['dynCall_vidd'](GLFW.active.cursorPosFunc, GLFW.active.id, Browser.mouseX, Browser.mouseY); + },DOMToGLFWMouseButton:function (event) { + // DOM and glfw have different button codes. + // See http://www.w3schools.com/jsref/event_button.asp. + var eventButton = event['button']; + if (eventButton > 0) { + if (eventButton == 1) { + eventButton = 2; + } else { + eventButton = 1; + } + } + return eventButton; + },onMouseenter:function (event) { + if (!GLFW.active) return; + + if (event.target != Module["canvas"] || !GLFW.active.cursorEnterFunc) return; + + Module['dynCall_vii'](GLFW.active.cursorEnterFunc, GLFW.active.id, 1); + },onMouseleave:function (event) { + if (!GLFW.active) return; + + if (event.target != Module["canvas"] || !GLFW.active.cursorEnterFunc) return; + + Module['dynCall_vii'](GLFW.active.cursorEnterFunc, GLFW.active.id, 0); + },onMouseButtonChanged:function (event, status) { + if (!GLFW.active) return; + + Browser.calculateMouseEvent(event); + + if (event.target != Module["canvas"]) return; + + eventButton = GLFW.DOMToGLFWMouseButton(event); + + if (status == 1) { // GLFW_PRESS + GLFW.active.buttons |= (1 << eventButton); + try { + event.target.setCapture(); + } catch (e) {} + } else { // GLFW_RELEASE + GLFW.active.buttons &= ~(1 << eventButton); + } + + if (!GLFW.active.mouseButtonFunc) return; + + + Module['dynCall_viiii'](GLFW.active.mouseButtonFunc, GLFW.active.id, eventButton, status, GLFW.getModBits(GLFW.active)); + },onMouseButtonDown:function (event) { + if (!GLFW.active) return; + GLFW.onMouseButtonChanged(event, 1); // GLFW_PRESS + },onMouseButtonUp:function (event) { + if (!GLFW.active) return; + GLFW.onMouseButtonChanged(event, 0); // GLFW_RELEASE + },onMouseWheel:function (event) { + // Note the minus sign that flips browser wheel direction (positive direction scrolls page down) to native wheel direction (positive direction is mouse wheel up) + var delta = -Browser.getMouseWheelDelta(event); + delta = (delta == 0) ? 0 : (delta > 0 ? Math.max(delta, 1) : Math.min(delta, -1)); // Quantize to integer so that minimum scroll is at least +/- 1. + GLFW.wheelPos += delta; + + if (!GLFW.active || !GLFW.active.scrollFunc || event.target != Module['canvas']) return; + + + var sx = 0; + var sy = 0; + if (event.type == 'mousewheel') { + sx = event.wheelDeltaX; + sy = event.wheelDeltaY; + } else { + sx = event.deltaX; + sy = event.deltaY; + } + + Module['dynCall_vidd'](GLFW.active.scrollFunc, GLFW.active.id, sx, sy); + + event.preventDefault(); + },onCanvasResize:function (width, height) { + if (!GLFW.active) return; + + var resizeNeeded = true; + + // If the client is requestiong fullscreen mode + if (document["fullscreen"] || document["fullScreen"] || document["mozFullScreen"] || document["webkitIsFullScreen"]) { + GLFW.active.storedX = GLFW.active.x; + GLFW.active.storedY = GLFW.active.y; + GLFW.active.storedWidth = GLFW.active.width; + GLFW.active.storedHeight = GLFW.active.height; + GLFW.active.x = GLFW.active.y = 0; + GLFW.active.width = screen.width; + GLFW.active.height = screen.height; + GLFW.active.fullscreen = true; + + // If the client is reverting from fullscreen mode + } else if (GLFW.active.fullscreen == true) { + GLFW.active.x = GLFW.active.storedX; + GLFW.active.y = GLFW.active.storedY; + GLFW.active.width = GLFW.active.storedWidth; + GLFW.active.height = GLFW.active.storedHeight; + GLFW.active.fullscreen = false; + + // If the width/height values do not match current active window sizes + } else if (GLFW.active.width != width || GLFW.active.height != height) { + GLFW.active.width = width; + GLFW.active.height = height; + } else { + resizeNeeded = false; + } + + // If any of the above conditions were true, we need to resize the canvas + if (resizeNeeded) { + // resets the canvas size to counter the aspect preservation of Browser.updateCanvasDimensions + Browser.setCanvasSize(GLFW.active.width, GLFW.active.height, true); + // TODO: Client dimensions (clientWidth/clientHeight) vs pixel dimensions (width/height) of + // the canvas should drive window and framebuffer size respectfully. + GLFW.onWindowSizeChanged(); + GLFW.onFramebufferSizeChanged(); + } + },onWindowSizeChanged:function () { + if (!GLFW.active) return; + + if (!GLFW.active.windowSizeFunc) return; + + + Module['dynCall_viii'](GLFW.active.windowSizeFunc, GLFW.active.id, GLFW.active.width, GLFW.active.height); + },onFramebufferSizeChanged:function () { + if (!GLFW.active) return; + + if (!GLFW.active.framebufferSizeFunc) return; + + Module['dynCall_viii'](GLFW.active.framebufferSizeFunc, GLFW.active.id, GLFW.active.width, GLFW.active.height); + },requestFullscreen:function () { + var RFS = Module["canvas"]['requestFullscreen'] || + Module["canvas"]['mozRequestFullScreen'] || + Module["canvas"]['webkitRequestFullScreen'] || + (function() {}); + RFS.apply(Module["canvas"], []); + },requestFullScreen:function () { + Module.printErr('GLFW.requestFullScreen() is deprecated. Please call GLFW.requestFullscreen instead.'); + GLFW.requestFullScreen = function() { + return GLFW.requestFullscreen(); + } + return GLFW.requestFullscreen(); + },exitFullscreen:function () { + var CFS = document['exitFullscreen'] || + document['cancelFullScreen'] || + document['mozCancelFullScreen'] || + document['webkitCancelFullScreen'] || + (function() {}); + CFS.apply(document, []); + },cancelFullScreen:function () { + Module.printErr('GLFW.cancelFullScreen() is deprecated. Please call GLFW.exitFullscreen instead.'); + GLFW.cancelFullScreen = function() { + return GLFW.exitFullscreen(); + } + return GLFW.exitFullscreen(); + },getTime:function () { + return _emscripten_get_now() / 1000; + },setWindowTitle:function (winid, title) { + var win = GLFW.WindowFromId(winid); + if (!win) return; + + win.title = Pointer_stringify(title); + if (GLFW.active.id == win.id) { + document.title = win.title; + } + },setJoystickCallback:function (cbfun) { + GLFW.joystickFunc = cbfun; + GLFW.refreshJoysticks(); + },joys:{},lastGamepadState:null,lastGamepadStateFrame:null,refreshJoysticks:function () { + // Produce a new Gamepad API sample if we are ticking a new game frame, or if not using emscripten_set_main_loop() at all to drive animation. + if (Browser.mainLoop.currentFrameNumber !== GLFW.lastGamepadStateFrame || !Browser.mainLoop.currentFrameNumber) { + GLFW.lastGamepadState = navigator.getGamepads ? navigator.getGamepads() : (navigator.webkitGetGamepads ? navigator.webkitGetGamepads : null); + GLFW.lastGamepadStateFrame = Browser.mainLoop.currentFrameNumber; + + for (var joy = 0; joy < GLFW.lastGamepadState.length; ++joy) { + var gamepad = GLFW.lastGamepadState[joy]; + + if (gamepad) { + if (!GLFW.joys[joy]) { + console.log('glfw joystick connected:',joy); + GLFW.joys[joy] = { + id: allocate(intArrayFromString(gamepad.id), 'i8', ALLOC_NORMAL), + buttonsCount: gamepad.buttons.length, + axesCount: gamepad.axes.length, + buttons: allocate(new Array(gamepad.buttons.length), 'i8', ALLOC_NORMAL), + axes: allocate(new Array(gamepad.axes.length*4), 'float', ALLOC_NORMAL) + }; + + if (GLFW.joystickFunc) { + Module['dynCall_vii'](GLFW.joystickFunc, joy, 0x00040001); // GLFW_CONNECTED + } + } + + var data = GLFW.joys[joy]; + + for (var i = 0; i < gamepad.buttons.length; ++i) { + setValue(data.buttons + i, gamepad.buttons[i].pressed, 'i8'); + } + + for (var i = 0; i < gamepad.axes.length; ++i) { + setValue(data.axes + i*4, gamepad.axes[i], 'float'); + } + } else { + if (GLFW.joys[joy]) { + console.log('glfw joystick disconnected',joy); + + if (GLFW.joystickFunc) { + Module['dynCall_vii'](GLFW.joystickFunc, joy, 0x00040002); // GLFW_DISCONNECTED + } + + _free(GLFW.joys[joy].id); + _free(GLFW.joys[joy].buttons); + _free(GLFW.joys[joy].axes); + + delete GLFW.joys[joy]; + } + } + } + } + },setKeyCallback:function (winid, cbfun) { + var win = GLFW.WindowFromId(winid); + if (!win) return; + win.keyFunc = cbfun; + },setCharCallback:function (winid, cbfun) { + var win = GLFW.WindowFromId(winid); + if (!win) return; + win.charFunc = cbfun; + },setMouseButtonCallback:function (winid, cbfun) { + var win = GLFW.WindowFromId(winid); + if (!win) return; + win.mouseButtonFunc = cbfun; + },setCursorPosCallback:function (winid, cbfun) { + var win = GLFW.WindowFromId(winid); + if (!win) return; + win.cursorPosFunc = cbfun; + },setScrollCallback:function (winid, cbfun) { + var win = GLFW.WindowFromId(winid); + if (!win) return; + win.scrollFunc = cbfun; + },setDropCallback:function (winid, cbfun) { + var win = GLFW.WindowFromId(winid); + if (!win) return; + win.dropFunc = cbfun; + },onDrop:function (event) { + if (!GLFW.active || !GLFW.active.dropFunc) return; + if (!event.dataTransfer || !event.dataTransfer.files || event.dataTransfer.files.length == 0) return; + + event.preventDefault(); + + var filenames = allocate(new Array(event.dataTransfer.files.length*4), 'i8*', ALLOC_NORMAL); + var filenamesArray = []; + var count = event.dataTransfer.files.length; + + // Read and save the files to emscripten's FS + var written = 0; + var drop_dir = '.glfw_dropped_files'; + FS.createPath('/', drop_dir); + + function save(file) { + var path = '/' + drop_dir + '/' + file.name.replace(/\//g, '_'); + var reader = new FileReader(); + reader.onloadend = function(e) { + if (reader.readyState != 2) { // not DONE + ++written; + console.log('failed to read dropped file: '+file.name+': '+reader.error); + return; + } + + var data = e.target.result; + FS.writeFile(path, new Uint8Array(data), { encoding: 'binary' }); + if (++written === count) { + Module['dynCall_viii'](GLFW.active.dropFunc, GLFW.active.id, count, filenames); + + for (var i = 0; i < filenamesArray.length; ++i) { + _free(filenamesArray[i]); + } + _free(filenames); + } + }; + reader.readAsArrayBuffer(file); + + var filename = allocate(intArrayFromString(path), 'i8', ALLOC_NORMAL); + filenamesArray.push(filename); + setValue(filenames + i*4, filename, 'i8*'); + } + + for (var i = 0; i < count; ++i) { + save(event.dataTransfer.files[i]); + } + + return false; + },onDragover:function (event) { + if (!GLFW.active || !GLFW.active.dropFunc) return; + + event.preventDefault(); + return false; + },setWindowSizeCallback:function (winid, cbfun) { + var win = GLFW.WindowFromId(winid); + if (!win) return; + win.windowSizeFunc = cbfun; + + },setWindowCloseCallback:function (winid, cbfun) { + var win = GLFW.WindowFromId(winid); + if (!win) return; + win.windowCloseFunc = cbfun; + },setWindowRefreshCallback:function (winid, cbfun) { + var win = GLFW.WindowFromId(winid); + if (!win) return; + win.windowRefreshFunc = cbfun; + },onClickRequestPointerLock:function (e) { + if (!Browser.pointerLock && Module['canvas'].requestPointerLock) { + Module['canvas'].requestPointerLock(); + e.preventDefault(); + } + },setInputMode:function (winid, mode, value) { + var win = GLFW.WindowFromId(winid); + if (!win) return; + + switch(mode) { + case 0x00033001: { // GLFW_CURSOR + switch(value) { + case 0x00034001: { // GLFW_CURSOR_NORMAL + win.inputModes[mode] = value; + Module['canvas'].removeEventListener('click', GLFW.onClickRequestPointerLock, true); + Module['canvas'].exitPointerLock(); + break; + } + case 0x00034002: { // GLFW_CURSOR_HIDDEN + console.log("glfwSetInputMode called with GLFW_CURSOR_HIDDEN value not implemented."); + break; + } + case 0x00034003: { // GLFW_CURSOR_DISABLED + win.inputModes[mode] = value; + Module['canvas'].addEventListener('click', GLFW.onClickRequestPointerLock, true); + Module['canvas'].requestPointerLock(); + break; + } + default: { + console.log("glfwSetInputMode called with unknown value parameter value: " + value + "."); + break; + } + } + break; + } + case 0x00033002: { // GLFW_STICKY_KEYS + console.log("glfwSetInputMode called with GLFW_STICKY_KEYS mode not implemented."); + break; + } + case 0x00033003: { // GLFW_STICKY_MOUSE_BUTTONS + console.log("glfwSetInputMode called with GLFW_STICKY_MOUSE_BUTTONS mode not implemented."); + break; + } + default: { + console.log("glfwSetInputMode called with unknown mode parameter value: " + mode + "."); + break; + } + } + },getKey:function (winid, key) { + var win = GLFW.WindowFromId(winid); + if (!win) return 0; + return win.keys[key]; + },getMouseButton:function (winid, button) { + var win = GLFW.WindowFromId(winid); + if (!win) return 0; + return (win.buttons & (1 << button)) > 0; + },getCursorPos:function (winid, x, y) { + setValue(x, Browser.mouseX, 'double'); + setValue(y, Browser.mouseY, 'double'); + },getMousePos:function (winid, x, y) { + setValue(x, Browser.mouseX, 'i32'); + setValue(y, Browser.mouseY, 'i32'); + },setCursorPos:function (winid, x, y) { + },getWindowPos:function (winid, x, y) { + var wx = 0; + var wy = 0; + + var win = GLFW.WindowFromId(winid); + if (win) { + wx = win.x; + wy = win.y; + } + + setValue(x, wx, 'i32'); + setValue(y, wy, 'i32'); + },setWindowPos:function (winid, x, y) { + var win = GLFW.WindowFromId(winid); + if (!win) return; + win.x = x; + win.y = y; + },getWindowSize:function (winid, width, height) { + var ww = 0; + var wh = 0; + + var win = GLFW.WindowFromId(winid); + if (win) { + ww = win.width; + wh = win.height; + } + + setValue(width, ww, 'i32'); + setValue(height, wh, 'i32'); + },setWindowSize:function (winid, width, height) { + var win = GLFW.WindowFromId(winid); + if (!win) return; + + if (GLFW.active.id == win.id) { + if (width == screen.width && height == screen.height) { + GLFW.requestFullscreen(); + } else { + GLFW.exitFullscreen(); + Browser.setCanvasSize(width, height); + win.width = width; + win.height = height; + } + } + + if (!win.windowSizeFunc) return; + + + Module['dynCall_viii'](win.windowSizeFunc, win.id, width, height); + },createWindow:function (width, height, title, monitor, share) { + var i, id; + for (i = 0; i < GLFW.windows.length && GLFW.windows[i] !== null; i++); + if (i > 0) throw "glfwCreateWindow only supports one window at time currently"; + + // id for window + id = i + 1; + + // not valid + if (width <= 0 || height <= 0) return 0; + + if (monitor) { + GLFW.requestFullscreen(); + } else { + Browser.setCanvasSize(width, height); + } + + // Create context when there are no existing alive windows + for (i = 0; i < GLFW.windows.length && GLFW.windows[i] == null; i++); + if (i == GLFW.windows.length) { + var contextAttributes = { + antialias: (GLFW.hints[0x0002100D] > 1), // GLFW_SAMPLES + depth: (GLFW.hints[0x00021005] > 0), // GLFW_DEPTH_BITS + stencil: (GLFW.hints[0x00021006] > 0), // GLFW_STENCIL_BITS + alpha: (GLFW.hints[0x00021004] > 0) // GLFW_ALPHA_BITS + } + Module.ctx = Browser.createContext(Module['canvas'], true, true, contextAttributes); + } + + // If context creation failed, do not return a valid window + if (!Module.ctx) return 0; + + // Get non alive id + var win = new GLFW.Window(id, width, height, title, monitor, share); + + // Set window to array + if (id - 1 == GLFW.windows.length) { + GLFW.windows.push(win); + } else { + GLFW.windows[id - 1] = win; + } + + GLFW.active = win; + return win.id; + },destroyWindow:function (winid) { + var win = GLFW.WindowFromId(winid); + if (!win) return; + + if (win.windowCloseFunc) + func(arg); + + GLFW.windows[win.id - 1] = null; + if (GLFW.active.id == win.id) + GLFW.active = null; + + // Destroy context when no alive windows + for (var i = 0; i < GLFW.windows.length; i++) + if (GLFW.windows[i] !== null) return; + + Module.ctx = Browser.destroyContext(Module['canvas'], true, true); + },swapBuffers:function (winid) { + },GLFW2ParamToGLFW3Param:function (param) { + table = { + 0x00030001:0, // GLFW_MOUSE_CURSOR + 0x00030002:0, // GLFW_STICKY_KEYS + 0x00030003:0, // GLFW_STICKY_MOUSE_BUTTONS + 0x00030004:0, // GLFW_SYSTEM_KEYS + 0x00030005:0, // GLFW_KEY_REPEAT + 0x00030006:0, // GLFW_AUTO_POLL_EVENTS + 0x00020001:0, // GLFW_OPENED + 0x00020002:0, // GLFW_ACTIVE + 0x00020003:0, // GLFW_ICONIFIED + 0x00020004:0, // GLFW_ACCELERATED + 0x00020005:0x00021001, // GLFW_RED_BITS + 0x00020006:0x00021002, // GLFW_GREEN_BITS + 0x00020007:0x00021003, // GLFW_BLUE_BITS + 0x00020008:0x00021004, // GLFW_ALPHA_BITS + 0x00020009:0x00021005, // GLFW_DEPTH_BITS + 0x0002000A:0x00021006, // GLFW_STENCIL_BITS + 0x0002000B:0x0002100F, // GLFW_REFRESH_RATE + 0x0002000C:0x00021007, // GLFW_ACCUM_RED_BITS + 0x0002000D:0x00021008, // GLFW_ACCUM_GREEN_BITS + 0x0002000E:0x00021009, // GLFW_ACCUM_BLUE_BITS + 0x0002000F:0x0002100A, // GLFW_ACCUM_ALPHA_BITS + 0x00020010:0x0002100B, // GLFW_AUX_BUFFERS + 0x00020011:0x0002100C, // GLFW_STEREO + 0x00020012:0, // GLFW_WINDOW_NO_RESIZE + 0x00020013:0x0002100D, // GLFW_FSAA_SAMPLES + 0x00020014:0x00022002, // GLFW_OPENGL_VERSION_MAJOR + 0x00020015:0x00022003, // GLFW_OPENGL_VERSION_MINOR + 0x00020016:0x00022006, // GLFW_OPENGL_FORWARD_COMPAT + 0x00020017:0x00022007, // GLFW_OPENGL_DEBUG_CONTEXT + 0x00020018:0x00022008, // GLFW_OPENGL_PROFILE + }; + return table[param]; + }};function _glfwGetVideoModes(monitor, count) { + setValue(count, 0, 'i32'); + return 0; + } + + function _glLinkProgram(program) { + GLctx.linkProgram(GL.programs[program]); + GL.programInfos[program] = null; // uniforms no longer keep the same names after linking + GL.populateUniformTable(program); + } + + function _glBindTexture(target, texture) { + GLctx.bindTexture(target, texture ? GL.textures[texture] : null); + } + + function _emscripten_glStencilFunc(x0, x1, x2) { GLctx['stencilFunc'](x0, x1, x2) } + + function _glFramebufferRenderbuffer(target, attachment, renderbuffertarget, renderbuffer) { + GLctx.framebufferRenderbuffer(target, attachment, renderbuffertarget, + GL.renderbuffers[renderbuffer]); + } + + function _glGetString(name_) { + if (GL.stringCache[name_]) return GL.stringCache[name_]; + var ret; + switch(name_) { + case 0x1F00 /* GL_VENDOR */: + case 0x1F01 /* GL_RENDERER */: + case 0x9245 /* UNMASKED_VENDOR_WEBGL */: + case 0x9246 /* UNMASKED_RENDERER_WEBGL */: + ret = allocate(intArrayFromString(GLctx.getParameter(name_)), 'i8', ALLOC_NORMAL); + break; + case 0x1F02 /* GL_VERSION */: + var glVersion = GLctx.getParameter(GLctx.VERSION); + // return GLES version string corresponding to the version of the WebGL context + { + glVersion = 'OpenGL ES 2.0 (' + glVersion + ')'; + } + ret = allocate(intArrayFromString(glVersion), 'i8', ALLOC_NORMAL); + break; + case 0x1F03 /* GL_EXTENSIONS */: + var exts = GLctx.getSupportedExtensions(); + var gl_exts = []; + for (var i = 0; i < exts.length; ++i) { + gl_exts.push(exts[i]); + gl_exts.push("GL_" + exts[i]); + } + ret = allocate(intArrayFromString(gl_exts.join(' ')), 'i8', ALLOC_NORMAL); + break; + case 0x8B8C /* GL_SHADING_LANGUAGE_VERSION */: + var glslVersion = GLctx.getParameter(GLctx.SHADING_LANGUAGE_VERSION); + // extract the version number 'N.M' from the string 'WebGL GLSL ES N.M ...' + var ver_re = /^WebGL GLSL ES ([0-9]\.[0-9][0-9]?)(?:$| .*)/; + var ver_num = glslVersion.match(ver_re); + if (ver_num !== null) { + if (ver_num[1].length == 3) ver_num[1] = ver_num[1] + '0'; // ensure minor version has 2 digits + glslVersion = 'OpenGL ES GLSL ES ' + ver_num[1] + ' (' + glslVersion + ')'; + } + ret = allocate(intArrayFromString(glslVersion), 'i8', ALLOC_NORMAL); + break; + default: + GL.recordError(0x0500/*GL_INVALID_ENUM*/); + return 0; + } + GL.stringCache[name_] = ret; + return ret; + } + + function _emscripten_glUniform3iv(location, count, value) { + + + GLctx.uniform3iv(GL.uniforms[location], HEAP32.subarray((value)>>2,(value+count*12)>>2)); + } + + function _glDetachShader(program, shader) { + GLctx.detachShader(GL.programs[program], + GL.shaders[shader]); + } + + function _pthread_mutex_init() {} + + function _emscripten_glReleaseShaderCompiler() { + // NOP (as allowed by GLES 2.0 spec) + } + + function _glfwSetScrollCallback(winid, cbfun) { + GLFW.setScrollCallback(winid, cbfun); + } + + function _emscripten_glTexParameterf(x0, x1, x2) { GLctx['texParameterf'](x0, x1, x2) } + + function _emscripten_glTexParameteri(x0, x1, x2) { GLctx['texParameteri'](x0, x1, x2) } + + function _glCompileShader(shader) { + GLctx.compileShader(GL.shaders[shader]); + } + + + + + var ERRNO_CODES={EPERM:1,ENOENT:2,ESRCH:3,EINTR:4,EIO:5,ENXIO:6,E2BIG:7,ENOEXEC:8,EBADF:9,ECHILD:10,EAGAIN:11,EWOULDBLOCK:11,ENOMEM:12,EACCES:13,EFAULT:14,ENOTBLK:15,EBUSY:16,EEXIST:17,EXDEV:18,ENODEV:19,ENOTDIR:20,EISDIR:21,EINVAL:22,ENFILE:23,EMFILE:24,ENOTTY:25,ETXTBSY:26,EFBIG:27,ENOSPC:28,ESPIPE:29,EROFS:30,EMLINK:31,EPIPE:32,EDOM:33,ERANGE:34,ENOMSG:42,EIDRM:43,ECHRNG:44,EL2NSYNC:45,EL3HLT:46,EL3RST:47,ELNRNG:48,EUNATCH:49,ENOCSI:50,EL2HLT:51,EDEADLK:35,ENOLCK:37,EBADE:52,EBADR:53,EXFULL:54,ENOANO:55,EBADRQC:56,EBADSLT:57,EDEADLOCK:35,EBFONT:59,ENOSTR:60,ENODATA:61,ETIME:62,ENOSR:63,ENONET:64,ENOPKG:65,EREMOTE:66,ENOLINK:67,EADV:68,ESRMNT:69,ECOMM:70,EPROTO:71,EMULTIHOP:72,EDOTDOT:73,EBADMSG:74,ENOTUNIQ:76,EBADFD:77,EREMCHG:78,ELIBACC:79,ELIBBAD:80,ELIBSCN:81,ELIBMAX:82,ELIBEXEC:83,ENOSYS:38,ENOTEMPTY:39,ENAMETOOLONG:36,ELOOP:40,EOPNOTSUPP:95,EPFNOSUPPORT:96,ECONNRESET:104,ENOBUFS:105,EAFNOSUPPORT:97,EPROTOTYPE:91,ENOTSOCK:88,ENOPROTOOPT:92,ESHUTDOWN:108,ECONNREFUSED:111,EADDRINUSE:98,ECONNABORTED:103,ENETUNREACH:101,ENETDOWN:100,ETIMEDOUT:110,EHOSTDOWN:112,EHOSTUNREACH:113,EINPROGRESS:115,EALREADY:114,EDESTADDRREQ:89,EMSGSIZE:90,EPROTONOSUPPORT:93,ESOCKTNOSUPPORT:94,EADDRNOTAVAIL:99,ENETRESET:102,EISCONN:106,ENOTCONN:107,ETOOMANYREFS:109,EUSERS:87,EDQUOT:122,ESTALE:116,ENOTSUP:95,ENOMEDIUM:123,EILSEQ:84,EOVERFLOW:75,ECANCELED:125,ENOTRECOVERABLE:131,EOWNERDEAD:130,ESTRPIPE:86}; + + var ERRNO_MESSAGES={0:"Success",1:"Not super-user",2:"No such file or directory",3:"No such process",4:"Interrupted system call",5:"I/O error",6:"No such device or address",7:"Arg list too long",8:"Exec format error",9:"Bad file number",10:"No children",11:"No more processes",12:"Not enough core",13:"Permission denied",14:"Bad address",15:"Block device required",16:"Mount device busy",17:"File exists",18:"Cross-device link",19:"No such device",20:"Not a directory",21:"Is a directory",22:"Invalid argument",23:"Too many open files in system",24:"Too many open files",25:"Not a typewriter",26:"Text file busy",27:"File too large",28:"No space left on device",29:"Illegal seek",30:"Read only file system",31:"Too many links",32:"Broken pipe",33:"Math arg out of domain of func",34:"Math result not representable",35:"File locking deadlock error",36:"File or path name too long",37:"No record locks available",38:"Function not implemented",39:"Directory not empty",40:"Too many symbolic links",42:"No message of desired type",43:"Identifier removed",44:"Channel number out of range",45:"Level 2 not synchronized",46:"Level 3 halted",47:"Level 3 reset",48:"Link number out of range",49:"Protocol driver not attached",50:"No CSI structure available",51:"Level 2 halted",52:"Invalid exchange",53:"Invalid request descriptor",54:"Exchange full",55:"No anode",56:"Invalid request code",57:"Invalid slot",59:"Bad font file fmt",60:"Device not a stream",61:"No data (for no delay io)",62:"Timer expired",63:"Out of streams resources",64:"Machine is not on the network",65:"Package not installed",66:"The object is remote",67:"The link has been severed",68:"Advertise error",69:"Srmount error",70:"Communication error on send",71:"Protocol error",72:"Multihop attempted",73:"Cross mount point (not really error)",74:"Trying to read unreadable message",75:"Value too large for defined data type",76:"Given log. name not unique",77:"f.d. invalid for this operation",78:"Remote address changed",79:"Can access a needed shared lib",80:"Accessing a corrupted shared lib",81:".lib section in a.out corrupted",82:"Attempting to link in too many libs",83:"Attempting to exec a shared library",84:"Illegal byte sequence",86:"Streams pipe error",87:"Too many users",88:"Socket operation on non-socket",89:"Destination address required",90:"Message too long",91:"Protocol wrong type for socket",92:"Protocol not available",93:"Unknown protocol",94:"Socket type not supported",95:"Not supported",96:"Protocol family not supported",97:"Address family not supported by protocol family",98:"Address already in use",99:"Address not available",100:"Network interface is not configured",101:"Network is unreachable",102:"Connection reset by network",103:"Connection aborted",104:"Connection reset by peer",105:"No buffer space available",106:"Socket is already connected",107:"Socket is not connected",108:"Can't send after socket shutdown",109:"Too many references",110:"Connection timed out",111:"Connection refused",112:"Host is down",113:"Host is unreachable",114:"Socket already connected",115:"Connection already in progress",116:"Stale file handle",122:"Quota exceeded",123:"No medium (in tape drive)",125:"Operation canceled",130:"Previous owner died",131:"State not recoverable"}; + + function ___setErrNo(value) { + if (Module['___errno_location']) HEAP32[((Module['___errno_location']())>>2)]=value; + else Module.printErr('failed to set errno from JS'); + return value; + } + + var PATH={splitPath:function (filename) { + var splitPathRe = /^(\/?|)([\s\S]*?)((?:\.{1,2}|[^\/]+?|)(\.[^.\/]*|))(?:[\/]*)$/; + return splitPathRe.exec(filename).slice(1); + },normalizeArray:function (parts, allowAboveRoot) { + // if the path tries to go above the root, `up` ends up > 0 + var up = 0; + for (var i = parts.length - 1; i >= 0; i--) { + var last = parts[i]; + if (last === '.') { + parts.splice(i, 1); + } else if (last === '..') { + parts.splice(i, 1); + up++; + } else if (up) { + parts.splice(i, 1); + up--; + } + } + // if the path is allowed to go above the root, restore leading ..s + if (allowAboveRoot) { + for (; up; up--) { + parts.unshift('..'); + } + } + return parts; + },normalize:function (path) { + var isAbsolute = path.charAt(0) === '/', + trailingSlash = path.substr(-1) === '/'; + // Normalize the path + path = PATH.normalizeArray(path.split('/').filter(function(p) { + return !!p; + }), !isAbsolute).join('/'); + if (!path && !isAbsolute) { + path = '.'; + } + if (path && trailingSlash) { + path += '/'; + } + return (isAbsolute ? '/' : '') + path; + },dirname:function (path) { + var result = PATH.splitPath(path), + root = result[0], + dir = result[1]; + if (!root && !dir) { + // No dirname whatsoever + return '.'; + } + if (dir) { + // It has a dirname, strip trailing slash + dir = dir.substr(0, dir.length - 1); + } + return root + dir; + },basename:function (path) { + // EMSCRIPTEN return '/'' for '/', not an empty string + if (path === '/') return '/'; + var lastSlash = path.lastIndexOf('/'); + if (lastSlash === -1) return path; + return path.substr(lastSlash+1); + },extname:function (path) { + return PATH.splitPath(path)[3]; + },join:function () { + var paths = Array.prototype.slice.call(arguments, 0); + return PATH.normalize(paths.join('/')); + },join2:function (l, r) { + return PATH.normalize(l + '/' + r); + },resolve:function () { + var resolvedPath = '', + resolvedAbsolute = false; + for (var i = arguments.length - 1; i >= -1 && !resolvedAbsolute; i--) { + var path = (i >= 0) ? arguments[i] : FS.cwd(); + // Skip empty and invalid entries + if (typeof path !== 'string') { + throw new TypeError('Arguments to path.resolve must be strings'); + } else if (!path) { + return ''; // an invalid portion invalidates the whole thing + } + resolvedPath = path + '/' + resolvedPath; + resolvedAbsolute = path.charAt(0) === '/'; + } + // At this point the path should be resolved to a full absolute path, but + // handle relative paths to be safe (might happen when process.cwd() fails) + resolvedPath = PATH.normalizeArray(resolvedPath.split('/').filter(function(p) { + return !!p; + }), !resolvedAbsolute).join('/'); + return ((resolvedAbsolute ? '/' : '') + resolvedPath) || '.'; + },relative:function (from, to) { + from = PATH.resolve(from).substr(1); + to = PATH.resolve(to).substr(1); + function trim(arr) { + var start = 0; + for (; start < arr.length; start++) { + if (arr[start] !== '') break; + } + var end = arr.length - 1; + for (; end >= 0; end--) { + if (arr[end] !== '') break; + } + if (start > end) return []; + return arr.slice(start, end - start + 1); + } + var fromParts = trim(from.split('/')); + var toParts = trim(to.split('/')); + var length = Math.min(fromParts.length, toParts.length); + var samePartsLength = length; + for (var i = 0; i < length; i++) { + if (fromParts[i] !== toParts[i]) { + samePartsLength = i; + break; + } + } + var outputParts = []; + for (var i = samePartsLength; i < fromParts.length; i++) { + outputParts.push('..'); + } + outputParts = outputParts.concat(toParts.slice(samePartsLength)); + return outputParts.join('/'); + }}; + + var TTY={ttys:[],init:function () { + // https://github.com/kripken/emscripten/pull/1555 + // if (ENVIRONMENT_IS_NODE) { + // // currently, FS.init does not distinguish if process.stdin is a file or TTY + // // device, it always assumes it's a TTY device. because of this, we're forcing + // // process.stdin to UTF8 encoding to at least make stdin reading compatible + // // with text files until FS.init can be refactored. + // process['stdin']['setEncoding']('utf8'); + // } + },shutdown:function () { + // https://github.com/kripken/emscripten/pull/1555 + // if (ENVIRONMENT_IS_NODE) { + // // inolen: any idea as to why node -e 'process.stdin.read()' wouldn't exit immediately (with process.stdin being a tty)? + // // isaacs: because now it's reading from the stream, you've expressed interest in it, so that read() kicks off a _read() which creates a ReadReq operation + // // inolen: I thought read() in that case was a synchronous operation that just grabbed some amount of buffered data if it exists? + // // isaacs: it is. but it also triggers a _read() call, which calls readStart() on the handle + // // isaacs: do process.stdin.pause() and i'd think it'd probably close the pending call + // process['stdin']['pause'](); + // } + },register:function (dev, ops) { + TTY.ttys[dev] = { input: [], output: [], ops: ops }; + FS.registerDevice(dev, TTY.stream_ops); + },stream_ops:{open:function (stream) { + var tty = TTY.ttys[stream.node.rdev]; + if (!tty) { + throw new FS.ErrnoError(ERRNO_CODES.ENODEV); + } + stream.tty = tty; + stream.seekable = false; + },close:function (stream) { + // flush any pending line data + stream.tty.ops.flush(stream.tty); + },flush:function (stream) { + stream.tty.ops.flush(stream.tty); + },read:function (stream, buffer, offset, length, pos /* ignored */) { + if (!stream.tty || !stream.tty.ops.get_char) { + throw new FS.ErrnoError(ERRNO_CODES.ENXIO); + } + var bytesRead = 0; + for (var i = 0; i < length; i++) { + var result; + try { + result = stream.tty.ops.get_char(stream.tty); + } catch (e) { + throw new FS.ErrnoError(ERRNO_CODES.EIO); + } + if (result === undefined && bytesRead === 0) { + throw new FS.ErrnoError(ERRNO_CODES.EAGAIN); + } + if (result === null || result === undefined) break; + bytesRead++; + buffer[offset+i] = result; + } + if (bytesRead) { + stream.node.timestamp = Date.now(); + } + return bytesRead; + },write:function (stream, buffer, offset, length, pos) { + if (!stream.tty || !stream.tty.ops.put_char) { + throw new FS.ErrnoError(ERRNO_CODES.ENXIO); + } + for (var i = 0; i < length; i++) { + try { + stream.tty.ops.put_char(stream.tty, buffer[offset+i]); + } catch (e) { + throw new FS.ErrnoError(ERRNO_CODES.EIO); + } + } + if (length) { + stream.node.timestamp = Date.now(); + } + return i; + }},default_tty_ops:{get_char:function (tty) { + if (!tty.input.length) { + var result = null; + if (ENVIRONMENT_IS_NODE) { + // we will read data by chunks of BUFSIZE + var BUFSIZE = 256; + var buf = new Buffer(BUFSIZE); + var bytesRead = 0; + + var isPosixPlatform = (process.platform != 'win32'); // Node doesn't offer a direct check, so test by exclusion + + var fd = process.stdin.fd; + if (isPosixPlatform) { + // Linux and Mac cannot use process.stdin.fd (which isn't set up as sync) + var usingDevice = false; + try { + fd = fs.openSync('/dev/stdin', 'r'); + usingDevice = true; + } catch (e) {} + } + + try { + bytesRead = fs.readSync(fd, buf, 0, BUFSIZE, null); + } catch(e) { + // Cross-platform differences: on Windows, reading EOF throws an exception, but on other OSes, + // reading EOF returns 0. Uniformize behavior by treating the EOF exception to return 0. + if (e.toString().indexOf('EOF') != -1) bytesRead = 0; + else throw e; + } + + if (usingDevice) { fs.closeSync(fd); } + if (bytesRead > 0) { + result = buf.slice(0, bytesRead).toString('utf-8'); + } else { + result = null; + } + + } else if (typeof window != 'undefined' && + typeof window.prompt == 'function') { + // Browser. + result = window.prompt('Input: '); // returns null on cancel + if (result !== null) { + result += '\n'; + } + } else if (typeof readline == 'function') { + // Command line. + result = readline(); + if (result !== null) { + result += '\n'; + } + } + if (!result) { + return null; + } + tty.input = intArrayFromString(result, true); + } + return tty.input.shift(); + },put_char:function (tty, val) { + if (val === null || val === 10) { + Module['print'](UTF8ArrayToString(tty.output, 0)); + tty.output = []; + } else { + if (val != 0) tty.output.push(val); // val == 0 would cut text output off in the middle. + } + },flush:function (tty) { + if (tty.output && tty.output.length > 0) { + Module['print'](UTF8ArrayToString(tty.output, 0)); + tty.output = []; + } + }},default_tty1_ops:{put_char:function (tty, val) { + if (val === null || val === 10) { + Module['printErr'](UTF8ArrayToString(tty.output, 0)); + tty.output = []; + } else { + if (val != 0) tty.output.push(val); + } + },flush:function (tty) { + if (tty.output && tty.output.length > 0) { + Module['printErr'](UTF8ArrayToString(tty.output, 0)); + tty.output = []; + } + }}}; + + var MEMFS={ops_table:null,mount:function (mount) { + return MEMFS.createNode(null, '/', 16384 | 511 /* 0777 */, 0); + },createNode:function (parent, name, mode, dev) { + if (FS.isBlkdev(mode) || FS.isFIFO(mode)) { + // no supported + throw new FS.ErrnoError(ERRNO_CODES.EPERM); + } + if (!MEMFS.ops_table) { + MEMFS.ops_table = { + dir: { + node: { + getattr: MEMFS.node_ops.getattr, + setattr: MEMFS.node_ops.setattr, + lookup: MEMFS.node_ops.lookup, + mknod: MEMFS.node_ops.mknod, + rename: MEMFS.node_ops.rename, + unlink: MEMFS.node_ops.unlink, + rmdir: MEMFS.node_ops.rmdir, + readdir: MEMFS.node_ops.readdir, + symlink: MEMFS.node_ops.symlink + }, + stream: { + llseek: MEMFS.stream_ops.llseek + } + }, + file: { + node: { + getattr: MEMFS.node_ops.getattr, + setattr: MEMFS.node_ops.setattr + }, + stream: { + llseek: MEMFS.stream_ops.llseek, + read: MEMFS.stream_ops.read, + write: MEMFS.stream_ops.write, + allocate: MEMFS.stream_ops.allocate, + mmap: MEMFS.stream_ops.mmap, + msync: MEMFS.stream_ops.msync + } + }, + link: { + node: { + getattr: MEMFS.node_ops.getattr, + setattr: MEMFS.node_ops.setattr, + readlink: MEMFS.node_ops.readlink + }, + stream: {} + }, + chrdev: { + node: { + getattr: MEMFS.node_ops.getattr, + setattr: MEMFS.node_ops.setattr + }, + stream: FS.chrdev_stream_ops + } + }; + } + var node = FS.createNode(parent, name, mode, dev); + if (FS.isDir(node.mode)) { + node.node_ops = MEMFS.ops_table.dir.node; + node.stream_ops = MEMFS.ops_table.dir.stream; + node.contents = {}; + } else if (FS.isFile(node.mode)) { + node.node_ops = MEMFS.ops_table.file.node; + node.stream_ops = MEMFS.ops_table.file.stream; + node.usedBytes = 0; // The actual number of bytes used in the typed array, as opposed to contents.length which gives the whole capacity. + // When the byte data of the file is populated, this will point to either a typed array, or a normal JS array. Typed arrays are preferred + // for performance, and used by default. However, typed arrays are not resizable like normal JS arrays are, so there is a small disk size + // penalty involved for appending file writes that continuously grow a file similar to std::vector capacity vs used -scheme. + node.contents = null; + } else if (FS.isLink(node.mode)) { + node.node_ops = MEMFS.ops_table.link.node; + node.stream_ops = MEMFS.ops_table.link.stream; + } else if (FS.isChrdev(node.mode)) { + node.node_ops = MEMFS.ops_table.chrdev.node; + node.stream_ops = MEMFS.ops_table.chrdev.stream; + } + node.timestamp = Date.now(); + // add the new node to the parent + if (parent) { + parent.contents[name] = node; + } + return node; + },getFileDataAsRegularArray:function (node) { + if (node.contents && node.contents.subarray) { + var arr = []; + for (var i = 0; i < node.usedBytes; ++i) arr.push(node.contents[i]); + return arr; // Returns a copy of the original data. + } + return node.contents; // No-op, the file contents are already in a JS array. Return as-is. + },getFileDataAsTypedArray:function (node) { + if (!node.contents) return new Uint8Array; + if (node.contents.subarray) return node.contents.subarray(0, node.usedBytes); // Make sure to not return excess unused bytes. + return new Uint8Array(node.contents); + },expandFileStorage:function (node, newCapacity) { + // If we are asked to expand the size of a file that already exists, revert to using a standard JS array to store the file + // instead of a typed array. This makes resizing the array more flexible because we can just .push() elements at the back to + // increase the size. + if (node.contents && node.contents.subarray && newCapacity > node.contents.length) { + node.contents = MEMFS.getFileDataAsRegularArray(node); + node.usedBytes = node.contents.length; // We might be writing to a lazy-loaded file which had overridden this property, so force-reset it. + } + + if (!node.contents || node.contents.subarray) { // Keep using a typed array if creating a new storage, or if old one was a typed array as well. + var prevCapacity = node.contents ? node.contents.length : 0; + if (prevCapacity >= newCapacity) return; // No need to expand, the storage was already large enough. + // Don't expand strictly to the given requested limit if it's only a very small increase, but instead geometrically grow capacity. + // For small filesizes (<1MB), perform size*2 geometric increase, but for large sizes, do a much more conservative size*1.125 increase to + // avoid overshooting the allocation cap by a very large margin. + var CAPACITY_DOUBLING_MAX = 1024 * 1024; + newCapacity = Math.max(newCapacity, (prevCapacity * (prevCapacity < CAPACITY_DOUBLING_MAX ? 2.0 : 1.125)) | 0); + if (prevCapacity != 0) newCapacity = Math.max(newCapacity, 256); // At minimum allocate 256b for each file when expanding. + var oldContents = node.contents; + node.contents = new Uint8Array(newCapacity); // Allocate new storage. + if (node.usedBytes > 0) node.contents.set(oldContents.subarray(0, node.usedBytes), 0); // Copy old data over to the new storage. + return; + } + // Not using a typed array to back the file storage. Use a standard JS array instead. + if (!node.contents && newCapacity > 0) node.contents = []; + while (node.contents.length < newCapacity) node.contents.push(0); + },resizeFileStorage:function (node, newSize) { + if (node.usedBytes == newSize) return; + if (newSize == 0) { + node.contents = null; // Fully decommit when requesting a resize to zero. + node.usedBytes = 0; + return; + } + if (!node.contents || node.contents.subarray) { // Resize a typed array if that is being used as the backing store. + var oldContents = node.contents; + node.contents = new Uint8Array(new ArrayBuffer(newSize)); // Allocate new storage. + if (oldContents) { + node.contents.set(oldContents.subarray(0, Math.min(newSize, node.usedBytes))); // Copy old data over to the new storage. + } + node.usedBytes = newSize; + return; + } + // Backing with a JS array. + if (!node.contents) node.contents = []; + if (node.contents.length > newSize) node.contents.length = newSize; + else while (node.contents.length < newSize) node.contents.push(0); + node.usedBytes = newSize; + },node_ops:{getattr:function (node) { + var attr = {}; + // device numbers reuse inode numbers. + attr.dev = FS.isChrdev(node.mode) ? node.id : 1; + attr.ino = node.id; + attr.mode = node.mode; + attr.nlink = 1; + attr.uid = 0; + attr.gid = 0; + attr.rdev = node.rdev; + if (FS.isDir(node.mode)) { + attr.size = 4096; + } else if (FS.isFile(node.mode)) { + attr.size = node.usedBytes; + } else if (FS.isLink(node.mode)) { + attr.size = node.link.length; + } else { + attr.size = 0; + } + attr.atime = new Date(node.timestamp); + attr.mtime = new Date(node.timestamp); + attr.ctime = new Date(node.timestamp); + // NOTE: In our implementation, st_blocks = Math.ceil(st_size/st_blksize), + // but this is not required by the standard. + attr.blksize = 4096; + attr.blocks = Math.ceil(attr.size / attr.blksize); + return attr; + },setattr:function (node, attr) { + if (attr.mode !== undefined) { + node.mode = attr.mode; + } + if (attr.timestamp !== undefined) { + node.timestamp = attr.timestamp; + } + if (attr.size !== undefined) { + MEMFS.resizeFileStorage(node, attr.size); + } + },lookup:function (parent, name) { + throw FS.genericErrors[ERRNO_CODES.ENOENT]; + },mknod:function (parent, name, mode, dev) { + return MEMFS.createNode(parent, name, mode, dev); + },rename:function (old_node, new_dir, new_name) { + // if we're overwriting a directory at new_name, make sure it's empty. + if (FS.isDir(old_node.mode)) { + var new_node; + try { + new_node = FS.lookupNode(new_dir, new_name); + } catch (e) { + } + if (new_node) { + for (var i in new_node.contents) { + throw new FS.ErrnoError(ERRNO_CODES.ENOTEMPTY); + } + } + } + // do the internal rewiring + delete old_node.parent.contents[old_node.name]; + old_node.name = new_name; + new_dir.contents[new_name] = old_node; + old_node.parent = new_dir; + },unlink:function (parent, name) { + delete parent.contents[name]; + },rmdir:function (parent, name) { + var node = FS.lookupNode(parent, name); + for (var i in node.contents) { + throw new FS.ErrnoError(ERRNO_CODES.ENOTEMPTY); + } + delete parent.contents[name]; + },readdir:function (node) { + var entries = ['.', '..'] + for (var key in node.contents) { + if (!node.contents.hasOwnProperty(key)) { + continue; + } + entries.push(key); + } + return entries; + },symlink:function (parent, newname, oldpath) { + var node = MEMFS.createNode(parent, newname, 511 /* 0777 */ | 40960, 0); + node.link = oldpath; + return node; + },readlink:function (node) { + if (!FS.isLink(node.mode)) { + throw new FS.ErrnoError(ERRNO_CODES.EINVAL); + } + return node.link; + }},stream_ops:{read:function (stream, buffer, offset, length, position) { + var contents = stream.node.contents; + if (position >= stream.node.usedBytes) return 0; + var size = Math.min(stream.node.usedBytes - position, length); + assert(size >= 0); + if (size > 8 && contents.subarray) { // non-trivial, and typed array + buffer.set(contents.subarray(position, position + size), offset); + } else { + for (var i = 0; i < size; i++) buffer[offset + i] = contents[position + i]; + } + return size; + },write:function (stream, buffer, offset, length, position, canOwn) { + if (!length) return 0; + var node = stream.node; + node.timestamp = Date.now(); + + if (buffer.subarray && (!node.contents || node.contents.subarray)) { // This write is from a typed array to a typed array? + if (canOwn) { + assert(position === 0, 'canOwn must imply no weird position inside the file'); + node.contents = buffer.subarray(offset, offset + length); + node.usedBytes = length; + return length; + } else if (node.usedBytes === 0 && position === 0) { // If this is a simple first write to an empty file, do a fast set since we don't need to care about old data. + node.contents = new Uint8Array(buffer.subarray(offset, offset + length)); + node.usedBytes = length; + return length; + } else if (position + length <= node.usedBytes) { // Writing to an already allocated and used subrange of the file? + node.contents.set(buffer.subarray(offset, offset + length), position); + return length; + } + } + + // Appending to an existing file and we need to reallocate, or source data did not come as a typed array. + MEMFS.expandFileStorage(node, position+length); + if (node.contents.subarray && buffer.subarray) node.contents.set(buffer.subarray(offset, offset + length), position); // Use typed array write if available. + else { + for (var i = 0; i < length; i++) { + node.contents[position + i] = buffer[offset + i]; // Or fall back to manual write if not. + } + } + node.usedBytes = Math.max(node.usedBytes, position+length); + return length; + },llseek:function (stream, offset, whence) { + var position = offset; + if (whence === 1) { // SEEK_CUR. + position += stream.position; + } else if (whence === 2) { // SEEK_END. + if (FS.isFile(stream.node.mode)) { + position += stream.node.usedBytes; + } + } + if (position < 0) { + throw new FS.ErrnoError(ERRNO_CODES.EINVAL); + } + return position; + },allocate:function (stream, offset, length) { + MEMFS.expandFileStorage(stream.node, offset + length); + stream.node.usedBytes = Math.max(stream.node.usedBytes, offset + length); + },mmap:function (stream, buffer, offset, length, position, prot, flags) { + if (!FS.isFile(stream.node.mode)) { + throw new FS.ErrnoError(ERRNO_CODES.ENODEV); + } + var ptr; + var allocated; + var contents = stream.node.contents; + // Only make a new copy when MAP_PRIVATE is specified. + if ( !(flags & 2) && + (contents.buffer === buffer || contents.buffer === buffer.buffer) ) { + // We can't emulate MAP_SHARED when the file is not backed by the buffer + // we're mapping to (e.g. the HEAP buffer). + allocated = false; + ptr = contents.byteOffset; + } else { + // Try to avoid unnecessary slices. + if (position > 0 || position + length < stream.node.usedBytes) { + if (contents.subarray) { + contents = contents.subarray(position, position + length); + } else { + contents = Array.prototype.slice.call(contents, position, position + length); + } + } + allocated = true; + ptr = _malloc(length); + if (!ptr) { + throw new FS.ErrnoError(ERRNO_CODES.ENOMEM); + } + buffer.set(contents, ptr); + } + return { ptr: ptr, allocated: allocated }; + },msync:function (stream, buffer, offset, length, mmapFlags) { + if (!FS.isFile(stream.node.mode)) { + throw new FS.ErrnoError(ERRNO_CODES.ENODEV); + } + if (mmapFlags & 2) { + // MAP_PRIVATE calls need not to be synced back to underlying fs + return 0; + } + + var bytesWritten = MEMFS.stream_ops.write(stream, buffer, 0, length, offset, false); + // should we check if bytesWritten and length are the same? + return 0; + }}}; + + var IDBFS={dbs:{},indexedDB:function () { + if (typeof indexedDB !== 'undefined') return indexedDB; + var ret = null; + if (typeof window === 'object') ret = window.indexedDB || window.mozIndexedDB || window.webkitIndexedDB || window.msIndexedDB; + assert(ret, 'IDBFS used, but indexedDB not supported'); + return ret; + },DB_VERSION:21,DB_STORE_NAME:"FILE_DATA",mount:function (mount) { + // reuse all of the core MEMFS functionality + return MEMFS.mount.apply(null, arguments); + },syncfs:function (mount, populate, callback) { + IDBFS.getLocalSet(mount, function(err, local) { + if (err) return callback(err); + + IDBFS.getRemoteSet(mount, function(err, remote) { + if (err) return callback(err); + + var src = populate ? remote : local; + var dst = populate ? local : remote; + + IDBFS.reconcile(src, dst, callback); + }); + }); + },getDB:function (name, callback) { + // check the cache first + var db = IDBFS.dbs[name]; + if (db) { + return callback(null, db); + } + + var req; + try { + req = IDBFS.indexedDB().open(name, IDBFS.DB_VERSION); + } catch (e) { + return callback(e); + } + if (!req) { + return callback("Unable to connect to IndexedDB"); + } + req.onupgradeneeded = function(e) { + var db = e.target.result; + var transaction = e.target.transaction; + + var fileStore; + + if (db.objectStoreNames.contains(IDBFS.DB_STORE_NAME)) { + fileStore = transaction.objectStore(IDBFS.DB_STORE_NAME); + } else { + fileStore = db.createObjectStore(IDBFS.DB_STORE_NAME); + } + + if (!fileStore.indexNames.contains('timestamp')) { + fileStore.createIndex('timestamp', 'timestamp', { unique: false }); + } + }; + req.onsuccess = function() { + db = req.result; + + // add to the cache + IDBFS.dbs[name] = db; + callback(null, db); + }; + req.onerror = function(e) { + callback(this.error); + e.preventDefault(); + }; + },getLocalSet:function (mount, callback) { + var entries = {}; + + function isRealDir(p) { + return p !== '.' && p !== '..'; + }; + function toAbsolute(root) { + return function(p) { + return PATH.join2(root, p); + } + }; + + var check = FS.readdir(mount.mountpoint).filter(isRealDir).map(toAbsolute(mount.mountpoint)); + + while (check.length) { + var path = check.pop(); + var stat; + + try { + stat = FS.stat(path); + } catch (e) { + return callback(e); + } + + if (FS.isDir(stat.mode)) { + check.push.apply(check, FS.readdir(path).filter(isRealDir).map(toAbsolute(path))); + } + + entries[path] = { timestamp: stat.mtime }; + } + + return callback(null, { type: 'local', entries: entries }); + },getRemoteSet:function (mount, callback) { + var entries = {}; + + IDBFS.getDB(mount.mountpoint, function(err, db) { + if (err) return callback(err); + + var transaction = db.transaction([IDBFS.DB_STORE_NAME], 'readonly'); + transaction.onerror = function(e) { + callback(this.error); + e.preventDefault(); + }; + + var store = transaction.objectStore(IDBFS.DB_STORE_NAME); + var index = store.index('timestamp'); + + index.openKeyCursor().onsuccess = function(event) { + var cursor = event.target.result; + + if (!cursor) { + return callback(null, { type: 'remote', db: db, entries: entries }); + } + + entries[cursor.primaryKey] = { timestamp: cursor.key }; + + cursor.continue(); + }; + }); + },loadLocalEntry:function (path, callback) { + var stat, node; + + try { + var lookup = FS.lookupPath(path); + node = lookup.node; + stat = FS.stat(path); + } catch (e) { + return callback(e); + } + + if (FS.isDir(stat.mode)) { + return callback(null, { timestamp: stat.mtime, mode: stat.mode }); + } else if (FS.isFile(stat.mode)) { + // Performance consideration: storing a normal JavaScript array to a IndexedDB is much slower than storing a typed array. + // Therefore always convert the file contents to a typed array first before writing the data to IndexedDB. + node.contents = MEMFS.getFileDataAsTypedArray(node); + return callback(null, { timestamp: stat.mtime, mode: stat.mode, contents: node.contents }); + } else { + return callback(new Error('node type not supported')); + } + },storeLocalEntry:function (path, entry, callback) { + try { + if (FS.isDir(entry.mode)) { + FS.mkdir(path, entry.mode); + } else if (FS.isFile(entry.mode)) { + FS.writeFile(path, entry.contents, { encoding: 'binary', canOwn: true }); + } else { + return callback(new Error('node type not supported')); + } + + FS.chmod(path, entry.mode); + FS.utime(path, entry.timestamp, entry.timestamp); + } catch (e) { + return callback(e); + } + + callback(null); + },removeLocalEntry:function (path, callback) { + try { + var lookup = FS.lookupPath(path); + var stat = FS.stat(path); + + if (FS.isDir(stat.mode)) { + FS.rmdir(path); + } else if (FS.isFile(stat.mode)) { + FS.unlink(path); + } + } catch (e) { + return callback(e); + } + + callback(null); + },loadRemoteEntry:function (store, path, callback) { + var req = store.get(path); + req.onsuccess = function(event) { callback(null, event.target.result); }; + req.onerror = function(e) { + callback(this.error); + e.preventDefault(); + }; + },storeRemoteEntry:function (store, path, entry, callback) { + var req = store.put(entry, path); + req.onsuccess = function() { callback(null); }; + req.onerror = function(e) { + callback(this.error); + e.preventDefault(); + }; + },removeRemoteEntry:function (store, path, callback) { + var req = store.delete(path); + req.onsuccess = function() { callback(null); }; + req.onerror = function(e) { + callback(this.error); + e.preventDefault(); + }; + },reconcile:function (src, dst, callback) { + var total = 0; + + var create = []; + Object.keys(src.entries).forEach(function (key) { + var e = src.entries[key]; + var e2 = dst.entries[key]; + if (!e2 || e.timestamp > e2.timestamp) { + create.push(key); + total++; + } + }); + + var remove = []; + Object.keys(dst.entries).forEach(function (key) { + var e = dst.entries[key]; + var e2 = src.entries[key]; + if (!e2) { + remove.push(key); + total++; + } + }); + + if (!total) { + return callback(null); + } + + var errored = false; + var completed = 0; + var db = src.type === 'remote' ? src.db : dst.db; + var transaction = db.transaction([IDBFS.DB_STORE_NAME], 'readwrite'); + var store = transaction.objectStore(IDBFS.DB_STORE_NAME); + + function done(err) { + if (err) { + if (!done.errored) { + done.errored = true; + return callback(err); + } + return; + } + if (++completed >= total) { + return callback(null); + } + }; + + transaction.onerror = function(e) { + done(this.error); + e.preventDefault(); + }; + + // sort paths in ascending order so directory entries are created + // before the files inside them + create.sort().forEach(function (path) { + if (dst.type === 'local') { + IDBFS.loadRemoteEntry(store, path, function (err, entry) { + if (err) return done(err); + IDBFS.storeLocalEntry(path, entry, done); + }); + } else { + IDBFS.loadLocalEntry(path, function (err, entry) { + if (err) return done(err); + IDBFS.storeRemoteEntry(store, path, entry, done); + }); + } + }); + + // sort paths in descending order so files are deleted before their + // parent directories + remove.sort().reverse().forEach(function(path) { + if (dst.type === 'local') { + IDBFS.removeLocalEntry(path, done); + } else { + IDBFS.removeRemoteEntry(store, path, done); + } + }); + }}; + + var NODEFS={isWindows:false,staticInit:function () { + NODEFS.isWindows = !!process.platform.match(/^win/); + },mount:function (mount) { + assert(ENVIRONMENT_IS_NODE); + return NODEFS.createNode(null, '/', NODEFS.getMode(mount.opts.root), 0); + },createNode:function (parent, name, mode, dev) { + if (!FS.isDir(mode) && !FS.isFile(mode) && !FS.isLink(mode)) { + throw new FS.ErrnoError(ERRNO_CODES.EINVAL); + } + var node = FS.createNode(parent, name, mode); + node.node_ops = NODEFS.node_ops; + node.stream_ops = NODEFS.stream_ops; + return node; + },getMode:function (path) { + var stat; + try { + stat = fs.lstatSync(path); + if (NODEFS.isWindows) { + // On Windows, directories return permission bits 'rw-rw-rw-', even though they have 'rwxrwxrwx', so + // propagate write bits to execute bits. + stat.mode = stat.mode | ((stat.mode & 146) >> 1); + } + } catch (e) { + if (!e.code) throw e; + throw new FS.ErrnoError(ERRNO_CODES[e.code]); + } + return stat.mode; + },realPath:function (node) { + var parts = []; + while (node.parent !== node) { + parts.push(node.name); + node = node.parent; + } + parts.push(node.mount.opts.root); + parts.reverse(); + return PATH.join.apply(null, parts); + },flagsToPermissionStringMap:{0:"r",1:"r+",2:"r+",64:"r",65:"r+",66:"r+",129:"rx+",193:"rx+",514:"w+",577:"w",578:"w+",705:"wx",706:"wx+",1024:"a",1025:"a",1026:"a+",1089:"a",1090:"a+",1153:"ax",1154:"ax+",1217:"ax",1218:"ax+",4096:"rs",4098:"rs+"},flagsToPermissionString:function (flags) { + flags &= ~0x200000 /*O_PATH*/; // Ignore this flag from musl, otherwise node.js fails to open the file. + flags &= ~0x800 /*O_NONBLOCK*/; // Ignore this flag from musl, otherwise node.js fails to open the file. + flags &= ~0x8000 /*O_LARGEFILE*/; // Ignore this flag from musl, otherwise node.js fails to open the file. + flags &= ~0x80000 /*O_CLOEXEC*/; // Some applications may pass it; it makes no sense for a single process. + if (flags in NODEFS.flagsToPermissionStringMap) { + return NODEFS.flagsToPermissionStringMap[flags]; + } else { + throw new FS.ErrnoError(ERRNO_CODES.EINVAL); + } + },node_ops:{getattr:function (node) { + var path = NODEFS.realPath(node); + var stat; + try { + stat = fs.lstatSync(path); + } catch (e) { + if (!e.code) throw e; + throw new FS.ErrnoError(ERRNO_CODES[e.code]); + } + // node.js v0.10.20 doesn't report blksize and blocks on Windows. Fake them with default blksize of 4096. + // See http://support.microsoft.com/kb/140365 + if (NODEFS.isWindows && !stat.blksize) { + stat.blksize = 4096; + } + if (NODEFS.isWindows && !stat.blocks) { + stat.blocks = (stat.size+stat.blksize-1)/stat.blksize|0; + } + return { + dev: stat.dev, + ino: stat.ino, + mode: stat.mode, + nlink: stat.nlink, + uid: stat.uid, + gid: stat.gid, + rdev: stat.rdev, + size: stat.size, + atime: stat.atime, + mtime: stat.mtime, + ctime: stat.ctime, + blksize: stat.blksize, + blocks: stat.blocks + }; + },setattr:function (node, attr) { + var path = NODEFS.realPath(node); + try { + if (attr.mode !== undefined) { + fs.chmodSync(path, attr.mode); + // update the common node structure mode as well + node.mode = attr.mode; + } + if (attr.timestamp !== undefined) { + var date = new Date(attr.timestamp); + fs.utimesSync(path, date, date); + } + if (attr.size !== undefined) { + fs.truncateSync(path, attr.size); + } + } catch (e) { + if (!e.code) throw e; + throw new FS.ErrnoError(ERRNO_CODES[e.code]); + } + },lookup:function (parent, name) { + var path = PATH.join2(NODEFS.realPath(parent), name); + var mode = NODEFS.getMode(path); + return NODEFS.createNode(parent, name, mode); + },mknod:function (parent, name, mode, dev) { + var node = NODEFS.createNode(parent, name, mode, dev); + // create the backing node for this in the fs root as well + var path = NODEFS.realPath(node); + try { + if (FS.isDir(node.mode)) { + fs.mkdirSync(path, node.mode); + } else { + fs.writeFileSync(path, '', { mode: node.mode }); + } + } catch (e) { + if (!e.code) throw e; + throw new FS.ErrnoError(ERRNO_CODES[e.code]); + } + return node; + },rename:function (oldNode, newDir, newName) { + var oldPath = NODEFS.realPath(oldNode); + var newPath = PATH.join2(NODEFS.realPath(newDir), newName); + try { + fs.renameSync(oldPath, newPath); + } catch (e) { + if (!e.code) throw e; + throw new FS.ErrnoError(ERRNO_CODES[e.code]); + } + },unlink:function (parent, name) { + var path = PATH.join2(NODEFS.realPath(parent), name); + try { + fs.unlinkSync(path); + } catch (e) { + if (!e.code) throw e; + throw new FS.ErrnoError(ERRNO_CODES[e.code]); + } + },rmdir:function (parent, name) { + var path = PATH.join2(NODEFS.realPath(parent), name); + try { + fs.rmdirSync(path); + } catch (e) { + if (!e.code) throw e; + throw new FS.ErrnoError(ERRNO_CODES[e.code]); + } + },readdir:function (node) { + var path = NODEFS.realPath(node); + try { + return fs.readdirSync(path); + } catch (e) { + if (!e.code) throw e; + throw new FS.ErrnoError(ERRNO_CODES[e.code]); + } + },symlink:function (parent, newName, oldPath) { + var newPath = PATH.join2(NODEFS.realPath(parent), newName); + try { + fs.symlinkSync(oldPath, newPath); + } catch (e) { + if (!e.code) throw e; + throw new FS.ErrnoError(ERRNO_CODES[e.code]); + } + },readlink:function (node) { + var path = NODEFS.realPath(node); + try { + path = fs.readlinkSync(path); + path = NODEJS_PATH.relative(NODEJS_PATH.resolve(node.mount.opts.root), path); + return path; + } catch (e) { + if (!e.code) throw e; + throw new FS.ErrnoError(ERRNO_CODES[e.code]); + } + }},stream_ops:{open:function (stream) { + var path = NODEFS.realPath(stream.node); + try { + if (FS.isFile(stream.node.mode)) { + stream.nfd = fs.openSync(path, NODEFS.flagsToPermissionString(stream.flags)); + } + } catch (e) { + if (!e.code) throw e; + throw new FS.ErrnoError(ERRNO_CODES[e.code]); + } + },close:function (stream) { + try { + if (FS.isFile(stream.node.mode) && stream.nfd) { + fs.closeSync(stream.nfd); + } + } catch (e) { + if (!e.code) throw e; + throw new FS.ErrnoError(ERRNO_CODES[e.code]); + } + },read:function (stream, buffer, offset, length, position) { + if (length === 0) return 0; // node errors on 0 length reads + // FIXME this is terrible. + var nbuffer = new Buffer(length); + var res; + try { + res = fs.readSync(stream.nfd, nbuffer, 0, length, position); + } catch (e) { + throw new FS.ErrnoError(ERRNO_CODES[e.code]); + } + if (res > 0) { + for (var i = 0; i < res; i++) { + buffer[offset + i] = nbuffer[i]; + } + } + return res; + },write:function (stream, buffer, offset, length, position) { + // FIXME this is terrible. + var nbuffer = new Buffer(buffer.subarray(offset, offset + length)); + var res; + try { + res = fs.writeSync(stream.nfd, nbuffer, 0, length, position); + } catch (e) { + throw new FS.ErrnoError(ERRNO_CODES[e.code]); + } + return res; + },llseek:function (stream, offset, whence) { + var position = offset; + if (whence === 1) { // SEEK_CUR. + position += stream.position; + } else if (whence === 2) { // SEEK_END. + if (FS.isFile(stream.node.mode)) { + try { + var stat = fs.fstatSync(stream.nfd); + position += stat.size; + } catch (e) { + throw new FS.ErrnoError(ERRNO_CODES[e.code]); + } + } + } + + if (position < 0) { + throw new FS.ErrnoError(ERRNO_CODES.EINVAL); + } + + return position; + }}}; + + var WORKERFS={DIR_MODE:16895,FILE_MODE:33279,reader:null,mount:function (mount) { + assert(ENVIRONMENT_IS_WORKER); + if (!WORKERFS.reader) WORKERFS.reader = new FileReaderSync(); + var root = WORKERFS.createNode(null, '/', WORKERFS.DIR_MODE, 0); + var createdParents = {}; + function ensureParent(path) { + // return the parent node, creating subdirs as necessary + var parts = path.split('/'); + var parent = root; + for (var i = 0; i < parts.length-1; i++) { + var curr = parts.slice(0, i+1).join('/'); + // Issue 4254: Using curr as a node name will prevent the node + // from being found in FS.nameTable when FS.open is called on + // a path which holds a child of this node, + // given that all FS functions assume node names + // are just their corresponding parts within their given path, + // rather than incremental aggregates which include their parent's + // directories. + if (!createdParents[curr]) { + createdParents[curr] = WORKERFS.createNode(parent, parts[i], WORKERFS.DIR_MODE, 0); + } + parent = createdParents[curr]; + } + return parent; + } + function base(path) { + var parts = path.split('/'); + return parts[parts.length-1]; + } + // We also accept FileList here, by using Array.prototype + Array.prototype.forEach.call(mount.opts["files"] || [], function(file) { + WORKERFS.createNode(ensureParent(file.name), base(file.name), WORKERFS.FILE_MODE, 0, file, file.lastModifiedDate); + }); + (mount.opts["blobs"] || []).forEach(function(obj) { + WORKERFS.createNode(ensureParent(obj["name"]), base(obj["name"]), WORKERFS.FILE_MODE, 0, obj["data"]); + }); + (mount.opts["packages"] || []).forEach(function(pack) { + pack['metadata'].files.forEach(function(file) { + var name = file.filename.substr(1); // remove initial slash + WORKERFS.createNode(ensureParent(name), base(name), WORKERFS.FILE_MODE, 0, pack['blob'].slice(file.start, file.end)); + }); + }); + return root; + },createNode:function (parent, name, mode, dev, contents, mtime) { + var node = FS.createNode(parent, name, mode); + node.mode = mode; + node.node_ops = WORKERFS.node_ops; + node.stream_ops = WORKERFS.stream_ops; + node.timestamp = (mtime || new Date).getTime(); + assert(WORKERFS.FILE_MODE !== WORKERFS.DIR_MODE); + if (mode === WORKERFS.FILE_MODE) { + node.size = contents.size; + node.contents = contents; + } else { + node.size = 4096; + node.contents = {}; + } + if (parent) { + parent.contents[name] = node; + } + return node; + },node_ops:{getattr:function (node) { + return { + dev: 1, + ino: undefined, + mode: node.mode, + nlink: 1, + uid: 0, + gid: 0, + rdev: undefined, + size: node.size, + atime: new Date(node.timestamp), + mtime: new Date(node.timestamp), + ctime: new Date(node.timestamp), + blksize: 4096, + blocks: Math.ceil(node.size / 4096), + }; + },setattr:function (node, attr) { + if (attr.mode !== undefined) { + node.mode = attr.mode; + } + if (attr.timestamp !== undefined) { + node.timestamp = attr.timestamp; + } + },lookup:function (parent, name) { + throw new FS.ErrnoError(ERRNO_CODES.ENOENT); + },mknod:function (parent, name, mode, dev) { + throw new FS.ErrnoError(ERRNO_CODES.EPERM); + },rename:function (oldNode, newDir, newName) { + throw new FS.ErrnoError(ERRNO_CODES.EPERM); + },unlink:function (parent, name) { + throw new FS.ErrnoError(ERRNO_CODES.EPERM); + },rmdir:function (parent, name) { + throw new FS.ErrnoError(ERRNO_CODES.EPERM); + },readdir:function (node) { + var entries = ['.', '..']; + for (var key in node.contents) { + if (!node.contents.hasOwnProperty(key)) { + continue; + } + entries.push(key); + } + return entries; + },symlink:function (parent, newName, oldPath) { + throw new FS.ErrnoError(ERRNO_CODES.EPERM); + },readlink:function (node) { + throw new FS.ErrnoError(ERRNO_CODES.EPERM); + }},stream_ops:{read:function (stream, buffer, offset, length, position) { + if (position >= stream.node.size) return 0; + var chunk = stream.node.contents.slice(position, position + length); + var ab = WORKERFS.reader.readAsArrayBuffer(chunk); + buffer.set(new Uint8Array(ab), offset); + return chunk.size; + },write:function (stream, buffer, offset, length, position) { + throw new FS.ErrnoError(ERRNO_CODES.EIO); + },llseek:function (stream, offset, whence) { + var position = offset; + if (whence === 1) { // SEEK_CUR. + position += stream.position; + } else if (whence === 2) { // SEEK_END. + if (FS.isFile(stream.node.mode)) { + position += stream.node.size; + } + } + if (position < 0) { + throw new FS.ErrnoError(ERRNO_CODES.EINVAL); + } + return position; + }}}; + + var _stdin=STATICTOP; STATICTOP += 16;; + + var _stdout=STATICTOP; STATICTOP += 16;; + + var _stderr=STATICTOP; STATICTOP += 16;;var FS={root:null,mounts:[],devices:[null],streams:[],nextInode:1,nameTable:null,currentPath:"/",initialized:false,ignorePermissions:true,trackingDelegate:{},tracking:{openFlags:{READ:1,WRITE:2}},ErrnoError:null,genericErrors:{},filesystems:null,syncFSRequests:0,handleFSError:function (e) { + if (!(e instanceof FS.ErrnoError)) throw e + ' : ' + stackTrace(); + return ___setErrNo(e.errno); + },lookupPath:function (path, opts) { + path = PATH.resolve(FS.cwd(), path); + opts = opts || {}; + + if (!path) return { path: '', node: null }; + + var defaults = { + follow_mount: true, + recurse_count: 0 + }; + for (var key in defaults) { + if (opts[key] === undefined) { + opts[key] = defaults[key]; + } + } + + if (opts.recurse_count > 8) { // max recursive lookup of 8 + throw new FS.ErrnoError(ERRNO_CODES.ELOOP); + } + + // split the path + var parts = PATH.normalizeArray(path.split('/').filter(function(p) { + return !!p; + }), false); + + // start at the root + var current = FS.root; + var current_path = '/'; + + for (var i = 0; i < parts.length; i++) { + var islast = (i === parts.length-1); + if (islast && opts.parent) { + // stop resolving + break; + } + + current = FS.lookupNode(current, parts[i]); + current_path = PATH.join2(current_path, parts[i]); + + // jump to the mount's root node if this is a mountpoint + if (FS.isMountpoint(current)) { + if (!islast || (islast && opts.follow_mount)) { + current = current.mounted.root; + } + } + + // by default, lookupPath will not follow a symlink if it is the final path component. + // setting opts.follow = true will override this behavior. + if (!islast || opts.follow) { + var count = 0; + while (FS.isLink(current.mode)) { + var link = FS.readlink(current_path); + current_path = PATH.resolve(PATH.dirname(current_path), link); + + var lookup = FS.lookupPath(current_path, { recurse_count: opts.recurse_count }); + current = lookup.node; + + if (count++ > 40) { // limit max consecutive symlinks to 40 (SYMLOOP_MAX). + throw new FS.ErrnoError(ERRNO_CODES.ELOOP); + } + } + } + } + + return { path: current_path, node: current }; + },getPath:function (node) { + var path; + while (true) { + if (FS.isRoot(node)) { + var mount = node.mount.mountpoint; + if (!path) return mount; + return mount[mount.length-1] !== '/' ? mount + '/' + path : mount + path; + } + path = path ? node.name + '/' + path : node.name; + node = node.parent; + } + },hashName:function (parentid, name) { + var hash = 0; + + + for (var i = 0; i < name.length; i++) { + hash = ((hash << 5) - hash + name.charCodeAt(i)) | 0; + } + return ((parentid + hash) >>> 0) % FS.nameTable.length; + },hashAddNode:function (node) { + var hash = FS.hashName(node.parent.id, node.name); + node.name_next = FS.nameTable[hash]; + FS.nameTable[hash] = node; + },hashRemoveNode:function (node) { + var hash = FS.hashName(node.parent.id, node.name); + if (FS.nameTable[hash] === node) { + FS.nameTable[hash] = node.name_next; + } else { + var current = FS.nameTable[hash]; + while (current) { + if (current.name_next === node) { + current.name_next = node.name_next; + break; + } + current = current.name_next; + } + } + },lookupNode:function (parent, name) { + var err = FS.mayLookup(parent); + if (err) { + throw new FS.ErrnoError(err, parent); + } + var hash = FS.hashName(parent.id, name); + for (var node = FS.nameTable[hash]; node; node = node.name_next) { + var nodeName = node.name; + if (node.parent.id === parent.id && nodeName === name) { + return node; + } + } + // if we failed to find it in the cache, call into the VFS + return FS.lookup(parent, name); + },createNode:function (parent, name, mode, rdev) { + if (!FS.FSNode) { + FS.FSNode = function(parent, name, mode, rdev) { + if (!parent) { + parent = this; // root node sets parent to itself + } + this.parent = parent; + this.mount = parent.mount; + this.mounted = null; + this.id = FS.nextInode++; + this.name = name; + this.mode = mode; + this.node_ops = {}; + this.stream_ops = {}; + this.rdev = rdev; + }; + + FS.FSNode.prototype = {}; + + // compatibility + var readMode = 292 | 73; + var writeMode = 146; + + // NOTE we must use Object.defineProperties instead of individual calls to + // Object.defineProperty in order to make closure compiler happy + Object.defineProperties(FS.FSNode.prototype, { + read: { + get: function() { return (this.mode & readMode) === readMode; }, + set: function(val) { val ? this.mode |= readMode : this.mode &= ~readMode; } + }, + write: { + get: function() { return (this.mode & writeMode) === writeMode; }, + set: function(val) { val ? this.mode |= writeMode : this.mode &= ~writeMode; } + }, + isFolder: { + get: function() { return FS.isDir(this.mode); } + }, + isDevice: { + get: function() { return FS.isChrdev(this.mode); } + } + }); + } + + var node = new FS.FSNode(parent, name, mode, rdev); + + FS.hashAddNode(node); + + return node; + },destroyNode:function (node) { + FS.hashRemoveNode(node); + },isRoot:function (node) { + return node === node.parent; + },isMountpoint:function (node) { + return !!node.mounted; + },isFile:function (mode) { + return (mode & 61440) === 32768; + },isDir:function (mode) { + return (mode & 61440) === 16384; + },isLink:function (mode) { + return (mode & 61440) === 40960; + },isChrdev:function (mode) { + return (mode & 61440) === 8192; + },isBlkdev:function (mode) { + return (mode & 61440) === 24576; + },isFIFO:function (mode) { + return (mode & 61440) === 4096; + },isSocket:function (mode) { + return (mode & 49152) === 49152; + },flagModes:{"r":0,"rs":1052672,"r+":2,"w":577,"wx":705,"xw":705,"w+":578,"wx+":706,"xw+":706,"a":1089,"ax":1217,"xa":1217,"a+":1090,"ax+":1218,"xa+":1218},modeStringToFlags:function (str) { + var flags = FS.flagModes[str]; + if (typeof flags === 'undefined') { + throw new Error('Unknown file open mode: ' + str); + } + return flags; + },flagsToPermissionString:function (flag) { + var perms = ['r', 'w', 'rw'][flag & 3]; + if ((flag & 512)) { + perms += 'w'; + } + return perms; + },nodePermissions:function (node, perms) { + if (FS.ignorePermissions) { + return 0; + } + // return 0 if any user, group or owner bits are set. + if (perms.indexOf('r') !== -1 && !(node.mode & 292)) { + return ERRNO_CODES.EACCES; + } else if (perms.indexOf('w') !== -1 && !(node.mode & 146)) { + return ERRNO_CODES.EACCES; + } else if (perms.indexOf('x') !== -1 && !(node.mode & 73)) { + return ERRNO_CODES.EACCES; + } + return 0; + },mayLookup:function (dir) { + var err = FS.nodePermissions(dir, 'x'); + if (err) return err; + if (!dir.node_ops.lookup) return ERRNO_CODES.EACCES; + return 0; + },mayCreate:function (dir, name) { + try { + var node = FS.lookupNode(dir, name); + return ERRNO_CODES.EEXIST; + } catch (e) { + } + return FS.nodePermissions(dir, 'wx'); + },mayDelete:function (dir, name, isdir) { + var node; + try { + node = FS.lookupNode(dir, name); + } catch (e) { + return e.errno; + } + var err = FS.nodePermissions(dir, 'wx'); + if (err) { + return err; + } + if (isdir) { + if (!FS.isDir(node.mode)) { + return ERRNO_CODES.ENOTDIR; + } + if (FS.isRoot(node) || FS.getPath(node) === FS.cwd()) { + return ERRNO_CODES.EBUSY; + } + } else { + if (FS.isDir(node.mode)) { + return ERRNO_CODES.EISDIR; + } + } + return 0; + },mayOpen:function (node, flags) { + if (!node) { + return ERRNO_CODES.ENOENT; + } + if (FS.isLink(node.mode)) { + return ERRNO_CODES.ELOOP; + } else if (FS.isDir(node.mode)) { + if (FS.flagsToPermissionString(flags) !== 'r' || // opening for write + (flags & 512)) { // TODO: check for O_SEARCH? (== search for dir only) + return ERRNO_CODES.EISDIR; + } + } + return FS.nodePermissions(node, FS.flagsToPermissionString(flags)); + },MAX_OPEN_FDS:4096,nextfd:function (fd_start, fd_end) { + fd_start = fd_start || 0; + fd_end = fd_end || FS.MAX_OPEN_FDS; + for (var fd = fd_start; fd <= fd_end; fd++) { + if (!FS.streams[fd]) { + return fd; + } + } + throw new FS.ErrnoError(ERRNO_CODES.EMFILE); + },getStream:function (fd) { + return FS.streams[fd]; + },createStream:function (stream, fd_start, fd_end) { + if (!FS.FSStream) { + FS.FSStream = function(){}; + FS.FSStream.prototype = {}; + // compatibility + Object.defineProperties(FS.FSStream.prototype, { + object: { + get: function() { return this.node; }, + set: function(val) { this.node = val; } + }, + isRead: { + get: function() { return (this.flags & 2097155) !== 1; } + }, + isWrite: { + get: function() { return (this.flags & 2097155) !== 0; } + }, + isAppend: { + get: function() { return (this.flags & 1024); } + } + }); + } + // clone it, so we can return an instance of FSStream + var newStream = new FS.FSStream(); + for (var p in stream) { + newStream[p] = stream[p]; + } + stream = newStream; + var fd = FS.nextfd(fd_start, fd_end); + stream.fd = fd; + FS.streams[fd] = stream; + return stream; + },closeStream:function (fd) { + FS.streams[fd] = null; + },chrdev_stream_ops:{open:function (stream) { + var device = FS.getDevice(stream.node.rdev); + // override node's stream ops with the device's + stream.stream_ops = device.stream_ops; + // forward the open call + if (stream.stream_ops.open) { + stream.stream_ops.open(stream); + } + },llseek:function () { + throw new FS.ErrnoError(ERRNO_CODES.ESPIPE); + }},major:function (dev) { + return ((dev) >> 8); + },minor:function (dev) { + return ((dev) & 0xff); + },makedev:function (ma, mi) { + return ((ma) << 8 | (mi)); + },registerDevice:function (dev, ops) { + FS.devices[dev] = { stream_ops: ops }; + },getDevice:function (dev) { + return FS.devices[dev]; + },getMounts:function (mount) { + var mounts = []; + var check = [mount]; + + while (check.length) { + var m = check.pop(); + + mounts.push(m); + + check.push.apply(check, m.mounts); + } + + return mounts; + },syncfs:function (populate, callback) { + if (typeof(populate) === 'function') { + callback = populate; + populate = false; + } + + FS.syncFSRequests++; + + if (FS.syncFSRequests > 1) { + console.log('warning: ' + FS.syncFSRequests + ' FS.syncfs operations in flight at once, probably just doing extra work'); + } + + var mounts = FS.getMounts(FS.root.mount); + var completed = 0; + + function doCallback(err) { + assert(FS.syncFSRequests > 0); + FS.syncFSRequests--; + return callback(err); + } + + function done(err) { + if (err) { + if (!done.errored) { + done.errored = true; + return doCallback(err); + } + return; + } + if (++completed >= mounts.length) { + doCallback(null); + } + }; + + // sync all mounts + mounts.forEach(function (mount) { + if (!mount.type.syncfs) { + return done(null); + } + mount.type.syncfs(mount, populate, done); + }); + },mount:function (type, opts, mountpoint) { + var root = mountpoint === '/'; + var pseudo = !mountpoint; + var node; + + if (root && FS.root) { + throw new FS.ErrnoError(ERRNO_CODES.EBUSY); + } else if (!root && !pseudo) { + var lookup = FS.lookupPath(mountpoint, { follow_mount: false }); + + mountpoint = lookup.path; // use the absolute path + node = lookup.node; + + if (FS.isMountpoint(node)) { + throw new FS.ErrnoError(ERRNO_CODES.EBUSY); + } + + if (!FS.isDir(node.mode)) { + throw new FS.ErrnoError(ERRNO_CODES.ENOTDIR); + } + } + + var mount = { + type: type, + opts: opts, + mountpoint: mountpoint, + mounts: [] + }; + + // create a root node for the fs + var mountRoot = type.mount(mount); + mountRoot.mount = mount; + mount.root = mountRoot; + + if (root) { + FS.root = mountRoot; + } else if (node) { + // set as a mountpoint + node.mounted = mount; + + // add the new mount to the current mount's children + if (node.mount) { + node.mount.mounts.push(mount); + } + } + + return mountRoot; + },unmount:function (mountpoint) { + var lookup = FS.lookupPath(mountpoint, { follow_mount: false }); + + if (!FS.isMountpoint(lookup.node)) { + throw new FS.ErrnoError(ERRNO_CODES.EINVAL); + } + + // destroy the nodes for this mount, and all its child mounts + var node = lookup.node; + var mount = node.mounted; + var mounts = FS.getMounts(mount); + + Object.keys(FS.nameTable).forEach(function (hash) { + var current = FS.nameTable[hash]; + + while (current) { + var next = current.name_next; + + if (mounts.indexOf(current.mount) !== -1) { + FS.destroyNode(current); + } + + current = next; + } + }); + + // no longer a mountpoint + node.mounted = null; + + // remove this mount from the child mounts + var idx = node.mount.mounts.indexOf(mount); + assert(idx !== -1); + node.mount.mounts.splice(idx, 1); + },lookup:function (parent, name) { + return parent.node_ops.lookup(parent, name); + },mknod:function (path, mode, dev) { + var lookup = FS.lookupPath(path, { parent: true }); + var parent = lookup.node; + var name = PATH.basename(path); + if (!name || name === '.' || name === '..') { + throw new FS.ErrnoError(ERRNO_CODES.EINVAL); + } + var err = FS.mayCreate(parent, name); + if (err) { + throw new FS.ErrnoError(err); + } + if (!parent.node_ops.mknod) { + throw new FS.ErrnoError(ERRNO_CODES.EPERM); + } + return parent.node_ops.mknod(parent, name, mode, dev); + },create:function (path, mode) { + mode = mode !== undefined ? mode : 438 /* 0666 */; + mode &= 4095; + mode |= 32768; + return FS.mknod(path, mode, 0); + },mkdir:function (path, mode) { + mode = mode !== undefined ? mode : 511 /* 0777 */; + mode &= 511 | 512; + mode |= 16384; + return FS.mknod(path, mode, 0); + },mkdirTree:function (path, mode) { + var dirs = path.split('/'); + var d = ''; + for (var i = 0; i < dirs.length; ++i) { + if (!dirs[i]) continue; + d += '/' + dirs[i]; + try { + FS.mkdir(d, mode); + } catch(e) { + if (e.errno != ERRNO_CODES.EEXIST) throw e; + } + } + },mkdev:function (path, mode, dev) { + if (typeof(dev) === 'undefined') { + dev = mode; + mode = 438 /* 0666 */; + } + mode |= 8192; + return FS.mknod(path, mode, dev); + },symlink:function (oldpath, newpath) { + if (!PATH.resolve(oldpath)) { + throw new FS.ErrnoError(ERRNO_CODES.ENOENT); + } + var lookup = FS.lookupPath(newpath, { parent: true }); + var parent = lookup.node; + if (!parent) { + throw new FS.ErrnoError(ERRNO_CODES.ENOENT); + } + var newname = PATH.basename(newpath); + var err = FS.mayCreate(parent, newname); + if (err) { + throw new FS.ErrnoError(err); + } + if (!parent.node_ops.symlink) { + throw new FS.ErrnoError(ERRNO_CODES.EPERM); + } + return parent.node_ops.symlink(parent, newname, oldpath); + },rename:function (old_path, new_path) { + var old_dirname = PATH.dirname(old_path); + var new_dirname = PATH.dirname(new_path); + var old_name = PATH.basename(old_path); + var new_name = PATH.basename(new_path); + // parents must exist + var lookup, old_dir, new_dir; + try { + lookup = FS.lookupPath(old_path, { parent: true }); + old_dir = lookup.node; + lookup = FS.lookupPath(new_path, { parent: true }); + new_dir = lookup.node; + } catch (e) { + throw new FS.ErrnoError(ERRNO_CODES.EBUSY); + } + if (!old_dir || !new_dir) throw new FS.ErrnoError(ERRNO_CODES.ENOENT); + // need to be part of the same mount + if (old_dir.mount !== new_dir.mount) { + throw new FS.ErrnoError(ERRNO_CODES.EXDEV); + } + // source must exist + var old_node = FS.lookupNode(old_dir, old_name); + // old path should not be an ancestor of the new path + var relative = PATH.relative(old_path, new_dirname); + if (relative.charAt(0) !== '.') { + throw new FS.ErrnoError(ERRNO_CODES.EINVAL); + } + // new path should not be an ancestor of the old path + relative = PATH.relative(new_path, old_dirname); + if (relative.charAt(0) !== '.') { + throw new FS.ErrnoError(ERRNO_CODES.ENOTEMPTY); + } + // see if the new path already exists + var new_node; + try { + new_node = FS.lookupNode(new_dir, new_name); + } catch (e) { + // not fatal + } + // early out if nothing needs to change + if (old_node === new_node) { + return; + } + // we'll need to delete the old entry + var isdir = FS.isDir(old_node.mode); + var err = FS.mayDelete(old_dir, old_name, isdir); + if (err) { + throw new FS.ErrnoError(err); + } + // need delete permissions if we'll be overwriting. + // need create permissions if new doesn't already exist. + err = new_node ? + FS.mayDelete(new_dir, new_name, isdir) : + FS.mayCreate(new_dir, new_name); + if (err) { + throw new FS.ErrnoError(err); + } + if (!old_dir.node_ops.rename) { + throw new FS.ErrnoError(ERRNO_CODES.EPERM); + } + if (FS.isMountpoint(old_node) || (new_node && FS.isMountpoint(new_node))) { + throw new FS.ErrnoError(ERRNO_CODES.EBUSY); + } + // if we are going to change the parent, check write permissions + if (new_dir !== old_dir) { + err = FS.nodePermissions(old_dir, 'w'); + if (err) { + throw new FS.ErrnoError(err); + } + } + try { + if (FS.trackingDelegate['willMovePath']) { + FS.trackingDelegate['willMovePath'](old_path, new_path); + } + } catch(e) { + console.log("FS.trackingDelegate['willMovePath']('"+old_path+"', '"+new_path+"') threw an exception: " + e.message); + } + // remove the node from the lookup hash + FS.hashRemoveNode(old_node); + // do the underlying fs rename + try { + old_dir.node_ops.rename(old_node, new_dir, new_name); + } catch (e) { + throw e; + } finally { + // add the node back to the hash (in case node_ops.rename + // changed its name) + FS.hashAddNode(old_node); + } + try { + if (FS.trackingDelegate['onMovePath']) FS.trackingDelegate['onMovePath'](old_path, new_path); + } catch(e) { + console.log("FS.trackingDelegate['onMovePath']('"+old_path+"', '"+new_path+"') threw an exception: " + e.message); + } + },rmdir:function (path) { + var lookup = FS.lookupPath(path, { parent: true }); + var parent = lookup.node; + var name = PATH.basename(path); + var node = FS.lookupNode(parent, name); + var err = FS.mayDelete(parent, name, true); + if (err) { + throw new FS.ErrnoError(err); + } + if (!parent.node_ops.rmdir) { + throw new FS.ErrnoError(ERRNO_CODES.EPERM); + } + if (FS.isMountpoint(node)) { + throw new FS.ErrnoError(ERRNO_CODES.EBUSY); + } + try { + if (FS.trackingDelegate['willDeletePath']) { + FS.trackingDelegate['willDeletePath'](path); + } + } catch(e) { + console.log("FS.trackingDelegate['willDeletePath']('"+path+"') threw an exception: " + e.message); + } + parent.node_ops.rmdir(parent, name); + FS.destroyNode(node); + try { + if (FS.trackingDelegate['onDeletePath']) FS.trackingDelegate['onDeletePath'](path); + } catch(e) { + console.log("FS.trackingDelegate['onDeletePath']('"+path+"') threw an exception: " + e.message); + } + },readdir:function (path) { + var lookup = FS.lookupPath(path, { follow: true }); + var node = lookup.node; + if (!node.node_ops.readdir) { + throw new FS.ErrnoError(ERRNO_CODES.ENOTDIR); + } + return node.node_ops.readdir(node); + },unlink:function (path) { + var lookup = FS.lookupPath(path, { parent: true }); + var parent = lookup.node; + var name = PATH.basename(path); + var node = FS.lookupNode(parent, name); + var err = FS.mayDelete(parent, name, false); + if (err) { + // According to POSIX, we should map EISDIR to EPERM, but + // we instead do what Linux does (and we must, as we use + // the musl linux libc). + throw new FS.ErrnoError(err); + } + if (!parent.node_ops.unlink) { + throw new FS.ErrnoError(ERRNO_CODES.EPERM); + } + if (FS.isMountpoint(node)) { + throw new FS.ErrnoError(ERRNO_CODES.EBUSY); + } + try { + if (FS.trackingDelegate['willDeletePath']) { + FS.trackingDelegate['willDeletePath'](path); + } + } catch(e) { + console.log("FS.trackingDelegate['willDeletePath']('"+path+"') threw an exception: " + e.message); + } + parent.node_ops.unlink(parent, name); + FS.destroyNode(node); + try { + if (FS.trackingDelegate['onDeletePath']) FS.trackingDelegate['onDeletePath'](path); + } catch(e) { + console.log("FS.trackingDelegate['onDeletePath']('"+path+"') threw an exception: " + e.message); + } + },readlink:function (path) { + var lookup = FS.lookupPath(path); + var link = lookup.node; + if (!link) { + throw new FS.ErrnoError(ERRNO_CODES.ENOENT); + } + if (!link.node_ops.readlink) { + throw new FS.ErrnoError(ERRNO_CODES.EINVAL); + } + return PATH.resolve(FS.getPath(link.parent), link.node_ops.readlink(link)); + },stat:function (path, dontFollow) { + var lookup = FS.lookupPath(path, { follow: !dontFollow }); + var node = lookup.node; + if (!node) { + throw new FS.ErrnoError(ERRNO_CODES.ENOENT); + } + if (!node.node_ops.getattr) { + throw new FS.ErrnoError(ERRNO_CODES.EPERM); + } + return node.node_ops.getattr(node); + },lstat:function (path) { + return FS.stat(path, true); + },chmod:function (path, mode, dontFollow) { + var node; + if (typeof path === 'string') { + var lookup = FS.lookupPath(path, { follow: !dontFollow }); + node = lookup.node; + } else { + node = path; + } + if (!node.node_ops.setattr) { + throw new FS.ErrnoError(ERRNO_CODES.EPERM); + } + node.node_ops.setattr(node, { + mode: (mode & 4095) | (node.mode & ~4095), + timestamp: Date.now() + }); + },lchmod:function (path, mode) { + FS.chmod(path, mode, true); + },fchmod:function (fd, mode) { + var stream = FS.getStream(fd); + if (!stream) { + throw new FS.ErrnoError(ERRNO_CODES.EBADF); + } + FS.chmod(stream.node, mode); + },chown:function (path, uid, gid, dontFollow) { + var node; + if (typeof path === 'string') { + var lookup = FS.lookupPath(path, { follow: !dontFollow }); + node = lookup.node; + } else { + node = path; + } + if (!node.node_ops.setattr) { + throw new FS.ErrnoError(ERRNO_CODES.EPERM); + } + node.node_ops.setattr(node, { + timestamp: Date.now() + // we ignore the uid / gid for now + }); + },lchown:function (path, uid, gid) { + FS.chown(path, uid, gid, true); + },fchown:function (fd, uid, gid) { + var stream = FS.getStream(fd); + if (!stream) { + throw new FS.ErrnoError(ERRNO_CODES.EBADF); + } + FS.chown(stream.node, uid, gid); + },truncate:function (path, len) { + if (len < 0) { + throw new FS.ErrnoError(ERRNO_CODES.EINVAL); + } + var node; + if (typeof path === 'string') { + var lookup = FS.lookupPath(path, { follow: true }); + node = lookup.node; + } else { + node = path; + } + if (!node.node_ops.setattr) { + throw new FS.ErrnoError(ERRNO_CODES.EPERM); + } + if (FS.isDir(node.mode)) { + throw new FS.ErrnoError(ERRNO_CODES.EISDIR); + } + if (!FS.isFile(node.mode)) { + throw new FS.ErrnoError(ERRNO_CODES.EINVAL); + } + var err = FS.nodePermissions(node, 'w'); + if (err) { + throw new FS.ErrnoError(err); + } + node.node_ops.setattr(node, { + size: len, + timestamp: Date.now() + }); + },ftruncate:function (fd, len) { + var stream = FS.getStream(fd); + if (!stream) { + throw new FS.ErrnoError(ERRNO_CODES.EBADF); + } + if ((stream.flags & 2097155) === 0) { + throw new FS.ErrnoError(ERRNO_CODES.EINVAL); + } + FS.truncate(stream.node, len); + },utime:function (path, atime, mtime) { + var lookup = FS.lookupPath(path, { follow: true }); + var node = lookup.node; + node.node_ops.setattr(node, { + timestamp: Math.max(atime, mtime) + }); + },open:function (path, flags, mode, fd_start, fd_end) { + if (path === "") { + throw new FS.ErrnoError(ERRNO_CODES.ENOENT); + } + flags = typeof flags === 'string' ? FS.modeStringToFlags(flags) : flags; + mode = typeof mode === 'undefined' ? 438 /* 0666 */ : mode; + if ((flags & 64)) { + mode = (mode & 4095) | 32768; + } else { + mode = 0; + } + var node; + if (typeof path === 'object') { + node = path; + } else { + path = PATH.normalize(path); + try { + var lookup = FS.lookupPath(path, { + follow: !(flags & 131072) + }); + node = lookup.node; + } catch (e) { + // ignore + } + } + // perhaps we need to create the node + var created = false; + if ((flags & 64)) { + if (node) { + // if O_CREAT and O_EXCL are set, error out if the node already exists + if ((flags & 128)) { + throw new FS.ErrnoError(ERRNO_CODES.EEXIST); + } + } else { + // node doesn't exist, try to create it + node = FS.mknod(path, mode, 0); + created = true; + } + } + if (!node) { + throw new FS.ErrnoError(ERRNO_CODES.ENOENT); + } + // can't truncate a device + if (FS.isChrdev(node.mode)) { + flags &= ~512; + } + // if asked only for a directory, then this must be one + if ((flags & 65536) && !FS.isDir(node.mode)) { + throw new FS.ErrnoError(ERRNO_CODES.ENOTDIR); + } + // check permissions, if this is not a file we just created now (it is ok to + // create and write to a file with read-only permissions; it is read-only + // for later use) + if (!created) { + var err = FS.mayOpen(node, flags); + if (err) { + throw new FS.ErrnoError(err); + } + } + // do truncation if necessary + if ((flags & 512)) { + FS.truncate(node, 0); + } + // we've already handled these, don't pass down to the underlying vfs + flags &= ~(128 | 512); + + // register the stream with the filesystem + var stream = FS.createStream({ + node: node, + path: FS.getPath(node), // we want the absolute path to the node + flags: flags, + seekable: true, + position: 0, + stream_ops: node.stream_ops, + // used by the file family libc calls (fopen, fwrite, ferror, etc.) + ungotten: [], + error: false + }, fd_start, fd_end); + // call the new stream's open function + if (stream.stream_ops.open) { + stream.stream_ops.open(stream); + } + if (Module['logReadFiles'] && !(flags & 1)) { + if (!FS.readFiles) FS.readFiles = {}; + if (!(path in FS.readFiles)) { + FS.readFiles[path] = 1; + Module['printErr']('read file: ' + path); + } + } + try { + if (FS.trackingDelegate['onOpenFile']) { + var trackingFlags = 0; + if ((flags & 2097155) !== 1) { + trackingFlags |= FS.tracking.openFlags.READ; + } + if ((flags & 2097155) !== 0) { + trackingFlags |= FS.tracking.openFlags.WRITE; + } + FS.trackingDelegate['onOpenFile'](path, trackingFlags); + } + } catch(e) { + console.log("FS.trackingDelegate['onOpenFile']('"+path+"', flags) threw an exception: " + e.message); + } + return stream; + },close:function (stream) { + if (stream.getdents) stream.getdents = null; // free readdir state + try { + if (stream.stream_ops.close) { + stream.stream_ops.close(stream); + } + } catch (e) { + throw e; + } finally { + FS.closeStream(stream.fd); + } + },llseek:function (stream, offset, whence) { + if (!stream.seekable || !stream.stream_ops.llseek) { + throw new FS.ErrnoError(ERRNO_CODES.ESPIPE); + } + stream.position = stream.stream_ops.llseek(stream, offset, whence); + stream.ungotten = []; + return stream.position; + },read:function (stream, buffer, offset, length, position) { + if (length < 0 || position < 0) { + throw new FS.ErrnoError(ERRNO_CODES.EINVAL); + } + if ((stream.flags & 2097155) === 1) { + throw new FS.ErrnoError(ERRNO_CODES.EBADF); + } + if (FS.isDir(stream.node.mode)) { + throw new FS.ErrnoError(ERRNO_CODES.EISDIR); + } + if (!stream.stream_ops.read) { + throw new FS.ErrnoError(ERRNO_CODES.EINVAL); + } + var seeking = true; + if (typeof position === 'undefined') { + position = stream.position; + seeking = false; + } else if (!stream.seekable) { + throw new FS.ErrnoError(ERRNO_CODES.ESPIPE); + } + var bytesRead = stream.stream_ops.read(stream, buffer, offset, length, position); + if (!seeking) stream.position += bytesRead; + return bytesRead; + },write:function (stream, buffer, offset, length, position, canOwn) { + if (length < 0 || position < 0) { + throw new FS.ErrnoError(ERRNO_CODES.EINVAL); + } + if ((stream.flags & 2097155) === 0) { + throw new FS.ErrnoError(ERRNO_CODES.EBADF); + } + if (FS.isDir(stream.node.mode)) { + throw new FS.ErrnoError(ERRNO_CODES.EISDIR); + } + if (!stream.stream_ops.write) { + throw new FS.ErrnoError(ERRNO_CODES.EINVAL); + } + if (stream.flags & 1024) { + // seek to the end before writing in append mode + FS.llseek(stream, 0, 2); + } + var seeking = true; + if (typeof position === 'undefined') { + position = stream.position; + seeking = false; + } else if (!stream.seekable) { + throw new FS.ErrnoError(ERRNO_CODES.ESPIPE); + } + var bytesWritten = stream.stream_ops.write(stream, buffer, offset, length, position, canOwn); + if (!seeking) stream.position += bytesWritten; + try { + if (stream.path && FS.trackingDelegate['onWriteToFile']) FS.trackingDelegate['onWriteToFile'](stream.path); + } catch(e) { + console.log("FS.trackingDelegate['onWriteToFile']('"+path+"') threw an exception: " + e.message); + } + return bytesWritten; + },allocate:function (stream, offset, length) { + if (offset < 0 || length <= 0) { + throw new FS.ErrnoError(ERRNO_CODES.EINVAL); + } + if ((stream.flags & 2097155) === 0) { + throw new FS.ErrnoError(ERRNO_CODES.EBADF); + } + if (!FS.isFile(stream.node.mode) && !FS.isDir(stream.node.mode)) { + throw new FS.ErrnoError(ERRNO_CODES.ENODEV); + } + if (!stream.stream_ops.allocate) { + throw new FS.ErrnoError(ERRNO_CODES.EOPNOTSUPP); + } + stream.stream_ops.allocate(stream, offset, length); + },mmap:function (stream, buffer, offset, length, position, prot, flags) { + // TODO if PROT is PROT_WRITE, make sure we have write access + if ((stream.flags & 2097155) === 1) { + throw new FS.ErrnoError(ERRNO_CODES.EACCES); + } + if (!stream.stream_ops.mmap) { + throw new FS.ErrnoError(ERRNO_CODES.ENODEV); + } + return stream.stream_ops.mmap(stream, buffer, offset, length, position, prot, flags); + },msync:function (stream, buffer, offset, length, mmapFlags) { + if (!stream || !stream.stream_ops.msync) { + return 0; + } + return stream.stream_ops.msync(stream, buffer, offset, length, mmapFlags); + },munmap:function (stream) { + return 0; + },ioctl:function (stream, cmd, arg) { + if (!stream.stream_ops.ioctl) { + throw new FS.ErrnoError(ERRNO_CODES.ENOTTY); + } + return stream.stream_ops.ioctl(stream, cmd, arg); + },readFile:function (path, opts) { + opts = opts || {}; + opts.flags = opts.flags || 'r'; + opts.encoding = opts.encoding || 'binary'; + if (opts.encoding !== 'utf8' && opts.encoding !== 'binary') { + throw new Error('Invalid encoding type "' + opts.encoding + '"'); + } + var ret; + var stream = FS.open(path, opts.flags); + var stat = FS.stat(path); + var length = stat.size; + var buf = new Uint8Array(length); + FS.read(stream, buf, 0, length, 0); + if (opts.encoding === 'utf8') { + ret = UTF8ArrayToString(buf, 0); + } else if (opts.encoding === 'binary') { + ret = buf; + } + FS.close(stream); + return ret; + },writeFile:function (path, data, opts) { + opts = opts || {}; + opts.flags = opts.flags || 'w'; + opts.encoding = opts.encoding || 'utf8'; + if (opts.encoding !== 'utf8' && opts.encoding !== 'binary') { + throw new Error('Invalid encoding type "' + opts.encoding + '"'); + } + var stream = FS.open(path, opts.flags, opts.mode); + if (opts.encoding === 'utf8') { + var buf = new Uint8Array(lengthBytesUTF8(data)+1); + var actualNumBytes = stringToUTF8Array(data, buf, 0, buf.length); + FS.write(stream, buf, 0, actualNumBytes, 0, opts.canOwn); + } else if (opts.encoding === 'binary') { + FS.write(stream, data, 0, data.length, 0, opts.canOwn); + } + FS.close(stream); + },cwd:function () { + return FS.currentPath; + },chdir:function (path) { + var lookup = FS.lookupPath(path, { follow: true }); + if (lookup.node === null) { + throw new FS.ErrnoError(ERRNO_CODES.ENOENT); + } + if (!FS.isDir(lookup.node.mode)) { + throw new FS.ErrnoError(ERRNO_CODES.ENOTDIR); + } + var err = FS.nodePermissions(lookup.node, 'x'); + if (err) { + throw new FS.ErrnoError(err); + } + FS.currentPath = lookup.path; + },createDefaultDirectories:function () { + FS.mkdir('/tmp'); + FS.mkdir('/home'); + FS.mkdir('/home/web_user'); + },createDefaultDevices:function () { + // create /dev + FS.mkdir('/dev'); + // setup /dev/null + FS.registerDevice(FS.makedev(1, 3), { + read: function() { return 0; }, + write: function(stream, buffer, offset, length, pos) { return length; } + }); + FS.mkdev('/dev/null', FS.makedev(1, 3)); + // setup /dev/tty and /dev/tty1 + // stderr needs to print output using Module['printErr'] + // so we register a second tty just for it. + TTY.register(FS.makedev(5, 0), TTY.default_tty_ops); + TTY.register(FS.makedev(6, 0), TTY.default_tty1_ops); + FS.mkdev('/dev/tty', FS.makedev(5, 0)); + FS.mkdev('/dev/tty1', FS.makedev(6, 0)); + // setup /dev/[u]random + var random_device; + if (typeof crypto !== 'undefined') { + // for modern web browsers + var randomBuffer = new Uint8Array(1); + random_device = function() { crypto.getRandomValues(randomBuffer); return randomBuffer[0]; }; + } else if (ENVIRONMENT_IS_NODE) { + // for nodejs + random_device = function() { return require('crypto').randomBytes(1)[0]; }; + } else { + // default for ES5 platforms + random_device = function() { return (Math.random()*256)|0; }; + } + FS.createDevice('/dev', 'random', random_device); + FS.createDevice('/dev', 'urandom', random_device); + // we're not going to emulate the actual shm device, + // just create the tmp dirs that reside in it commonly + FS.mkdir('/dev/shm'); + FS.mkdir('/dev/shm/tmp'); + },createSpecialDirectories:function () { + // create /proc/self/fd which allows /proc/self/fd/6 => readlink gives the name of the stream for fd 6 (see test_unistd_ttyname) + FS.mkdir('/proc'); + FS.mkdir('/proc/self'); + FS.mkdir('/proc/self/fd'); + FS.mount({ + mount: function() { + var node = FS.createNode('/proc/self', 'fd', 16384 | 511 /* 0777 */, 73); + node.node_ops = { + lookup: function(parent, name) { + var fd = +name; + var stream = FS.getStream(fd); + if (!stream) throw new FS.ErrnoError(ERRNO_CODES.EBADF); + var ret = { + parent: null, + mount: { mountpoint: 'fake' }, + node_ops: { readlink: function() { return stream.path } } + }; + ret.parent = ret; // make it look like a simple root node + return ret; + } + }; + return node; + } + }, {}, '/proc/self/fd'); + },createStandardStreams:function () { + // TODO deprecate the old functionality of a single + // input / output callback and that utilizes FS.createDevice + // and instead require a unique set of stream ops + + // by default, we symlink the standard streams to the + // default tty devices. however, if the standard streams + // have been overwritten we create a unique device for + // them instead. + if (Module['stdin']) { + FS.createDevice('/dev', 'stdin', Module['stdin']); + } else { + FS.symlink('/dev/tty', '/dev/stdin'); + } + if (Module['stdout']) { + FS.createDevice('/dev', 'stdout', null, Module['stdout']); + } else { + FS.symlink('/dev/tty', '/dev/stdout'); + } + if (Module['stderr']) { + FS.createDevice('/dev', 'stderr', null, Module['stderr']); + } else { + FS.symlink('/dev/tty1', '/dev/stderr'); + } + + // open default streams for the stdin, stdout and stderr devices + var stdin = FS.open('/dev/stdin', 'r'); + assert(stdin.fd === 0, 'invalid handle for stdin (' + stdin.fd + ')'); + + var stdout = FS.open('/dev/stdout', 'w'); + assert(stdout.fd === 1, 'invalid handle for stdout (' + stdout.fd + ')'); + + var stderr = FS.open('/dev/stderr', 'w'); + assert(stderr.fd === 2, 'invalid handle for stderr (' + stderr.fd + ')'); + },ensureErrnoError:function () { + if (FS.ErrnoError) return; + FS.ErrnoError = function ErrnoError(errno, node) { + //Module.printErr(stackTrace()); // useful for debugging + this.node = node; + this.setErrno = function(errno) { + this.errno = errno; + for (var key in ERRNO_CODES) { + if (ERRNO_CODES[key] === errno) { + this.code = key; + break; + } + } + }; + this.setErrno(errno); + this.message = ERRNO_MESSAGES[errno]; + if (this.stack) this.stack = demangleAll(this.stack); + }; + FS.ErrnoError.prototype = new Error(); + FS.ErrnoError.prototype.constructor = FS.ErrnoError; + // Some errors may happen quite a bit, to avoid overhead we reuse them (and suffer a lack of stack info) + [ERRNO_CODES.ENOENT].forEach(function(code) { + FS.genericErrors[code] = new FS.ErrnoError(code); + FS.genericErrors[code].stack = ''; + }); + },staticInit:function () { + FS.ensureErrnoError(); + + FS.nameTable = new Array(4096); + + FS.mount(MEMFS, {}, '/'); + + FS.createDefaultDirectories(); + FS.createDefaultDevices(); + FS.createSpecialDirectories(); + + FS.filesystems = { + 'MEMFS': MEMFS, + 'IDBFS': IDBFS, + 'NODEFS': NODEFS, + 'WORKERFS': WORKERFS, + }; + },init:function (input, output, error) { + assert(!FS.init.initialized, 'FS.init was previously called. If you want to initialize later with custom parameters, remove any earlier calls (note that one is automatically added to the generated code)'); + FS.init.initialized = true; + + FS.ensureErrnoError(); + + // Allow Module.stdin etc. to provide defaults, if none explicitly passed to us here + Module['stdin'] = input || Module['stdin']; + Module['stdout'] = output || Module['stdout']; + Module['stderr'] = error || Module['stderr']; + + FS.createStandardStreams(); + },quit:function () { + FS.init.initialized = false; + // force-flush all streams, so we get musl std streams printed out + var fflush = Module['_fflush']; + if (fflush) fflush(0); + // close all of our streams + for (var i = 0; i < FS.streams.length; i++) { + var stream = FS.streams[i]; + if (!stream) { + continue; + } + FS.close(stream); + } + },getMode:function (canRead, canWrite) { + var mode = 0; + if (canRead) mode |= 292 | 73; + if (canWrite) mode |= 146; + return mode; + },joinPath:function (parts, forceRelative) { + var path = PATH.join.apply(null, parts); + if (forceRelative && path[0] == '/') path = path.substr(1); + return path; + },absolutePath:function (relative, base) { + return PATH.resolve(base, relative); + },standardizePath:function (path) { + return PATH.normalize(path); + },findObject:function (path, dontResolveLastLink) { + var ret = FS.analyzePath(path, dontResolveLastLink); + if (ret.exists) { + return ret.object; + } else { + ___setErrNo(ret.error); + return null; + } + },analyzePath:function (path, dontResolveLastLink) { + // operate from within the context of the symlink's target + try { + var lookup = FS.lookupPath(path, { follow: !dontResolveLastLink }); + path = lookup.path; + } catch (e) { + } + var ret = { + isRoot: false, exists: false, error: 0, name: null, path: null, object: null, + parentExists: false, parentPath: null, parentObject: null + }; + try { + var lookup = FS.lookupPath(path, { parent: true }); + ret.parentExists = true; + ret.parentPath = lookup.path; + ret.parentObject = lookup.node; + ret.name = PATH.basename(path); + lookup = FS.lookupPath(path, { follow: !dontResolveLastLink }); + ret.exists = true; + ret.path = lookup.path; + ret.object = lookup.node; + ret.name = lookup.node.name; + ret.isRoot = lookup.path === '/'; + } catch (e) { + ret.error = e.errno; + }; + return ret; + },createFolder:function (parent, name, canRead, canWrite) { + var path = PATH.join2(typeof parent === 'string' ? parent : FS.getPath(parent), name); + var mode = FS.getMode(canRead, canWrite); + return FS.mkdir(path, mode); + },createPath:function (parent, path, canRead, canWrite) { + parent = typeof parent === 'string' ? parent : FS.getPath(parent); + var parts = path.split('/').reverse(); + while (parts.length) { + var part = parts.pop(); + if (!part) continue; + var current = PATH.join2(parent, part); + try { + FS.mkdir(current); + } catch (e) { + // ignore EEXIST + } + parent = current; + } + return current; + },createFile:function (parent, name, properties, canRead, canWrite) { + var path = PATH.join2(typeof parent === 'string' ? parent : FS.getPath(parent), name); + var mode = FS.getMode(canRead, canWrite); + return FS.create(path, mode); + },createDataFile:function (parent, name, data, canRead, canWrite, canOwn) { + var path = name ? PATH.join2(typeof parent === 'string' ? parent : FS.getPath(parent), name) : parent; + var mode = FS.getMode(canRead, canWrite); + var node = FS.create(path, mode); + if (data) { + if (typeof data === 'string') { + var arr = new Array(data.length); + for (var i = 0, len = data.length; i < len; ++i) arr[i] = data.charCodeAt(i); + data = arr; + } + // make sure we can write to the file + FS.chmod(node, mode | 146); + var stream = FS.open(node, 'w'); + FS.write(stream, data, 0, data.length, 0, canOwn); + FS.close(stream); + FS.chmod(node, mode); + } + return node; + },createDevice:function (parent, name, input, output) { + var path = PATH.join2(typeof parent === 'string' ? parent : FS.getPath(parent), name); + var mode = FS.getMode(!!input, !!output); + if (!FS.createDevice.major) FS.createDevice.major = 64; + var dev = FS.makedev(FS.createDevice.major++, 0); + // Create a fake device that a set of stream ops to emulate + // the old behavior. + FS.registerDevice(dev, { + open: function(stream) { + stream.seekable = false; + }, + close: function(stream) { + // flush any pending line data + if (output && output.buffer && output.buffer.length) { + output(10); + } + }, + read: function(stream, buffer, offset, length, pos /* ignored */) { + var bytesRead = 0; + for (var i = 0; i < length; i++) { + var result; + try { + result = input(); + } catch (e) { + throw new FS.ErrnoError(ERRNO_CODES.EIO); + } + if (result === undefined && bytesRead === 0) { + throw new FS.ErrnoError(ERRNO_CODES.EAGAIN); + } + if (result === null || result === undefined) break; + bytesRead++; + buffer[offset+i] = result; + } + if (bytesRead) { + stream.node.timestamp = Date.now(); + } + return bytesRead; + }, + write: function(stream, buffer, offset, length, pos) { + for (var i = 0; i < length; i++) { + try { + output(buffer[offset+i]); + } catch (e) { + throw new FS.ErrnoError(ERRNO_CODES.EIO); + } + } + if (length) { + stream.node.timestamp = Date.now(); + } + return i; + } + }); + return FS.mkdev(path, mode, dev); + },createLink:function (parent, name, target, canRead, canWrite) { + var path = PATH.join2(typeof parent === 'string' ? parent : FS.getPath(parent), name); + return FS.symlink(target, path); + },forceLoadFile:function (obj) { + if (obj.isDevice || obj.isFolder || obj.link || obj.contents) return true; + var success = true; + if (typeof XMLHttpRequest !== 'undefined') { + throw new Error("Lazy loading should have been performed (contents set) in createLazyFile, but it was not. Lazy loading only works in web workers. Use --embed-file or --preload-file in emcc on the main thread."); + } else if (Module['read']) { + // Command-line. + try { + // WARNING: Can't read binary files in V8's d8 or tracemonkey's js, as + // read() will try to parse UTF8. + obj.contents = intArrayFromString(Module['read'](obj.url), true); + obj.usedBytes = obj.contents.length; + } catch (e) { + success = false; + } + } else { + throw new Error('Cannot load without read() or XMLHttpRequest.'); + } + if (!success) ___setErrNo(ERRNO_CODES.EIO); + return success; + },createLazyFile:function (parent, name, url, canRead, canWrite) { + // Lazy chunked Uint8Array (implements get and length from Uint8Array). Actual getting is abstracted away for eventual reuse. + function LazyUint8Array() { + this.lengthKnown = false; + this.chunks = []; // Loaded chunks. Index is the chunk number + } + LazyUint8Array.prototype.get = function LazyUint8Array_get(idx) { + if (idx > this.length-1 || idx < 0) { + return undefined; + } + var chunkOffset = idx % this.chunkSize; + var chunkNum = (idx / this.chunkSize)|0; + return this.getter(chunkNum)[chunkOffset]; + } + LazyUint8Array.prototype.setDataGetter = function LazyUint8Array_setDataGetter(getter) { + this.getter = getter; + } + LazyUint8Array.prototype.cacheLength = function LazyUint8Array_cacheLength() { + // Find length + var xhr = new XMLHttpRequest(); + xhr.open('HEAD', url, false); + xhr.send(null); + if (!(xhr.status >= 200 && xhr.status < 300 || xhr.status === 304)) throw new Error("Couldn't load " + url + ". Status: " + xhr.status); + var datalength = Number(xhr.getResponseHeader("Content-length")); + var header; + var hasByteServing = (header = xhr.getResponseHeader("Accept-Ranges")) && header === "bytes"; + var usesGzip = (header = xhr.getResponseHeader("Content-Encoding")) && header === "gzip"; + + var chunkSize = 1024*1024; // Chunk size in bytes + + if (!hasByteServing) chunkSize = datalength; + + // Function to get a range from the remote URL. + var doXHR = (function(from, to) { + if (from > to) throw new Error("invalid range (" + from + ", " + to + ") or no bytes requested!"); + if (to > datalength-1) throw new Error("only " + datalength + " bytes available! programmer error!"); + + // TODO: Use mozResponseArrayBuffer, responseStream, etc. if available. + var xhr = new XMLHttpRequest(); + xhr.open('GET', url, false); + if (datalength !== chunkSize) xhr.setRequestHeader("Range", "bytes=" + from + "-" + to); + + // Some hints to the browser that we want binary data. + if (typeof Uint8Array != 'undefined') xhr.responseType = 'arraybuffer'; + if (xhr.overrideMimeType) { + xhr.overrideMimeType('text/plain; charset=x-user-defined'); + } + + xhr.send(null); + if (!(xhr.status >= 200 && xhr.status < 300 || xhr.status === 304)) throw new Error("Couldn't load " + url + ". Status: " + xhr.status); + if (xhr.response !== undefined) { + return new Uint8Array(xhr.response || []); + } else { + return intArrayFromString(xhr.responseText || '', true); + } + }); + var lazyArray = this; + lazyArray.setDataGetter(function(chunkNum) { + var start = chunkNum * chunkSize; + var end = (chunkNum+1) * chunkSize - 1; // including this byte + end = Math.min(end, datalength-1); // if datalength-1 is selected, this is the last block + if (typeof(lazyArray.chunks[chunkNum]) === "undefined") { + lazyArray.chunks[chunkNum] = doXHR(start, end); + } + if (typeof(lazyArray.chunks[chunkNum]) === "undefined") throw new Error("doXHR failed!"); + return lazyArray.chunks[chunkNum]; + }); + + if (usesGzip || !datalength) { + // if the server uses gzip or doesn't supply the length, we have to download the whole file to get the (uncompressed) length + chunkSize = datalength = 1; // this will force getter(0)/doXHR do download the whole file + datalength = this.getter(0).length; + chunkSize = datalength; + console.log("LazyFiles on gzip forces download of the whole file when length is accessed"); + } + + this._length = datalength; + this._chunkSize = chunkSize; + this.lengthKnown = true; + } + if (typeof XMLHttpRequest !== 'undefined') { + if (!ENVIRONMENT_IS_WORKER) throw 'Cannot do synchronous binary XHRs outside webworkers in modern browsers. Use --embed-file or --preload-file in emcc'; + var lazyArray = new LazyUint8Array(); + Object.defineProperties(lazyArray, { + length: { + get: function() { + if(!this.lengthKnown) { + this.cacheLength(); + } + return this._length; + } + }, + chunkSize: { + get: function() { + if(!this.lengthKnown) { + this.cacheLength(); + } + return this._chunkSize; + } + } + }); + + var properties = { isDevice: false, contents: lazyArray }; + } else { + var properties = { isDevice: false, url: url }; + } + + var node = FS.createFile(parent, name, properties, canRead, canWrite); + // This is a total hack, but I want to get this lazy file code out of the + // core of MEMFS. If we want to keep this lazy file concept I feel it should + // be its own thin LAZYFS proxying calls to MEMFS. + if (properties.contents) { + node.contents = properties.contents; + } else if (properties.url) { + node.contents = null; + node.url = properties.url; + } + // Add a function that defers querying the file size until it is asked the first time. + Object.defineProperties(node, { + usedBytes: { + get: function() { return this.contents.length; } + } + }); + // override each stream op with one that tries to force load the lazy file first + var stream_ops = {}; + var keys = Object.keys(node.stream_ops); + keys.forEach(function(key) { + var fn = node.stream_ops[key]; + stream_ops[key] = function forceLoadLazyFile() { + if (!FS.forceLoadFile(node)) { + throw new FS.ErrnoError(ERRNO_CODES.EIO); + } + return fn.apply(null, arguments); + }; + }); + // use a custom read function + stream_ops.read = function stream_ops_read(stream, buffer, offset, length, position) { + if (!FS.forceLoadFile(node)) { + throw new FS.ErrnoError(ERRNO_CODES.EIO); + } + var contents = stream.node.contents; + if (position >= contents.length) + return 0; + var size = Math.min(contents.length - position, length); + assert(size >= 0); + if (contents.slice) { // normal array + for (var i = 0; i < size; i++) { + buffer[offset + i] = contents[position + i]; + } + } else { + for (var i = 0; i < size; i++) { // LazyUint8Array from sync binary XHR + buffer[offset + i] = contents.get(position + i); + } + } + return size; + }; + node.stream_ops = stream_ops; + return node; + },createPreloadedFile:function (parent, name, url, canRead, canWrite, onload, onerror, dontCreateFile, canOwn, preFinish) { + Browser.init(); // XXX perhaps this method should move onto Browser? + // TODO we should allow people to just pass in a complete filename instead + // of parent and name being that we just join them anyways + var fullname = name ? PATH.resolve(PATH.join2(parent, name)) : parent; + var dep = getUniqueRunDependency('cp ' + fullname); // might have several active requests for the same fullname + function processData(byteArray) { + function finish(byteArray) { + if (preFinish) preFinish(); + if (!dontCreateFile) { + FS.createDataFile(parent, name, byteArray, canRead, canWrite, canOwn); + } + if (onload) onload(); + removeRunDependency(dep); + } + var handled = false; + Module['preloadPlugins'].forEach(function(plugin) { + if (handled) return; + if (plugin['canHandle'](fullname)) { + plugin['handle'](byteArray, fullname, finish, function() { + if (onerror) onerror(); + removeRunDependency(dep); + }); + handled = true; + } + }); + if (!handled) finish(byteArray); + } + addRunDependency(dep); + if (typeof url == 'string') { + Browser.asyncLoad(url, function(byteArray) { + processData(byteArray); + }, onerror); + } else { + processData(url); + } + },indexedDB:function () { + return window.indexedDB || window.mozIndexedDB || window.webkitIndexedDB || window.msIndexedDB; + },DB_NAME:function () { + return 'EM_FS_' + window.location.pathname; + },DB_VERSION:20,DB_STORE_NAME:"FILE_DATA",saveFilesToDB:function (paths, onload, onerror) { + onload = onload || function(){}; + onerror = onerror || function(){}; + var indexedDB = FS.indexedDB(); + try { + var openRequest = indexedDB.open(FS.DB_NAME(), FS.DB_VERSION); + } catch (e) { + return onerror(e); + } + openRequest.onupgradeneeded = function openRequest_onupgradeneeded() { + console.log('creating db'); + var db = openRequest.result; + db.createObjectStore(FS.DB_STORE_NAME); + }; + openRequest.onsuccess = function openRequest_onsuccess() { + var db = openRequest.result; + var transaction = db.transaction([FS.DB_STORE_NAME], 'readwrite'); + var files = transaction.objectStore(FS.DB_STORE_NAME); + var ok = 0, fail = 0, total = paths.length; + function finish() { + if (fail == 0) onload(); else onerror(); + } + paths.forEach(function(path) { + var putRequest = files.put(FS.analyzePath(path).object.contents, path); + putRequest.onsuccess = function putRequest_onsuccess() { ok++; if (ok + fail == total) finish() }; + putRequest.onerror = function putRequest_onerror() { fail++; if (ok + fail == total) finish() }; + }); + transaction.onerror = onerror; + }; + openRequest.onerror = onerror; + },loadFilesFromDB:function (paths, onload, onerror) { + onload = onload || function(){}; + onerror = onerror || function(){}; + var indexedDB = FS.indexedDB(); + try { + var openRequest = indexedDB.open(FS.DB_NAME(), FS.DB_VERSION); + } catch (e) { + return onerror(e); + } + openRequest.onupgradeneeded = onerror; // no database to load from + openRequest.onsuccess = function openRequest_onsuccess() { + var db = openRequest.result; + try { + var transaction = db.transaction([FS.DB_STORE_NAME], 'readonly'); + } catch(e) { + onerror(e); + return; + } + var files = transaction.objectStore(FS.DB_STORE_NAME); + var ok = 0, fail = 0, total = paths.length; + function finish() { + if (fail == 0) onload(); else onerror(); + } + paths.forEach(function(path) { + var getRequest = files.get(path); + getRequest.onsuccess = function getRequest_onsuccess() { + if (FS.analyzePath(path).exists) { + FS.unlink(path); + } + FS.createDataFile(PATH.dirname(path), PATH.basename(path), getRequest.result, true, true, true); + ok++; + if (ok + fail == total) finish(); + }; + getRequest.onerror = function getRequest_onerror() { fail++; if (ok + fail == total) finish() }; + }); + transaction.onerror = onerror; + }; + openRequest.onerror = onerror; + }};var SYSCALLS={DEFAULT_POLLMASK:5,mappings:{},umask:511,calculateAt:function (dirfd, path) { + if (path[0] !== '/') { + // relative path + var dir; + if (dirfd === -100) { + dir = FS.cwd(); + } else { + var dirstream = FS.getStream(dirfd); + if (!dirstream) throw new FS.ErrnoError(ERRNO_CODES.EBADF); + dir = dirstream.path; + } + path = PATH.join2(dir, path); + } + return path; + },doStat:function (func, path, buf) { + try { + var stat = func(path); + } catch (e) { + if (e && e.node && PATH.normalize(path) !== PATH.normalize(FS.getPath(e.node))) { + // an error occurred while trying to look up the path; we should just report ENOTDIR + return -ERRNO_CODES.ENOTDIR; + } + throw e; + } + HEAP32[((buf)>>2)]=stat.dev; + HEAP32[(((buf)+(4))>>2)]=0; + HEAP32[(((buf)+(8))>>2)]=stat.ino; + HEAP32[(((buf)+(12))>>2)]=stat.mode; + HEAP32[(((buf)+(16))>>2)]=stat.nlink; + HEAP32[(((buf)+(20))>>2)]=stat.uid; + HEAP32[(((buf)+(24))>>2)]=stat.gid; + HEAP32[(((buf)+(28))>>2)]=stat.rdev; + HEAP32[(((buf)+(32))>>2)]=0; + HEAP32[(((buf)+(36))>>2)]=stat.size; + HEAP32[(((buf)+(40))>>2)]=4096; + HEAP32[(((buf)+(44))>>2)]=stat.blocks; + HEAP32[(((buf)+(48))>>2)]=(stat.atime.getTime() / 1000)|0; + HEAP32[(((buf)+(52))>>2)]=0; + HEAP32[(((buf)+(56))>>2)]=(stat.mtime.getTime() / 1000)|0; + HEAP32[(((buf)+(60))>>2)]=0; + HEAP32[(((buf)+(64))>>2)]=(stat.ctime.getTime() / 1000)|0; + HEAP32[(((buf)+(68))>>2)]=0; + HEAP32[(((buf)+(72))>>2)]=stat.ino; + return 0; + },doMsync:function (addr, stream, len, flags) { + var buffer = new Uint8Array(HEAPU8.subarray(addr, addr + len)); + FS.msync(stream, buffer, 0, len, flags); + },doMkdir:function (path, mode) { + // remove a trailing slash, if one - /a/b/ has basename of '', but + // we want to create b in the context of this function + path = PATH.normalize(path); + if (path[path.length-1] === '/') path = path.substr(0, path.length-1); + FS.mkdir(path, mode, 0); + return 0; + },doMknod:function (path, mode, dev) { + // we don't want this in the JS API as it uses mknod to create all nodes. + switch (mode & 61440) { + case 32768: + case 8192: + case 24576: + case 4096: + case 49152: + break; + default: return -ERRNO_CODES.EINVAL; + } + FS.mknod(path, mode, dev); + return 0; + },doReadlink:function (path, buf, bufsize) { + if (bufsize <= 0) return -ERRNO_CODES.EINVAL; + var ret = FS.readlink(path); + + var len = Math.min(bufsize, lengthBytesUTF8(ret)); + var endChar = HEAP8[buf+len]; + stringToUTF8(ret, buf, bufsize+1); + // readlink is one of the rare functions that write out a C string, but does never append a null to the output buffer(!) + // stringToUTF8() always appends a null byte, so restore the character under the null byte after the write. + HEAP8[buf+len] = endChar; + + return len; + },doAccess:function (path, amode) { + if (amode & ~7) { + // need a valid mode + return -ERRNO_CODES.EINVAL; + } + var node; + var lookup = FS.lookupPath(path, { follow: true }); + node = lookup.node; + var perms = ''; + if (amode & 4) perms += 'r'; + if (amode & 2) perms += 'w'; + if (amode & 1) perms += 'x'; + if (perms /* otherwise, they've just passed F_OK */ && FS.nodePermissions(node, perms)) { + return -ERRNO_CODES.EACCES; + } + return 0; + },doDup:function (path, flags, suggestFD) { + var suggest = FS.getStream(suggestFD); + if (suggest) FS.close(suggest); + return FS.open(path, flags, 0, suggestFD, suggestFD).fd; + },doReadv:function (stream, iov, iovcnt, offset) { + var ret = 0; + for (var i = 0; i < iovcnt; i++) { + var ptr = HEAP32[(((iov)+(i*8))>>2)]; + var len = HEAP32[(((iov)+(i*8 + 4))>>2)]; + var curr = FS.read(stream, HEAP8,ptr, len, offset); + if (curr < 0) return -1; + ret += curr; + if (curr < len) break; // nothing more to read + } + return ret; + },doWritev:function (stream, iov, iovcnt, offset) { + var ret = 0; + for (var i = 0; i < iovcnt; i++) { + var ptr = HEAP32[(((iov)+(i*8))>>2)]; + var len = HEAP32[(((iov)+(i*8 + 4))>>2)]; + var curr = FS.write(stream, HEAP8,ptr, len, offset); + if (curr < 0) return -1; + ret += curr; + } + return ret; + },varargs:0,get:function (varargs) { + SYSCALLS.varargs += 4; + var ret = HEAP32[(((SYSCALLS.varargs)-(4))>>2)]; + return ret; + },getStr:function () { + var ret = Pointer_stringify(SYSCALLS.get()); + return ret; + },getStreamFromFD:function () { + var stream = FS.getStream(SYSCALLS.get()); + if (!stream) throw new FS.ErrnoError(ERRNO_CODES.EBADF); + return stream; + },getSocketFromFD:function () { + var socket = SOCKFS.getSocket(SYSCALLS.get()); + if (!socket) throw new FS.ErrnoError(ERRNO_CODES.EBADF); + return socket; + },getSocketAddress:function (allowNull) { + var addrp = SYSCALLS.get(), addrlen = SYSCALLS.get(); + if (allowNull && addrp === 0) return null; + var info = __read_sockaddr(addrp, addrlen); + if (info.errno) throw new FS.ErrnoError(info.errno); + info.addr = DNS.lookup_addr(info.addr) || info.addr; + return info; + },get64:function () { + var low = SYSCALLS.get(), high = SYSCALLS.get(); + if (low >= 0) assert(high === 0); + else assert(high === -1); + return low; + },getZero:function () { + assert(SYSCALLS.get() === 0); + }};function ___syscall54(which, varargs) {SYSCALLS.varargs = varargs; + try { + // ioctl + var stream = SYSCALLS.getStreamFromFD(), op = SYSCALLS.get(); + switch (op) { + case 21505: { + if (!stream.tty) return -ERRNO_CODES.ENOTTY; + return 0; + } + case 21506: { + if (!stream.tty) return -ERRNO_CODES.ENOTTY; + return 0; // no-op, not actually adjusting terminal settings + } + case 21519: { + if (!stream.tty) return -ERRNO_CODES.ENOTTY; + var argp = SYSCALLS.get(); + HEAP32[((argp)>>2)]=0; + return 0; + } + case 21520: { + if (!stream.tty) return -ERRNO_CODES.ENOTTY; + return -ERRNO_CODES.EINVAL; // not supported + } + case 21531: { + var argp = SYSCALLS.get(); + return FS.ioctl(stream, op, argp); + } + case 21523: { + // TODO: in theory we should write to the winsize struct that gets + // passed in, but for now musl doesn't read anything on it + if (!stream.tty) return -ERRNO_CODES.ENOTTY; + return 0; + } + default: abort('bad ioctl syscall ' + op); + } + } catch (e) { + if (typeof FS === 'undefined' || !(e instanceof FS.ErrnoError)) abort(e); + return -e.errno; + } + } + + function _emscripten_glSampleCoverage(value, invert) { + GLctx.sampleCoverage(value, !!invert); + } + + function _emscripten_glUniform4f(location, v0, v1, v2, v3) { + GLctx.uniform4f(GL.uniforms[location], v0, v1, v2, v3); + } + + function _emscripten_glFrustum() { + Module['printErr']('missing function: emscripten_glFrustum'); abort(-1); + } + + function _glVertexAttrib4f(x0, x1, x2, x3, x4) { GLctx['vertexAttrib4f'](x0, x1, x2, x3, x4) } + + function _glfwSetWindowSizeCallback(winid, cbfun) { + GLFW.setWindowSizeCallback(winid, cbfun); + } + + function _emscripten_glGetTexParameterfv(target, pname, params) { + if (!params) { + // GLES2 specification does not specify how to behave if params is a null pointer. Since calling this function does not make sense + // if p == null, issue a GL error to notify user about it. + GL.recordError(0x0501 /* GL_INVALID_VALUE */); + return; + } + HEAPF32[((params)>>2)]=GLctx.getTexParameter(target, pname); + } + + function _emscripten_glUniform4i(location, v0, v1, v2, v3) { + GLctx.uniform4i(GL.uniforms[location], v0, v1, v2, v3); + } + + function _emscripten_glBindRenderbuffer(target, renderbuffer) { + GLctx.bindRenderbuffer(target, renderbuffer ? GL.renderbuffers[renderbuffer] : null); + } + + function _emscripten_glViewport(x0, x1, x2, x3) { GLctx['viewport'](x0, x1, x2, x3) } + + + var DLFCN={error:null,errorMsg:null,loadedLibs:{},loadedLibNames:{}};function _dlclose(handle) { + // int dlclose(void *handle); + // http://pubs.opengroup.org/onlinepubs/009695399/functions/dlclose.html + if (!DLFCN.loadedLibs[handle]) { + DLFCN.errorMsg = 'Tried to dlclose() unopened handle: ' + handle; + return 1; + } else { + var lib_record = DLFCN.loadedLibs[handle]; + if (--lib_record.refcount == 0) { + if (lib_record.module.cleanups) { + lib_record.module.cleanups.forEach(function(cleanup) { cleanup() }); + } + delete DLFCN.loadedLibNames[lib_record.name]; + delete DLFCN.loadedLibs[handle]; + } + return 0; + } + } + + + + var JSEvents={keyEvent:0,mouseEvent:0,wheelEvent:0,uiEvent:0,focusEvent:0,deviceOrientationEvent:0,deviceMotionEvent:0,fullscreenChangeEvent:0,pointerlockChangeEvent:0,visibilityChangeEvent:0,touchEvent:0,lastGamepadState:null,lastGamepadStateFrame:null,numGamepadsConnected:0,previousFullscreenElement:null,previousScreenX:null,previousScreenY:null,removeEventListenersRegistered:false,staticInit:function () { + if (typeof window !== 'undefined') { + window.addEventListener("gamepadconnected", function() { ++JSEvents.numGamepadsConnected; }); + window.addEventListener("gamepaddisconnected", function() { --JSEvents.numGamepadsConnected; }); + + // Chromium does not fire the gamepadconnected event on reload, so we need to get the number of gamepads here as a workaround. + // See https://bugs.chromium.org/p/chromium/issues/detail?id=502824 + var firstState = navigator.getGamepads ? navigator.getGamepads() : (navigator.webkitGetGamepads ? navigator.webkitGetGamepads() : null); + if (firstState) { + JSEvents.numGamepadsConnected = firstState.length; + } + } + },registerRemoveEventListeners:function () { + if (!JSEvents.removeEventListenersRegistered) { + __ATEXIT__.push(function() { + for(var i = JSEvents.eventHandlers.length-1; i >= 0; --i) { + JSEvents._removeHandler(i); + } + }); + JSEvents.removeEventListenersRegistered = true; + } + },findEventTarget:function (target) { + if (target) { + if (typeof target == "number") { + target = Pointer_stringify(target); + } + if (target == '#window') return window; + else if (target == '#document') return document; + else if (target == '#screen') return window.screen; + else if (target == '#canvas') return Module['canvas']; + + if (typeof target == 'string') return document.getElementById(target); + else return target; + } else { + // The sensible target varies between events, but use window as the default + // since DOM events mostly can default to that. Specific callback registrations + // override their own defaults. + return window; + } + },deferredCalls:[],deferCall:function (targetFunction, precedence, argsList) { + function arraysHaveEqualContent(arrA, arrB) { + if (arrA.length != arrB.length) return false; + + for(var i in arrA) { + if (arrA[i] != arrB[i]) return false; + } + return true; + } + // Test if the given call was already queued, and if so, don't add it again. + for(var i in JSEvents.deferredCalls) { + var call = JSEvents.deferredCalls[i]; + if (call.targetFunction == targetFunction && arraysHaveEqualContent(call.argsList, argsList)) { + return; + } + } + JSEvents.deferredCalls.push({ + targetFunction: targetFunction, + precedence: precedence, + argsList: argsList + }); + + JSEvents.deferredCalls.sort(function(x,y) { return x.precedence < y.precedence; }); + },removeDeferredCalls:function (targetFunction) { + for(var i = 0; i < JSEvents.deferredCalls.length; ++i) { + if (JSEvents.deferredCalls[i].targetFunction == targetFunction) { + JSEvents.deferredCalls.splice(i, 1); + --i; + } + } + },canPerformEventHandlerRequests:function () { + return JSEvents.inEventHandler && JSEvents.currentEventHandler.allowsDeferredCalls; + },runDeferredCalls:function () { + if (!JSEvents.canPerformEventHandlerRequests()) { + return; + } + for(var i = 0; i < JSEvents.deferredCalls.length; ++i) { + var call = JSEvents.deferredCalls[i]; + JSEvents.deferredCalls.splice(i, 1); + --i; + call.targetFunction.apply(this, call.argsList); + } + },inEventHandler:0,currentEventHandler:null,eventHandlers:[],isInternetExplorer:function () { return navigator.userAgent.indexOf('MSIE') !== -1 || navigator.appVersion.indexOf('Trident/') > 0; },removeAllHandlersOnTarget:function (target, eventTypeString) { + for(var i = 0; i < JSEvents.eventHandlers.length; ++i) { + if (JSEvents.eventHandlers[i].target == target && + (!eventTypeString || eventTypeString == JSEvents.eventHandlers[i].eventTypeString)) { + JSEvents._removeHandler(i--); + } + } + },_removeHandler:function (i) { + var h = JSEvents.eventHandlers[i]; + h.target.removeEventListener(h.eventTypeString, h.eventListenerFunc, h.useCapture); + JSEvents.eventHandlers.splice(i, 1); + },registerOrRemoveHandler:function (eventHandler) { + var jsEventHandler = function jsEventHandler(event) { + // Increment nesting count for the event handler. + ++JSEvents.inEventHandler; + JSEvents.currentEventHandler = eventHandler; + // Process any old deferred calls the user has placed. + JSEvents.runDeferredCalls(); + // Process the actual event, calls back to user C code handler. + eventHandler.handlerFunc(event); + // Process any new deferred calls that were placed right now from this event handler. + JSEvents.runDeferredCalls(); + // Out of event handler - restore nesting count. + --JSEvents.inEventHandler; + } + + if (eventHandler.callbackfunc) { + eventHandler.eventListenerFunc = jsEventHandler; + eventHandler.target.addEventListener(eventHandler.eventTypeString, jsEventHandler, eventHandler.useCapture); + JSEvents.eventHandlers.push(eventHandler); + JSEvents.registerRemoveEventListeners(); + } else { + for(var i = 0; i < JSEvents.eventHandlers.length; ++i) { + if (JSEvents.eventHandlers[i].target == eventHandler.target + && JSEvents.eventHandlers[i].eventTypeString == eventHandler.eventTypeString) { + JSEvents._removeHandler(i--); + } + } + } + },registerKeyEventCallback:function (target, userData, useCapture, callbackfunc, eventTypeId, eventTypeString) { + if (!JSEvents.keyEvent) { + JSEvents.keyEvent = _malloc( 164 ); + } + var handlerFunc = function(event) { + var e = event || window.event; + stringToUTF8(e.key ? e.key : "", JSEvents.keyEvent + 0, 32); + stringToUTF8(e.code ? e.code : "", JSEvents.keyEvent + 32, 32); + HEAP32[(((JSEvents.keyEvent)+(64))>>2)]=e.location; + HEAP32[(((JSEvents.keyEvent)+(68))>>2)]=e.ctrlKey; + HEAP32[(((JSEvents.keyEvent)+(72))>>2)]=e.shiftKey; + HEAP32[(((JSEvents.keyEvent)+(76))>>2)]=e.altKey; + HEAP32[(((JSEvents.keyEvent)+(80))>>2)]=e.metaKey; + HEAP32[(((JSEvents.keyEvent)+(84))>>2)]=e.repeat; + stringToUTF8(e.locale ? e.locale : "", JSEvents.keyEvent + 88, 32); + stringToUTF8(e.char ? e.char : "", JSEvents.keyEvent + 120, 32); + HEAP32[(((JSEvents.keyEvent)+(152))>>2)]=e.charCode; + HEAP32[(((JSEvents.keyEvent)+(156))>>2)]=e.keyCode; + HEAP32[(((JSEvents.keyEvent)+(160))>>2)]=e.which; + var shouldCancel = Module['dynCall_iiii'](callbackfunc, eventTypeId, JSEvents.keyEvent, userData); + if (shouldCancel) { + e.preventDefault(); + } + }; + + var eventHandler = { + target: JSEvents.findEventTarget(target), + allowsDeferredCalls: JSEvents.isInternetExplorer() ? false : true, // MSIE doesn't allow fullscreen and pointerlock requests from key handlers, others do. + eventTypeString: eventTypeString, + callbackfunc: callbackfunc, + handlerFunc: handlerFunc, + useCapture: useCapture + }; + JSEvents.registerOrRemoveHandler(eventHandler); + },getBoundingClientRectOrZeros:function (target) { + return target.getBoundingClientRect ? target.getBoundingClientRect() : { left: 0, top: 0 }; + },fillMouseEventData:function (eventStruct, e, target) { + HEAPF64[((eventStruct)>>3)]=JSEvents.tick(); + HEAP32[(((eventStruct)+(8))>>2)]=e.screenX; + HEAP32[(((eventStruct)+(12))>>2)]=e.screenY; + HEAP32[(((eventStruct)+(16))>>2)]=e.clientX; + HEAP32[(((eventStruct)+(20))>>2)]=e.clientY; + HEAP32[(((eventStruct)+(24))>>2)]=e.ctrlKey; + HEAP32[(((eventStruct)+(28))>>2)]=e.shiftKey; + HEAP32[(((eventStruct)+(32))>>2)]=e.altKey; + HEAP32[(((eventStruct)+(36))>>2)]=e.metaKey; + HEAP16[(((eventStruct)+(40))>>1)]=e.button; + HEAP16[(((eventStruct)+(42))>>1)]=e.buttons; + HEAP32[(((eventStruct)+(44))>>2)]=e["movementX"] || e["mozMovementX"] || e["webkitMovementX"] || (e.screenX-JSEvents.previousScreenX); + HEAP32[(((eventStruct)+(48))>>2)]=e["movementY"] || e["mozMovementY"] || e["webkitMovementY"] || (e.screenY-JSEvents.previousScreenY); + + if (Module['canvas']) { + var rect = Module['canvas'].getBoundingClientRect(); + HEAP32[(((eventStruct)+(60))>>2)]=e.clientX - rect.left; + HEAP32[(((eventStruct)+(64))>>2)]=e.clientY - rect.top; + } else { // Canvas is not initialized, return 0. + HEAP32[(((eventStruct)+(60))>>2)]=0; + HEAP32[(((eventStruct)+(64))>>2)]=0; + } + if (target) { + var rect = JSEvents.getBoundingClientRectOrZeros(target); + HEAP32[(((eventStruct)+(52))>>2)]=e.clientX - rect.left; + HEAP32[(((eventStruct)+(56))>>2)]=e.clientY - rect.top; + } else { // No specific target passed, return 0. + HEAP32[(((eventStruct)+(52))>>2)]=0; + HEAP32[(((eventStruct)+(56))>>2)]=0; + } + // wheel and mousewheel events contain wrong screenX/screenY on chrome/opera + // https://github.com/kripken/emscripten/pull/4997 + // https://bugs.chromium.org/p/chromium/issues/detail?id=699956 + if (e.type !== 'wheel' && e.type !== 'mousewheel') { + JSEvents.previousScreenX = e.screenX; + JSEvents.previousScreenY = e.screenY; + } + },registerMouseEventCallback:function (target, userData, useCapture, callbackfunc, eventTypeId, eventTypeString) { + if (!JSEvents.mouseEvent) { + JSEvents.mouseEvent = _malloc( 72 ); + } + target = JSEvents.findEventTarget(target); + var handlerFunc = function(event) { + var e = event || window.event; + JSEvents.fillMouseEventData(JSEvents.mouseEvent, e, target); + var shouldCancel = Module['dynCall_iiii'](callbackfunc, eventTypeId, JSEvents.mouseEvent, userData); + if (shouldCancel) { + e.preventDefault(); + } + }; + + var eventHandler = { + target: target, + allowsDeferredCalls: eventTypeString != 'mousemove' && eventTypeString != 'mouseenter' && eventTypeString != 'mouseleave', // Mouse move events do not allow fullscreen/pointer lock requests to be handled in them! + eventTypeString: eventTypeString, + callbackfunc: callbackfunc, + handlerFunc: handlerFunc, + useCapture: useCapture + }; + // In IE, mousedown events don't either allow deferred calls to be run! + if (JSEvents.isInternetExplorer() && eventTypeString == 'mousedown') eventHandler.allowsDeferredCalls = false; + JSEvents.registerOrRemoveHandler(eventHandler); + },registerWheelEventCallback:function (target, userData, useCapture, callbackfunc, eventTypeId, eventTypeString) { + if (!JSEvents.wheelEvent) { + JSEvents.wheelEvent = _malloc( 104 ); + } + target = JSEvents.findEventTarget(target); + // The DOM Level 3 events spec event 'wheel' + var wheelHandlerFunc = function(event) { + var e = event || window.event; + JSEvents.fillMouseEventData(JSEvents.wheelEvent, e, target); + HEAPF64[(((JSEvents.wheelEvent)+(72))>>3)]=e["deltaX"]; + HEAPF64[(((JSEvents.wheelEvent)+(80))>>3)]=e["deltaY"]; + HEAPF64[(((JSEvents.wheelEvent)+(88))>>3)]=e["deltaZ"]; + HEAP32[(((JSEvents.wheelEvent)+(96))>>2)]=e["deltaMode"]; + var shouldCancel = Module['dynCall_iiii'](callbackfunc, eventTypeId, JSEvents.wheelEvent, userData); + if (shouldCancel) { + e.preventDefault(); + } + }; + // The 'mousewheel' event as implemented in Safari 6.0.5 + var mouseWheelHandlerFunc = function(event) { + var e = event || window.event; + JSEvents.fillMouseEventData(JSEvents.wheelEvent, e, target); + HEAPF64[(((JSEvents.wheelEvent)+(72))>>3)]=e["wheelDeltaX"] || 0; + HEAPF64[(((JSEvents.wheelEvent)+(80))>>3)]=-(e["wheelDeltaY"] ? e["wheelDeltaY"] : e["wheelDelta"]) /* 1. Invert to unify direction with the DOM Level 3 wheel event. 2. MSIE does not provide wheelDeltaY, so wheelDelta is used as a fallback. */; + HEAPF64[(((JSEvents.wheelEvent)+(88))>>3)]=0 /* Not available */; + HEAP32[(((JSEvents.wheelEvent)+(96))>>2)]=0 /* DOM_DELTA_PIXEL */; + var shouldCancel = Module['dynCall_iiii'](callbackfunc, eventTypeId, JSEvents.wheelEvent, userData); + if (shouldCancel) { + e.preventDefault(); + } + }; + + var eventHandler = { + target: target, + allowsDeferredCalls: true, + eventTypeString: eventTypeString, + callbackfunc: callbackfunc, + handlerFunc: (eventTypeString == 'wheel') ? wheelHandlerFunc : mouseWheelHandlerFunc, + useCapture: useCapture + }; + JSEvents.registerOrRemoveHandler(eventHandler); + },pageScrollPos:function () { + if (window.pageXOffset > 0 || window.pageYOffset > 0) { + return [window.pageXOffset, window.pageYOffset]; + } + if (typeof document.documentElement.scrollLeft !== 'undefined' || typeof document.documentElement.scrollTop !== 'undefined') { + return [document.documentElement.scrollLeft, document.documentElement.scrollTop]; + } + return [document.body.scrollLeft|0, document.body.scrollTop|0]; + },registerUiEventCallback:function (target, userData, useCapture, callbackfunc, eventTypeId, eventTypeString) { + if (!JSEvents.uiEvent) { + JSEvents.uiEvent = _malloc( 36 ); + } + + if (eventTypeString == "scroll" && !target) { + target = document; // By default read scroll events on document rather than window. + } else { + target = JSEvents.findEventTarget(target); + } + + var handlerFunc = function(event) { + var e = event || window.event; + if (e.target != target) { + // Never take ui events such as scroll via a 'bubbled' route, but always from the direct element that + // was targeted. Otherwise e.g. if app logs a message in response to a page scroll, the Emscripten log + // message box could cause to scroll, generating a new (bubbled) scroll message, causing a new log print, + // causing a new scroll, etc.. + return; + } + var scrollPos = JSEvents.pageScrollPos(); + HEAP32[((JSEvents.uiEvent)>>2)]=e.detail; + HEAP32[(((JSEvents.uiEvent)+(4))>>2)]=document.body.clientWidth; + HEAP32[(((JSEvents.uiEvent)+(8))>>2)]=document.body.clientHeight; + HEAP32[(((JSEvents.uiEvent)+(12))>>2)]=window.innerWidth; + HEAP32[(((JSEvents.uiEvent)+(16))>>2)]=window.innerHeight; + HEAP32[(((JSEvents.uiEvent)+(20))>>2)]=window.outerWidth; + HEAP32[(((JSEvents.uiEvent)+(24))>>2)]=window.outerHeight; + HEAP32[(((JSEvents.uiEvent)+(28))>>2)]=scrollPos[0]; + HEAP32[(((JSEvents.uiEvent)+(32))>>2)]=scrollPos[1]; + var shouldCancel = Module['dynCall_iiii'](callbackfunc, eventTypeId, JSEvents.uiEvent, userData); + if (shouldCancel) { + e.preventDefault(); + } + }; + + var eventHandler = { + target: target, + allowsDeferredCalls: false, // Neither scroll or resize events allow running requests inside them. + eventTypeString: eventTypeString, + callbackfunc: callbackfunc, + handlerFunc: handlerFunc, + useCapture: useCapture + }; + JSEvents.registerOrRemoveHandler(eventHandler); + },getNodeNameForTarget:function (target) { + if (!target) return ''; + if (target == window) return '#window'; + if (target == window.screen) return '#screen'; + return (target && target.nodeName) ? target.nodeName : ''; + },registerFocusEventCallback:function (target, userData, useCapture, callbackfunc, eventTypeId, eventTypeString) { + if (!JSEvents.focusEvent) { + JSEvents.focusEvent = _malloc( 256 ); + } + var handlerFunc = function(event) { + var e = event || window.event; + + var nodeName = JSEvents.getNodeNameForTarget(e.target); + var id = e.target.id ? e.target.id : ''; + stringToUTF8(nodeName, JSEvents.focusEvent + 0, 128); + stringToUTF8(id, JSEvents.focusEvent + 128, 128); + var shouldCancel = Module['dynCall_iiii'](callbackfunc, eventTypeId, JSEvents.focusEvent, userData); + if (shouldCancel) { + e.preventDefault(); + } + }; + + var eventHandler = { + target: JSEvents.findEventTarget(target), + allowsDeferredCalls: false, + eventTypeString: eventTypeString, + callbackfunc: callbackfunc, + handlerFunc: handlerFunc, + useCapture: useCapture + }; + JSEvents.registerOrRemoveHandler(eventHandler); + },tick:function () { + if (window['performance'] && window['performance']['now']) return window['performance']['now'](); + else return Date.now(); + },registerDeviceOrientationEventCallback:function (target, userData, useCapture, callbackfunc, eventTypeId, eventTypeString) { + if (!JSEvents.deviceOrientationEvent) { + JSEvents.deviceOrientationEvent = _malloc( 40 ); + } + var handlerFunc = function(event) { + var e = event || window.event; + + HEAPF64[((JSEvents.deviceOrientationEvent)>>3)]=JSEvents.tick(); + HEAPF64[(((JSEvents.deviceOrientationEvent)+(8))>>3)]=e.alpha; + HEAPF64[(((JSEvents.deviceOrientationEvent)+(16))>>3)]=e.beta; + HEAPF64[(((JSEvents.deviceOrientationEvent)+(24))>>3)]=e.gamma; + HEAP32[(((JSEvents.deviceOrientationEvent)+(32))>>2)]=e.absolute; + + var shouldCancel = Module['dynCall_iiii'](callbackfunc, eventTypeId, JSEvents.deviceOrientationEvent, userData); + if (shouldCancel) { + e.preventDefault(); + } + }; + + var eventHandler = { + target: JSEvents.findEventTarget(target), + allowsDeferredCalls: false, + eventTypeString: eventTypeString, + callbackfunc: callbackfunc, + handlerFunc: handlerFunc, + useCapture: useCapture + }; + JSEvents.registerOrRemoveHandler(eventHandler); + },registerDeviceMotionEventCallback:function (target, userData, useCapture, callbackfunc, eventTypeId, eventTypeString) { + if (!JSEvents.deviceMotionEvent) { + JSEvents.deviceMotionEvent = _malloc( 80 ); + } + var handlerFunc = function(event) { + var e = event || window.event; + + HEAPF64[((JSEvents.deviceMotionEvent)>>3)]=JSEvents.tick(); + HEAPF64[(((JSEvents.deviceMotionEvent)+(8))>>3)]=e.acceleration.x; + HEAPF64[(((JSEvents.deviceMotionEvent)+(16))>>3)]=e.acceleration.y; + HEAPF64[(((JSEvents.deviceMotionEvent)+(24))>>3)]=e.acceleration.z; + HEAPF64[(((JSEvents.deviceMotionEvent)+(32))>>3)]=e.accelerationIncludingGravity.x; + HEAPF64[(((JSEvents.deviceMotionEvent)+(40))>>3)]=e.accelerationIncludingGravity.y; + HEAPF64[(((JSEvents.deviceMotionEvent)+(48))>>3)]=e.accelerationIncludingGravity.z; + HEAPF64[(((JSEvents.deviceMotionEvent)+(56))>>3)]=e.rotationRate.alpha; + HEAPF64[(((JSEvents.deviceMotionEvent)+(64))>>3)]=e.rotationRate.beta; + HEAPF64[(((JSEvents.deviceMotionEvent)+(72))>>3)]=e.rotationRate.gamma; + + var shouldCancel = Module['dynCall_iiii'](callbackfunc, eventTypeId, JSEvents.deviceMotionEvent, userData); + if (shouldCancel) { + e.preventDefault(); + } + }; + + var eventHandler = { + target: JSEvents.findEventTarget(target), + allowsDeferredCalls: false, + eventTypeString: eventTypeString, + callbackfunc: callbackfunc, + handlerFunc: handlerFunc, + useCapture: useCapture + }; + JSEvents.registerOrRemoveHandler(eventHandler); + },screenOrientation:function () { + if (!window.screen) return undefined; + return window.screen.orientation || window.screen.mozOrientation || window.screen.webkitOrientation || window.screen.msOrientation; + },fillOrientationChangeEventData:function (eventStruct, e) { + var orientations = ["portrait-primary", "portrait-secondary", "landscape-primary", "landscape-secondary"]; + var orientations2 = ["portrait", "portrait", "landscape", "landscape"]; + + var orientationString = JSEvents.screenOrientation(); + var orientation = orientations.indexOf(orientationString); + if (orientation == -1) { + orientation = orientations2.indexOf(orientationString); + } + + HEAP32[((eventStruct)>>2)]=1 << orientation; + HEAP32[(((eventStruct)+(4))>>2)]=window.orientation; + },registerOrientationChangeEventCallback:function (target, userData, useCapture, callbackfunc, eventTypeId, eventTypeString) { + if (!JSEvents.orientationChangeEvent) { + JSEvents.orientationChangeEvent = _malloc( 8 ); + } + + if (!target) { + target = window.screen; // Orientation events need to be captured from 'window.screen' instead of 'window' + } else { + target = JSEvents.findEventTarget(target); + } + + var handlerFunc = function(event) { + var e = event || window.event; + + JSEvents.fillOrientationChangeEventData(JSEvents.orientationChangeEvent, e); + + var shouldCancel = Module['dynCall_iiii'](callbackfunc, eventTypeId, JSEvents.orientationChangeEvent, userData); + if (shouldCancel) { + e.preventDefault(); + } + }; + + if (eventTypeString == "orientationchange" && window.screen.mozOrientation !== undefined) { + eventTypeString = "mozorientationchange"; + } + + var eventHandler = { + target: target, + allowsDeferredCalls: false, + eventTypeString: eventTypeString, + callbackfunc: callbackfunc, + handlerFunc: handlerFunc, + useCapture: useCapture + }; + JSEvents.registerOrRemoveHandler(eventHandler); + },fullscreenEnabled:function () { + return document.fullscreenEnabled || document.mozFullScreenEnabled || document.webkitFullscreenEnabled || document.msFullscreenEnabled; + },fillFullscreenChangeEventData:function (eventStruct, e) { + var fullscreenElement = document.fullscreenElement || document.mozFullScreenElement || document.webkitFullscreenElement || document.msFullscreenElement; + var isFullscreen = !!fullscreenElement; + HEAP32[((eventStruct)>>2)]=isFullscreen; + HEAP32[(((eventStruct)+(4))>>2)]=JSEvents.fullscreenEnabled(); + // If transitioning to fullscreen, report info about the element that is now fullscreen. + // If transitioning to windowed mode, report info about the element that just was fullscreen. + var reportedElement = isFullscreen ? fullscreenElement : JSEvents.previousFullscreenElement; + var nodeName = JSEvents.getNodeNameForTarget(reportedElement); + var id = (reportedElement && reportedElement.id) ? reportedElement.id : ''; + stringToUTF8(nodeName, eventStruct + 8, 128); + stringToUTF8(id, eventStruct + 136, 128); + HEAP32[(((eventStruct)+(264))>>2)]=reportedElement ? reportedElement.clientWidth : 0; + HEAP32[(((eventStruct)+(268))>>2)]=reportedElement ? reportedElement.clientHeight : 0; + HEAP32[(((eventStruct)+(272))>>2)]=screen.width; + HEAP32[(((eventStruct)+(276))>>2)]=screen.height; + if (isFullscreen) { + JSEvents.previousFullscreenElement = fullscreenElement; + } + },registerFullscreenChangeEventCallback:function (target, userData, useCapture, callbackfunc, eventTypeId, eventTypeString) { + if (!JSEvents.fullscreenChangeEvent) { + JSEvents.fullscreenChangeEvent = _malloc( 280 ); + } + + if (!target) { + target = document; // Fullscreen change events need to be captured from 'document' by default instead of 'window' + } else { + target = JSEvents.findEventTarget(target); + } + + var handlerFunc = function(event) { + var e = event || window.event; + + JSEvents.fillFullscreenChangeEventData(JSEvents.fullscreenChangeEvent, e); + + var shouldCancel = Module['dynCall_iiii'](callbackfunc, eventTypeId, JSEvents.fullscreenChangeEvent, userData); + if (shouldCancel) { + e.preventDefault(); + } + }; + + var eventHandler = { + target: target, + allowsDeferredCalls: false, + eventTypeString: eventTypeString, + callbackfunc: callbackfunc, + handlerFunc: handlerFunc, + useCapture: useCapture + }; + JSEvents.registerOrRemoveHandler(eventHandler); + },resizeCanvasForFullscreen:function (target, strategy) { + var restoreOldStyle = __registerRestoreOldStyle(target); + var cssWidth = strategy.softFullscreen ? window.innerWidth : screen.width; + var cssHeight = strategy.softFullscreen ? window.innerHeight : screen.height; + var rect = target.getBoundingClientRect(); + var windowedCssWidth = rect.right - rect.left; + var windowedCssHeight = rect.bottom - rect.top; + var windowedRttWidth = target.width; + var windowedRttHeight = target.height; + + if (strategy.scaleMode == 3) { + __setLetterbox(target, (cssHeight - windowedCssHeight) / 2, (cssWidth - windowedCssWidth) / 2); + cssWidth = windowedCssWidth; + cssHeight = windowedCssHeight; + } else if (strategy.scaleMode == 2) { + if (cssWidth*windowedRttHeight < windowedRttWidth*cssHeight) { + var desiredCssHeight = windowedRttHeight * cssWidth / windowedRttWidth; + __setLetterbox(target, (cssHeight - desiredCssHeight) / 2, 0); + cssHeight = desiredCssHeight; + } else { + var desiredCssWidth = windowedRttWidth * cssHeight / windowedRttHeight; + __setLetterbox(target, 0, (cssWidth - desiredCssWidth) / 2); + cssWidth = desiredCssWidth; + } + } + + // If we are adding padding, must choose a background color or otherwise Chrome will give the + // padding a default white color. Do it only if user has not customized their own background color. + if (!target.style.backgroundColor) target.style.backgroundColor = 'black'; + // IE11 does the same, but requires the color to be set in the document body. + if (!document.body.style.backgroundColor) document.body.style.backgroundColor = 'black'; // IE11 + // Firefox always shows black letterboxes independent of style color. + + target.style.width = cssWidth + 'px'; + target.style.height = cssHeight + 'px'; + + if (strategy.filteringMode == 1) { + target.style.imageRendering = 'optimizeSpeed'; + target.style.imageRendering = '-moz-crisp-edges'; + target.style.imageRendering = '-o-crisp-edges'; + target.style.imageRendering = '-webkit-optimize-contrast'; + target.style.imageRendering = 'optimize-contrast'; + target.style.imageRendering = 'crisp-edges'; + target.style.imageRendering = 'pixelated'; + } + + var dpiScale = (strategy.canvasResolutionScaleMode == 2) ? window.devicePixelRatio : 1; + if (strategy.canvasResolutionScaleMode != 0) { + target.width = cssWidth * dpiScale; + target.height = cssHeight * dpiScale; + if (target.GLctxObject) target.GLctxObject.GLctx.viewport(0, 0, target.width, target.height); + } + return restoreOldStyle; + },requestFullscreen:function (target, strategy) { + // EMSCRIPTEN_FULLSCREEN_SCALE_DEFAULT + EMSCRIPTEN_FULLSCREEN_CANVAS_SCALE_NONE is a mode where no extra logic is performed to the DOM elements. + if (strategy.scaleMode != 0 || strategy.canvasResolutionScaleMode != 0) { + JSEvents.resizeCanvasForFullscreen(target, strategy); + } + + if (target.requestFullscreen) { + target.requestFullscreen(); + } else if (target.msRequestFullscreen) { + target.msRequestFullscreen(); + } else if (target.mozRequestFullScreen) { + target.mozRequestFullScreen(); + } else if (target.mozRequestFullscreen) { + target.mozRequestFullscreen(); + } else if (target.webkitRequestFullscreen) { + target.webkitRequestFullscreen(Element.ALLOW_KEYBOARD_INPUT); + } else { + if (typeof JSEvents.fullscreenEnabled() === 'undefined') { + return -1; + } else { + return -3; + } + } + + if (strategy.canvasResizedCallback) { + Module['dynCall_iiii'](strategy.canvasResizedCallback, 37, 0, strategy.canvasResizedCallbackUserData); + } + + return 0; + },fillPointerlockChangeEventData:function (eventStruct, e) { + var pointerLockElement = document.pointerLockElement || document.mozPointerLockElement || document.webkitPointerLockElement || document.msPointerLockElement; + var isPointerlocked = !!pointerLockElement; + HEAP32[((eventStruct)>>2)]=isPointerlocked; + var nodeName = JSEvents.getNodeNameForTarget(pointerLockElement); + var id = (pointerLockElement && pointerLockElement.id) ? pointerLockElement.id : ''; + stringToUTF8(nodeName, eventStruct + 4, 128); + stringToUTF8(id, eventStruct + 132, 128); + },registerPointerlockChangeEventCallback:function (target, userData, useCapture, callbackfunc, eventTypeId, eventTypeString) { + if (!JSEvents.pointerlockChangeEvent) { + JSEvents.pointerlockChangeEvent = _malloc( 260 ); + } + + if (!target) { + target = document; // Pointer lock change events need to be captured from 'document' by default instead of 'window' + } else { + target = JSEvents.findEventTarget(target); + } + + var handlerFunc = function(event) { + var e = event || window.event; + + JSEvents.fillPointerlockChangeEventData(JSEvents.pointerlockChangeEvent, e); + + var shouldCancel = Module['dynCall_iiii'](callbackfunc, eventTypeId, JSEvents.pointerlockChangeEvent, userData); + if (shouldCancel) { + e.preventDefault(); + } + }; + + var eventHandler = { + target: target, + allowsDeferredCalls: false, + eventTypeString: eventTypeString, + callbackfunc: callbackfunc, + handlerFunc: handlerFunc, + useCapture: useCapture + }; + JSEvents.registerOrRemoveHandler(eventHandler); + },registerPointerlockErrorEventCallback:function (target, userData, useCapture, callbackfunc, eventTypeId, eventTypeString) { + if (!target) { + target = document; // Pointer lock events need to be captured from 'document' by default instead of 'window' + } else { + target = JSEvents.findEventTarget(target); + } + + var handlerFunc = function(event) { + var e = event || window.event; + + var shouldCancel = Module['dynCall_iiii'](callbackfunc, eventTypeId, 0, userData); + if (shouldCancel) { + e.preventDefault(); + } + }; + + var eventHandler = { + target: target, + allowsDeferredCalls: false, + eventTypeString: eventTypeString, + callbackfunc: callbackfunc, + handlerFunc: handlerFunc, + useCapture: useCapture + }; + JSEvents.registerOrRemoveHandler(eventHandler); + },requestPointerLock:function (target) { + if (target.requestPointerLock) { + target.requestPointerLock(); + } else if (target.mozRequestPointerLock) { + target.mozRequestPointerLock(); + } else if (target.webkitRequestPointerLock) { + target.webkitRequestPointerLock(); + } else if (target.msRequestPointerLock) { + target.msRequestPointerLock(); + } else { + // document.body is known to accept pointer lock, so use that to differentiate if the user passed a bad element, + // or if the whole browser just doesn't support the feature. + if (document.body.requestPointerLock || document.body.mozRequestPointerLock || document.body.webkitRequestPointerLock || document.body.msRequestPointerLock) { + return -3; + } else { + return -1; + } + } + return 0; + },fillVisibilityChangeEventData:function (eventStruct, e) { + var visibilityStates = [ "hidden", "visible", "prerender", "unloaded" ]; + var visibilityState = visibilityStates.indexOf(document.visibilityState); + + HEAP32[((eventStruct)>>2)]=document.hidden; + HEAP32[(((eventStruct)+(4))>>2)]=visibilityState; + },registerVisibilityChangeEventCallback:function (target, userData, useCapture, callbackfunc, eventTypeId, eventTypeString) { + if (!JSEvents.visibilityChangeEvent) { + JSEvents.visibilityChangeEvent = _malloc( 8 ); + } + + if (!target) { + target = document; // Visibility change events need to be captured from 'document' by default instead of 'window' + } else { + target = JSEvents.findEventTarget(target); + } + + var handlerFunc = function(event) { + var e = event || window.event; + + JSEvents.fillVisibilityChangeEventData(JSEvents.visibilityChangeEvent, e); + + var shouldCancel = Module['dynCall_iiii'](callbackfunc, eventTypeId, JSEvents.visibilityChangeEvent, userData); + if (shouldCancel) { + e.preventDefault(); + } + }; + + var eventHandler = { + target: target, + allowsDeferredCalls: false, + eventTypeString: eventTypeString, + callbackfunc: callbackfunc, + handlerFunc: handlerFunc, + useCapture: useCapture + }; + JSEvents.registerOrRemoveHandler(eventHandler); + },registerTouchEventCallback:function (target, userData, useCapture, callbackfunc, eventTypeId, eventTypeString) { + if (!JSEvents.touchEvent) { + JSEvents.touchEvent = _malloc( 1684 ); + } + + target = JSEvents.findEventTarget(target); + + var handlerFunc = function(event) { + var e = event || window.event; + + var touches = {}; + for(var i = 0; i < e.touches.length; ++i) { + var touch = e.touches[i]; + touches[touch.identifier] = touch; + } + for(var i = 0; i < e.changedTouches.length; ++i) { + var touch = e.changedTouches[i]; + touches[touch.identifier] = touch; + touch.changed = true; + } + for(var i = 0; i < e.targetTouches.length; ++i) { + var touch = e.targetTouches[i]; + touches[touch.identifier].onTarget = true; + } + + var ptr = JSEvents.touchEvent; + HEAP32[(((ptr)+(4))>>2)]=e.ctrlKey; + HEAP32[(((ptr)+(8))>>2)]=e.shiftKey; + HEAP32[(((ptr)+(12))>>2)]=e.altKey; + HEAP32[(((ptr)+(16))>>2)]=e.metaKey; + ptr += 20; // Advance to the start of the touch array. + var canvasRect = Module['canvas'] ? Module['canvas'].getBoundingClientRect() : undefined; + var targetRect = JSEvents.getBoundingClientRectOrZeros(target); + var numTouches = 0; + for(var i in touches) { + var t = touches[i]; + HEAP32[((ptr)>>2)]=t.identifier; + HEAP32[(((ptr)+(4))>>2)]=t.screenX; + HEAP32[(((ptr)+(8))>>2)]=t.screenY; + HEAP32[(((ptr)+(12))>>2)]=t.clientX; + HEAP32[(((ptr)+(16))>>2)]=t.clientY; + HEAP32[(((ptr)+(20))>>2)]=t.pageX; + HEAP32[(((ptr)+(24))>>2)]=t.pageY; + HEAP32[(((ptr)+(28))>>2)]=t.changed; + HEAP32[(((ptr)+(32))>>2)]=t.onTarget; + if (canvasRect) { + HEAP32[(((ptr)+(44))>>2)]=t.clientX - canvasRect.left; + HEAP32[(((ptr)+(48))>>2)]=t.clientY - canvasRect.top; + } else { + HEAP32[(((ptr)+(44))>>2)]=0; + HEAP32[(((ptr)+(48))>>2)]=0; + } + HEAP32[(((ptr)+(36))>>2)]=t.clientX - targetRect.left; + HEAP32[(((ptr)+(40))>>2)]=t.clientY - targetRect.top; + + ptr += 52; + + if (++numTouches >= 32) { + break; + } + } + HEAP32[((JSEvents.touchEvent)>>2)]=numTouches; + + var shouldCancel = Module['dynCall_iiii'](callbackfunc, eventTypeId, JSEvents.touchEvent, userData); + if (shouldCancel) { + e.preventDefault(); + } + }; + + var eventHandler = { + target: target, + allowsDeferredCalls: eventTypeString == 'touchstart' || eventTypeString == 'touchend', + eventTypeString: eventTypeString, + callbackfunc: callbackfunc, + handlerFunc: handlerFunc, + useCapture: useCapture + }; + JSEvents.registerOrRemoveHandler(eventHandler); + },fillGamepadEventData:function (eventStruct, e) { + HEAPF64[((eventStruct)>>3)]=e.timestamp; + for(var i = 0; i < e.axes.length; ++i) { + HEAPF64[(((eventStruct+i*8)+(16))>>3)]=e.axes[i]; + } + for(var i = 0; i < e.buttons.length; ++i) { + if (typeof(e.buttons[i]) === 'object') { + HEAPF64[(((eventStruct+i*8)+(528))>>3)]=e.buttons[i].value; + } else { + HEAPF64[(((eventStruct+i*8)+(528))>>3)]=e.buttons[i]; + } + } + for(var i = 0; i < e.buttons.length; ++i) { + if (typeof(e.buttons[i]) === 'object') { + HEAP32[(((eventStruct+i*4)+(1040))>>2)]=e.buttons[i].pressed; + } else { + HEAP32[(((eventStruct+i*4)+(1040))>>2)]=e.buttons[i] == 1.0; + } + } + HEAP32[(((eventStruct)+(1296))>>2)]=e.connected; + HEAP32[(((eventStruct)+(1300))>>2)]=e.index; + HEAP32[(((eventStruct)+(8))>>2)]=e.axes.length; + HEAP32[(((eventStruct)+(12))>>2)]=e.buttons.length; + stringToUTF8(e.id, eventStruct + 1304, 64); + stringToUTF8(e.mapping, eventStruct + 1368, 64); + },registerGamepadEventCallback:function (target, userData, useCapture, callbackfunc, eventTypeId, eventTypeString) { + if (!JSEvents.gamepadEvent) { + JSEvents.gamepadEvent = _malloc( 1432 ); + } + + var handlerFunc = function(event) { + var e = event || window.event; + + JSEvents.fillGamepadEventData(JSEvents.gamepadEvent, e.gamepad); + + var shouldCancel = Module['dynCall_iiii'](callbackfunc, eventTypeId, JSEvents.gamepadEvent, userData); + if (shouldCancel) { + e.preventDefault(); + } + }; + + var eventHandler = { + target: JSEvents.findEventTarget(target), + allowsDeferredCalls: true, + eventTypeString: eventTypeString, + callbackfunc: callbackfunc, + handlerFunc: handlerFunc, + useCapture: useCapture + }; + JSEvents.registerOrRemoveHandler(eventHandler); + },registerBeforeUnloadEventCallback:function (target, userData, useCapture, callbackfunc, eventTypeId, eventTypeString) { + var handlerFunc = function(event) { + var e = event || window.event; + + var confirmationMessage = Module['dynCall_iiii'](callbackfunc, eventTypeId, 0, userData); + + if (confirmationMessage) { + confirmationMessage = Pointer_stringify(confirmationMessage); + } + if (confirmationMessage) { + e.preventDefault(); + e.returnValue = confirmationMessage; + return confirmationMessage; + } + }; + + var eventHandler = { + target: JSEvents.findEventTarget(target), + allowsDeferredCalls: false, + eventTypeString: eventTypeString, + callbackfunc: callbackfunc, + handlerFunc: handlerFunc, + useCapture: useCapture + }; + JSEvents.registerOrRemoveHandler(eventHandler); + },battery:function () { return navigator.battery || navigator.mozBattery || navigator.webkitBattery; },fillBatteryEventData:function (eventStruct, e) { + HEAPF64[((eventStruct)>>3)]=e.chargingTime; + HEAPF64[(((eventStruct)+(8))>>3)]=e.dischargingTime; + HEAPF64[(((eventStruct)+(16))>>3)]=e.level; + HEAP32[(((eventStruct)+(24))>>2)]=e.charging; + },registerBatteryEventCallback:function (target, userData, useCapture, callbackfunc, eventTypeId, eventTypeString) { + if (!JSEvents.batteryEvent) { + JSEvents.batteryEvent = _malloc( 32 ); + } + + var handlerFunc = function(event) { + var e = event || window.event; + + JSEvents.fillBatteryEventData(JSEvents.batteryEvent, JSEvents.battery()); + + var shouldCancel = Module['dynCall_iiii'](callbackfunc, eventTypeId, JSEvents.batteryEvent, userData); + if (shouldCancel) { + e.preventDefault(); + } + }; + + var eventHandler = { + target: JSEvents.findEventTarget(target), + allowsDeferredCalls: false, + eventTypeString: eventTypeString, + callbackfunc: callbackfunc, + handlerFunc: handlerFunc, + useCapture: useCapture + }; + JSEvents.registerOrRemoveHandler(eventHandler); + },registerWebGlEventCallback:function (target, userData, useCapture, callbackfunc, eventTypeId, eventTypeString) { + if (!target) { + target = Module['canvas']; + } + var handlerFunc = function(event) { + var e = event || window.event; + + var shouldCancel = Module['dynCall_iiii'](callbackfunc, eventTypeId, 0, userData); + if (shouldCancel) { + e.preventDefault(); + } + }; + + var eventHandler = { + target: JSEvents.findEventTarget(target), + allowsDeferredCalls: false, + eventTypeString: eventTypeString, + callbackfunc: callbackfunc, + handlerFunc: handlerFunc, + useCapture: useCapture + }; + JSEvents.registerOrRemoveHandler(eventHandler); + }};function __emscripten_sample_gamepad_data() { + // Polling gamepads generates garbage, so don't do it when we know there are no gamepads connected. + if (!JSEvents.numGamepadsConnected) return; + + // Produce a new Gamepad API sample if we are ticking a new game frame, or if not using emscripten_set_main_loop() at all to drive animation. + if (Browser.mainLoop.currentFrameNumber !== JSEvents.lastGamepadStateFrame || !Browser.mainLoop.currentFrameNumber) { + JSEvents.lastGamepadState = navigator.getGamepads ? navigator.getGamepads() : (navigator.webkitGetGamepads ? navigator.webkitGetGamepads : null); + JSEvents.lastGamepadStateFrame = Browser.mainLoop.currentFrameNumber; + } + }function _emscripten_get_gamepad_status(index, gamepadState) { + __emscripten_sample_gamepad_data(); + if (!JSEvents.lastGamepadState) return -1; + + // INVALID_PARAM is returned on a Gamepad index that never was there. + if (index < 0 || index >= JSEvents.lastGamepadState.length) return -5; + + // NO_DATA is returned on a Gamepad index that was removed. + // For previously disconnected gamepads there should be an empty slot (null/undefined/false) at the index. + // This is because gamepads must keep their original position in the array. + // For example, removing the first of two gamepads produces [null/undefined/false, gamepad]. + if (!JSEvents.lastGamepadState[index]) return -7; + + JSEvents.fillGamepadEventData(gamepadState, JSEvents.lastGamepadState[index]); + return 0; + } + + var _llvm_pow_f64=Math_pow; + + function _emscripten_glCopyTexImage2D(x0, x1, x2, x3, x4, x5, x6, x7) { GLctx['copyTexImage2D'](x0, x1, x2, x3, x4, x5, x6, x7) } + + function _emscripten_glTexParameterfv(target, pname, params) { + var param = HEAPF32[((params)>>2)]; + GLctx.texParameterf(target, pname, param); + } + + + + + + + + + + function _SDL_CloseAudio() { + if (SDL.audio) { + _SDL_PauseAudio(1); + _free(SDL.audio.buffer); + SDL.audio = null; + SDL.allocateChannels(0); + } + } + + + + + + + + + + + + + + var _environ=STATICTOP; STATICTOP += 16;;var ___environ=_environ;function ___buildEnvironment(env) { + // WARNING: Arbitrary limit! + var MAX_ENV_VALUES = 64; + var TOTAL_ENV_SIZE = 1024; + + // Statically allocate memory for the environment. + var poolPtr; + var envPtr; + if (!___buildEnvironment.called) { + ___buildEnvironment.called = true; + // Set default values. Use string keys for Closure Compiler compatibility. + ENV['USER'] = ENV['LOGNAME'] = 'web_user'; + ENV['PATH'] = '/'; + ENV['PWD'] = '/'; + ENV['HOME'] = '/home/web_user'; + ENV['LANG'] = 'C'; + ENV['_'] = Module['thisProgram']; + // Allocate memory. + poolPtr = allocate(TOTAL_ENV_SIZE, 'i8', ALLOC_STATIC); + envPtr = allocate(MAX_ENV_VALUES * 4, + 'i8*', ALLOC_STATIC); + HEAP32[((envPtr)>>2)]=poolPtr; + HEAP32[((_environ)>>2)]=envPtr; + } else { + envPtr = HEAP32[((_environ)>>2)]; + poolPtr = HEAP32[((envPtr)>>2)]; + } + + // Collect key=value lines. + var strings = []; + var totalSize = 0; + for (var key in env) { + if (typeof env[key] === 'string') { + var line = key + '=' + env[key]; + strings.push(line); + totalSize += line.length; + } + } + if (totalSize > TOTAL_ENV_SIZE) { + throw new Error('Environment size exceeded TOTAL_ENV_SIZE!'); + } + + // Make new. + var ptrSize = 4; + for (var i = 0; i < strings.length; i++) { + var line = strings[i]; + writeAsciiToMemory(line, poolPtr); + HEAP32[(((envPtr)+(i * ptrSize))>>2)]=poolPtr; + poolPtr += line.length + 1; + } + HEAP32[(((envPtr)+(strings.length * ptrSize))>>2)]=0; + }var ENV={};function _getenv(name) { + // char *getenv(const char *name); + // http://pubs.opengroup.org/onlinepubs/009695399/functions/getenv.html + if (name === 0) return 0; + name = Pointer_stringify(name); + if (!ENV.hasOwnProperty(name)) return 0; + + if (_getenv.ret) _free(_getenv.ret); + _getenv.ret = allocate(intArrayFromString(ENV[name]), 'i8', ALLOC_NORMAL); + return _getenv.ret; + } + + function _putenv(string) { + // int putenv(char *string); + // http://pubs.opengroup.org/onlinepubs/009695399/functions/putenv.html + // WARNING: According to the standard (and the glibc implementation), the + // string is taken by reference so future changes are reflected. + // We copy it instead, possibly breaking some uses. + if (string === 0) { + ___setErrNo(ERRNO_CODES.EINVAL); + return -1; + } + string = Pointer_stringify(string); + var splitPoint = string.indexOf('=') + if (string === '' || string.indexOf('=') === -1) { + ___setErrNo(ERRNO_CODES.EINVAL); + return -1; + } + var name = string.slice(0, splitPoint); + var value = string.slice(splitPoint + 1); + if (!(name in ENV) || ENV[name] !== value) { + ENV[name] = value; + ___buildEnvironment(ENV); + } + return 0; + } + + function _SDL_RWFromConstMem(mem, size) { + var id = SDL.rwops.length; // TODO: recycle ids when they are null + SDL.rwops.push({ bytes: mem, count: size }); + return id; + }function _TTF_FontHeight(font) { + var fontData = SDL.fonts[font]; + return fontData.size; + }function _TTF_SizeText(font, text, w, h) { + var fontData = SDL.fonts[font]; + if (w) { + HEAP32[((w)>>2)]=SDL.estimateTextWidth(fontData, Pointer_stringify(text)); + } + if (h) { + HEAP32[((h)>>2)]=fontData.size; + } + return 0; + }function _TTF_RenderText_Solid(font, text, color) { + // XXX the font and color are ignored + text = Pointer_stringify(text) || ' '; // if given an empty string, still return a valid surface + var fontData = SDL.fonts[font]; + var w = SDL.estimateTextWidth(fontData, text); + var h = fontData.size; + var color = SDL.loadColorToCSSRGB(color); // XXX alpha breaks fonts? + var fontString = SDL.makeFontString(h, fontData.name); + var surf = SDL.makeSurface(w, h, 0, false, 'text:' + text); // bogus numbers.. + var surfData = SDL.surfaces[surf]; + surfData.ctx.save(); + surfData.ctx.fillStyle = color; + surfData.ctx.font = fontString; + // use bottom alligment, because it works + // same in all browsers, more info here: + // https://bugzilla.mozilla.org/show_bug.cgi?id=737852 + surfData.ctx.textBaseline = 'bottom'; + surfData.ctx.fillText(text, 0, h|0); + surfData.ctx.restore(); + return surf; + }function _Mix_HaltMusic() { + var audio = SDL.music.audio; + if (audio) { + audio.src = audio.src; // rewind element + audio.currentPosition = 0; // rewind Web Audio graph playback. + audio.pause(); + } + SDL.music.audio = null; + if (SDL.hookMusicFinished) { + func(); + } + return 0; + }function _Mix_PlayMusic(id, loops) { + // Pause old music if it exists. + if (SDL.music.audio) { + if (!SDL.music.audio.paused) Module.printErr('Music is already playing. ' + SDL.music.source); + SDL.music.audio.pause(); + } + var info = SDL.audios[id]; + var audio; + if (info.webAudio) { // Play via Web Audio API + // Create an instance of the WebAudio object. + audio = {}; + audio.resource = info; // This new webAudio object is an instance that refers to this existing resource. + audio.paused = false; + audio.currentPosition = 0; + audio.play = function() { SDL.playWebAudio(this); } + audio.pause = function() { SDL.pauseWebAudio(this); } + } else if (info.audio) { // Play via the